JPS622582B2 - - Google Patents
Info
- Publication number
- JPS622582B2 JPS622582B2 JP52024503A JP2450377A JPS622582B2 JP S622582 B2 JPS622582 B2 JP S622582B2 JP 52024503 A JP52024503 A JP 52024503A JP 2450377 A JP2450377 A JP 2450377A JP S622582 B2 JPS622582 B2 JP S622582B2
- Authority
- JP
- Japan
- Prior art keywords
- hydrogenation
- cocatalyst
- alkyl
- reaction
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000005984 hydrogenation reaction Methods 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 5
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 239000003426 co-catalyst Substances 0.000 claims description 2
- 239000007791 liquid phase Substances 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims 3
- 238000000034 method Methods 0.000 claims 3
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 claims 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N mono-n-propyl amine Natural products CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims 1
- 125000006308 propyl amino group Chemical group 0.000 claims 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- RXAVHODYCLIQCW-UHFFFAOYSA-N 2-hydroxy-n-phenylbutanamide Chemical compound CCC(O)C(=O)NC1=CC=CC=C1 RXAVHODYCLIQCW-UHFFFAOYSA-N 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical group C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WWROGCAUSKGAMX-UHFFFAOYSA-N n-(4-ethoxyphenyl)-3-oxobutanamide Chemical compound CCOC1=CC=C(NC(=O)CC(C)=O)C=C1 WWROGCAUSKGAMX-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- -1 p-phenetidine 3-hydroxybutyrate Chemical compound 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2609835A DE2609835C3 (de) | 1976-03-10 | 1976-03-10 | Verfahren zur Herstellung von 3-Hydroxybuttersäure-N-arylamiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS52108935A JPS52108935A (en) | 1977-09-12 |
| JPS622582B2 true JPS622582B2 (enExample) | 1987-01-20 |
Family
ID=5971961
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2450377A Granted JPS52108935A (en) | 1976-03-10 | 1977-03-08 | Preparation of 33hydroxybutyric acid arylamide |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4128578A (enExample) |
| JP (1) | JPS52108935A (enExample) |
| BE (1) | BE852340A (enExample) |
| CH (1) | CH626326A5 (enExample) |
| DE (1) | DE2609835C3 (enExample) |
| FR (1) | FR2343720A1 (enExample) |
| GB (1) | GB1535009A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2837022A1 (de) * | 1978-08-24 | 1980-03-06 | Hoechst Ag | Verfahren zur hydrierung organischer verbindungen |
| DE3003254A1 (de) * | 1980-01-30 | 1981-08-20 | Hoechst Ag, 6000 Frankfurt | Verfahren zur katalytischen hydrierung organischer verbindungen |
| US4689431A (en) * | 1985-02-21 | 1987-08-25 | Japan As Represented By General Director Of Agency Of Industrial Science And Technology | Method for the preparation of phenyl pyruvic acid |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2830087A (en) * | 1955-02-21 | 1958-04-08 | Hoechst Ag | beta-hydroxybutyric acid para-phenetidide and a process for preparing it |
| US3051618A (en) * | 1956-11-06 | 1962-08-28 | Hoechst Ag | Beta-hydroxy-butyric acid amide derivatives and process for their use as narcotics |
| NL276543A (enExample) * | 1961-03-29 | 1900-01-01 | ||
| GB1200233A (en) * | 1967-12-21 | 1970-07-29 | British Petroleum Co | Improvements relating to the preparation of hydrogenation catalysts |
| US3737459A (en) * | 1970-08-12 | 1973-06-05 | Union Oil Co | Catalyzed reaction of an arylamine with an alkylamine to form an n-alkyl substituted arylamine |
| US3819734A (en) * | 1972-05-05 | 1974-06-25 | Goodyear Tire & Rubber | Hydrogenation process |
| US3992323A (en) * | 1973-03-26 | 1976-11-16 | Atlantic Richfield Company | Olefin polymerization catalyst |
| DE2435818C3 (de) * | 1974-07-25 | 1982-02-25 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung aromatischer Diamine |
-
1976
- 1976-03-10 DE DE2609835A patent/DE2609835C3/de not_active Expired
-
1977
- 1977-03-07 CH CH281777A patent/CH626326A5/de not_active IP Right Cessation
- 1977-03-08 US US05/775,461 patent/US4128578A/en not_active Expired - Lifetime
- 1977-03-08 JP JP2450377A patent/JPS52108935A/ja active Granted
- 1977-03-09 GB GB9993/77A patent/GB1535009A/en not_active Expired
- 1977-03-10 BE BE175692A patent/BE852340A/xx not_active IP Right Cessation
- 1977-03-10 FR FR7707084A patent/FR2343720A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4128578A (en) | 1978-12-05 |
| CH626326A5 (enExample) | 1981-11-13 |
| DE2609835B2 (de) | 1978-10-19 |
| JPS52108935A (en) | 1977-09-12 |
| FR2343720A1 (fr) | 1977-10-07 |
| DE2609835C3 (de) | 1979-06-07 |
| GB1535009A (en) | 1978-12-06 |
| FR2343720B1 (enExample) | 1983-09-02 |
| DE2609835A1 (de) | 1977-09-22 |
| BE852340A (fr) | 1977-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2355837A (en) | Substituted glyoxalidines | |
| US3162658A (en) | Process for catalytic isomerization of compounds of unconjugated polyethenoid acids | |
| US2762845A (en) | Alkylation of aromatic amines | |
| US4812587A (en) | Process for selective hydrogenation of C--C double bonds in the presence of reducible, nitrogen-containing groups and new ruthenium complex compounds | |
| US1996115A (en) | Alkyl halide synthesis | |
| US3218352A (en) | Homotaurine process | |
| JP2894382B2 (ja) | エテノリシスによるα−オレフインの製造 | |
| JPS622582B2 (enExample) | ||
| US3816483A (en) | Carboxylic acid amide preparation | |
| US2413248A (en) | Polyamines and process for preparing them | |
| US2408171A (en) | Process for preparation of 2-methyl-1, 2-propanediamine | |
| US2109159A (en) | Process for preparing furfurylamines | |
| US2540938A (en) | N-substituted diamines and preparation of the same | |
| US2947784A (en) | Preparation of n, n-dibutyl aniline | |
| JPH05504942A (ja) | エチレンからの線状α―オレフィンの製法 | |
| US2908722A (en) | Process for preparing saturated monohydric alcohols | |
| US2408172A (en) | Process for preparation of diamines | |
| US3928441A (en) | Raney copper catalyst production and use | |
| JPH048426B2 (enExample) | ||
| US2129631A (en) | Hydrogenation of phenyl primary amines | |
| US3932506A (en) | Raney copper catalyst production and use | |
| US2175585A (en) | Preparation of furfurylamines | |
| US3154584A (en) | Process for the catalytic reduction of dinitrotoluenes | |
| US2516337A (en) | Manufacture of 5-amino-1-pentanol and alkyl derivatives thereof | |
| US3867443A (en) | Nuclear hydrogenation of n-aryl polyamides |