JPS6134424B2 - - Google Patents
Info
- Publication number
- JPS6134424B2 JPS6134424B2 JP8048578A JP8048578A JPS6134424B2 JP S6134424 B2 JPS6134424 B2 JP S6134424B2 JP 8048578 A JP8048578 A JP 8048578A JP 8048578 A JP8048578 A JP 8048578A JP S6134424 B2 JPS6134424 B2 JP S6134424B2
- Authority
- JP
- Japan
- Prior art keywords
- formula
- alkyl group
- halogen atom
- hydrogen
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 5-indanyloxy group Chemical group 0.000 claims description 51
- 125000000217 alkyl group Chemical group 0.000 claims description 27
- 239000000460 chlorine Substances 0.000 claims description 24
- 125000005843 halogen group Chemical group 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 12
- 150000001408 amides Chemical class 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 229910052751 metal Chemical group 0.000 claims description 6
- 239000002184 metal Chemical group 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 3
- 239000003377 acid catalyst Substances 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229940030600 antihypertensive agent Drugs 0.000 claims description 2
- 239000002220 antihypertensive agent Substances 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- RXHAQWAUXWKINY-UHFFFAOYSA-N 5-(4-chlorophenoxy)pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1OC1=CC=C(Cl)C=C1 RXHAQWAUXWKINY-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- NPAUPKKDRMTHSQ-UHFFFAOYSA-N 5-(4-chlorobutoxy)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(OCCCCCl)C=N1 NPAUPKKDRMTHSQ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229940081066 picolinic acid Drugs 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000001988 toxicity Effects 0.000 description 3
- 231100000419 toxicity Toxicity 0.000 description 3
- CHBNFEFUVKGTPY-UHFFFAOYSA-N 5-(2-chlorophenoxy)pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1OC1=CC=CC=C1Cl CHBNFEFUVKGTPY-UHFFFAOYSA-N 0.000 description 2
- OCYOPQMIQQOESK-UHFFFAOYSA-N 5-[2-(trifluoromethyl)phenoxy]pyridine-2-carboxamide Chemical compound C1=NC(C(=O)N)=CC=C1OC1=CC=CC=C1C(F)(F)F OCYOPQMIQQOESK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- WRCVJCBJEBIBFI-UHFFFAOYSA-N ethyl 5-(4-chlorophenoxy)pyridine-2-carboxylate Chemical compound C1=NC(C(=O)OCC)=CC=C1OC1=CC=C(Cl)C=C1 WRCVJCBJEBIBFI-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000010446 mirabilite Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SIUTWYZMSNPSIO-UHFFFAOYSA-N 2-chloroethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCCl SIUTWYZMSNPSIO-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- QPXZVRUEENMWGK-UHFFFAOYSA-N 5-(4-chlorobutoxy)pyridine-2-carboxamide Chemical compound NC(=O)C1=CC=C(OCCCCCl)C=N1 QPXZVRUEENMWGK-UHFFFAOYSA-N 0.000 description 1
- DEQKVLYBIBRZNU-UHFFFAOYSA-N 5-(4-chlorobutoxy)pyridine-2-carboxylic acid;hydrochloride Chemical compound Cl.OC(=O)C1=CC=C(OCCCCCl)C=N1 DEQKVLYBIBRZNU-UHFFFAOYSA-N 0.000 description 1
- GUJREVOWVMEPEX-UHFFFAOYSA-N 5-(4-chlorophenoxy)pyridine-2-carboxamide Chemical compound C1=NC(C(=O)N)=CC=C1OC1=CC=C(Cl)C=C1 GUJREVOWVMEPEX-UHFFFAOYSA-N 0.000 description 1
- KTHFMMUXNXWKNS-UHFFFAOYSA-N 5-[2-(trifluoromethyl)phenoxy]pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1OC1=CC=CC=C1C(F)(F)F KTHFMMUXNXWKNS-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000004531 blood pressure lowering effect Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940124567 diuretic antihypertensive agent Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical compound O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 239000005555 hypertensive agent Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- YIAPLDFPUUJILH-UHFFFAOYSA-N indan-1-ol Chemical compound C1=CC=C2C(O)CCC2=C1 YIAPLDFPUUJILH-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- XHFLOLLMZOTPSM-UHFFFAOYSA-M sodium;hydrogen carbonate;hydrate Chemical compound [OH-].[Na+].OC(O)=O XHFLOLLMZOTPSM-UHFFFAOYSA-M 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
Landscapes
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8048578A JPS559002A (en) | 1978-07-04 | 1978-07-04 | 5-substituted picolinic acid derivative, its preparation and hypotensive agent containing the same |
| CA323,912A CA1115709A (en) | 1978-03-24 | 1979-03-21 | 5-substituted-hydroxy picolinic acid derivatives |
| IT48451/79A IT1115064B (it) | 1978-03-24 | 1979-03-22 | Derivati di acidi picolinici 5-sostituiti procedimento per preparli e composizioni ipertensive che li contengono |
| CH268779A CH637941A5 (fr) | 1978-03-24 | 1979-03-22 | Derives de l'acide picolinique substitues en position 5 et composition anti-hypertensive contenant ces derives. |
| DE2911492A DE2911492C2 (de) | 1978-03-24 | 1979-03-23 | 5-Substituierte Picolinsäuren, deren Natrium-, Kalium-, Magnesium-, Calcium- und Aluminiumsalze, 5-Indanylester und Säureamide Verfahren zu deren Herstellung und antihypertonische Mittel, welche diese enthalten |
| FR7907345A FR2422639A1 (fr) | 1978-03-24 | 1979-03-23 | Derives d'acide picolinique substitue en 5, procede de preparation et composition anti-hypertensive contenant ces derives |
| SE7902665A SE446863B (sv) | 1978-03-24 | 1979-03-23 | 5-substituerade pikolinsyraderivat, forfarande for framstellning derav och anvendning av foreningarna som aktiv bestandsdel i en antihypertensiv komposition |
| GB7910324A GB2018753B (en) | 1978-03-24 | 1979-03-23 | 5-substituted picolinic acid derivatives a process for preparation thereof and ananti-hypertensive composition containing the same |
| US06/023,504 US4229448A (en) | 1978-03-24 | 1979-03-23 | 5-Substituted picolinic acid derivatives and an anti-hypertensive composition containing the same |
| ES478918A ES478918A1 (es) | 1978-03-24 | 1979-03-23 | Un procedimiento para la preparacion de acidos picolinicos 5-sustituidos y sus sales, esteres y amidas. |
| NLAANVRAGE7902306,A NL178251C (nl) | 1978-03-24 | 1979-03-23 | 5-gesubstitueerde picolinezuren en derivaten daarvan met bloeddruk verlagende werking, werkwijze voor de bereiding daarvan en preparaten die ze bevatten. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8048578A JPS559002A (en) | 1978-07-04 | 1978-07-04 | 5-substituted picolinic acid derivative, its preparation and hypotensive agent containing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS559002A JPS559002A (en) | 1980-01-22 |
| JPS6134424B2 true JPS6134424B2 (member.php) | 1986-08-07 |
Family
ID=13719580
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP8048578A Granted JPS559002A (en) | 1978-03-24 | 1978-07-04 | 5-substituted picolinic acid derivative, its preparation and hypotensive agent containing the same |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS559002A (member.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62176723U (member.php) * | 1986-04-28 | 1987-11-10 | ||
| JPS6373628U (member.php) * | 1986-10-31 | 1988-05-17 |
-
1978
- 1978-07-04 JP JP8048578A patent/JPS559002A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS62176723U (member.php) * | 1986-04-28 | 1987-11-10 | ||
| JPS6373628U (member.php) * | 1986-10-31 | 1988-05-17 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS559002A (en) | 1980-01-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69409525T2 (de) | Acetamidderivate und ihre verwendung als modifizierungsmittel des verhaltens der verdauung | |
| US7893279B2 (en) | Cyclohexanecarboxylic acid compound | |
| FR2530626A1 (fr) | Composes de carbostyryle | |
| EP0288973A2 (en) | Benzothiazolinone derivatives, their production and pharmaceutical composition | |
| HU218487B (hu) | N-Ciano-piridin-karboximid-amid-származékok, ilyen vegyületeket tartalmazó gyógyászati készítmények és eljárás a vegyületek előállítására | |
| JPS6229566A (ja) | 新規グアニジノメチル安息香酸誘導体 | |
| FR2565587A1 (fr) | Derive nouveau de diamide d'amino-acide a caractere acide n-acylique, un sel de celui-ci, un procede de production de celui-ci et un agent anti-ulcereux le contenant | |
| JP5210405B2 (ja) | アミノ酸誘導体を含有する医薬及び該誘導体の製造方法 | |
| US4158013A (en) | N-Cyano-N'-alkynyl-N"-2-mercaptoethylguanidines | |
| JPS6134424B2 (member.php) | ||
| US4157340A (en) | N,N'-[Bis(N-cyanoguanyl)]cystamine derivatives | |
| KR920000374B1 (ko) | 소염작용 및 점액 용해작용을 갖는 n-아세틸 시스테인 및 s-카르복시메틸시스테인의 2',4'-디플루오로-4-히드록시-(1,1'-디페닐)-3-카르복실산 유도체의 제조방법 | |
| FR2460934A1 (fr) | Derives d'isoquinoleine contenant du soufre, procedes pour leur preparation et compositions pharmaceutiques les contenant | |
| JPH0515704B2 (member.php) | ||
| KR820001277B1 (ko) | 5-치환 피코린산 유도체의 제조법 | |
| US4923888A (en) | Butenoic acid amides, their salts, and pharmaceutical compositions containing them | |
| US4069333A (en) | Anti-hypertensive compositions | |
| SU1634134A3 (ru) | Способ получени 4-оксо-4-(замещенный фенил)-бутеноилсалицилатов Е-конфигурации | |
| US5849725A (en) | Phosphorylated derivatives of compositions having anti-inflammatory or analgesic activity and a method for the preparation thereof | |
| IE47543B1 (en) | Guanidine derivatives | |
| IE52884B1 (en) | 2-methoxyphenyl esters of n-substituted amino acids, their preparation and pharmaceutical use | |
| Savard et al. | SYNTHESIS OF A NEW α-AMINO ACID, S-METHYL-β, β-DIMETHYLCYSTEINE | |
| EP0092380A2 (en) | Antiallergic 4H-furo(3,2-b)indoles and their production | |
| KR0181215B1 (ko) | N-치환 헤테로 화합물 및 이의 제조방법 | |
| GB2100261A (en) | Aminophenylalkylamine derivatives, a process for their preparation and their use as pharmaceuticals |