JPS6111974B2 - - Google Patents
Info
- Publication number
- JPS6111974B2 JPS6111974B2 JP52011698A JP1169877A JPS6111974B2 JP S6111974 B2 JPS6111974 B2 JP S6111974B2 JP 52011698 A JP52011698 A JP 52011698A JP 1169877 A JP1169877 A JP 1169877A JP S6111974 B2 JPS6111974 B2 JP S6111974B2
- Authority
- JP
- Japan
- Prior art keywords
- vinyl acetate
- dihydroxy
- polycarbonate
- ethylene
- diphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 claims description 23
- 239000004417 polycarbonate Substances 0.000 claims description 23
- 229920005668 polycarbonate resin Polymers 0.000 claims description 20
- 239000004431 polycarbonate resin Substances 0.000 claims description 20
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 17
- 239000005038 ethylene vinyl acetate Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 10
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical group CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 4
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 239000008240 homogeneous mixture Substances 0.000 claims description 2
- 238000005336 cracking Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000001294 propane Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 3
- 239000001273 butane Substances 0.000 description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 3
- -1 carbonic diesters Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 230000001954 sterilising effect Effects 0.000 description 3
- 238000004659 sterilization and disinfection Methods 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 230000006835 compression Effects 0.000 description 2
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- UTCOUOISVRSLSH-UHFFFAOYSA-N 1,2-Anthracenediol Chemical compound C1=CC=CC2=CC3=C(O)C(O)=CC=C3C=C21 UTCOUOISVRSLSH-UHFFFAOYSA-N 0.000 description 1
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N dimethylmethane Natural products CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 125000005027 hydroxyaryl group Chemical group 0.000 description 1
- 150000005204 hydroxybenzenes Chemical class 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000012690 ionic polymerization Methods 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- 235000014366 other mixer Nutrition 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/656,490 US4145373A (en) | 1976-02-09 | 1976-02-09 | Stress crack resistant polycarbonates |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5296656A JPS5296656A (en) | 1977-08-13 |
| JPS6111974B2 true JPS6111974B2 (OSRAM) | 1986-04-05 |
Family
ID=24633246
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP1169877A Granted JPS5296656A (en) | 1976-02-09 | 1977-02-07 | Stress cracking resistant polycarbonate |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4145373A (OSRAM) |
| JP (1) | JPS5296656A (OSRAM) |
| CA (1) | CA1080886A (OSRAM) |
| DE (1) | DE2704683A1 (OSRAM) |
| FR (1) | FR2340349A1 (OSRAM) |
| GB (1) | GB1508754A (OSRAM) |
| IT (1) | IT1081472B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0275165U (OSRAM) * | 1988-11-30 | 1990-06-08 |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2706126C2 (de) * | 1977-02-14 | 1984-03-29 | Bayer Ag, 5090 Leverkusen | Schwerentflammbare Polycarbonat-Folien |
| US4324869A (en) * | 1980-11-18 | 1982-04-13 | Union Carbide Corporation | Polyarylate blends with ethylene-alkyl acrylate copolymers |
| US4464512A (en) * | 1982-01-29 | 1984-08-07 | General Electric Company | Composition comprising an aromatic polyester-carbonate resin and a linear low density polyolefin polymer |
| US4401785A (en) * | 1982-01-29 | 1983-08-30 | General Electric Company | Polyolefin-poly(ester-carbonate) composition |
| DE3227029A1 (de) * | 1982-07-20 | 1984-01-26 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen aus polycarbonat, pfropfpolymerisat, ethylen/vinylacetat-copolymerisat und ggf. polyalkylenterephthalat |
| US4562222A (en) * | 1982-09-23 | 1985-12-31 | General Electric Company | Polycarbonate resin mixtures |
| US4536542A (en) * | 1983-11-18 | 1985-08-20 | General Electric Company | Method for altering the surface of thermoplastic polymers |
| US4579910A (en) * | 1985-01-02 | 1986-04-01 | General Electric Company | Polycarbonate composition |
| US4737546A (en) * | 1986-08-15 | 1988-04-12 | General Electric Company | Moldable polycarbonate resin and copolyester-carbonate compositions of improved processability |
| US4894423A (en) * | 1988-11-07 | 1990-01-16 | The Dow Chemical Company | Environmental stress failure resistant polycarbonate |
| CN109438954B (zh) * | 2018-11-13 | 2020-12-15 | 金发科技股份有限公司 | 一种聚碳酸酯合金及其制备方法 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA863411A (en) | 1971-02-09 | L. Heiss Herbert | Polycarbonate resin compositions | |
| BE532543A (OSRAM) * | 1953-10-16 | |||
| US3153008A (en) * | 1955-07-05 | 1964-10-13 | Gen Electric | Aromatic carbonate resins and preparation thereof |
| US2991273A (en) * | 1956-07-07 | 1961-07-04 | Bayer Ag | Process for manufacture of vacuum moulded parts of high molecular weight thermoplastic polycarbonates |
| US2999846A (en) * | 1956-11-30 | 1961-09-12 | Schnell Hermann | High molecular weight thermoplastic aromatic sulfoxy polycarbonates |
| US2999835A (en) * | 1959-01-02 | 1961-09-12 | Gen Electric | Resinous mixture comprising organo-polysiloxane and polymer of a carbonate of a dihydric phenol, and products containing same |
| NL120878C (OSRAM) * | 1959-09-30 | |||
| US3215668A (en) * | 1962-04-09 | 1965-11-02 | Pittsburgh Plate Glass Co | Mixed carbonate-carbamate polyesters and process of making |
| BE634842A (OSRAM) * | 1962-07-11 | |||
| US3248414A (en) * | 1963-01-16 | 1966-04-26 | Pittsburgh Plate Glass Co | Method of preparing high molecular weight polycarbonates |
| DE2400086A1 (de) * | 1973-01-02 | 1974-07-04 | Gen Electric | Schaeumbares polykarbonatharz |
| US3297784A (en) * | 1964-12-17 | 1967-01-10 | Union Carbide Corp | Alpha olefin polymer modified thermoplastic polyhydroxyether compositions |
| FR1548028A (OSRAM) | 1966-12-20 | 1968-11-29 | ||
| CA945699A (en) | 1970-02-02 | 1974-04-16 | Percy L. Smith | Polyester compositions |
| US3801673A (en) * | 1972-01-03 | 1974-04-02 | Gen Electric | Process for preparing polycarbonate alloys |
| DE2304894B2 (de) * | 1973-02-01 | 1980-10-30 | Bayer Ag, 5090 Leverkusen | Polycarbonat-Polyvinylchlorid-Formmassen |
| DE2322435C2 (de) * | 1973-05-04 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen |
| DE2329646A1 (de) * | 1973-06-09 | 1975-01-09 | Bayer Ag | Transparente formmassen |
-
1976
- 1976-02-09 US US05/656,490 patent/US4145373A/en not_active Expired - Lifetime
- 1976-12-31 CA CA269,003A patent/CA1080886A/en not_active Expired
-
1977
- 1977-02-04 DE DE19772704683 patent/DE2704683A1/de not_active Withdrawn
- 1977-02-07 JP JP1169877A patent/JPS5296656A/ja active Granted
- 1977-02-07 IT IT47941/77A patent/IT1081472B/it active
- 1977-02-07 GB GB4892/77A patent/GB1508754A/en not_active Expired
- 1977-02-09 FR FR7703662A patent/FR2340349A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0275165U (OSRAM) * | 1988-11-30 | 1990-06-08 |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2704683A1 (de) | 1977-08-11 |
| IT1081472B (it) | 1985-05-21 |
| US4145373A (en) | 1979-03-20 |
| JPS5296656A (en) | 1977-08-13 |
| GB1508754A (en) | 1978-04-26 |
| FR2340349A1 (fr) | 1977-09-02 |
| FR2340349B1 (OSRAM) | 1983-11-18 |
| CA1080886A (en) | 1980-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2065436B1 (en) | Fire-retarded polycarbonate resin composition | |
| DE3752171T2 (de) | Polyesterharzzusammensetzung | |
| US7288579B2 (en) | Method for reducing haze in a fire resistant polycarbonate composition | |
| EP0086353A1 (de) | Polycarbonat-Formmassen mit verbesserter Flammwidrigkeit | |
| DE2920246A1 (de) | Polyestermasse fuer die herstellung von formkoerpern und die daraus hergestellten formkoerper | |
| US4145373A (en) | Stress crack resistant polycarbonates | |
| CA1182234A (en) | Glass-filled polycarbonate of improved impact strength | |
| US4496693A (en) | Compatibilization of polycarbonate blends | |
| JPH07233309A (ja) | 熱可塑性樹脂組成物 | |
| DE19946129A1 (de) | Hydrolysestabile Polycarbonat-Formmasse | |
| US4886849A (en) | Butene-1 molding resin blends | |
| US4783494A (en) | Thermoplastic compositions of polycarbonate resin and copolymers of ethylene and acrylic or methacrylic acid | |
| EP0062189A1 (de) | Polycarbonat mit verbesserter Schlagzähigkeit | |
| DE3779721T2 (de) | Aromatisches polycarbonat mit verbesserter schlagfestigkeit. | |
| JPS6144897B2 (OSRAM) | ||
| EP0252240B1 (en) | A process for forming thermoplastic foam | |
| EP0472064A2 (de) | Ternäre Mischungen | |
| US4100130A (en) | Flame-resistant polycarbonates | |
| EP0216267A1 (en) | Thermoplastic compositions of polycarbonate resin and copolymers of ethylene and acrylic or methacrylic acid | |
| CA1064185A (en) | Modified aromatic polycarbonates | |
| US7390450B2 (en) | Process for preparing a fire resistant polycarbonate composition | |
| JPH02381B2 (OSRAM) | ||
| JPS6051742A (ja) | 組成物 | |
| KR20170028831A (ko) | 코폴리카보네이트 및 이의 제조방법 | |
| JPS5989349A (ja) | ポリカ−ボネ−ト樹脂混合物 |