JPS604161B2 - バクテリア、菌類および胞子類の抑制法 - Google Patents
バクテリア、菌類および胞子類の抑制法Info
- Publication number
- JPS604161B2 JPS604161B2 JP50086599A JP8659975A JPS604161B2 JP S604161 B2 JPS604161 B2 JP S604161B2 JP 50086599 A JP50086599 A JP 50086599A JP 8659975 A JP8659975 A JP 8659975A JP S604161 B2 JPS604161 B2 JP S604161B2
- Authority
- JP
- Japan
- Prior art keywords
- tetrahydrofuran
- bis
- spores
- fungi
- alcohol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 22
- 241000894006 Bacteria Species 0.000 title claims description 7
- 241000233866 Fungi Species 0.000 title claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 12
- 230000000844 anti-bacterial effect Effects 0.000 claims description 9
- -1 allyl compound Chemical class 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000003899 bactericide agent Substances 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims 1
- 239000002422 sporicide Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 238000004659 sterilization and disinfection Methods 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 230000001954 sterilising effect Effects 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 6
- 230000003330 sporicidal effect Effects 0.000 description 6
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 4
- IPEMCIBPDYCJLO-UHFFFAOYSA-N 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-n-(2,4,6-trimethoxyphenyl)furan-2-carboxamide Chemical compound COC1=CC(OC)=CC(OC)=C1NC(=O)C(O1)=CC=C1CC1=CC(C(CCC2(C)C)(C)C)=C2C=C1C IPEMCIBPDYCJLO-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 150000002240 furans Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 229940015043 glyoxal Drugs 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 244000063299 Bacillus subtilis Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YAGOYTJTDVUVBN-UHFFFAOYSA-N 2,5-bis(phenylmethoxy)oxolane Chemical compound C=1C=CC=CC=1COC(O1)CCC1OCC1=CC=CC=C1 YAGOYTJTDVUVBN-UHFFFAOYSA-N 0.000 description 1
- ZLKHNURELCONBB-UHFFFAOYSA-N 2,5-diethoxyoxolane Chemical compound CCOC1CCC(OCC)O1 ZLKHNURELCONBB-UHFFFAOYSA-N 0.000 description 1
- WXFWXFIWDGJRSC-UHFFFAOYSA-N 2,5-dimethoxy-2,5-dihydrofuran Chemical compound COC1OC(OC)C=C1 WXFWXFIWDGJRSC-UHFFFAOYSA-N 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZLVFYUORUHNMBO-UHFFFAOYSA-N 4-bromo-2,6-dimethylphenol Chemical compound CC1=CC(Br)=CC(C)=C1O ZLVFYUORUHNMBO-UHFFFAOYSA-N 0.000 description 1
- 241000194107 Bacillus megaterium Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001480037 Microsporum Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- ZOLLIQAKMYWTBR-RYMQXAEESA-N cyclododecatriene Chemical compound C/1C\C=C\CC\C=C/CC\C=C\1 ZOLLIQAKMYWTBR-RYMQXAEESA-N 0.000 description 1
- 230000000249 desinfective effect Effects 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical compound [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- WURFKUQACINBSI-UHFFFAOYSA-M ozonide Chemical compound [O]O[O-] WURFKUQACINBSI-UHFFFAOYSA-M 0.000 description 1
- 238000005949 ozonolysis reaction Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229960000380 propiolactone Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- 238000002604 ultrasonography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/26—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D307/30—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/32—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/18—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/20—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2433836A DE2433836C3 (de) | 1974-07-15 | 1974-07-15 | Desinfektionsmittel mit sporieider Wirkung |
| DE2433836.1 | 1974-07-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5135426A JPS5135426A (en) | 1976-03-25 |
| JPS604161B2 true JPS604161B2 (ja) | 1985-02-01 |
Family
ID=5920538
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP50086599A Expired JPS604161B2 (ja) | 1974-07-15 | 1975-07-15 | バクテリア、菌類および胞子類の抑制法 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4004024A (enExample) |
| JP (1) | JPS604161B2 (enExample) |
| AT (1) | AT339507B (enExample) |
| BE (1) | BE824039A (enExample) |
| CA (1) | CA1070240A (enExample) |
| CH (1) | CH594417A5 (enExample) |
| DE (1) | DE2433836C3 (enExample) |
| DK (1) | DK148672C (enExample) |
| FR (1) | FR2281135A1 (enExample) |
| GB (1) | GB1507502A (enExample) |
| NL (1) | NL186677C (enExample) |
| NO (1) | NO142733C (enExample) |
| SE (1) | SE426012B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3143048A1 (de) * | 1981-10-30 | 1983-05-05 | Henkel Kgaa | "2.5-dihydro-2.5-dialkoxy-2.5-dialkylfuran-derivate enthaltende antimikrobielle mittel" |
| US4637916A (en) * | 1983-01-28 | 1987-01-20 | Universite Catholique De Louvain | Sterilization method employing a circulating gaseous sterilant |
| DE4301295C2 (de) * | 1993-01-15 | 1999-04-08 | Schuelke & Mayr Gmbh | Wäßriges Desinfektionsmittelkonzentrat und Desinfektionsmittel auf Aldehyd- und Alkoholbasis und deren Verwendung |
| GB2378136A (en) * | 2001-08-01 | 2003-02-05 | Thomas David White | Disinfectant formulation and method for determining sporicidal activity |
-
1974
- 1974-07-15 DE DE2433836A patent/DE2433836C3/de not_active Expired
- 1974-10-29 AT AT868774A patent/AT339507B/de not_active IP Right Cessation
- 1974-11-08 DK DK582074A patent/DK148672C/da not_active IP Right Cessation
- 1974-12-09 SE SE7415350A patent/SE426012B/xx not_active IP Right Cessation
- 1974-12-30 NO NO744725A patent/NO142733C/no unknown
- 1974-12-31 BE BE152091A patent/BE824039A/xx not_active IP Right Cessation
-
1975
- 1975-01-07 CH CH7375A patent/CH594417A5/xx not_active IP Right Cessation
- 1975-01-10 FR FR7500662A patent/FR2281135A1/fr active Granted
- 1975-02-14 NL NLAANVRAGE7501730,A patent/NL186677C/xx not_active IP Right Cessation
- 1975-03-10 GB GB9803/75A patent/GB1507502A/en not_active Expired
- 1975-07-07 US US05/593,558 patent/US4004024A/en not_active Expired - Lifetime
- 1975-07-14 CA CA231,377A patent/CA1070240A/en not_active Expired
- 1975-07-15 JP JP50086599A patent/JPS604161B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2433836C3 (de) | 1979-03-22 |
| CA1070240A (en) | 1980-01-22 |
| FR2281135B1 (enExample) | 1978-10-27 |
| FR2281135A1 (fr) | 1976-03-05 |
| NO142733C (no) | 1980-10-08 |
| DE2433836B2 (de) | 1978-07-20 |
| ATA868774A (de) | 1977-02-15 |
| NL7501730A (nl) | 1976-01-19 |
| NL186677C (nl) | 1991-02-01 |
| DK148672C (da) | 1986-02-03 |
| AT339507B (de) | 1977-10-25 |
| BE824039A (fr) | 1975-04-16 |
| CH594417A5 (enExample) | 1978-01-13 |
| US4004024A (en) | 1977-01-18 |
| NO744725L (enExample) | 1976-01-16 |
| DK582074A (da) | 1976-01-16 |
| DK148672B (da) | 1985-09-02 |
| NO142733B (no) | 1980-06-30 |
| DE2433836A1 (de) | 1976-01-29 |
| SE7415350L (sv) | 1976-01-16 |
| JPS5135426A (en) | 1976-03-25 |
| GB1507502A (en) | 1978-04-19 |
| NL186677B (nl) | 1990-09-03 |
| SE426012B (sv) | 1982-12-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1334761C (en) | Benzylamine derivatives, process for production thereof, and use thereof | |
| US3489805A (en) | 2,3-dihalophenyl-3-iodopropargyl ethers | |
| JPH0725720B2 (ja) | 抗微生物化合物 | |
| US3930835A (en) | Pesticidal compositions and methods employing substituted oxirane compounds | |
| US4018801A (en) | Substituted oxirane compounds | |
| FI64572B (fi) | Foerfarande foer framstaellning av antimikrobiella polyaminderivat | |
| JPS604161B2 (ja) | バクテリア、菌類および胞子類の抑制法 | |
| US4062859A (en) | Halogenated 3-isothiazolidinone 1-oxide and 1,1-dioxides | |
| US4073926A (en) | Mono-quaternary ammonium salts of hydantoin and compositions thereof | |
| US5151447A (en) | S-substituted beta-thioacrylamide biocides and fungicides | |
| US4376094A (en) | Method of disinfecting and a method for destroying bacteria and fungi using 2-substituted glutaraldehydes | |
| US4193935A (en) | Novel oxiodinium and thiaiodinium compounds | |
| US4013772A (en) | Fungicidal methods employing substituted oxirane compounds | |
| US4059596A (en) | 2,5-Bis(benzyloxy)tetrahydrofuran | |
| US4613620A (en) | Novel oxiodinium and thiaiodinium compounds | |
| US4405795A (en) | 2,6-Dialkoxy-3-(α-alkoxybenzyl)tetrahydropyrans used as intermediates to make 2-benzylideneglutaraldehydes | |
| US3506719A (en) | Novel oxiodinium and thiaiodinium compounds | |
| JPS61291582A (ja) | 殺菌剤組成物および第3アミン化合物 | |
| US3399199A (en) | Nitroalkyl-piperazines | |
| US4025533A (en) | 5-Bromo-5-nitro-2-alkylsubstituted-1,3-dioxane | |
| US4283349A (en) | Novel oxiodinium and thiaiodinium compounds | |
| EP0697016A1 (de) | Substituierte chinolinverbindungen und deren verwendung als safener | |
| US3678168A (en) | Nitroalkyl-piperazines for inhibiting bacteria fungi and nematodes | |
| US2501191A (en) | N, n'-polythioamines as pesticides | |
| NZ219954A (en) | Propargyl thiocyanates and biocidal compositions |