JPS6037160B2 - 包装された洗剤組成物 - Google Patents
包装された洗剤組成物Info
- Publication number
- JPS6037160B2 JPS6037160B2 JP50057182A JP5718275A JPS6037160B2 JP S6037160 B2 JPS6037160 B2 JP S6037160B2 JP 50057182 A JP50057182 A JP 50057182A JP 5718275 A JP5718275 A JP 5718275A JP S6037160 B2 JPS6037160 B2 JP S6037160B2
- Authority
- JP
- Japan
- Prior art keywords
- detergent
- tablets
- detergents
- sodium
- tablet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003599 detergent Substances 0.000 title claims description 205
- 239000000203 mixture Substances 0.000 title claims description 106
- 239000004615 ingredient Substances 0.000 claims description 48
- 238000005406 washing Methods 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 32
- 239000000126 substance Substances 0.000 claims description 13
- 239000002775 capsule Substances 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 description 33
- 238000009472 formulation Methods 0.000 description 32
- 239000003795 chemical substances by application Substances 0.000 description 30
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 18
- 229910052708 sodium Inorganic materials 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- 229910019142 PO4 Inorganic materials 0.000 description 17
- 235000021317 phosphate Nutrition 0.000 description 17
- 239000000344 soap Substances 0.000 description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 15
- 125000000217 alkyl group Chemical group 0.000 description 14
- -1 alkali metal salts Chemical class 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 239000012752 auxiliary agent Substances 0.000 description 12
- 239000007844 bleaching agent Substances 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 11
- 239000010452 phosphate Substances 0.000 description 11
- 235000019832 sodium triphosphate Nutrition 0.000 description 11
- 239000007788 liquid Substances 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000000034 method Methods 0.000 description 9
- 239000004604 Blowing Agent Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000194 fatty acid Substances 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229920002472 Starch Polymers 0.000 description 7
- 125000000129 anionic group Chemical group 0.000 description 7
- 238000004140 cleaning Methods 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 239000008107 starch Substances 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 7
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 6
- 239000004115 Sodium Silicate Substances 0.000 description 6
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000001768 carboxy methyl cellulose Substances 0.000 description 6
- 239000000945 filler Substances 0.000 description 6
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 6
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 6
- 229910052911 sodium silicate Inorganic materials 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 239000006187 pill Substances 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 239000002518 antifoaming agent Substances 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 239000000645 desinfectant Substances 0.000 description 4
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 4
- 229940088598 enzyme Drugs 0.000 description 4
- 239000000796 flavoring agent Substances 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 238000004806 packaging method and process Methods 0.000 description 4
- 159000000001 potassium salts Chemical class 0.000 description 4
- 150000004760 silicates Chemical class 0.000 description 4
- 229960001922 sodium perborate Drugs 0.000 description 4
- 229940045872 sodium percarbonate Drugs 0.000 description 4
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 4
- LDVVTQMJQSCDMK-UHFFFAOYSA-N 1,3-dihydroxypropan-2-yl formate Chemical compound OCC(CO)OC=O LDVVTQMJQSCDMK-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical class CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 3
- 239000004166 Lanolin Substances 0.000 description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 239000002216 antistatic agent Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 229910021538 borax Inorganic materials 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 238000005056 compaction Methods 0.000 description 3
- 238000004851 dishwashing Methods 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 235000019634 flavors Nutrition 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 229940039717 lanolin Drugs 0.000 description 3
- 235000019388 lanolin Nutrition 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 3
- 229920001296 polysiloxane Polymers 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 239000004328 sodium tetraborate Substances 0.000 description 3
- 235000010339 sodium tetraborate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 239000004711 α-olefin Substances 0.000 description 3
- GDJZZWYLFXAGFH-UHFFFAOYSA-N 1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid Chemical compound CC1C=CC=CC1(C)S(O)(=O)=O GDJZZWYLFXAGFH-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 229920002257 Plurafac® Polymers 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 159000000007 calcium salts Chemical class 0.000 description 2
- 150000001767 cationic compounds Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 2
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000004088 foaming agent Substances 0.000 description 2
- 239000003205 fragrance Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000008233 hard water Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 239000003230 hygroscopic agent Substances 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052909 inorganic silicate Inorganic materials 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000004900 laundering Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 2
- 238000010944 pre-mature reactiony Methods 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000271 synthetic detergent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- KRTNITDCKAVIFI-UHFFFAOYSA-N tridecyl benzenesulfonate Chemical compound CCCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KRTNITDCKAVIFI-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- ZQYTUZRTFNQVCE-UHFFFAOYSA-N 2-(methylamino)ethanesulfonamide Chemical compound CNCCS(N)(=O)=O ZQYTUZRTFNQVCE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000060350 Citronella moorei Species 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 229920005682 EO-PO block copolymer Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000047703 Nonion Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- 101710194948 Protein phosphatase PhpP Proteins 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 102000005158 Subtilisins Human genes 0.000 description 1
- 108010056079 Subtilisins Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- DUJHUESDNVWCBZ-UHFFFAOYSA-N [acetyloxy(2-hydroxyethyl)amino] acetate Chemical compound CC(=O)ON(CCO)OC(C)=O DUJHUESDNVWCBZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- DXCJPNJCVNMRCS-UHFFFAOYSA-N carbonic acid;2,3-dihydroxybutanedioic acid Chemical compound OC(O)=O.OC(=O)C(O)C(O)C(O)=O DXCJPNJCVNMRCS-UHFFFAOYSA-N 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 1
- 238000012851 eutrophication Methods 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000010855 food raising agent Nutrition 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229940116364 hard fat Drugs 0.000 description 1
- 229920000140 heteropolymer Polymers 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 235000010420 locust bean gum Nutrition 0.000 description 1
- 239000000711 locust bean gum Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229940075065 polyvinyl acetate Drugs 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical class [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 1
- DUXXGJTXFHUORE-UHFFFAOYSA-M sodium;4-tridecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCCC1=CC=C(S([O-])(=O)=O)C=C1 DUXXGJTXFHUORE-UHFFFAOYSA-M 0.000 description 1
- MWZFQMUXPSUDJQ-KVVVOXFISA-M sodium;[(z)-octadec-9-enyl] sulfate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCCOS([O-])(=O)=O MWZFQMUXPSUDJQ-KVVVOXFISA-M 0.000 description 1
- OTNVGWMVOULBFZ-UHFFFAOYSA-N sodium;hydrochloride Chemical class [Na].Cl OTNVGWMVOULBFZ-UHFFFAOYSA-N 0.000 description 1
- CLJTZNIHUYFUMR-UHFFFAOYSA-M sodium;hydrogen carbonate;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound [Na+].OC([O-])=O.OC(=O)CC(O)(C(O)=O)CC(O)=O CLJTZNIHUYFUMR-UHFFFAOYSA-M 0.000 description 1
- DKYPZNSPQXLRRQ-UHFFFAOYSA-M sodium;undec-10-enoate Chemical compound [Na+].[O-]C(=O)CCCCCCCCC=C DKYPZNSPQXLRRQ-UHFFFAOYSA-M 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47K—SANITARY EQUIPMENT NOT OTHERWISE PROVIDED FOR; TOILET ACCESSORIES
- A47K5/00—Holders or dispensers for soap, toothpaste, or the like
- A47K5/06—Dispensers for soap
- A47K5/08—Dispensers for soap for solid soap
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
- C11D17/0086—Laundry tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/04—Detergent materials or soaps characterised by their shape or physical properties combined with or containing other objects
- C11D17/041—Compositions releasably affixed on a substrate or incorporated into a dispensing means
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06F—LAUNDERING, DRYING, IRONING, PRESSING OR FOLDING TEXTILE ARTICLES
- D06F39/00—Details of washing machines not specific to a single type of machines covered by groups D06F9/00 - D06F27/00
- D06F39/02—Devices for adding soap or other washing agents
- D06F39/026—Devices for adding soap or other washing agents the powder or tablets being added directly, e.g. without the need of a flushing liquid
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Public Health (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Feeding, Discharge, Calcimining, Fusing, And Gas-Generation Devices (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US47025874A | 1974-05-15 | 1974-05-15 | |
| US470258 | 1974-05-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS50155507A JPS50155507A (enExample) | 1975-12-15 |
| JPS6037160B2 true JPS6037160B2 (ja) | 1985-08-24 |
Family
ID=23866866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP50057182A Expired JPS6037160B2 (ja) | 1974-05-15 | 1975-05-14 | 包装された洗剤組成物 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4099912A (enExample) |
| JP (1) | JPS6037160B2 (enExample) |
| AT (1) | AT373622B (enExample) |
| AU (1) | AU501550B2 (enExample) |
| BE (1) | BE829148A (enExample) |
| BR (1) | BR7502975A (enExample) |
| CA (1) | CA1080076A (enExample) |
| CH (1) | CH622550A5 (enExample) |
| DE (1) | DE2521883A1 (enExample) |
| DK (1) | DK149311C (enExample) |
| FI (1) | FI60406C (enExample) |
| FR (1) | FR2271286B1 (enExample) |
| GB (1) | GB1505274A (enExample) |
| IN (1) | IN144116B (enExample) |
| IT (1) | IT1035683B (enExample) |
| NL (1) | NL7505703A (enExample) |
| NO (1) | NO146288C (enExample) |
| NZ (1) | NZ177354A (enExample) |
| PH (1) | PH13814A (enExample) |
| SE (1) | SE423113B (enExample) |
| ZA (1) | ZA752732B (enExample) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4253842A (en) * | 1974-05-15 | 1981-03-03 | Colgate-Palmolive Company | Detergent compositions and washing methods including and utilizing separate tablets of components |
| DE2554592C3 (de) * | 1975-12-04 | 1981-11-26 | Bosch-Siemens Hausgeräte GmbH, 7000 Stuttgart | In einer automatischen Waschmaschine durchzuführendes Waschverfahren für Textilien sowie Vorrichtung zu dessen Durchführung |
| GB1583082A (en) * | 1977-05-18 | 1981-01-21 | Unilever Ltd | Detergent products |
| CH639416A5 (de) * | 1977-06-27 | 1983-11-15 | Akzo Nv | Detergentienzusammensetzung enthaltend alkalicarbonat. |
| DK435881A (da) * | 1981-10-01 | 1983-04-02 | Niels Ole Vesterager | Vaskeaktiv doseringsenhed, fremgangsmaade til fremstilling heraf samt anvendelsen heraf |
| JPS6329734Y2 (enExample) * | 1984-11-24 | 1988-08-09 | ||
| JPS61190595A (ja) * | 1985-02-19 | 1986-08-25 | 松村化学工業株式会社 | 尿類除去用組成物及びこれを用いた尿類の除去法 |
| JPS6252165U (enExample) * | 1985-09-19 | 1987-04-01 | ||
| USRE33646E (en) * | 1986-01-31 | 1991-07-23 | Amway Corporation | Dispensing pouch containing premeasured laundering compositions and washer-resistant dryer additive |
| US4659496A (en) * | 1986-01-31 | 1987-04-21 | Amway Corporation | Dispensing pouch containing premeasured laundering compositions |
| DE3641314A1 (de) * | 1986-12-03 | 1988-06-09 | Henkel Kgaa | Waeschenachbehandlungsmittel auf der basis von schichtsilikat |
| US5078301A (en) * | 1987-10-02 | 1992-01-07 | Ecolab Inc. | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use |
| US5198198A (en) * | 1987-10-02 | 1993-03-30 | Ecolab Inc. | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use |
| US5234615A (en) * | 1987-10-02 | 1993-08-10 | Ecolab Inc. | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use |
| GB8727135D0 (en) * | 1987-11-19 | 1987-12-23 | Unilever Plc | Machine dishwashing composition |
| GB8918984D0 (en) * | 1989-08-21 | 1989-10-04 | Unilever Plc | Detergent compositions |
| GB2235206A (en) * | 1989-08-21 | 1991-02-27 | Unilever Plc | Multiple component detergent |
| TR24867A (tr) * | 1989-08-23 | 1992-07-01 | Unilever Nv | CAMASIR MUAMELE MAMULü |
| US5133892A (en) * | 1990-10-17 | 1992-07-28 | Lever Brothers Company, Division Of Conopco, Inc. | Machine dishwashing detergent tablets |
| GB9205894D0 (en) * | 1992-03-17 | 1992-04-29 | Unilever Plc | Detergent compositions |
| US5269974A (en) * | 1992-09-01 | 1993-12-14 | The Procter & Gamble Company | Liquid or gel dishwashing detergent composition containing alkyl amphocarboxylic acid and magnesium or calcium ions |
| ES2122601T3 (es) * | 1994-09-12 | 1998-12-16 | Ecolab Inc | Composicion para enjuagado de plasticos. |
| US5684121A (en) * | 1994-12-06 | 1997-11-04 | Isp Investments Inc. | N-vinyl lactam polymer containing tablets of low friability and high rate of dissolution |
| GB2324495A (en) * | 1997-04-22 | 1998-10-28 | Procter & Gamble | Multi-layer detergent tablet |
| GB9711829D0 (en) | 1997-06-06 | 1997-08-06 | Unilever Plc | Detergent compositions |
| GB2331994A (en) † | 1997-12-02 | 1999-06-09 | Procter & Gamble | Detergent tablet |
| US5993792A (en) * | 1997-11-13 | 1999-11-30 | Tiro Industries Incorporated | System for customized hair products containing surfactants |
| US6551981B1 (en) * | 1998-07-17 | 2003-04-22 | Patrizio Ricci | Detergent tablet |
| PT976819E (pt) * | 1998-07-17 | 2002-06-28 | Procter & Gamble | Pastilha detergente |
| DE19848458A1 (de) * | 1998-10-21 | 2000-04-27 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper/Verpackung-Kombination |
| DE19860189C1 (de) * | 1998-12-24 | 2000-03-30 | Henkel Kgaa | Formoptimierter Waschmittelformkörper |
| ATE310073T1 (de) * | 1999-03-10 | 2005-12-15 | Unilever Nv | Waschmittelformkörper |
| ES2222253T3 (es) * | 1999-11-17 | 2005-02-01 | Reckitt Benckiser (Uk) Limited | Recipientes solubles en agua moldeados por inyeccion. |
| US6328951B1 (en) * | 1999-12-21 | 2001-12-11 | International Flavors & Fragrances Inc. | Water-soluble solid-phase ironing aid freshening composition tablets consisting of same for use in the steam chamber of an iron and process for preparing and utilizing the same |
| DE10005575A1 (de) * | 2000-02-09 | 2001-08-23 | Reckitt Benckiser Nv | Reinigungsmittelzusammensetzung in Tablettenform |
| US7351683B2 (en) * | 2000-02-17 | 2008-04-01 | The Procter & Gamble Company | Laundry additive sachet |
| US20030104969A1 (en) * | 2000-05-11 | 2003-06-05 | Caswell Debra Sue | Laundry system having unitized dosing |
| AU2001264744A1 (en) * | 2000-05-22 | 2001-12-03 | The Procter And Gamble Company | A method for caring for a fabric article and for providing system therefor |
| AU2001264725A1 (en) * | 2000-05-22 | 2001-12-03 | The Procter And Gamble Company | A kit for caring for a fabric article |
| BR0113807A (pt) * | 2000-09-11 | 2003-07-29 | Procter & Gamble | Artigos para lavanderia e métodos para a proteção de tecidos ou para limpeza e proteção combinadas de tecidos |
| DE10138283A1 (de) * | 2001-08-10 | 2003-03-06 | Henkel Kgaa | Waschverfahren |
| GB0122665D0 (en) * | 2001-09-20 | 2001-11-14 | Cussons Int Ltd | Dispenser for personal care composition |
| US20050072720A1 (en) * | 2002-02-05 | 2005-04-07 | Reign Corporation | Point-of-use water softener |
| US6722434B2 (en) * | 2002-05-31 | 2004-04-20 | Halliburton Energy Services, Inc. | Methods of generating gas in well treating fluids |
| GB0514001D0 (en) * | 2005-07-08 | 2005-08-17 | Reckitt Benckiser Nv | Article and method |
| GB0513997D0 (en) * | 2005-07-08 | 2005-08-17 | Reckitt Benckiser Nv | Article and method |
| US7871518B2 (en) * | 2006-03-27 | 2011-01-18 | Dbg Group Investments, Llc | Apparatus for treating wash water supplied |
| GB0616444D0 (en) | 2006-08-18 | 2006-09-27 | Reckitt Benckiser Nv | Detergent composition |
| GB0616439D0 (en) * | 2006-08-18 | 2006-09-27 | Reckitt Benckiser Nv | Detergent composition |
| US9730557B2 (en) | 2007-05-16 | 2017-08-15 | Ecolab Usa Inc. | Keyed dispensing cartridge with valve insert |
| USD648095S1 (en) * | 2010-11-11 | 2011-11-01 | Fernandez Carlos F | Coin counting and holding device |
| JP6074612B2 (ja) * | 2012-06-12 | 2017-02-08 | パナソニックIpマネジメント株式会社 | 洗濯機システム |
| US8877240B1 (en) | 2014-01-09 | 2014-11-04 | Chemlink Laboratories, Llc | Tablet binding compositions |
| EP3118296A1 (de) * | 2015-07-16 | 2017-01-18 | Clearwhite GmbH | Reinigungstablette für karaffen |
| US10626350B2 (en) * | 2015-12-08 | 2020-04-21 | Ecolab Usa Inc. | Pressed manual dish detergent |
| ES2796402T3 (es) * | 2016-11-15 | 2020-11-26 | Unilever Nv | Dispositivo aplicador para composiciones detergentes fluidas |
| ES2776400T3 (es) * | 2016-11-15 | 2020-07-30 | Unilever Nv | Dispositivo aplicador de fluidos |
| US10569286B2 (en) | 2017-05-08 | 2020-02-25 | Ecolab Usa Inc. | Shaped cartridge dispensing systems |
| US20210188523A1 (en) * | 2017-10-18 | 2021-06-24 | Splash Innovations, Llc | Moisture-sensitive pod dispenser and method |
| CN110747610B (zh) * | 2018-07-23 | 2024-12-27 | 青岛海尔洗护电器有限公司 | 一种壁挂式洗衣机 |
| IT201900022392A1 (it) * | 2019-11-28 | 2021-05-28 | Salros S R L | Composizione di lavaggio liquida a componenti separati, per bucato in macchine lavatrici automatiche |
| CN114908524B (zh) * | 2021-02-09 | 2024-12-20 | 青岛海尔洗衣机有限公司 | 一种储液盒、添加剂投放装置及添加剂种类的识别方法 |
| CN114875628A (zh) * | 2022-04-24 | 2022-08-09 | 无锡小天鹅电器有限公司 | 洗涤剂投放方法、装置、设备及介质 |
| IL294539B2 (en) * | 2022-07-05 | 2023-07-01 | Capsule Minimal Ltd | A fast-dissolving cartridge array and industrial systems and methods for its production |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3034911A (en) * | 1959-03-25 | 1962-05-15 | Nat Starch Chem Corp | Tablet disintegrants |
| DE1403674A1 (de) * | 1961-02-22 | 1968-10-24 | Siemens Elektorgeraete Gmbh | Dosiereinrichtung fuer Geschirrspuel- und Waschmaschinen |
| GB1022680A (en) * | 1963-12-11 | 1966-03-16 | Proctor & Gamble Ltd | Improvements in or relating to detergent briquettes |
| US3338836A (en) * | 1964-06-29 | 1967-08-29 | Fmc Corp | Cleansing tablets |
| ZA666332B (enExample) * | 1965-10-22 | |||
| CA813298A (en) * | 1966-07-08 | 1969-05-20 | W. Gray Frederick | Bleaching packets |
| DE1302882B (de) * | 1967-01-07 | 1971-01-07 | Henkel & Cie Gmbh | Verfahren zur Ergaenzung von Reinigungsbaedern fuer die kontinuierliche Reinigung von starrem Material |
| CA795288A (en) * | 1966-11-12 | 1968-09-24 | Chapuis Jacques | Encapsulated synthetic liquid detergent and process for preparing the same |
| US3557003A (en) * | 1967-06-21 | 1971-01-19 | Procter & Gamble | Detergent tablet |
| US3756457A (en) * | 1970-12-11 | 1973-09-04 | Economical Lab Inc | Dual additive feeder for dishwashing |
| US3826113A (en) * | 1973-05-07 | 1974-07-30 | Economics Lab | Additive control and injection system useful in laundry machine operations |
-
1975
- 1975-04-28 ZA ZA00752732A patent/ZA752732B/xx unknown
- 1975-04-29 NZ NZ177354A patent/NZ177354A/xx unknown
- 1975-04-30 IN IN876/CAL/1975A patent/IN144116B/en unknown
- 1975-05-06 PH PH17144A patent/PH13814A/en unknown
- 1975-05-12 IT IT49533/75A patent/IT1035683B/it active
- 1975-05-13 SE SE7505464A patent/SE423113B/xx not_active IP Right Cessation
- 1975-05-13 FI FI751404A patent/FI60406C/fi not_active IP Right Cessation
- 1975-05-14 AU AU81146/75A patent/AU501550B2/en not_active Expired
- 1975-05-14 DE DE19752521883 patent/DE2521883A1/de not_active Withdrawn
- 1975-05-14 GB GB20370/75A patent/GB1505274A/en not_active Expired
- 1975-05-14 JP JP50057182A patent/JPS6037160B2/ja not_active Expired
- 1975-05-14 BR BR3795/75A patent/BR7502975A/pt unknown
- 1975-05-14 NO NO751701A patent/NO146288C/no unknown
- 1975-05-14 CA CA226,943A patent/CA1080076A/en not_active Expired
- 1975-05-15 DK DK215075A patent/DK149311C/da not_active IP Right Cessation
- 1975-05-15 AT AT0370275A patent/AT373622B/de not_active IP Right Cessation
- 1975-05-15 FR FR7515243A patent/FR2271286B1/fr not_active Expired
- 1975-05-15 CH CH628175A patent/CH622550A5/de not_active IP Right Cessation
- 1975-05-15 NL NL7505703A patent/NL7505703A/xx not_active Application Discontinuation
- 1975-05-15 BE BE156416A patent/BE829148A/xx not_active IP Right Cessation
-
1976
- 1976-09-13 US US05/722,988 patent/US4099912A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| PH13814A (en) | 1980-10-03 |
| NZ177354A (en) | 1981-03-16 |
| JPS50155507A (enExample) | 1975-12-15 |
| NO146288B (no) | 1982-05-24 |
| FI60406B (fi) | 1981-09-30 |
| AU501550B2 (en) | 1979-06-21 |
| SE423113B (sv) | 1982-04-13 |
| CA1080076A (en) | 1980-06-24 |
| ATA370275A (de) | 1983-06-15 |
| SE7505464L (sv) | 1975-11-17 |
| AU8114675A (en) | 1976-11-18 |
| NL7505703A (nl) | 1975-11-18 |
| NO751701L (enExample) | 1975-11-18 |
| CH622550A5 (enExample) | 1981-04-15 |
| DK149311C (da) | 1986-09-08 |
| GB1505274A (en) | 1978-03-30 |
| IN144116B (enExample) | 1978-03-25 |
| BE829148A (fr) | 1975-09-01 |
| NO146288C (no) | 1982-09-01 |
| US4099912A (en) | 1978-07-11 |
| DK215075A (da) | 1975-11-16 |
| DK149311B (da) | 1986-04-28 |
| BR7502975A (pt) | 1976-03-23 |
| FR2271286A1 (enExample) | 1975-12-12 |
| FI60406C (fi) | 1982-01-11 |
| FR2271286B1 (enExample) | 1979-03-30 |
| DE2521883A1 (de) | 1975-12-04 |
| FI751404A7 (enExample) | 1975-11-16 |
| ZA752732B (en) | 1976-12-29 |
| AT373622B (de) | 1984-02-10 |
| IT1035683B (it) | 1979-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6037160B2 (ja) | 包装された洗剤組成物 | |
| US4253842A (en) | Detergent compositions and washing methods including and utilizing separate tablets of components | |
| US4365853A (en) | Article for storing and dispensing detergent compositions utilizing separate tablets of components | |
| US5078301A (en) | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use | |
| US5198198A (en) | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use | |
| US5234615A (en) | Article comprising a water soluble bag containing a multiple use amount of a pelletized functional material and methods of its use | |
| US4618444A (en) | Household laundry detergent with dual strength bleach | |
| EP1121410B1 (en) | Encapsulated bleach composition | |
| JPH0571699B2 (enExample) | ||
| WO1989004863A1 (en) | Machine dishwashing compositions | |
| JP2688074B2 (ja) | 複数回の使用量のペレット状機能材料を含有する水溶性袋を包含する製品とその使用方法 | |
| US20240150685A1 (en) | Product for machine dishwashing in the form of a capsule with multiple compartments | |
| AU2020357644B2 (en) | Machine dishwasher capsule with three compartments | |
| EP1026230A1 (en) | A machine dishwashing kit | |
| CA2315137A1 (en) | Cleaning tablets | |
| JPS6160477A (ja) | 洗たく用助剤のパツケ−ジ及び洗たく方法 | |
| CA2302141A1 (en) | A builder-containing tablet | |
| RU2810792C1 (ru) | Капсула для посудомоечной машины с тремя отделениями | |
| BR112022004781B1 (pt) | Cápsula de máquina de lavagem de louças | |
| ES2443767A1 (es) | Composición detergente en forma de comprimido efervescente | |
| HK1037667B (en) | Encapsulated bleach composition |