JPS6023497A - 漂白洗剤組成物 - Google Patents
漂白洗剤組成物Info
- Publication number
- JPS6023497A JPS6023497A JP59123558A JP12355884A JPS6023497A JP S6023497 A JPS6023497 A JP S6023497A JP 59123558 A JP59123558 A JP 59123558A JP 12355884 A JP12355884 A JP 12355884A JP S6023497 A JPS6023497 A JP S6023497A
- Authority
- JP
- Japan
- Prior art keywords
- composition
- manganese
- sodium
- composition according
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000000203 mixture Substances 0.000 title claims description 43
- 239000007844 bleaching agent Substances 0.000 title description 14
- -1 manganese(II) ions Chemical class 0.000 claims description 20
- 239000003599 detergent Substances 0.000 claims description 18
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 17
- 238000004061 bleaching Methods 0.000 claims description 17
- 239000011572 manganese Substances 0.000 claims description 17
- 239000002243 precursor Substances 0.000 claims description 16
- 229910052748 manganese Inorganic materials 0.000 claims description 15
- 150000004965 peroxy acids Chemical class 0.000 claims description 15
- 239000004094 surface-active agent Substances 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 8
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical group CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 claims description 6
- 150000002500 ions Chemical class 0.000 claims description 6
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 5
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 5
- 230000009919 sequestration Effects 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 2
- 125000002091 cationic group Chemical group 0.000 claims description 2
- 229960001922 sodium perborate Drugs 0.000 claims description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 7
- 150000003871 sulfonates Chemical class 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 239000002738 chelating agent Substances 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 229910052723 transition metal Inorganic materials 0.000 description 5
- 150000003624 transition metals Chemical class 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- PEYVWSJAZONVQK-UHFFFAOYSA-N hydroperoxy(oxo)borane Chemical compound OOB=O PEYVWSJAZONVQK-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- TTZMPOZCBFTTPR-UHFFFAOYSA-N O=P1OCO1 Chemical compound O=P1OCO1 TTZMPOZCBFTTPR-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 244000269722 Thea sinensis Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- VPVSTMAPERLKKM-UHFFFAOYSA-N glycoluril Chemical compound N1C(=O)NC2NC(=O)NC21 VPVSTMAPERLKKM-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229940081066 picolinic acid Drugs 0.000 description 2
- 229920001983 poloxamer Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- BVUOEDOMUOJKOY-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) benzoate Chemical compound C=1C=CC=CC=1C(=O)ON1C(=O)CCC1=O BVUOEDOMUOJKOY-UHFFFAOYSA-N 0.000 description 1
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- VAVZXZURPCYUHS-RQOWECAXSA-N (z)-3-(hydrazinecarbonyl)-4-oxopent-2-enoic acid Chemical compound OC(=O)/C=C(C(=O)C)\C(=O)NN VAVZXZURPCYUHS-RQOWECAXSA-N 0.000 description 1
- UDATXMIGEVPXTR-UHFFFAOYSA-N 1,2,4-triazolidine-3,5-dione Chemical compound O=C1NNC(=O)N1 UDATXMIGEVPXTR-UHFFFAOYSA-N 0.000 description 1
- RFTORHYUCZJHDO-UHFFFAOYSA-N 1,3-dimethylimidazolidine-2,4-dione Chemical compound CN1CC(=O)N(C)C1=O RFTORHYUCZJHDO-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- YNSJJJCTNXHMEW-UHFFFAOYSA-N 4-methoxy-n-methyl-n-methylsulfonylbenzamide Chemical compound COC1=CC=C(C(=O)N(C)S(C)(=O)=O)C=C1 YNSJJJCTNXHMEW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- 240000002853 Nelumbo nucifera Species 0.000 description 1
- 235000006508 Nelumbo nucifera Nutrition 0.000 description 1
- 235000006510 Nelumbo pentapetala Nutrition 0.000 description 1
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 238000001069 Raman spectroscopy Methods 0.000 description 1
- ZYPMNZKYVVSXOJ-YNEHKIRRSA-N [(2r,3s,4r)-2,3,4-triacetyloxy-5-oxopentyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O ZYPMNZKYVVSXOJ-YNEHKIRRSA-N 0.000 description 1
- MJOQJPYNENPSSS-XQHKEYJVSA-N [(3r,4s,5r,6s)-4,5,6-triacetyloxyoxan-3-yl] acetate Chemical compound CC(=O)O[C@@H]1CO[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O MJOQJPYNENPSSS-XQHKEYJVSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 239000004067 bulking agent Substances 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- WOWHHFRSBJGXCM-UHFFFAOYSA-M cetyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)C WOWHHFRSBJGXCM-UHFFFAOYSA-M 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 125000001309 chloro group Chemical class Cl* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PSLWZOIUBRXAQW-UHFFFAOYSA-M dimethyl(dioctadecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC PSLWZOIUBRXAQW-UHFFFAOYSA-M 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 230000005183 environmental health Effects 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- ILHIHKRJJMKBEE-UHFFFAOYSA-N hydroperoxyethane Chemical compound CCOO ILHIHKRJJMKBEE-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 229940099596 manganese sulfate Drugs 0.000 description 1
- 239000011702 manganese sulphate Substances 0.000 description 1
- 235000007079 manganese sulphate Nutrition 0.000 description 1
- HRSYISMFWLVXAQ-UHFFFAOYSA-N n-[2-(diacetylamino)ethyl]acetamide Chemical group CC(=O)NCCN(C(C)=O)C(C)=O HRSYISMFWLVXAQ-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- DDNVNUWFESEAHN-UHFFFAOYSA-N n-methyl-n-methylsulfonylacetamide Chemical compound CC(=O)N(C)S(C)(=O)=O DDNVNUWFESEAHN-UHFFFAOYSA-N 0.000 description 1
- FVCXXYLGLXGBDR-UHFFFAOYSA-N n-methyl-n-methylsulfonylbenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=CC=C1 FVCXXYLGLXGBDR-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical class O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000010944 pre-mature reactiony Methods 0.000 description 1
- XTHRMVQDBJOEPD-UHFFFAOYSA-N prop-1-ene;urea Chemical compound CC=C.NC(N)=O.NC(N)=O XTHRMVQDBJOEPD-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- RPQSWSMNPBZEHT-UHFFFAOYSA-M sodium;2-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=CC=C1S([O-])(=O)=O RPQSWSMNPBZEHT-UHFFFAOYSA-M 0.000 description 1
- MZSDGDXXBZSFTG-UHFFFAOYSA-M sodium;benzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC=C1 MZSDGDXXBZSFTG-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 230000002747 voluntary effect Effects 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/10—Carbonates ; Bicarbonates
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3932—Inorganic compounds or complexes
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Table Devices Or Equipment (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838316761A GB8316761D0 (en) | 1983-06-20 | 1983-06-20 | Detergent bleach compositions |
| GB8316761 | 1983-06-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS6023497A true JPS6023497A (ja) | 1985-02-06 |
| JPS6126959B2 JPS6126959B2 (OSRAM) | 1986-06-23 |
Family
ID=10544515
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP59123558A Granted JPS6023497A (ja) | 1983-06-20 | 1984-06-15 | 漂白洗剤組成物 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4578206A (OSRAM) |
| EP (1) | EP0132860B1 (OSRAM) |
| JP (1) | JPS6023497A (OSRAM) |
| AU (1) | AU549761B2 (OSRAM) |
| BR (1) | BR8403006A (OSRAM) |
| CA (1) | CA1229286A (OSRAM) |
| DE (1) | DE3460901D1 (OSRAM) |
| GB (1) | GB8316761D0 (OSRAM) |
| GR (1) | GR82374B (OSRAM) |
| NO (1) | NO161273C (OSRAM) |
| NZ (1) | NZ208491A (OSRAM) |
| PT (1) | PT78765B (OSRAM) |
| TR (1) | TR21921A (OSRAM) |
| ZA (1) | ZA844626B (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59155152A (ja) * | 1983-02-24 | 1984-09-04 | Seiko Epson Corp | 樹脂封止半導体装置 |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ210398A (en) * | 1983-12-06 | 1986-11-12 | Unilever Plc | Detergent bleach composition containing a peroxide compound and a manganese compound |
| US4620935A (en) * | 1984-06-06 | 1986-11-04 | Interox Chemicals Limited | Activation of aqueous hydrogen peroxide with manganese catalyst and alkaline earth metal compound |
| US4711748A (en) * | 1985-12-06 | 1987-12-08 | Lever Brothers Company | Preparation of bleach catalyst aggregates of manganese cation impregnated aluminosilicates by high velocity granulation |
| US4731196A (en) * | 1986-10-28 | 1988-03-15 | Ethyl Corporation | Process for making bleach activator |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US4861509A (en) * | 1986-12-10 | 1989-08-29 | Lever Brothers Company | Enzymatic detergent and bleaching composition |
| US5230820A (en) * | 1987-11-23 | 1993-07-27 | Ciba-Geigy Corporation | Storage-stable bleaching detergents containing bis-benzofuranyl fluoescent whitening agents |
| US5035825A (en) * | 1987-11-26 | 1991-07-30 | Ciba-Geigy Corporation | Stable bleaching detergents containing stilbene fluorescent whitening agents |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| JPH02238216A (ja) * | 1989-03-08 | 1990-09-20 | Matsushita Electric Ind Co Ltd | 暖房用燃焼機 |
| US5326491A (en) * | 1989-04-28 | 1994-07-05 | Ciba-Geigy Corporation | Detergents containing certain sulfonated dibenzofuranylbiphenyls |
| EP0672749A1 (en) * | 1994-03-17 | 1995-09-20 | The Procter & Gamble Company | Bleaching compositions |
| ATE170553T1 (de) * | 1994-04-07 | 1998-09-15 | Procter & Gamble | Bleichmittel enthaltend metall haltige bleichkatalysatoren und antioxidantien |
| ATE170916T1 (de) * | 1994-04-07 | 1998-09-15 | Procter & Gamble | Bleichmittelzusammensetzungen enthaltend bleichaktivatoren und bleichkatalysatoren |
| CA2187169A1 (en) * | 1994-04-07 | 1995-10-19 | Gerard Marcel Abel Baillely | Bleach compositions comprising metal-containing bleach catalysts |
| US5686014A (en) * | 1994-04-07 | 1997-11-11 | The Procter & Gamble Company | Bleach compositions comprising manganese-containing bleach catalysts |
| CA2145104A1 (en) * | 1994-04-13 | 1995-10-14 | Lucille Florence Taylor | Automatic dishwashing composition containing bleach activators |
| US5560748A (en) * | 1994-06-10 | 1996-10-01 | The Procter & Gamble Company | Detergent compositions comprising large pore size redox catalysts |
| BR9607127A (pt) * | 1995-02-02 | 1997-11-04 | Procter & Gamble | Composições para lavagem automática de pratos compreendendo catalísadores de cobalto(III) |
| US5968881A (en) * | 1995-02-02 | 1999-10-19 | The Procter & Gamble Company | Phosphate built automatic dishwashing compositions comprising catalysts |
| ATE193320T1 (de) * | 1995-02-02 | 2000-06-15 | Procter & Gamble | Maschinengeschirrspülmittel zusammensetzungen mit kobalt chelatkatalysatoren |
| ATE203051T1 (de) * | 1995-06-16 | 2001-07-15 | Procter & Gamble | Maschinengeschirrspülmittel, die kobaltkatalysatoren enthalten |
| BR9609384A (pt) * | 1995-06-16 | 1999-05-18 | Procter & Gamble | Composições alvejantes compreendendo catalisadores de cobalto |
| US5830836A (en) * | 1995-10-27 | 1998-11-03 | Eldorado Chemical Co., Inc. | Compositions and methods for coating removal |
| US5703034A (en) * | 1995-10-30 | 1997-12-30 | The Procter & Gamble Company | Bleach catalyst particles |
| FR2885302B1 (fr) * | 2005-05-09 | 2007-08-03 | Hypred Sa | Produits et methodes de nettoyage et de desinfection pour l'hygiene en production laitiere |
| US10280386B2 (en) | 2015-04-03 | 2019-05-07 | Ecolab Usa Inc. | Enhanced peroxygen stability in multi-dispense TAED-containing peroxygen solid |
| US9783766B2 (en) | 2015-04-03 | 2017-10-10 | Ecolab Usa Inc. | Enhanced peroxygen stability using anionic surfactant in TAED-containing peroxygen solid |
| US10870818B2 (en) | 2018-06-15 | 2020-12-22 | Ecolab Usa Inc. | Enhanced peroxygen stability using fatty acid in bleach activating agent containing peroxygen solid |
| EP4396317A1 (en) * | 2021-09-01 | 2024-07-10 | Unilever IP Holdings B.V. | Machine dishwash detergent |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3532634A (en) * | 1966-03-01 | 1970-10-06 | United States Borax Chem | Bleaching compositions and methods |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156654A (en) * | 1961-06-19 | 1964-11-10 | Shell Oil Co | Bleaching |
| GB1120944A (en) * | 1964-07-24 | 1968-07-24 | Unilever Ltd | Catalysts |
| US3332882A (en) * | 1964-12-18 | 1967-07-25 | Fmc Corp | Peroxygen compositions |
| US3372125A (en) * | 1965-11-15 | 1968-03-05 | Peter Strong & Company Inc | Denture cleanser |
| US4128494A (en) * | 1976-09-01 | 1978-12-05 | Produits Chimiques Ugine Kuhlmann | Activators for percompounds |
| GB1557568A (en) * | 1976-09-20 | 1979-12-12 | Procter & Gamble | Laundry composition comprising an agglomerate of a cationic surfactant and a bleach activator |
| DE2902236A1 (de) * | 1978-01-25 | 1979-07-26 | Kao Corp | Bleichmittelmischung |
| DD141844B1 (de) * | 1978-12-28 | 1982-04-28 | Rudolf Opitz | Bleichmittel |
| GR76237B (OSRAM) * | 1981-08-08 | 1984-08-04 | Procter & Gamble | |
| US4481129A (en) * | 1981-12-23 | 1984-11-06 | Lever Brothers Company | Bleach compositions |
-
1983
- 1983-06-20 GB GB838316761A patent/GB8316761D0/en active Pending
-
1984
- 1984-06-08 DE DE8484200813T patent/DE3460901D1/de not_active Expired
- 1984-06-08 EP EP84200813A patent/EP0132860B1/en not_active Expired
- 1984-06-13 NZ NZ208491A patent/NZ208491A/en unknown
- 1984-06-13 US US06/619,975 patent/US4578206A/en not_active Expired - Fee Related
- 1984-06-13 CA CA000456446A patent/CA1229286A/en not_active Expired
- 1984-06-14 GR GR75023A patent/GR82374B/el unknown
- 1984-06-15 TR TR21921A patent/TR21921A/xx unknown
- 1984-06-15 JP JP59123558A patent/JPS6023497A/ja active Granted
- 1984-06-18 NO NO842436A patent/NO161273C/no unknown
- 1984-06-18 AU AU29465/84A patent/AU549761B2/en not_active Ceased
- 1984-06-19 BR BR8403006A patent/BR8403006A/pt not_active IP Right Cessation
- 1984-06-19 PT PT78765A patent/PT78765B/pt unknown
- 1984-06-19 ZA ZA844626A patent/ZA844626B/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3532634A (en) * | 1966-03-01 | 1970-10-06 | United States Borax Chem | Bleaching compositions and methods |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS59155152A (ja) * | 1983-02-24 | 1984-09-04 | Seiko Epson Corp | 樹脂封止半導体装置 |
Also Published As
| Publication number | Publication date |
|---|---|
| GB8316761D0 (en) | 1983-07-20 |
| AU2946584A (en) | 1985-01-03 |
| EP0132860B1 (en) | 1986-10-08 |
| PT78765A (en) | 1984-07-01 |
| EP0132860A1 (en) | 1985-02-13 |
| TR21921A (tr) | 1985-11-07 |
| NO161273B (no) | 1989-04-17 |
| NO842436L (no) | 1984-12-21 |
| GR82374B (OSRAM) | 1984-12-13 |
| PT78765B (en) | 1986-11-13 |
| US4578206A (en) | 1986-03-25 |
| CA1229286A (en) | 1987-11-17 |
| AU549761B2 (en) | 1986-02-13 |
| NZ208491A (en) | 1986-05-09 |
| BR8403006A (pt) | 1985-05-28 |
| DE3460901D1 (en) | 1986-11-13 |
| NO161273C (no) | 1989-07-26 |
| JPS6126959B2 (OSRAM) | 1986-06-23 |
| ZA844626B (en) | 1986-01-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6023497A (ja) | 漂白洗剤組成物 | |
| US4119557A (en) | Bleaching compositions and process for cleaning fabrics | |
| US4481129A (en) | Bleach compositions | |
| US4478733A (en) | Detergent compositions | |
| US4601845A (en) | Bleaching compositions containing mixed metal cations adsorbed onto aluminosilicate support materials | |
| US6074437A (en) | Bleaching with polyoxometalates and air or molecular oxygen | |
| CA2042736C (en) | Bleach activation | |
| US5785886A (en) | Bleaching compositions containing imine hydrogen peroxide and a transition metal catalyst | |
| ES2219438T5 (es) | Metodo para blanquear un sustrato. | |
| NZ246258A (en) | Use of acylated citrate ester derivatives as a hydrogen peroxide activator | |
| US4536183A (en) | Manganese bleach activators | |
| JPS62225598A (ja) | 漂白組成物 | |
| CA1143511A (en) | Bleach composition | |
| CA1226502A (en) | Detergent bleach composition | |
| CA2312901A1 (en) | Bleaching compositions | |
| US4559158A (en) | Organic cyanamide compounds as activators for inorganic per compounds | |
| EP0157483A1 (en) | Peroxide activation | |
| GB2141755A (en) | Detergent bleach compositions | |
| CA1208852A (en) | Low temperature bleaching composition | |
| GB2129454A (en) | Peroxyacid bleaching and laundering composition | |
| KR100979849B1 (ko) | 거대고리 망간 착화합물을 함유한 표백제 및 표백세제조성물 | |
| ZA200104131B (en) | Bleaching with polyoxometalates and air or molecular oxygen. |