JPS5827825B2 - ビニル含有呈色性化合物 - Google Patents
ビニル含有呈色性化合物Info
- Publication number
- JPS5827825B2 JPS5827825B2 JP51005388A JP538876A JPS5827825B2 JP S5827825 B2 JPS5827825 B2 JP S5827825B2 JP 51005388 A JP51005388 A JP 51005388A JP 538876 A JP538876 A JP 538876A JP S5827825 B2 JPS5827825 B2 JP S5827825B2
- Authority
- JP
- Japan
- Prior art keywords
- ethylene
- bis
- dimethylaminophenyl
- absorption peak
- color
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 87
- 229920002554 vinyl polymer Polymers 0.000 title description 19
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 title description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical group C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000001475 halogen functional group Chemical group 0.000 claims 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 238000010521 absorption reaction Methods 0.000 description 78
- -1 2-alkyl Chemical group 0.000 description 71
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 58
- 239000005977 Ethylene Substances 0.000 description 58
- 239000000463 material Substances 0.000 description 38
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 31
- 150000004715 keto acids Chemical class 0.000 description 25
- GQWAOUOHRMHSHL-UHFFFAOYSA-N 4-ethenyl-n,n-dimethylaniline Chemical group CN(C)C1=CC=C(C=C)C=C1 GQWAOUOHRMHSHL-UHFFFAOYSA-N 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 18
- 150000008064 anhydrides Chemical class 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical group C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 12
- 230000002378 acidificating effect Effects 0.000 description 12
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 10
- CBZMQWPBAUBAPO-UHFFFAOYSA-N 4-ethenyl-n,n-diethylaniline Chemical group CCN(CC)C1=CC=C(C=C)C=C1 CBZMQWPBAUBAPO-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 7
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 7
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 238000000862 absorption spectrum Methods 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000004927 clay Substances 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 5
- UBHUZTDZYCCKLP-UHFFFAOYSA-N 4-(2-bromoethenyl)-n,n-dimethylaniline Chemical group CN(C)C1=CC=C(C=CBr)C=C1 UBHUZTDZYCCKLP-UHFFFAOYSA-N 0.000 description 5
- JXBCJUPBVRELNY-UHFFFAOYSA-N [7-(diethylamino)phenothiazin-3-ylidene]-diethylazanium Chemical compound C1=CC(N(CC)CC)=CC2=[S+]C3=CC(N(CC)CC)=CC=C3N=C21 JXBCJUPBVRELNY-UHFFFAOYSA-N 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000005011 phenolic resin Substances 0.000 description 5
- 229920001568 phenolic resin Polymers 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 238000000985 reflectance spectrum Methods 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- WKOPFKCDGGWLAV-UHFFFAOYSA-N 5-(dimethylamino)-2-benzofuran-1,3-dione Chemical compound CN(C)C1=CC=C2C(=O)OC(=O)C2=C1 WKOPFKCDGGWLAV-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- MMIUVGRZSMZLQE-UHFFFAOYSA-N oxane-2,3,6-trione Chemical compound O=C1CCC(=O)C(=O)O1 MMIUVGRZSMZLQE-UHFFFAOYSA-N 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- XMOWAIVXKJWQBJ-UHFFFAOYSA-N 1-ethyl-2-methylindole Chemical compound C1=CC=C2N(CC)C(C)=CC2=C1 XMOWAIVXKJWQBJ-UHFFFAOYSA-N 0.000 description 3
- AKHSBAVQPIRVAG-UHFFFAOYSA-N 4h-isochromene-1,3-dione Chemical compound C1=CC=C2C(=O)OC(=O)CC2=C1 AKHSBAVQPIRVAG-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 3
- 150000002475 indoles Chemical class 0.000 description 3
- 239000000976 ink Substances 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- 229920000620 organic polymer Polymers 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- AUHHYELHRWCWEZ-UHFFFAOYSA-N tetrachlorophthalic anhydride Chemical compound ClC1=C(Cl)C(Cl)=C2C(=O)OC(=O)C2=C1Cl AUHHYELHRWCWEZ-UHFFFAOYSA-N 0.000 description 3
- UAJRSHJHFRVGMG-UHFFFAOYSA-N 1-ethenyl-4-methoxybenzene Chemical group COC1=CC=C(C=C)C=C1 UAJRSHJHFRVGMG-UHFFFAOYSA-N 0.000 description 2
- RCSKFKICHQAKEZ-UHFFFAOYSA-N 1-ethenylindole Chemical compound C1=CC=C2N(C=C)C=CC2=C1 RCSKFKICHQAKEZ-UHFFFAOYSA-N 0.000 description 2
- CTXUTPWZJZHRJC-UHFFFAOYSA-N 1-ethenylpyrrole Chemical compound C=CN1C=CC=C1 CTXUTPWZJZHRJC-UHFFFAOYSA-N 0.000 description 2
- ZSYADSJFYABYLF-UHFFFAOYSA-N 3-bromo-4-ethenyl-n,n-dimethylaniline Chemical group CN(C)C1=CC=C(C=C)C(Br)=C1 ZSYADSJFYABYLF-UHFFFAOYSA-N 0.000 description 2
- GJZZZZQIYCJVEO-UHFFFAOYSA-N 5-(ditert-butylamino)-2-benzofuran-1,3-dione Chemical compound CC(C)(C)N(C(C)(C)C)C1=CC=C2C(=O)OC(=O)C2=C1 GJZZZZQIYCJVEO-UHFFFAOYSA-N 0.000 description 2
- UYPMEGMZCYYSAH-UHFFFAOYSA-N 7-oxatricyclo[7.2.2.22,5]pentadeca-1(12),2(15),3,5(14),9(13),10-hexaene-6,8-dione Chemical compound C1=CC2=CC=C1C(=O)OC(=O)C1=CC=C2C=C1 UYPMEGMZCYYSAH-UHFFFAOYSA-N 0.000 description 2
- 241000974482 Aricia saepiolus Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- AGCSOGVTICZFOS-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-[4-(dimethylamino)benzoyl]benzoic acid Chemical group C1=CC(N(C)C)=CC=C1C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(O)=O AGCSOGVTICZFOS-UHFFFAOYSA-N 0.000 description 1
- ZWVBUDPQGPFIRX-UHFFFAOYSA-N 2-(1-ethyl-2-methylindole-3-carbonyl)benzoic acid Chemical compound C12=CC=CC=C2N(CC)C(C)=C1C(=O)C1=CC=CC=C1C(O)=O ZWVBUDPQGPFIRX-UHFFFAOYSA-N 0.000 description 1
- DVVXXHVHGGWWPE-UHFFFAOYSA-N 2-(dimethylamino)benzoic acid Chemical compound CN(C)C1=CC=CC=C1C(O)=O DVVXXHVHGGWWPE-UHFFFAOYSA-N 0.000 description 1
- CDEHYOXDNZSALU-UHFFFAOYSA-N 2-[4-(diethylamino)-2-methoxybenzoyl]benzoic acid Chemical compound COC1=CC(N(CC)CC)=CC=C1C(=O)C1=CC=CC=C1C(O)=O CDEHYOXDNZSALU-UHFFFAOYSA-N 0.000 description 1
- CDTPAAZQBPSVGS-UHFFFAOYSA-N 2-[4-(dimethylamino)phenyl]ethanol Chemical compound CN(C)C1=CC=C(CCO)C=C1 CDTPAAZQBPSVGS-UHFFFAOYSA-N 0.000 description 1
- XIRDTMSOGDWMOX-UHFFFAOYSA-N 3,4,5,6-tetrabromophthalic acid Chemical compound OC(=O)C1=C(Br)C(Br)=C(Br)C(Br)=C1C(O)=O XIRDTMSOGDWMOX-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- WAVOOWVINKGEHS-UHFFFAOYSA-N 3-(diethylamino)phenol Chemical compound CCN(CC)C1=CC=CC(O)=C1 WAVOOWVINKGEHS-UHFFFAOYSA-N 0.000 description 1
- BKFXSOCDAQACQM-UHFFFAOYSA-N 3-chlorophthalic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1C(O)=O BKFXSOCDAQACQM-UHFFFAOYSA-N 0.000 description 1
- NMWKWBPNKPGATC-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one Chemical compound ClC1=C(Cl)C(Cl)=C2COC(=O)C2=C1Cl NMWKWBPNKPGATC-UHFFFAOYSA-N 0.000 description 1
- LDZZMHQBIRVIOS-UHFFFAOYSA-N 4-ethenyl-n,n-bis(3-methylbutyl)aniline Chemical group CC(C)CCN(CCC(C)C)C1=CC=C(C=C)C=C1 LDZZMHQBIRVIOS-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- TWWAWPHAOPTQEU-UHFFFAOYSA-N 4-methyl-2-benzofuran-1,3-dione Chemical compound CC1=CC=CC2=C1C(=O)OC2=O TWWAWPHAOPTQEU-UHFFFAOYSA-N 0.000 description 1
- FIUAKOPOCYNCCY-UHFFFAOYSA-N 5-(dihexylamino)-2-benzofuran-1,3-dione Chemical compound CCCCCCN(CCCCCC)C1=CC=C2C(=O)OC(=O)C2=C1 FIUAKOPOCYNCCY-UHFFFAOYSA-N 0.000 description 1
- JJCFABAQVHRXAW-UHFFFAOYSA-N 5-(dimethylamino)-2-[4-(dimethylamino)benzoyl]benzoic acid Chemical group C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1C(O)=O JJCFABAQVHRXAW-UHFFFAOYSA-N 0.000 description 1
- XEXYPSSRGQPBSP-UHFFFAOYSA-N 5-butyl-2-benzofuran-1,3-dione Chemical compound CCCCC1=CC=C2C(=O)OC(=O)C2=C1 XEXYPSSRGQPBSP-UHFFFAOYSA-N 0.000 description 1
- HAHCRDSCBRNQMG-UHFFFAOYSA-N 6-ethenyl-3,6-dimethylcyclohexa-2,4-dien-1-amine Chemical group CC1(C(C=C(C=C1)C)N)C=C HAHCRDSCBRNQMG-UHFFFAOYSA-N 0.000 description 1
- MPIXKPSMKMURQT-UHFFFAOYSA-N 6-ethyl-4-propyl-2-benzofuran-1,3-dione Chemical compound CCCC1=CC(CC)=CC2=C1C(=O)OC2=O MPIXKPSMKMURQT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UJOBWOGCFQCDNV-UHFFFAOYSA-N Carbazole Chemical group C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical compound O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- ZFMQKOWCDKKBIF-UHFFFAOYSA-N bis(3,5-difluorophenyl)phosphane Chemical compound FC1=CC(F)=CC(PC=2C=C(F)C=C(F)C=2)=C1 ZFMQKOWCDKKBIF-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229940096529 carboxypolymethylene Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000021615 conjugation Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- BEGBSFPALGFMJI-UHFFFAOYSA-N ethene;sodium Chemical group [Na].C=C BEGBSFPALGFMJI-UHFFFAOYSA-N 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- FWQHNLCNFPYBCA-UHFFFAOYSA-N fluoran Chemical compound C12=CC=CC=C2OC2=CC=CC=C2C11OC(=O)C2=CC=CC=C21 FWQHNLCNFPYBCA-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- MCQOWYALZVKMAR-UHFFFAOYSA-N furo[3,4-b]pyridine-5,7-dione Chemical compound C1=CC=C2C(=O)OC(=O)C2=N1 MCQOWYALZVKMAR-UHFFFAOYSA-N 0.000 description 1
- KFKMGUPDWTWQFM-UHFFFAOYSA-N furo[3,4-c]pyridine-1,3-dione Chemical compound N1=CC=C2C(=O)OC(=O)C2=C1 KFKMGUPDWTWQFM-UHFFFAOYSA-N 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 229910052621 halloysite Inorganic materials 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical group 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 229940107698 malachite green Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- FPROORYZXUAKDP-UHFFFAOYSA-N n,n-diethyl-4-(3-methylbut-1-enyl)aniline Chemical group CCN(CC)C1=CC=C(C=CC(C)C)C=C1 FPROORYZXUAKDP-UHFFFAOYSA-N 0.000 description 1
- XGHHHPDRXLIMPM-UHFFFAOYSA-N n,n-dimethyl-4-(2-phenylethenyl)aniline Chemical group C1=CC(N(C)C)=CC=C1C=CC1=CC=CC=C1 XGHHHPDRXLIMPM-UHFFFAOYSA-N 0.000 description 1
- NINOYJQVULROET-UHFFFAOYSA-N n,n-dimethylethenamine Chemical group CN(C)C=C NINOYJQVULROET-UHFFFAOYSA-N 0.000 description 1
- UNBPFPUTIKOOOI-UHFFFAOYSA-N oxane-2,4,6-trione Chemical compound O=C1CC(=O)OC(=O)C1 UNBPFPUTIKOOOI-UHFFFAOYSA-N 0.000 description 1
- CXFCLPSGBUBGMM-UHFFFAOYSA-N pentyl 2-[4-[bis(3-methylbutyl)amino]phenyl]prop-2-enoate Chemical group CCCCCOC(=O)C(=C)C1=CC=C(N(CCC(C)C)CCC(C)C)C=C1 CXFCLPSGBUBGMM-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
- C07D313/16—Eight-membered rings
- C07D313/20—Eight-membered rings condensed with carbocyclic rings or ring systems
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
- B41M5/145—Organic colour formers, e.g. leuco dyes with a lactone or lactam ring
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/323—Organic colour formers, e.g. leuco dyes
- B41M5/327—Organic colour formers, e.g. leuco dyes with a lactone or lactam ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/36—Oxygen atoms in position 3, e.g. adrenochrome
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
- C07D307/88—Benzo [c] furans; Hydrogenated benzo [c] furans with one oxygen atom directly attached in position 1 or 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/92—Naphthofurans; Hydrogenated naphthofurans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Color Printing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/566,852 US4022771A (en) | 1975-04-10 | 1975-04-10 | Aminophenyl lactone compounds containing an ethyleno group |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS51121037A JPS51121037A (en) | 1976-10-22 |
| JPS5827825B2 true JPS5827825B2 (ja) | 1983-06-11 |
Family
ID=24264661
Family Applications (6)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP51005388A Expired JPS5827825B2 (ja) | 1975-04-10 | 1976-01-20 | ビニル含有呈色性化合物 |
| JP1767980A Pending JPS55115448A (en) | 1975-04-10 | 1980-02-15 | Vinyl comtaining color developable compound |
| JP1768080A Pending JPS55115449A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768380A Pending JPS55115452A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768180A Pending JPS55115450A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768280A Pending JPS55115451A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
Family Applications After (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP1767980A Pending JPS55115448A (en) | 1975-04-10 | 1980-02-15 | Vinyl comtaining color developable compound |
| JP1768080A Pending JPS55115449A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768380A Pending JPS55115452A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768180A Pending JPS55115450A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
| JP1768280A Pending JPS55115451A (en) | 1975-04-10 | 1980-02-15 | Vinyl containing color developable compound |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4022771A (enExample) |
| JP (6) | JPS5827825B2 (enExample) |
| CA (1) | CA1055941A (enExample) |
| CH (1) | CH623318A5 (enExample) |
| DE (1) | DE2615024C2 (enExample) |
| FR (1) | FR2306987A1 (enExample) |
| GB (1) | GB1492913A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0757287A1 (en) | 1995-07-19 | 1997-02-05 | Fuji Photo Film Co., Ltd. | Image formation method |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4020056A (en) * | 1975-04-10 | 1977-04-26 | Ncr Corporation | Di-vinyl phthalides color formers |
| JPS5212019A (en) * | 1975-07-16 | 1977-01-29 | Yamamoto Kagaku Gosei Kk | Recording materials |
| US4189171A (en) * | 1977-03-01 | 1980-02-19 | Sterling Drug Inc. | Marking systems containing 3-aryl-3-heterylphthalides and 3,3-bis(heteryl)phthalides |
| JPS57167979A (en) * | 1981-04-08 | 1982-10-16 | Kanzaki Paper Mfg Co Ltd | Phthalide derivative, its preparation, recording material using it |
| EP0062544B1 (en) * | 1981-04-08 | 1987-09-30 | Kanzaki Paper Manufacturing Company Limited | New phthalide derivatives, process for preparing the same and recording system utilizing the same as colourless chromogenic material |
| JPS60224582A (ja) * | 1984-04-20 | 1985-11-08 | Yamada Kagaku Kogyo Kk | 発色性記録材料 |
| US4730057A (en) * | 1985-01-17 | 1988-03-08 | Kanzaki Paper Manufacturing Co., Ltd. | Phthalide derivatives useful as colorless chromogenic material |
| US4761396A (en) * | 1986-02-12 | 1988-08-02 | Kanzaki Paper Manufacturing Co., Ltd. | Heat-sensitive recording material |
| US4814320A (en) * | 1986-04-15 | 1989-03-21 | Yamada Chemical Co., Ltd. | Heat-sensitive recording material |
| US4808567A (en) * | 1986-04-15 | 1989-02-28 | Yamada Chemical Co., Ltd. | Divinyl compounds and chromogenic recording-material prepared by using thereof |
| US4826806A (en) * | 1986-07-31 | 1989-05-02 | Shin Nisso Kako Co., Ltd. | Fluoran compounds and color forming recording materials using same |
| DE3727201C1 (de) * | 1986-08-14 | 1988-03-10 | Ricoh Kk | Faerbende Phthalid-Verbindungen und diese als faerbenden Bestandteil enthaltende Aufzeichnungsmaterialien |
| JPH0776303B2 (ja) * | 1986-11-21 | 1995-08-16 | 株式会社リコー | 呈色性フタリド化合物及びその製造法及びこのものを発色成分とした記録材料 |
| US4977131A (en) * | 1988-05-24 | 1990-12-11 | Moore Business Forms, Inc. | OCR scannable carbonless copying system and a method of producing OCR scannable images therewith |
| US4985345A (en) * | 1989-02-02 | 1991-01-15 | Ricoh Company, Ltd. | Recording material |
| US4996328A (en) * | 1989-03-08 | 1991-02-26 | Appleton Papers Inc. | Bis-(indolyl)ethylenes |
| US5116978A (en) * | 1989-03-08 | 1992-05-26 | Appleton Papers Inc. | Process for bis(indolyl)ethylene synthesis |
| US5039821A (en) * | 1989-08-23 | 1991-08-13 | Appleton Papers Inc. | Process for producing di[bis-(indolyl)ethylenyl]tetrahalophthalides |
| DE59009797D1 (de) * | 1990-01-11 | 1995-11-23 | Ciba Geigy Ag | Pyrrolin- bzw. indolinhaltige Phthalide. |
| US5200519A (en) * | 1992-01-03 | 1993-04-06 | Appleton Papers Inc. | Mono(indolylethylenyl)phthalides |
| US5218127A (en) * | 1992-01-03 | 1993-06-08 | Appleton Papers Inc. | Method of preparing mono (indolylethylenyl) phthalides |
| DE69332794T2 (de) * | 1992-07-31 | 2004-01-29 | Yamamoto Chemicals Inc | Phthalide Verbindungen und damit hergestelltes Aufzeichnungsmaterial |
| JP3271226B2 (ja) * | 1994-01-25 | 2002-04-02 | 山本化成株式会社 | フタリド化合物、およびこれを用いる近赤外線吸収剤並びに記録材料 |
| EP1413925A3 (en) * | 2002-10-23 | 2004-08-25 | Konica Minolta Holdings, Inc. | Photosensitive composition and photosensitive lithographic printing plate |
| US8053494B2 (en) * | 2003-10-06 | 2011-11-08 | Nocopi Technologies, Inc. | Invisible ink and scratch pad |
| US20050165131A1 (en) * | 2003-10-06 | 2005-07-28 | Terry Stovold | Invisible ink |
| WO2005037905A1 (en) * | 2003-10-06 | 2005-04-28 | Nocopi Technologies, Inc. | Invisible ink |
| ITMI20050744A1 (it) * | 2005-04-26 | 2006-10-27 | Gruppo Cordenons Spa | Materiale cartaceo patinato autenticabile in particolare per etichettatura e confezionamento e relativo procedimento di fabbricazione |
| JP4761060B2 (ja) * | 2006-06-14 | 2011-08-31 | 北川工業株式会社 | 導電防振ブッシュ |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2505488A (en) * | 1944-01-31 | 1950-04-25 | Ncr Co | Process of making pressure sensitive record material |
| US3491112A (en) * | 1967-01-30 | 1970-01-20 | Ncr Co | 3-(phenyl)-3-(heterocyclic-substituted)-phthalides |
| US3594369A (en) * | 1969-01-21 | 1971-07-20 | Ncr Co | 3,5(6)-disubstituted-3-(para-diloweralkyl-aminophenyl) phthalides |
| DE2259409C2 (de) * | 1971-12-06 | 1985-10-10 | Appleton Papers Inc., Appleton, Wis. | Chromogene Furo[3,4-b]pyridin-7-one und -pyrazin-5-one |
| US3804855A (en) * | 1972-03-22 | 1974-04-16 | Ncr | Naphthalide compounds |
| JPS517575B2 (enExample) * | 1973-03-23 | 1976-03-09 | ||
| JPS5031917A (enExample) * | 1973-07-24 | 1975-03-28 | ||
| US4020068A (en) * | 1974-05-08 | 1977-04-26 | Ncr Corporation | Chromogenic furoquinoxalines |
| US3928685A (en) * | 1974-11-21 | 1975-12-23 | Moore Business Forms Inc | 1-Hydroxy-1-(4-aminophenyl polymethine) naphthalan compounds and pressure-sensitive recording system therewith |
-
1975
- 1975-04-10 US US05/566,852 patent/US4022771A/en not_active Expired - Lifetime
- 1975-11-03 CA CA238,869A patent/CA1055941A/en not_active Expired
-
1976
- 1976-01-20 JP JP51005388A patent/JPS5827825B2/ja not_active Expired
- 1976-03-15 GB GB10239/76A patent/GB1492913A/en not_active Expired
- 1976-04-07 DE DE2615024A patent/DE2615024C2/de not_active Expired
- 1976-04-09 FR FR7610423A patent/FR2306987A1/fr active Granted
- 1976-04-12 CH CH452376A patent/CH623318A5/de not_active IP Right Cessation
-
1977
- 1977-04-25 US US05/790,627 patent/US4119776A/en not_active Expired - Lifetime
-
1980
- 1980-02-15 JP JP1767980A patent/JPS55115448A/ja active Pending
- 1980-02-15 JP JP1768080A patent/JPS55115449A/ja active Pending
- 1980-02-15 JP JP1768380A patent/JPS55115452A/ja active Pending
- 1980-02-15 JP JP1768180A patent/JPS55115450A/ja active Pending
- 1980-02-15 JP JP1768280A patent/JPS55115451A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0757287A1 (en) | 1995-07-19 | 1997-02-05 | Fuji Photo Film Co., Ltd. | Image formation method |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS55115449A (en) | 1980-09-05 |
| DE2615024C2 (de) | 1986-06-05 |
| JPS55115448A (en) | 1980-09-05 |
| CH623318A5 (enExample) | 1981-05-29 |
| GB1492913A (en) | 1977-11-23 |
| US4022771A (en) | 1977-05-10 |
| FR2306987B1 (enExample) | 1978-12-08 |
| JPS55115452A (en) | 1980-09-05 |
| DE2615024A1 (de) | 1976-10-21 |
| JPS55115451A (en) | 1980-09-05 |
| JPS55115450A (en) | 1980-09-05 |
| CA1055941A (en) | 1979-06-05 |
| JPS51121037A (en) | 1976-10-22 |
| FR2306987A1 (fr) | 1976-11-05 |
| US4119776A (en) | 1978-10-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5827825B2 (ja) | ビニル含有呈色性化合物 | |
| JPS585940B2 (ja) | ジビニル含有呈色性化合物 | |
| CA1055943A (en) | Benzoindole phthalides | |
| US4062866A (en) | 3-Indolyl-3-phenyl-phthalides | |
| US4189171A (en) | Marking systems containing 3-aryl-3-heterylphthalides and 3,3-bis(heteryl)phthalides | |
| US4020068A (en) | Chromogenic furoquinoxalines | |
| US4695636A (en) | Chromogenic dihydrofuropyridinones | |
| JPS598302B2 (ja) | フクソカンシキチカンラクトンカゴウブツノセイホウ | |
| CA1072963A (en) | Derivatives of dianhydrides as vinyl color formers | |
| US4316036A (en) | Benzopyranothiazoles | |
| US4876357A (en) | Chromogenic phthalides and azaphthalides | |
| US4100169A (en) | Thiazolylphthalide compounds | |
| JPS6112952B2 (enExample) | ||
| US4503227A (en) | Chromogenic dihydroquinazolines | |
| US4251446A (en) | Phthalide compounds, processes and marking systems | |
| US4668966A (en) | Aliphatic bridged chromogenic bisquinazolines substituted with phenylamine or phenyl-containing heterobicyclic radicals | |
| IE45772B1 (en) | Process for preparing phthalide color-formers and novel substituted 5-aminobenzoic acid derivatives | |
| US4970308A (en) | Di(bis-(indolyl)ethylenyl)tetrahalophtalides | |
| US5157012A (en) | Di[bis-(indolyl)ethylenyl]tetrahalophthalide record materials | |
| US4555569A (en) | Chromogenic quinazolines | |
| US3896116A (en) | Lactone compounds derived from pyridine-carboxylic acids and process for preparing the same | |
| US4322352A (en) | Indolyl phthalide compounds | |
| US5200519A (en) | Mono(indolylethylenyl)phthalides | |
| US5039821A (en) | Process for producing di[bis-(indolyl)ethylenyl]tetrahalophthalides | |
| US4732991A (en) | Substituted phthalides |