JPS5798249A - Ester compound - Google Patents
Ester compoundInfo
- Publication number
- JPS5798249A JPS5798249A JP17416980A JP17416980A JPS5798249A JP S5798249 A JPS5798249 A JP S5798249A JP 17416980 A JP17416980 A JP 17416980A JP 17416980 A JP17416980 A JP 17416980A JP S5798249 A JPS5798249 A JP S5798249A
- Authority
- JP
- Japan
- Prior art keywords
- liquid crystal
- alkylcyclohexane
- trans
- give
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 Ester compound Chemical class 0.000 title 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000003054 catalyst Substances 0.000 abstract 1
- 239000004615 ingredient Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17416980A JPS5798249A (en) | 1980-12-10 | 1980-12-10 | Ester compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17416980A JPS5798249A (en) | 1980-12-10 | 1980-12-10 | Ester compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5798249A true JPS5798249A (en) | 1982-06-18 |
| JPS6364421B2 JPS6364421B2 (cg-RX-API-DMAC7.html) | 1988-12-12 |
Family
ID=15973906
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP17416980A Granted JPS5798249A (en) | 1980-12-10 | 1980-12-10 | Ester compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5798249A (cg-RX-API-DMAC7.html) |
-
1980
- 1980-12-10 JP JP17416980A patent/JPS5798249A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6364421B2 (cg-RX-API-DMAC7.html) | 1988-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57118526A (en) | Dicyclohexylethane derivative | |
| JPS5798249A (en) | Ester compound | |
| JPS5795953A (en) | Ester compound | |
| JPS56110777A (en) | Ester derivative of 4-fluorobenzoic acid | |
| JPS5616447A (en) | Ester compound | |
| JPS5616457A (en) | Ester compound | |
| JPS5683449A (en) | Cyclohexanecarboxylic acid cyclohexyl ester derivative | |
| JPS559012A (en) | Liquid crystal compound | |
| JPS57108056A (en) | 4'-(alkyloxymethyl)-4-cyanobiphenyl | |
| JPS54134087A (en) | Liquid crystal composition | |
| JPS57116039A (en) | Liquid crystal compound | |
| JPS5764689A (en) | Substituted biphenylyldioxane | |
| JPS56122333A (en) | Ester compound | |
| JPS57142955A (en) | Liquid crystal additive having high positive dielectric anisotropic value | |
| JPS57188545A (en) | Trans-4-alkylcyclohexane carboxylic acid methyl- substituted-4-chlorophenyl ester | |
| JPS5798248A (en) | Diester compound | |
| JPS5732260A (en) | Mercaptofatty acid derivative and its preparation | |
| JPS5782347A (en) | Ester compound | |
| JPS5616458A (en) | Ester compound | |
| JPS5572156A (en) | 3-butoxy-6-cyclohexanecarboxy-phthalonitriles | |
| JPS57159753A (en) | Liquid crystal compound | |
| JPS56156249A (en) | Liquid crystal ester compound and its preparation | |
| JPS574927A (en) | 4'-substituted-1'-cyclohexen-1'-yl-4-fluorobenzene | |
| JPS5585568A (en) | Quinolinone-imine derivative and its preparation | |
| JPS54160350A (en) | Ester compound |