JPS5795953A - Ester compound - Google Patents
Ester compoundInfo
- Publication number
- JPS5795953A JPS5795953A JP17113380A JP17113380A JPS5795953A JP S5795953 A JPS5795953 A JP S5795953A JP 17113380 A JP17113380 A JP 17113380A JP 17113380 A JP17113380 A JP 17113380A JP S5795953 A JPS5795953 A JP S5795953A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- compound
- formulai
- trans
- give
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- -1 Ester compound Chemical class 0.000 title abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 4
- 239000000463 material Substances 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 239000003054 catalyst Substances 0.000 abstract 1
- 239000004973 liquid crystal related substance Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17113380A JPS5795953A (en) | 1980-12-04 | 1980-12-04 | Ester compound |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP17113380A JPS5795953A (en) | 1980-12-04 | 1980-12-04 | Ester compound |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5795953A true JPS5795953A (en) | 1982-06-15 |
| JPS643183B2 JPS643183B2 (cg-RX-API-DMAC7.html) | 1989-01-19 |
Family
ID=15917588
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP17113380A Granted JPS5795953A (en) | 1980-12-04 | 1980-12-04 | Ester compound |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5795953A (cg-RX-API-DMAC7.html) |
-
1980
- 1980-12-04 JP JP17113380A patent/JPS5795953A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS643183B2 (cg-RX-API-DMAC7.html) | 1989-01-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS57118526A (en) | Dicyclohexylethane derivative | |
| JPS5795953A (en) | Ester compound | |
| JPS54125632A (en) | Novel salicylic acid derivative | |
| JPS5521429A (en) | Liquid crystal composition | |
| JPS5576852A (en) | Novel derivative of anthranilic acid | |
| JPS5798249A (en) | Ester compound | |
| JPS5683449A (en) | Cyclohexanecarboxylic acid cyclohexyl ester derivative | |
| JPS5589245A (en) | 9,10-dihydroanthracene-2-alkanoic acid derivative | |
| JPS56110777A (en) | Ester derivative of 4-fluorobenzoic acid | |
| JPS577457A (en) | Ester | |
| JPS5616447A (en) | Ester compound | |
| JPS5616457A (en) | Ester compound | |
| JPS57116039A (en) | Liquid crystal compound | |
| JPS56122333A (en) | Ester compound | |
| JPS5732260A (en) | Mercaptofatty acid derivative and its preparation | |
| JPS54134087A (en) | Liquid crystal composition | |
| JPS55102548A (en) | Nitrosamine derivative | |
| JPS5764689A (en) | Substituted biphenylyldioxane | |
| JPS57114549A (en) | Preparation of cyclopentenediol monoester | |
| JPS57188545A (en) | Trans-4-alkylcyclohexane carboxylic acid methyl- substituted-4-chlorophenyl ester | |
| JPS5585568A (en) | Quinolinone-imine derivative and its preparation | |
| JPS56123939A (en) | Novel (meth)acrylic acid ester | |
| JPS5283714A (en) | Novel alkyl ester derivatives of 16-alkyl-20-alkoxyprostadienoic acids | |
| JPS5782347A (en) | Ester compound | |
| JPS5785343A (en) | Trans-4-alkylcyclohexanecarboxylic 3'-fluoro-4'- alkoxyphenyl ester |