JPS55162758A - Novel phenylacetamide derivative - Google Patents
Novel phenylacetamide derivativeInfo
- Publication number
- JPS55162758A JPS55162758A JP3992179A JP3992179A JPS55162758A JP S55162758 A JPS55162758 A JP S55162758A JP 3992179 A JP3992179 A JP 3992179A JP 3992179 A JP3992179 A JP 3992179A JP S55162758 A JPS55162758 A JP S55162758A
- Authority
- JP
- Japan
- Prior art keywords
- formula
- group
- compound
- ethyl
- phenylacetamide derivative
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical class NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 title abstract 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 abstract 2
- 206010012335 Dependence Diseases 0.000 abstract 1
- -1 N-2-( 4-Hydroxyphenyl )ethyl-N-2-( N-methyl-N-cyclopropylmethyl- amino)ethyl-4-methoxyphenylacetamide Chemical compound 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 230000000202 analgesic effect Effects 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 239000003874 central nervous system depressant Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract 1
Landscapes
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3992179A JPS55162758A (en) | 1979-04-02 | 1979-04-02 | Novel phenylacetamide derivative |
| EP80300817A EP0017376A1 (en) | 1979-03-30 | 1980-03-18 | Phenylacetamide compounds and an analgesic composition containing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3992179A JPS55162758A (en) | 1979-04-02 | 1979-04-02 | Novel phenylacetamide derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS55162758A true JPS55162758A (en) | 1980-12-18 |
| JPS6155496B2 JPS6155496B2 (enrdf_load_stackoverflow) | 1986-11-28 |
Family
ID=12566392
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP3992179A Granted JPS55162758A (en) | 1979-03-30 | 1979-04-02 | Novel phenylacetamide derivative |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS55162758A (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7144912B2 (en) | 2001-07-18 | 2006-12-05 | Gemin X Biotechnologies Inc. | Pyrrole-type compounds, compositions, and methods for treating cancer, treating viral diseases and causing immunosuppression |
| US11944555B2 (en) | 2018-01-05 | 2024-04-02 | Otto Bock Healthcare Products Gmbh | Gripping device |
-
1979
- 1979-04-02 JP JP3992179A patent/JPS55162758A/ja active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7144912B2 (en) | 2001-07-18 | 2006-12-05 | Gemin X Biotechnologies Inc. | Pyrrole-type compounds, compositions, and methods for treating cancer, treating viral diseases and causing immunosuppression |
| US11944555B2 (en) | 2018-01-05 | 2024-04-02 | Otto Bock Healthcare Products Gmbh | Gripping device |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6155496B2 (enrdf_load_stackoverflow) | 1986-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5692272A (en) | N-pyridylaniline compound, its preparation and control agent against injurious organisms containing the same | |
| JPS5490195A (en) | Novel benzodiazepine compound | |
| JPS56131565A (en) | 4-substituted-2-oxoazetidine compound and its preparation | |
| JPS55129256A (en) | Antifungal compound | |
| JPS57165387A (en) | Prparation of fluoran derivative | |
| JPS55162758A (en) | Novel phenylacetamide derivative | |
| JPS552602A (en) | 1-beta-d-arabinofranosylcytosine-5'-phosphoric acid oleyl ester | |
| JPS55130949A (en) | Novel phenylacetamide derivative | |
| JPS55124777A (en) | Novel dibenzoxepin derivative and its preparation | |
| JPS55118494A (en) | Novel phosphorylcholine compound, its preparation, and antitumor agent comprising it | |
| JPS5745193A (en) | Organic phosphoric ester, its preparation and insecticide, acaricide or nematocide containing the same | |
| JPS54138533A (en) | Novel choline derivative | |
| JPS5655383A (en) | Amizine derivative and its preparation | |
| JPS574974A (en) | Carbostyril derivative | |
| JPS56164157A (en) | Novel-alpha-oxyphenylacetamide derivative | |
| JPS5655371A (en) | Quinoline derivative | |
| JPS5359656A (en) | Silacyclopropene derivatives and process for preparation of the same | |
| JPS57126457A (en) | Novel benzanilide derivative | |
| JPS5661330A (en) | 2-methoxy-4-alkoxycarbonyl-5-halobenzoyl chloride and its preparation | |
| JPS5661365A (en) | Dimethoxyphthalazinone derivative and its preparation | |
| JPS5690070A (en) | Novel pyrimidine derivative | |
| JPS5585568A (en) | Quinolinone-imine derivative and its preparation | |
| JPS567762A (en) | Acylated indole derivative, its preparation, and platelet coagulation inhibiting agent containing the same | |
| JPS56131576A (en) | Novel phenylacetamide derivative | |
| JPS5479297A (en) | Pyrazoquinoline |