JPS5448770A - 5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the same - Google Patents
5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the sameInfo
- Publication number
- JPS5448770A JPS5448770A JP11501377A JP11501377A JPS5448770A JP S5448770 A JPS5448770 A JP S5448770A JP 11501377 A JP11501377 A JP 11501377A JP 11501377 A JP11501377 A JP 11501377A JP S5448770 A JPS5448770 A JP S5448770A
- Authority
- JP
- Japan
- Prior art keywords
- compound
- acid ester
- preparation
- same
- hypotensive agent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000002220 antihypertensive agent Substances 0.000 title abstract 2
- 150000002148 esters Chemical class 0.000 title abstract 2
- 239000002253 acid Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 3
- -1 alkoxyaikyl Chemical group 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 2
- XXOUHKWIQVEQIH-UHFFFAOYSA-N 5-butoxypyridine-2-carboxylic acid Chemical compound CCCCOC1=CC=C(C(O)=O)N=C1 XXOUHKWIQVEQIH-UHFFFAOYSA-N 0.000 abstract 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000005633 phthalidyl group Chemical group 0.000 abstract 1
- 229940081066 picolinic acid Drugs 0.000 abstract 1
- 230000001988 toxicity Effects 0.000 abstract 1
- 231100000419 toxicity Toxicity 0.000 abstract 1
Landscapes
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11501377A JPS5448770A (en) | 1977-09-24 | 1977-09-24 | 5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the same |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP11501377A JPS5448770A (en) | 1977-09-24 | 1977-09-24 | 5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS5448770A true JPS5448770A (en) | 1979-04-17 |
| JPS6134422B2 JPS6134422B2 (enExample) | 1986-08-07 |
Family
ID=14652096
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP11501377A Granted JPS5448770A (en) | 1977-09-24 | 1977-09-24 | 5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the same |
Country Status (1)
| Country | Link |
|---|---|
| JP (1) | JPS5448770A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53149121U (enExample) * | 1978-03-15 | 1978-11-24 |
-
1977
- 1977-09-24 JP JP11501377A patent/JPS5448770A/ja active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53149121U (enExample) * | 1978-03-15 | 1978-11-24 |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6134422B2 (enExample) | 1986-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS5432460A (en) | Cycloalkylidenemethylphenylacetic acid derivative and their preparation | |
| JPS57116074A (en) | Novel camptothecin derivative and its preparation | |
| JPS5448770A (en) | 5-alkoxypicolinic acid ester, its preparation and hypotensive agent containing the same | |
| JPS53135958A (en) | Substituted phenylacetic acid derivatives and their preparation | |
| JPS51118772A (en) | Method for preparing carbostyryl derivatives | |
| JPS57130950A (en) | 3,5-di-tert-butyl-4-hydroxystyrene derivative and anti- inflammatory, analgesic, antipyretic agent and inhibitor for blood platelet aggregation | |
| JPS5424882A (en) | Novel heterocyclic compounds and their preparation | |
| JPS53119819A (en) | Substituted iso-valerianic acid and its ester | |
| JPS5732260A (en) | Mercaptofatty acid derivative and its preparation | |
| JPS5767578A (en) | N-phthtalidy-5-fluorouracil derivative | |
| JPS5716856A (en) | 4-guanidinomethylcyclohexanecarboxylic acid ester and its preparation | |
| JPS5387370A (en) | Preparation of penicillamine derivative | |
| JPS5344575A (en) | Preparation of hydantoin derivatives | |
| JPS52118445A (en) | 2-cyano-3-methyl-3-(4-isobutylphenyl)acrylic acid derivatives and met hod of preparing the same | |
| JPS5430179A (en) | Carbostyril derivative | |
| JPS5283672A (en) | Novel 2-amino-1,4-dihydropyridine derivatives | |
| JPS5625166A (en) | 5-fluorouracil derivative | |
| JPS57144254A (en) | 2-substituted-2-oxoazetidine derivative and its preparation | |
| JPS5432491A (en) | Cyclicthio-or dithiophosphoric acid esters, their preparation, and her- bicides | |
| JPS5262295A (en) | Preparation of n1-oxy-2-thioadenosines | |
| JPS5353647A (en) | 7-oxo-6-azabicyclo 3,2,1 oct-2-ene-2,8-dicarboxylic acid derivatives, theirmolecular compounds and preparation | |
| JPS57192396A (en) | O-arylphosphoric ester having nitrogen-containing heterocyclic group, its preparation and insecticide containing the same | |
| JPS5441849A (en) | Novel cyclopentane derivative | |
| JPS5387382A (en) | Novel cyclopropylmethylamine derivative and its preparation | |
| JPS5444696A (en) | Condensed isoxazole compound and its preparation |