JPH06211849A - タンパク質分解酵素阻害剤として有用な新規なアリールカルボン酸2−サッカリニルメチル類、その組成物および使用方法 - Google Patents
タンパク質分解酵素阻害剤として有用な新規なアリールカルボン酸2−サッカリニルメチル類、その組成物および使用方法Info
- Publication number
- JPH06211849A JPH06211849A JP5231485A JP23148593A JPH06211849A JP H06211849 A JPH06211849 A JP H06211849A JP 5231485 A JP5231485 A JP 5231485A JP 23148593 A JP23148593 A JP 23148593A JP H06211849 A JPH06211849 A JP H06211849A
- Authority
- JP
- Japan
- Prior art keywords
- lower alkyl
- alkyl
- alkylene
- acid
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 2-saccharinylmethyl Chemical group 0.000 title claims abstract description 263
- 239000000203 mixture Substances 0.000 title claims abstract description 168
- VVBXXVAFSPEIJQ-CVIPOMFBSA-N [(2r)-3-[[(2r)-1-[[(2s,5r,8r,11r,12s,15s,18s,21s)-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-5-[(4-hydroxyphenyl)methyl]-4,11-dimethyl-2-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]am Chemical compound C([C@@H]1C(=O)N[C@@H](C(=O)O[C@H](C)[C@@H](C(N[C@@H](CCCN=C(N)N)C(=O)N[C@H]2CC[C@H](O)N(C2=O)[C@@H](CC(C)C)C(=O)N1C)=O)NC(=O)[C@H](NC(=O)[C@H](O)COS(O)(=O)=O)CC(C)C)C(C)C)C1=CC=C(O)C=C1 VVBXXVAFSPEIJQ-CVIPOMFBSA-N 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 112
- 150000001875 compounds Chemical class 0.000 claims abstract description 96
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 66
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 57
- 150000003839 salts Chemical class 0.000 claims abstract description 49
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 41
- 239000001257 hydrogen Substances 0.000 claims abstract description 40
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 35
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 19
- 150000002367 halogens Chemical class 0.000 claims abstract description 18
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 16
- 125000001424 substituent group Chemical group 0.000 claims abstract description 16
- 208000015122 neurodegenerative disease Diseases 0.000 claims abstract description 12
- 102000035195 Peptidases Human genes 0.000 claims abstract description 11
- 108091005804 Peptidases Proteins 0.000 claims abstract description 11
- 230000002401 inhibitory effect Effects 0.000 claims abstract description 11
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims abstract description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims abstract description 5
- 229940081974 saccharin Drugs 0.000 claims description 101
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 claims description 101
- 235000019204 saccharin Nutrition 0.000 claims description 100
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 claims description 90
- 239000002253 acid Substances 0.000 claims description 85
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 55
- 125000002947 alkylene group Chemical group 0.000 claims description 49
- 239000000460 chlorine Substances 0.000 claims description 46
- 125000003282 alkyl amino group Chemical group 0.000 claims description 45
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 38
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 30
- 238000004519 manufacturing process Methods 0.000 claims description 30
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 29
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 22
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 21
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 20
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 19
- 229920006395 saturated elastomer Polymers 0.000 claims description 19
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 14
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 13
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000003857 carboxamides Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- 241001024304 Mino Species 0.000 claims description 4
- 125000002393 azetidinyl group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 claims description 3
- HVONUXAIYMDLJA-UHFFFAOYSA-N 2-[[2-[(2,6-dichlorobenzoyl)oxymethyl]-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl]oxy]acetic acid Chemical compound CC(C)C1=CC(OCC(O)=O)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC=C1Cl HVONUXAIYMDLJA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 2
- 150000001241 acetals Chemical class 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229940079593 drug Drugs 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- DNFRRBSJLDTJHB-UHFFFAOYSA-N (6-methoxy-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-2-yl)methyl benzoate Chemical compound CC(C)C1=CC(OC)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=CC=CC=C1 DNFRRBSJLDTJHB-UHFFFAOYSA-N 0.000 claims 1
- 150000001336 alkenes Chemical class 0.000 claims 1
- 125000000000 cycloalkoxy group Chemical group 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 claims 1
- 229920006389 polyphenyl polymer Polymers 0.000 claims 1
- 102000004190 Enzymes Human genes 0.000 abstract description 13
- 108090000790 Enzymes Proteins 0.000 abstract description 13
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 abstract description 4
- 230000002255 enzymatic effect Effects 0.000 abstract description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 281
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 194
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 167
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 166
- 239000000243 solution Substances 0.000 description 161
- 238000002360 preparation method Methods 0.000 description 139
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 132
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 121
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 106
- 235000019439 ethyl acetate Nutrition 0.000 description 95
- 238000000034 method Methods 0.000 description 92
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 90
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 90
- 239000002904 solvent Substances 0.000 description 84
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 82
- 238000006243 chemical reaction Methods 0.000 description 77
- 239000011541 reaction mixture Substances 0.000 description 69
- 239000007787 solid Substances 0.000 description 68
- 239000000047 product Substances 0.000 description 62
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 60
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 60
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 59
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- 239000003921 oil Substances 0.000 description 51
- 235000019198 oils Nutrition 0.000 description 50
- 229960000583 acetic acid Drugs 0.000 description 46
- 239000012044 organic layer Substances 0.000 description 44
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 40
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 40
- 238000003756 stirring Methods 0.000 description 37
- 239000012267 brine Substances 0.000 description 36
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 36
- 238000010992 reflux Methods 0.000 description 30
- MRUDNSFOFOQZDA-UHFFFAOYSA-N 2,6-dichlorobenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC=C1Cl MRUDNSFOFOQZDA-UHFFFAOYSA-N 0.000 description 28
- 239000012362 glacial acetic acid Substances 0.000 description 27
- 238000004440 column chromatography Methods 0.000 description 26
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 26
- 239000000377 silicon dioxide Substances 0.000 description 26
- VVPUIKNICYCXJZ-UHFFFAOYSA-N 4-iodobutyl benzoate Chemical compound ICCCCOC(=O)C1=CC=CC=C1 VVPUIKNICYCXJZ-UHFFFAOYSA-N 0.000 description 25
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 25
- 239000000706 filtrate Substances 0.000 description 25
- 239000011734 sodium Substances 0.000 description 25
- 239000002585 base Substances 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 24
- 229910002027 silica gel Inorganic materials 0.000 description 24
- 239000012299 nitrogen atmosphere Substances 0.000 description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 22
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 22
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 20
- 239000000126 substance Substances 0.000 description 20
- 238000001914 filtration Methods 0.000 description 19
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 18
- 229910052783 alkali metal Inorganic materials 0.000 description 18
- 239000000284 extract Substances 0.000 description 18
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 18
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 17
- 239000003054 catalyst Substances 0.000 description 17
- 239000010410 layer Substances 0.000 description 17
- 229910003002 lithium salt Inorganic materials 0.000 description 17
- 159000000002 lithium salts Chemical class 0.000 description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 230000003197 catalytic effect Effects 0.000 description 15
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 15
- 230000002829 reductive effect Effects 0.000 description 14
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 13
- 239000005457 ice water Substances 0.000 description 13
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000005711 Benzoic acid Substances 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 229940088598 enzyme Drugs 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- 235000011181 potassium carbonates Nutrition 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 11
- 239000012298 atmosphere Substances 0.000 description 11
- 239000003960 organic solvent Substances 0.000 description 11
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 10
- 235000010233 benzoic acid Nutrition 0.000 description 10
- 238000004587 chromatography analysis Methods 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 10
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Chemical compound CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 10
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 10
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 9
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 9
- 102100033174 Neutrophil elastase Human genes 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 9
- 238000003818 flash chromatography Methods 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 8
- 229930040373 Paraformaldehyde Natural products 0.000 description 8
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 8
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 8
- 229910052744 lithium Inorganic materials 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 229920002866 paraformaldehyde Polymers 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- ZSWYICNLNOGISL-UHFFFAOYSA-N 1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CSC1=CC=CC=C1 ZSWYICNLNOGISL-UHFFFAOYSA-N 0.000 description 7
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 7
- 206010014561 Emphysema Diseases 0.000 description 7
- OIRKWBHWPWCPRK-UHFFFAOYSA-N ONO[Na] Chemical compound ONO[Na] OIRKWBHWPWCPRK-UHFFFAOYSA-N 0.000 description 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- 239000007864 aqueous solution Substances 0.000 description 7
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 229910052698 phosphorus Inorganic materials 0.000 description 7
- 239000011574 phosphorus Substances 0.000 description 7
- 238000007363 ring formation reaction Methods 0.000 description 7
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 7
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 6
- RFAHYFCQZDZXLP-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CCl)C(=O)C2=C1 RFAHYFCQZDZXLP-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 230000005764 inhibitory process Effects 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 6
- 150000003475 thallium Chemical class 0.000 description 6
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 6
- MRUDNSFOFOQZDA-UHFFFAOYSA-M 2,6-dichlorobenzoate Chemical compound [O-]C(=O)C1=C(Cl)C=CC=C1Cl MRUDNSFOFOQZDA-UHFFFAOYSA-M 0.000 description 5
- LWVDCUCGKCOXLT-UHFFFAOYSA-N 4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC2=C1C(=O)NS2(=O)=O LWVDCUCGKCOXLT-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- 101000856199 Homo sapiens Chymotrypsin-like protease CTRL-1 Proteins 0.000 description 5
- 102000012479 Serine Proteases Human genes 0.000 description 5
- 108010022999 Serine Proteases Proteins 0.000 description 5
- 150000003863 ammonium salts Chemical class 0.000 description 5
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000006264 debenzylation reaction Methods 0.000 description 5
- 239000012954 diazonium Substances 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 239000012259 ether extract Substances 0.000 description 5
- 238000007327 hydrogenolysis reaction Methods 0.000 description 5
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 5
- 229940095102 methyl benzoate Drugs 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 206010039073 rheumatoid arthritis Diseases 0.000 description 5
- ZTMWHBJKVKHBTO-UHFFFAOYSA-M sodium amino sulfate Chemical compound [Na+].NOS([O-])(=O)=O ZTMWHBJKVKHBTO-UHFFFAOYSA-M 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- RRURGOPYONTFSU-UHFFFAOYSA-N (6-hydroxy-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-2-yl)methyl 2,6-dichlorobenzoate Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC=C1Cl RRURGOPYONTFSU-UHFFFAOYSA-N 0.000 description 4
- ITNOKSZSFCACOE-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbonitrile Chemical compound N#CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 ITNOKSZSFCACOE-UHFFFAOYSA-N 0.000 description 4
- PUYQLJDNZIEPCV-UHFFFAOYSA-N 1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical compound S1(=O)(=O)NC(=O)C2CCCC=C12 PUYQLJDNZIEPCV-UHFFFAOYSA-N 0.000 description 4
- DVSLBDBGAXXLKZ-UHFFFAOYSA-N 2,3-diethylbenzamide Chemical compound CCC1=CC=CC(C(N)=O)=C1CC DVSLBDBGAXXLKZ-UHFFFAOYSA-N 0.000 description 4
- QBZUIAHJZRGHRJ-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC2=C1C(=O)NS2(=O)=O QBZUIAHJZRGHRJ-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- FFDGPVCHZBVARC-UHFFFAOYSA-N N,N-dimethylglycine Chemical compound CN(C)CC(O)=O FFDGPVCHZBVARC-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 206010033645 Pancreatitis Diseases 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 150000001340 alkali metals Chemical class 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 4
- 150000001720 carbohydrates Chemical class 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000001072 heteroaryl group Chemical group 0.000 description 4
- 230000002779 inactivation Effects 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 4
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- RJCIDWGLYRNGCB-UHFFFAOYSA-N (4-ethoxy-6-hydroxy-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 2,6-dichlorobenzoate Chemical compound CCOC1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC=C1Cl RJCIDWGLYRNGCB-UHFFFAOYSA-N 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- ITOKPILJWUVEPH-UHFFFAOYSA-N 2,4-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(OC)C(=O)C2=C1C=CC=C2OC ITOKPILJWUVEPH-UHFFFAOYSA-N 0.000 description 3
- BXQOWUSZAWCFIL-UHFFFAOYSA-N 2-benzyl-5-chloro-1,2-thiazol-3-one Chemical compound S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 BXQOWUSZAWCFIL-UHFFFAOYSA-N 0.000 description 3
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 3
- 206010006458 Bronchitis chronic Diseases 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 201000003883 Cystic fibrosis Diseases 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 3
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 3
- JLNGEXDJAQASHD-UHFFFAOYSA-N N,N-Diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1 JLNGEXDJAQASHD-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 206010034277 Pemphigoid Diseases 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- 201000004681 Psoriasis Diseases 0.000 description 3
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 125000000539 amino acid group Chemical group 0.000 description 3
- 239000011260 aqueous acid Substances 0.000 description 3
- JHVLLYQQQYIWKX-UHFFFAOYSA-N benzyl 2-bromoacetate Chemical compound BrCC(=O)OCC1=CC=CC=C1 JHVLLYQQQYIWKX-UHFFFAOYSA-N 0.000 description 3
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 3
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 3
- 206010006451 bronchitis Diseases 0.000 description 3
- 208000000594 bullous pemphigoid Diseases 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 208000007451 chronic bronchitis Diseases 0.000 description 3
- 108700003601 dimethylglycine Proteins 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 230000002849 elastaseinhibitory effect Effects 0.000 description 3
- 230000002901 elastaselike Effects 0.000 description 3
- DZFYOYRNBGNPJW-UHFFFAOYSA-N ethoxythallium Chemical compound [Tl+].CC[O-] DZFYOYRNBGNPJW-UHFFFAOYSA-N 0.000 description 3
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 3
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- OBWFJXLKRAFEDI-UHFFFAOYSA-N methyl cyanoformate Chemical compound COC(=O)C#N OBWFJXLKRAFEDI-UHFFFAOYSA-N 0.000 description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- BZXOURRFKYYAJK-UHFFFAOYSA-N (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl benzoate Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N1COC(=O)C1=CC=CC=C1 BZXOURRFKYYAJK-UHFFFAOYSA-N 0.000 description 2
- DJRCXWFCZRAPCO-UHFFFAOYSA-N (6-methoxy-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-2-yl)methyl 2,6-dichloro-3-hydroxybenzoate Chemical compound CC(C)C1=CC(OC)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC(O)=C1Cl DJRCXWFCZRAPCO-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- CXUAEBDTJFKMBV-UHFFFAOYSA-N 1-(chloromethyl)-2,3,4,5,6-pentamethylbenzene Chemical compound CC1=C(C)C(C)=C(CCl)C(C)=C1C CXUAEBDTJFKMBV-UHFFFAOYSA-N 0.000 description 2
- IFCXRNRLQRXPJP-UHFFFAOYSA-N 1-oxo-1-sulfanylidene-6-(trifluoromethyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)C1=CC=C2C(=O)NS(=O)(=S)C2=C1 IFCXRNRLQRXPJP-UHFFFAOYSA-N 0.000 description 2
- IBXNCJKFFQIKKY-UHFFFAOYSA-N 1-pentyne Chemical compound CCCC#C IBXNCJKFFQIKKY-UHFFFAOYSA-N 0.000 description 2
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 2
- RMVUIQANGFYPKL-UHFFFAOYSA-N 2,4-diethoxy-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCOC1=CC(OCC)=C(C(=O)N(CC)CC)C(S(N)(=O)=O)=C1 RMVUIQANGFYPKL-UHFFFAOYSA-N 0.000 description 2
- GPVDHNVGGIAOQT-UHFFFAOYSA-N 2,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(OC)=C1 GPVDHNVGGIAOQT-UHFFFAOYSA-N 0.000 description 2
- LHJFBVDNRPBOOW-UHFFFAOYSA-N 2,6-dichloro-3-hydroxybenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(O)=C1Cl LHJFBVDNRPBOOW-UHFFFAOYSA-N 0.000 description 2
- DRVSBKBRVIGXNR-UHFFFAOYSA-N 2-(chloromethyl)-4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O DRVSBKBRVIGXNR-UHFFFAOYSA-N 0.000 description 2
- PZWPTWZDBJUEMM-UHFFFAOYSA-N 2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical class C1=CC=C2S(=O)(=O)N(CO)C(=O)C2=C1 PZWPTWZDBJUEMM-UHFFFAOYSA-N 0.000 description 2
- QZHSLVWCHZTCPQ-UHFFFAOYSA-N 2-benzyl-5-chloro-1-oxo-1,2-thiazol-3-one Chemical compound O=S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 QZHSLVWCHZTCPQ-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- INDJCCHBFRVERC-UHFFFAOYSA-N 2-ethenyl-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C=C)C=CC=C1S(N)(=O)=O INDJCCHBFRVERC-UHFFFAOYSA-N 0.000 description 2
- QUWBGQXYZZQGGY-UHFFFAOYSA-N 2-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(O)C(=O)C2=C1 QUWBGQXYZZQGGY-UHFFFAOYSA-N 0.000 description 2
- GAAODRILOUDQTB-UHFFFAOYSA-N 2-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(OC)C(=O)C2=C1 GAAODRILOUDQTB-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- BANIKQOYSWTYOZ-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 BANIKQOYSWTYOZ-UHFFFAOYSA-N 0.000 description 2
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 2
- DVMYPDXIXIJXLA-UHFFFAOYSA-N 4-(dimethylamino)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CN(C)C1=CC=CC2=C1C(=O)NS2(=O)=O DVMYPDXIXIJXLA-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 2
- RRNGUUHSUFLOHB-UHFFFAOYSA-N 4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCOC1=CC(O[Si](C)(C)C(C)(C)C)=CC(S(N)(=O)=O)=C1C(=O)N(CC)CC RRNGUUHSUFLOHB-UHFFFAOYSA-N 0.000 description 2
- NDCKONYYLNDXHQ-UHFFFAOYSA-N 4-bromo-3-ethoxyphenol Chemical compound CCOC1=CC(O)=CC=C1Br NDCKONYYLNDXHQ-UHFFFAOYSA-N 0.000 description 2
- MPCCNXGZCOXPMG-UHFFFAOYSA-N 4-bromobenzene-1,3-diol Chemical compound OC1=CC=C(Br)C(O)=C1 MPCCNXGZCOXPMG-UHFFFAOYSA-N 0.000 description 2
- NNNBYOYSLQUCNI-UHFFFAOYSA-N 4-chloro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound ClC1=CC=CC2=C1C(=O)NS2(=O)=O NNNBYOYSLQUCNI-UHFFFAOYSA-N 0.000 description 2
- MWLQEWDQXQHQED-UHFFFAOYSA-N 4-cyclohexylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1CCCCC1 MWLQEWDQXQHQED-UHFFFAOYSA-N 0.000 description 2
- LUCBYMRMLUDETM-UHFFFAOYSA-N 4-ethoxy-6-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCOC1=CC(O)=CC2=C1C(=O)NS2(=O)=O LUCBYMRMLUDETM-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- MUWHYUUQBYGDEG-UHFFFAOYSA-N 6-amino-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N)=CC2=C1C(=O)NS2(=O)=O MUWHYUUQBYGDEG-UHFFFAOYSA-N 0.000 description 2
- CNRNMBAPSVPGCJ-UHFFFAOYSA-N 6-fluoro-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(F)=CC2=C1C(=O)NS2(=O)=O CNRNMBAPSVPGCJ-UHFFFAOYSA-N 0.000 description 2
- CBEQLGOXRLCMNJ-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propoxy-1,2-benzothiazol-3-one Chemical compound CCCOC1=CC(OC)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 CBEQLGOXRLCMNJ-UHFFFAOYSA-N 0.000 description 2
- SGQJHTPAGPKONZ-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)NS2(=O)=O SGQJHTPAGPKONZ-UHFFFAOYSA-N 0.000 description 2
- RRRGMXLPAKHDMX-UHFFFAOYSA-N 6-methyl-1-oxo-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC1=CC=C2C(=O)NS(=O)(=S)C2=C1 RRRGMXLPAKHDMX-UHFFFAOYSA-N 0.000 description 2
- JOQYJAMJVBTUAO-UHFFFAOYSA-N 6-methyl-1-oxo-4-propan-2-yl-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(C)=CC2=C1C(=O)NS2(=O)=S JOQYJAMJVBTUAO-UHFFFAOYSA-N 0.000 description 2
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Natural products C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 108090000617 Cathepsin G Proteins 0.000 description 2
- 102000004173 Cathepsin G Human genes 0.000 description 2
- 108090000317 Chymotrypsin Proteins 0.000 description 2
- 102100025566 Chymotrypsin-like protease CTRL-1 Human genes 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Natural products NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 2
- 238000000023 Kugelrohr distillation Methods 0.000 description 2
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical class [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 108010067372 Pancreatic elastase Proteins 0.000 description 2
- 102000016387 Pancreatic elastase Human genes 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- LGPYGVFCRQDPEQ-UHFFFAOYSA-N S-chloro N,N-dimethylcarbamothioate Chemical compound CN(C(=O)SCl)C LGPYGVFCRQDPEQ-UHFFFAOYSA-N 0.000 description 2
- 244000000231 Sesamum indicum Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- BQRQOLQFLNSWNV-UHFFFAOYSA-N [5-[(dimethylamino)methyl]furan-2-yl]methanol Chemical compound CN(C)CC1=CC=C(CO)O1 BQRQOLQFLNSWNV-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 125000005210 alkyl ammonium group Chemical group 0.000 description 2
- 208000006682 alpha 1-Antitrypsin Deficiency Diseases 0.000 description 2
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 2
- 230000002785 anti-thrombosis Effects 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 150000003936 benzamides Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- ATMAFOGHBMIGMV-UHFFFAOYSA-N benzyl 2,2,2-trichloroacetate Chemical compound ClC(Cl)(Cl)C(=O)OCC1=CC=CC=C1 ATMAFOGHBMIGMV-UHFFFAOYSA-N 0.000 description 2
- ZYBCQKXKMSMAAO-UHFFFAOYSA-N benzyl 2-bromo-2,2-difluoroacetate Chemical compound FC(F)(Br)C(=O)OCC1=CC=CC=C1 ZYBCQKXKMSMAAO-UHFFFAOYSA-N 0.000 description 2
- 229960002903 benzyl benzoate Drugs 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- LLSMWLJPWFSMCP-UHFFFAOYSA-N chloromethylsulfanylbenzene Chemical compound ClCSC1=CC=CC=C1 LLSMWLJPWFSMCP-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 229960002376 chymotrypsin Drugs 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 2
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003602 elastase inhibitor Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- SATMZMMKDDTOSQ-UHFFFAOYSA-N harmol Chemical compound C12=CC=C(O)C=C2NC2=C1C=CN=C2C SATMZMMKDDTOSQ-UHFFFAOYSA-N 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 2
- 210000003630 histaminocyte Anatomy 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- BXRYSXCIRIKKJV-UHFFFAOYSA-N methyl 2-amino-6-chlorobenzoate Chemical compound COC(=O)C1=C(N)C=CC=C1Cl BXRYSXCIRIKKJV-UHFFFAOYSA-N 0.000 description 2
- HCLLOQLXKCCWLJ-UHFFFAOYSA-N methyl 2-amino-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1N HCLLOQLXKCCWLJ-UHFFFAOYSA-N 0.000 description 2
- ZICRWXFGZCVTBZ-UHFFFAOYSA-N methyl 2-hydroxy-4-methoxybenzoate Chemical compound COC(=O)C1=CC=C(OC)C=C1O ZICRWXFGZCVTBZ-UHFFFAOYSA-N 0.000 description 2
- KYPGXFQOCRNTQT-UHFFFAOYSA-N methyl 3-hydroxy-2,6-dimethylbenzoate Chemical compound COC(=O)C1=C(C)C=CC(O)=C1C KYPGXFQOCRNTQT-UHFFFAOYSA-N 0.000 description 2
- YKUCHDXIBAQWSF-UHFFFAOYSA-N methyl 3-hydroxybenzoate Chemical compound COC(=O)C1=CC=CC(O)=C1 YKUCHDXIBAQWSF-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- HVOYZOQVDYHUPF-UHFFFAOYSA-N n,n',n'-trimethylethane-1,2-diamine Chemical compound CNCCN(C)C HVOYZOQVDYHUPF-UHFFFAOYSA-N 0.000 description 2
- HUUSTUALCPTCGJ-UHFFFAOYSA-N n,n-diethylcarbamothioyl chloride Chemical compound CCN(CC)C(Cl)=S HUUSTUALCPTCGJ-UHFFFAOYSA-N 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 2
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 2
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000010502 orange oil Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000011698 potassium fluoride Substances 0.000 description 2
- 235000003270 potassium fluoride Nutrition 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- OHVYAQFQYUUMGO-UHFFFAOYSA-N (1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-2-yl)methyl 2,6-dichloro-3-phenylmethoxybenzoate Chemical compound CC(C)C1=CC=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C(C=1Cl)=C(Cl)C=CC=1OCC1=CC=CC=C1 OHVYAQFQYUUMGO-UHFFFAOYSA-N 0.000 description 1
- MDNZNXOPSPWJGR-UHFFFAOYSA-N (4-bromo-3-ethoxyphenoxy)-tert-butyl-dimethylsilane Chemical compound CCOC1=CC(O[Si](C)(C)C(C)(C)C)=CC=C1Br MDNZNXOPSPWJGR-UHFFFAOYSA-N 0.000 description 1
- PNAGHSVYUUIEEH-UHFFFAOYSA-N (4-bromo-3-ethoxyphenyl) 4-methylbenzenesulfonate Chemical compound C1=C(Br)C(OCC)=CC(OS(=O)(=O)C=2C=CC(C)=CC=2)=C1 PNAGHSVYUUIEEH-UHFFFAOYSA-N 0.000 description 1
- TUFPLMCYDKOOLG-UHFFFAOYSA-N (4-methyl-1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl acetate Chemical compound O=S1(=O)N(COC(=O)C)C(=O)C2=C1C=CC=C2C TUFPLMCYDKOOLG-UHFFFAOYSA-N 0.000 description 1
- GRZHHTYDZVRPIC-UHFFFAOYSA-N (benzyloxy)acetic acid Chemical compound OC(=O)COCC1=CC=CC=C1 GRZHHTYDZVRPIC-UHFFFAOYSA-N 0.000 description 1
- KMPPLOIOXCQZAT-UHFFFAOYSA-N 1,1,1-trichloro-2-iodoethane Chemical compound ClC(Cl)(Cl)CI KMPPLOIOXCQZAT-UHFFFAOYSA-N 0.000 description 1
- RKOUFQLNMRAACI-UHFFFAOYSA-N 1,1,1-trifluoro-2-iodoethane Chemical compound FC(F)(F)CI RKOUFQLNMRAACI-UHFFFAOYSA-N 0.000 description 1
- UJPMYEOUBPIPHQ-UHFFFAOYSA-N 1,1,1-trifluoroethane Chemical compound CC(F)(F)F UJPMYEOUBPIPHQ-UHFFFAOYSA-N 0.000 description 1
- XKFVBPBRLDQVSH-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbaldehyde Chemical compound O=CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 XKFVBPBRLDQVSH-UHFFFAOYSA-N 0.000 description 1
- CRSHTYPFKXPVRE-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide Chemical compound NS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CRSHTYPFKXPVRE-UHFFFAOYSA-N 0.000 description 1
- ZDUVXKZSRKSBCU-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 ZDUVXKZSRKSBCU-UHFFFAOYSA-N 0.000 description 1
- QNERCWAWQBNQQV-UHFFFAOYSA-N 1,1-dioxo-2-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C(C)C)C(=O)C2=C1 QNERCWAWQBNQQV-UHFFFAOYSA-N 0.000 description 1
- ZDTHRFZLOKXSMA-UHFFFAOYSA-N 1,1-dioxo-4-(1-trimethylsilylethyl)-1,2-benzothiazol-3-one Chemical compound C[Si](C)(C)C(C)C1=CC=CC2=C1C(=O)NS2(=O)=O ZDTHRFZLOKXSMA-UHFFFAOYSA-N 0.000 description 1
- HKRGCFFQZCGKRD-UHFFFAOYSA-N 1,1-dioxo-4-phenyl-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC(C=3C=CC=CC=3)=C2C(=O)N1CSC1=CC=CC=C1 HKRGCFFQZCGKRD-UHFFFAOYSA-N 0.000 description 1
- VTSFEVZZZKVVJF-UHFFFAOYSA-N 1,1-dioxo-4-propyl-1,2-benzothiazol-3-one Chemical compound CCCC1=CC=CC2=C1C(=O)NS2(=O)=O VTSFEVZZZKVVJF-UHFFFAOYSA-N 0.000 description 1
- CODUIIGXZPRYFC-UHFFFAOYSA-N 1,1-dioxo-6-(trichloromethyl)-1,2-benzothiazol-3-one Chemical compound ClC(Cl)(Cl)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CODUIIGXZPRYFC-UHFFFAOYSA-N 0.000 description 1
- WXJYCAYBKTXXID-UHFFFAOYSA-N 1,1-dioxo-6-(trifluoromethylsulfonyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)S(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 WXJYCAYBKTXXID-UHFFFAOYSA-N 0.000 description 1
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 1
- UEFCKYIRXORTFI-UHFFFAOYSA-N 1,2-thiazolidin-3-one Chemical compound O=C1CCSN1 UEFCKYIRXORTFI-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- MKGFYMKFBCWNCP-UHFFFAOYSA-N 1,3-diethoxybenzene Chemical compound CCOC1=CC=CC(OCC)=C1 MKGFYMKFBCWNCP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HUXJXNSHCKHFIL-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methoxyethane Chemical compound COCCOCCBr HUXJXNSHCKHFIL-UHFFFAOYSA-N 0.000 description 1
- MMAJXKGUZYDTHV-UHFFFAOYSA-N 1-benzhydrylazetidin-3-ol Chemical compound C1C(O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MMAJXKGUZYDTHV-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- HNAGHMKIPMKKBB-UHFFFAOYSA-N 1-benzylpyrrolidine-3-carboxamide Chemical compound C1C(C(=O)N)CCN1CC1=CC=CC=C1 HNAGHMKIPMKKBB-UHFFFAOYSA-N 0.000 description 1
- JCBFHVQBVSJGCP-UHFFFAOYSA-N 1-bromo-4,5-dimethoxy-2-propan-2-ylbenzene Chemical compound COC1=CC(Br)=C(C(C)C)C=C1OC JCBFHVQBVSJGCP-UHFFFAOYSA-N 0.000 description 1
- BLZNSXFQRKVFRP-UHFFFAOYSA-N 1-bromo-4-methoxy-2-methylbenzene Chemical compound COC1=CC=C(Br)C(C)=C1 BLZNSXFQRKVFRP-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006021 1-methyl-2-propenyl group Chemical group 0.000 description 1
- MWXVFRCOTFIJSP-UHFFFAOYSA-N 1-oxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(=O)NS(=O)C2=C1 MWXVFRCOTFIJSP-UHFFFAOYSA-N 0.000 description 1
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 description 1
- QYVIIQURNZYWFT-UHFFFAOYSA-N 2,4-diethoxy-n,n-diethylbenzamide Chemical compound CCOC1=CC=C(C(=O)N(CC)CC)C(OCC)=C1 QYVIIQURNZYWFT-UHFFFAOYSA-N 0.000 description 1
- KVIUXRJCBBXEGJ-UHFFFAOYSA-N 2,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(OC)=C1 KVIUXRJCBBXEGJ-UHFFFAOYSA-N 0.000 description 1
- FCYSIQQOCBOUAD-UHFFFAOYSA-N 2,4-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=C2C(N(S(=O)(=O)C2=CC=C1)C)=O FCYSIQQOCBOUAD-UHFFFAOYSA-N 0.000 description 1
- LDCBSAJFVZJLMB-UHFFFAOYSA-N 2,6-dichloro-3-[2-(4-methylpiperazin-1-yl)ethoxy]benzoic acid Chemical compound CN1CCN(CC1)CCOC2=C(C(=C(C=C2)Cl)C(=O)O)Cl LDCBSAJFVZJLMB-UHFFFAOYSA-N 0.000 description 1
- DLNZLRWANKIGNJ-UHFFFAOYSA-N 2,6-dichloro-3-[2-(dimethylamino)ethoxy]benzoic acid Chemical compound CN(C)CCOC1=CC=C(Cl)C(C(O)=O)=C1Cl DLNZLRWANKIGNJ-UHFFFAOYSA-N 0.000 description 1
- JDTZZOXWEJEADB-UHFFFAOYSA-N 2,6-dichloro-3-hydroxybenzaldehyde Chemical compound OC1=CC=C(Cl)C(C=O)=C1Cl JDTZZOXWEJEADB-UHFFFAOYSA-N 0.000 description 1
- QVWZNESUFUVSMI-UHFFFAOYSA-N 2,6-dichloro-3-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1Cl QVWZNESUFUVSMI-UHFFFAOYSA-N 0.000 description 1
- WJOVLMLBLLKYKD-UHFFFAOYSA-N 2,6-dichloro-4-hydroxybenzoic acid Chemical compound OC(=O)C1=C(Cl)C=C(O)C=C1Cl WJOVLMLBLLKYKD-UHFFFAOYSA-N 0.000 description 1
- JBLIDPPHFGWTKU-UHFFFAOYSA-N 2,6-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=C(Cl)C=CC=C1Cl JBLIDPPHFGWTKU-UHFFFAOYSA-N 0.000 description 1
- ONOTYLMNTZNAQZ-UHFFFAOYSA-N 2,6-difluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC=C1F ONOTYLMNTZNAQZ-UHFFFAOYSA-N 0.000 description 1
- YIKBQFPTPKEFSM-UHFFFAOYSA-N 2,6-dimethoxy-3-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C(OC)=C1C(O)=O YIKBQFPTPKEFSM-UHFFFAOYSA-N 0.000 description 1
- BSXZSYDFLAENTA-UHFFFAOYSA-N 2,6-dimethyl-3-(2-morpholin-4-ylethoxy)benzoic acid Chemical compound CC1=C(C(O)=O)C(C)=CC=C1OCCN1CCOCC1 BSXZSYDFLAENTA-UHFFFAOYSA-N 0.000 description 1
- RVXMXYOYVRCWKN-UHFFFAOYSA-N 2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)(C(F)(F)F)C(F)(F)F RVXMXYOYVRCWKN-UHFFFAOYSA-N 0.000 description 1
- CZROPTCHPNIDTD-UHFFFAOYSA-N 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(C(F)(F)F)C(F)(F)F CZROPTCHPNIDTD-UHFFFAOYSA-N 0.000 description 1
- PUBMVJWTZCLMPG-UHFFFAOYSA-N 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)benzoyl chloride Chemical compound FC(F)(F)C(C(F)(F)F)C1=CC=CC=C1C(Cl)=O PUBMVJWTZCLMPG-UHFFFAOYSA-N 0.000 description 1
- FAXUBRGCGJYLPU-UHFFFAOYSA-N 2-(1,2-dibromoethyl)-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(Br)CBr)C=CC=C1S(N)(=O)=O FAXUBRGCGJYLPU-UHFFFAOYSA-N 0.000 description 1
- FYVMBPXFPFAECB-UHFFFAOYSA-N 2-(1-methylpyrrolidin-2-yl)ethanol Chemical compound CN1CCCC1CCO FYVMBPXFPFAECB-UHFFFAOYSA-N 0.000 description 1
- HKZOBICNEHHXFA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)propan-2-ol Chemical compound COC1=CC=C(C(C)(C)O)C=C1OC HKZOBICNEHHXFA-UHFFFAOYSA-N 0.000 description 1
- CQJKYTKTCXRVSO-UHFFFAOYSA-N 2-(4-chlorophenyl)benzenethiol Chemical compound SC1=CC=CC=C1C1=CC=C(Cl)C=C1 CQJKYTKTCXRVSO-UHFFFAOYSA-N 0.000 description 1
- PEKAELDGTPPFOJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)benzenethiol Chemical compound C1=CC(OC)=CC=C1C1=CC=CC=C1S PEKAELDGTPPFOJ-UHFFFAOYSA-N 0.000 description 1
- DLMYXFNCIVZCRA-UHFFFAOYSA-N 2-(4-methylphenyl)benzenethiol Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1S DLMYXFNCIVZCRA-UHFFFAOYSA-N 0.000 description 1
- QHTUMQYGZQYEOZ-UHFFFAOYSA-N 2-(4-methylpiperazin-1-yl)ethanol Chemical compound CN1CCN(CCO)CC1 QHTUMQYGZQYEOZ-UHFFFAOYSA-N 0.000 description 1
- 125000000586 2-(4-morpholinyl)ethoxy group Chemical group [H]C([H])(O*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- CUTVBDNGHSDKJQ-UHFFFAOYSA-N 2-(bromomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CBr)C(=O)C2=C1 CUTVBDNGHSDKJQ-UHFFFAOYSA-N 0.000 description 1
- KFHDKNYCWMFARS-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical compound C1CCC=C2S(=O)(=O)N(CCl)C(=O)C21 KFHDKNYCWMFARS-UHFFFAOYSA-N 0.000 description 1
- BZTUYGJQLUMFNS-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-4-phenyl-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CCl)C(=O)C2=C1C=CC=C2C1=CC=CC=C1 BZTUYGJQLUMFNS-UHFFFAOYSA-N 0.000 description 1
- ZLDJKTZONIMWHD-UHFFFAOYSA-N 2-(chloromethyl)-4,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O ZLDJKTZONIMWHD-UHFFFAOYSA-N 0.000 description 1
- JGUVRAIJJVSETO-UHFFFAOYSA-N 2-(chloromethyl)-4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)N(CCl)S2(=O)=O JGUVRAIJJVSETO-UHFFFAOYSA-N 0.000 description 1
- BGKLABSMIJAXHB-UHFFFAOYSA-N 2-(chloromethyl)-4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O BGKLABSMIJAXHB-UHFFFAOYSA-N 0.000 description 1
- IBWZPLSRKHFROS-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-(trifluoromethyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)C1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O IBWZPLSRKHFROS-UHFFFAOYSA-N 0.000 description 1
- IAVWIJNTOZKJNL-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O IAVWIJNTOZKJNL-UHFFFAOYSA-N 0.000 description 1
- BTOIXOQVLIJKSA-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propoxy-1,2-benzothiazol-3-one Chemical compound CCCOC1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O BTOIXOQVLIJKSA-UHFFFAOYSA-N 0.000 description 1
- DARQLSDSHIJNTG-UHFFFAOYSA-N 2-(dibenzylamino)-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 DARQLSDSHIJNTG-UHFFFAOYSA-N 0.000 description 1
- YHOXJBDJTLMLMA-UHFFFAOYSA-N 2-(dibenzylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 YHOXJBDJTLMLMA-UHFFFAOYSA-N 0.000 description 1
- YEVUJTJCNAOPEF-UHFFFAOYSA-N 2-(dibenzylamino)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 YEVUJTJCNAOPEF-UHFFFAOYSA-N 0.000 description 1
- UZUPYNAQIMGZMO-UHFFFAOYSA-N 2-(dimethylamino)-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1N(C)C UZUPYNAQIMGZMO-UHFFFAOYSA-N 0.000 description 1
- CDEUGGREIZGBIX-UHFFFAOYSA-N 2-(furan-2-carbonyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N1C(=O)C1=CC=CO1 CDEUGGREIZGBIX-UHFFFAOYSA-N 0.000 description 1
- CSXHUONYHRDYGM-UHFFFAOYSA-N 2-(hydroxyamino)-2-oxoacetic acid Chemical compound ONC(=O)C(O)=O CSXHUONYHRDYGM-UHFFFAOYSA-N 0.000 description 1
- DLYXOFNUYLZPCF-UHFFFAOYSA-N 2-(iodomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical class C1=CC=C2S(=O)(=O)N(CI)C(=O)C2=C1 DLYXOFNUYLZPCF-UHFFFAOYSA-N 0.000 description 1
- LWTXRSWGLSFPSU-UHFFFAOYSA-N 2-(trichloromethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LWTXRSWGLSFPSU-UHFFFAOYSA-N 0.000 description 1
- LJMNEQZBOODJQR-UHFFFAOYSA-N 2-(trichloromethyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LJMNEQZBOODJQR-UHFFFAOYSA-N 0.000 description 1
- MXIUWSYTQJLIKE-UHFFFAOYSA-N 2-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1C(Cl)=O MXIUWSYTQJLIKE-UHFFFAOYSA-N 0.000 description 1
- LAZKSSYOKYWMRN-UHFFFAOYSA-N 2-[(2,2,2-trifluoroacetyl)amino]benzoic acid Chemical class OC(=O)C1=CC=CC=C1NC(=O)C(F)(F)F LAZKSSYOKYWMRN-UHFFFAOYSA-N 0.000 description 1
- MRPLRZQKMWXJRF-UHFFFAOYSA-N 2-amino-4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=C2C(N(S(=O)(=O)C2=CC=C1)N)=O MRPLRZQKMWXJRF-UHFFFAOYSA-N 0.000 description 1
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 1
- XHKUSCPWTGRCHR-UHFFFAOYSA-N 2-benzyl-1,1,3-trioxo-1,2-benzothiazole-6-carbonitrile Chemical compound O=S1(=O)C2=CC(C#N)=CC=C2C(=O)N1CC1=CC=CC=C1 XHKUSCPWTGRCHR-UHFFFAOYSA-N 0.000 description 1
- JLGPMOJYECOCEP-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CC1=CC=CC=C1 JLGPMOJYECOCEP-UHFFFAOYSA-N 0.000 description 1
- VRIWDDSMUSKLDG-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-4-propan-2-yl-4,5,7,7a-tetrahydro-3ah-1,2-benzothiazole-3,6-dione Chemical compound CC(C)C1CC(=O)CC(S2(=O)=O)C1C(=O)N2CC1=CC=CC=C1 VRIWDDSMUSKLDG-UHFFFAOYSA-N 0.000 description 1
- XFYAYXIMRLTTOH-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-4-propan-2-yl-6-sulfanyl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 XFYAYXIMRLTTOH-UHFFFAOYSA-N 0.000 description 1
- UJFZDOCYWCYDMB-UHFFFAOYSA-N 2-benzyl-1,2-thiazol-3-one Chemical compound O=C1C=CSN1CC1=CC=CC=C1 UJFZDOCYWCYDMB-UHFFFAOYSA-N 0.000 description 1
- RWTYHCVZDFSHBD-UHFFFAOYSA-N 2-benzyl-4,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 RWTYHCVZDFSHBD-UHFFFAOYSA-N 0.000 description 1
- KUKANSABISBCHB-UHFFFAOYSA-N 2-benzyl-6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 KUKANSABISBCHB-UHFFFAOYSA-N 0.000 description 1
- ZFPNXMCVMCSIJD-UHFFFAOYSA-N 2-benzyl-7-hydroxy-4-methoxy-1-oxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(O)C(S2=O)=C1C(=O)N2CC1=CC=CC=C1 ZFPNXMCVMCSIJD-UHFFFAOYSA-N 0.000 description 1
- ONMSBNJJCUCYED-UHFFFAOYSA-N 2-bromo-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1Br ONMSBNJJCUCYED-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- SKUBAITXBJSKRS-UHFFFAOYSA-N 2-chlorosulfonyl-6-phenylbenzoic acid Chemical compound ClS(=O)(=O)C1=C(C(=O)O)C(=CC=C1)C1=CC=CC=C1 SKUBAITXBJSKRS-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- OIMCPRDFGPEXAU-UHFFFAOYSA-N 2-ethenyl-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C=C OIMCPRDFGPEXAU-UHFFFAOYSA-N 0.000 description 1
- XUDBVJCTLZTSDC-UHFFFAOYSA-N 2-ethenylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C=C XUDBVJCTLZTSDC-UHFFFAOYSA-N 0.000 description 1
- VFOZPUQEFHZHBT-UHFFFAOYSA-N 2-ethenylbenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C=C VFOZPUQEFHZHBT-UHFFFAOYSA-N 0.000 description 1
- IROFVEPLXXBUMC-UHFFFAOYSA-N 2-ethoxy-n,n-diethyl-4-hydroxy-6-sulfamoylbenzamide Chemical compound CCOC1=CC(O)=CC(S(N)(=O)=O)=C1C(=O)N(CC)CC IROFVEPLXXBUMC-UHFFFAOYSA-N 0.000 description 1
- FHUFFVIITDISHQ-UHFFFAOYSA-N 2-ethoxyfuran Chemical compound CCOC1=CC=CO1 FHUFFVIITDISHQ-UHFFFAOYSA-N 0.000 description 1
- GKTFLKJXZOYBRW-UHFFFAOYSA-N 2-ethylbenzamide Chemical compound CCC1=CC=CC=C1C(N)=O GKTFLKJXZOYBRW-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- OXCGHDNCMSOEBZ-UHFFFAOYSA-N 2-methoxyfuran Chemical compound COC1=CC=CO1 OXCGHDNCMSOEBZ-UHFFFAOYSA-N 0.000 description 1
- DDIIAJRLFATEEE-UHFFFAOYSA-N 2-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C)C(=O)C2=C1 DDIIAJRLFATEEE-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- IQANHWBWTVLDTP-UHFFFAOYSA-N 2-methylhex-3-ene Chemical compound CCC=CC(C)C IQANHWBWTVLDTP-UHFFFAOYSA-N 0.000 description 1
- CUZKCNWZBXLAJX-UHFFFAOYSA-N 2-phenylmethoxyethanol Chemical compound OCCOCC1=CC=CC=C1 CUZKCNWZBXLAJX-UHFFFAOYSA-N 0.000 description 1
- VRDBIJCCXDEZJN-UHFFFAOYSA-N 2-piperidin-1-ylacetic acid Chemical compound OC(=O)CN1CCCCC1 VRDBIJCCXDEZJN-UHFFFAOYSA-N 0.000 description 1
- LDSQQXKSEFZAPE-UHFFFAOYSA-N 2-piperidin-4-ylethanol Chemical compound OCCC1CCNCC1 LDSQQXKSEFZAPE-UHFFFAOYSA-N 0.000 description 1
- WCIYEHWFYVYBCD-UHFFFAOYSA-N 2-propan-2-yl-1,3-dioxole Chemical compound CC(C)C1OC=CO1 WCIYEHWFYVYBCD-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- MRBPIDPXHZXZNQ-UHFFFAOYSA-N 4,6-diethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCOC1=CC(OCC)=CC2=C1C(=O)NS2(=O)=O MRBPIDPXHZXZNQ-UHFFFAOYSA-N 0.000 description 1
- UFBQWRUMBIJHCE-UHFFFAOYSA-N 4,6-diethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CCOC1=CC(OCC)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 UFBQWRUMBIJHCE-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical group CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- YRWHBHJLSKSUGV-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)NS2(=O)=O YRWHBHJLSKSUGV-UHFFFAOYSA-N 0.000 description 1
- VHABQMJQVSVXLO-UHFFFAOYSA-N 4-(1,2-thiazol-5-yl)but-3-enoic acid Chemical compound OC(=O)CC=CC1=CC=NS1 VHABQMJQVSVXLO-UHFFFAOYSA-N 0.000 description 1
- NBJHDLKSWUDGJG-UHFFFAOYSA-N 4-(2-chloroethyl)morpholin-4-ium;chloride Chemical compound Cl.ClCCN1CCOCC1 NBJHDLKSWUDGJG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- PGGOYACMHDPZQV-UHFFFAOYSA-N 4-(trichloromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 PGGOYACMHDPZQV-UHFFFAOYSA-N 0.000 description 1
- LNIAVCRNJMPGGT-UHFFFAOYSA-N 4-(trichloromethyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 LNIAVCRNJMPGGT-UHFFFAOYSA-N 0.000 description 1
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KCUFTIDRRAWLCM-UHFFFAOYSA-N 4-[tert-butyl(dimethyl)silyl]oxy-2-ethoxy-n,n-diethylbenzamide Chemical compound CCOC1=CC(O[Si](C)(C)C(C)(C)C)=CC=C1C(=O)N(CC)CC KCUFTIDRRAWLCM-UHFFFAOYSA-N 0.000 description 1
- JQSVXJNTPDVVKM-UHFFFAOYSA-N 4-amino-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NC1=CC=CC2=C1C(=O)NS2(=O)=O JQSVXJNTPDVVKM-UHFFFAOYSA-N 0.000 description 1
- FCBABQMEBSCFOO-UHFFFAOYSA-N 4-bromo-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound BrC1=CC=CC2=C1C(=O)NS2(=O)=O FCBABQMEBSCFOO-UHFFFAOYSA-N 0.000 description 1
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 1
- WCFNFNINPFMFAN-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CCl)C(=O)C2=C1C=CC=C2Cl WCFNFNINPFMFAN-UHFFFAOYSA-N 0.000 description 1
- AZGZINIKGIDBPR-UHFFFAOYSA-N 4-chloro-2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CO)C(=O)C2=C1C=CC=C2Cl AZGZINIKGIDBPR-UHFFFAOYSA-N 0.000 description 1
- ZKIUBOCVOSYTQM-UHFFFAOYSA-N 4-cyclohexyl-n,n-diethyl-2-sulfamoylbenzamide Chemical compound C1=C(S(N)(=O)=O)C(C(=O)N(CC)CC)=CC=C1C1CCCCC1 ZKIUBOCVOSYTQM-UHFFFAOYSA-N 0.000 description 1
- QCIWHVKGVVQHIY-UHFFFAOYSA-N 4-cyclohexylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1CCCCC1 QCIWHVKGVVQHIY-UHFFFAOYSA-N 0.000 description 1
- LQNASZLNSGPGEA-UHFFFAOYSA-N 4-ethoxy-1,1-dioxo-6-(2-phenylmethoxyethoxy)-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound C=1C(S(N(CSC=2C=CC=CC=2)C2=O)(=O)=O)=C2C(OCC)=CC=1OCCOCC1=CC=CC=C1 LQNASZLNSGPGEA-UHFFFAOYSA-N 0.000 description 1
- CDQLHJLVEUEIJM-UHFFFAOYSA-N 4-ethoxy-6-hydroxy-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CCOC1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 CDQLHJLVEUEIJM-UHFFFAOYSA-N 0.000 description 1
- ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCC1=CC=CC2=C1C(=O)NS2(=O)=O ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- DWWDNPIWPBIMOA-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoic acid Chemical compound CC(C)C1=CC(F)=CC=C1C(O)=O DWWDNPIWPBIMOA-UHFFFAOYSA-N 0.000 description 1
- VLIFCVKBFRCCQT-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoyl chloride Chemical compound CC(C)C1=CC(F)=CC=C1C(Cl)=O VLIFCVKBFRCCQT-UHFFFAOYSA-N 0.000 description 1
- ZJGLJAXKTJBYSD-UHFFFAOYSA-N 4-hydroxy-2h-1,2-benzothiazine-3-carboxylic acid Chemical compound C1=CC=C2SNC(C(=O)O)=C(O)C2=C1 ZJGLJAXKTJBYSD-UHFFFAOYSA-N 0.000 description 1
- IELNXGPPRWLPCZ-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC2=C1C(=O)NS2(=O)=O IELNXGPPRWLPCZ-UHFFFAOYSA-N 0.000 description 1
- ISQXIGUSUAIWIV-UHFFFAOYSA-N 4-methoxy-2-propoxybenzoic acid Chemical compound CCCOC1=CC(OC)=CC=C1C(O)=O ISQXIGUSUAIWIV-UHFFFAOYSA-N 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-M 4-methoxybenzoate Chemical compound COC1=CC=C(C([O-])=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-M 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- BUFBNKOBQPIKKV-UHFFFAOYSA-N 4-methyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 BUFBNKOBQPIKKV-UHFFFAOYSA-N 0.000 description 1
- 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
- MNXLSODRJUQNRP-UHFFFAOYSA-N 4-methylnaphthalene-1-thiol Chemical compound C1=CC=C2C(C)=CC=C(S)C2=C1 MNXLSODRJUQNRP-UHFFFAOYSA-N 0.000 description 1
- RZDVCYHZYFLUNA-UHFFFAOYSA-N 4-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC(C)(C)C1=CC=CC2=C1C(=O)NS2(=O)=O RZDVCYHZYFLUNA-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- JHUBNQSPUZXGKI-UHFFFAOYSA-N 5-propan-2-yl-1,3-benzodioxole Chemical compound CC(C)C1=CC=C2OCOC2=C1 JHUBNQSPUZXGKI-UHFFFAOYSA-N 0.000 description 1
- DHKUQTIUQLTJRK-UHFFFAOYSA-N 6,7-dihydro-5h-1,2-benzothiazol-4-one Chemical compound O=C1CCCC2=C1C=NS2 DHKUQTIUQLTJRK-UHFFFAOYSA-N 0.000 description 1
- QXISDZNLLFCPLK-UHFFFAOYSA-N 6,7-dimethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound COC1=CC(C(C)C)=C2C(=O)NS(=O)(=O)C2=C1OC QXISDZNLLFCPLK-UHFFFAOYSA-N 0.000 description 1
- TZHSOKUMRLKHCT-UHFFFAOYSA-N 6-(aminomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NCC1=CC=C2C(=O)NS(=O)(=O)C2=C1 TZHSOKUMRLKHCT-UHFFFAOYSA-N 0.000 description 1
- YDXWPEDBHPKGPV-UHFFFAOYSA-N 6-(dimethylamino)-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N(C)C)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 YDXWPEDBHPKGPV-UHFFFAOYSA-N 0.000 description 1
- SGXKWDMCEXVTQI-UHFFFAOYSA-N 6-(dimethylamino)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N(C)C)=CC2=C1C(=O)NS2(=O)=O SGXKWDMCEXVTQI-UHFFFAOYSA-N 0.000 description 1
- NORHTNDKSPORRY-UHFFFAOYSA-N 6-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound OCC1=CC=C2C(=O)NS(=O)(=O)C2=C1 NORHTNDKSPORRY-UHFFFAOYSA-N 0.000 description 1
- JNYLMODTPLSLIF-UHFFFAOYSA-N 6-(trifluoromethyl)pyridine-3-carboxylic acid Chemical group OC(=O)C1=CC=C(C(F)(F)F)N=C1 JNYLMODTPLSLIF-UHFFFAOYSA-N 0.000 description 1
- SSRKZHLPNHLAKM-UHFFFAOYSA-N 6-amino-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NC1=CC=C2C(=O)NS(=O)(=O)C2=C1 SSRKZHLPNHLAKM-UHFFFAOYSA-N 0.000 description 1
- CIOSVBMRIVNNRA-UHFFFAOYSA-N 6-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC(N)=CC=C2C(=O)N1CC1=CC=CC=C1 CIOSVBMRIVNNRA-UHFFFAOYSA-N 0.000 description 1
- KCXQJGKVYLACCW-UHFFFAOYSA-N 6-cyclohexyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C=1C=C2C(=O)NS(=O)(=O)C2=CC=1C1CCCCC1 KCXQJGKVYLACCW-UHFFFAOYSA-N 0.000 description 1
- FGWXGHBHIOINCJ-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C2C(=O)NS(=O)(=O)C2=C1 FGWXGHBHIOINCJ-UHFFFAOYSA-N 0.000 description 1
- LOIAZRUFNHUSCE-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-2-propan-2-yl-1,2-benzothiazol-3-one Chemical compound COc1ccc2C(=O)N(C(C)C)S(=O)(=O)c2c1 LOIAZRUFNHUSCE-UHFFFAOYSA-N 0.000 description 1
- SZQIFNGAYIEDGA-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-4-propoxy-1,2-benzothiazol-3-one Chemical compound CCCOC1=CC(OC)=CC2=C1C(=O)NS2(=O)=O SZQIFNGAYIEDGA-UHFFFAOYSA-N 0.000 description 1
- HRXRAGMPINUXGG-UHFFFAOYSA-N 6-methylsulfonyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 HRXRAGMPINUXGG-UHFFFAOYSA-N 0.000 description 1
- HZZFBUZSKAVIOV-UHFFFAOYSA-N 6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound [O-][N+](=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 HZZFBUZSKAVIOV-UHFFFAOYSA-N 0.000 description 1
- USSHTWOXWQEPPI-UHFFFAOYSA-N 6-sulfonylcyclohexa-2,4-diene-1-carboxylic acid Chemical compound OC(=O)C1C=CC=CC1=S(=O)=O USSHTWOXWQEPPI-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 101710134784 Agnoprotein Proteins 0.000 description 1
- 101710081722 Antitrypsin Proteins 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- MOZDKDIOPSPTBH-UHFFFAOYSA-N Benzyl parahydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OCC1=CC=CC=C1 MOZDKDIOPSPTBH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- UBKFKLSSCYJCQM-UHFFFAOYSA-N C(C)ON1S(=O)(=O)C2=CC(=CC=C2C1=O)OC Chemical compound C(C)ON1S(=O)(=O)C2=CC(=CC=C2C1=O)OC UBKFKLSSCYJCQM-UHFFFAOYSA-N 0.000 description 1
- INQUSPWHVVRKLR-UHFFFAOYSA-N C1(CCCCC1)C1=C(C(=O)N(CC)CC)C=CC=C1 Chemical compound C1(CCCCC1)C1=C(C(=O)N(CC)CC)C=CC=C1 INQUSPWHVVRKLR-UHFFFAOYSA-N 0.000 description 1
- KSGJVBSONKYXKJ-UHFFFAOYSA-N C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O Chemical compound C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O KSGJVBSONKYXKJ-UHFFFAOYSA-N 0.000 description 1
- ROJNRJPKKOHDBZ-UHFFFAOYSA-N CC(C(OC)=C(C(S(N1Cl)(=O)=O)=C2)C1=O)=C2OC Chemical compound CC(C(OC)=C(C(S(N1Cl)(=O)=O)=C2)C1=O)=C2OC ROJNRJPKKOHDBZ-UHFFFAOYSA-N 0.000 description 1
- ZVSXJAFPWIUCGK-UHFFFAOYSA-N CC(C)(C)C1CCC=C(C1C(=O)O)SCC2=CC=CC=C2 Chemical compound CC(C)(C)C1CCC=C(C1C(=O)O)SCC2=CC=CC=C2 ZVSXJAFPWIUCGK-UHFFFAOYSA-N 0.000 description 1
- HVUSCKPLXJUOON-UHFFFAOYSA-N CCNCC.CCOC(C=C1S(N2)(=O)=O)=CC(OCC)=C1C2=O Chemical compound CCNCC.CCOC(C=C1S(N2)(=O)=O)=CC(OCC)=C1C2=O HVUSCKPLXJUOON-UHFFFAOYSA-N 0.000 description 1
- WHWBRTAUEPIHQE-UHFFFAOYSA-N CN1S(=O)(=O)C2=CC=CC(=C2C1=O)CCC Chemical compound CN1S(=O)(=O)C2=CC=CC(=C2C1=O)CCC WHWBRTAUEPIHQE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000005973 Carvone Substances 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- 102100024539 Chymase Human genes 0.000 description 1
- 108090000227 Chymases Proteins 0.000 description 1
- 239000012027 Collins reagent Substances 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- NMEZJSDUZQOPFE-UHFFFAOYSA-N Cyclohex-1-enecarboxylic acid Chemical compound OC(=O)C1=CCCCC1 NMEZJSDUZQOPFE-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 102100022825 Disintegrin and metalloproteinase domain-containing protein 22 Human genes 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 240000001414 Eucalyptus viminalis Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 101000756722 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 22 Proteins 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- HCJXEOFLVIFFDG-UHFFFAOYSA-N N,N-Diethyl-4-methoxybenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C=C1 HCJXEOFLVIFFDG-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- HLVWXPYVLRCCRO-UHFFFAOYSA-N O=C1N(CCl)S(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 Chemical compound O=C1N(CCl)S(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 HLVWXPYVLRCCRO-UHFFFAOYSA-N 0.000 description 1
- BGAVPVVGPKJGSG-UHFFFAOYSA-N O=C1NS(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 Chemical compound O=C1NS(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 BGAVPVVGPKJGSG-UHFFFAOYSA-N 0.000 description 1
- MNQITOYQZFGOTG-UHFFFAOYSA-N O=S=O.ONOS(O)(=O)=O Chemical compound O=S=O.ONOS(O)(=O)=O MNQITOYQZFGOTG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000003434 Sesamum indicum Nutrition 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- XRKIHUXCUIFHAS-UHFFFAOYSA-N [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid Chemical compound COC(=O)CCC1=CC=C(B(O)O)C=C1 XRKIHUXCUIFHAS-UHFFFAOYSA-N 0.000 description 1
- PKQDKQVNASNLKU-UHFFFAOYSA-N [N+](=O)([O-])C1=C(C(=O)OCN2S(=O)(=O)C3=CC=CC=C3C2=O)C=CC=C1 Chemical compound [N+](=O)([O-])C1=C(C(=O)OCN2S(=O)(=O)C3=CC=CC=C3C2=O)C=CC=C1 PKQDKQVNASNLKU-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005192 alkyl ethylene group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- CWNKMHIETKEBCA-UHFFFAOYSA-N alpha-Ethylaminohexanophenone Chemical compound CCCCC(NCC)C(=O)C1=CC=CC=C1 CWNKMHIETKEBCA-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000001475 anti-trypsic effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- XTPLQANXHDDXIH-UHFFFAOYSA-N azanium;1,1-dioxo-1,2-benzothiazol-3-olate Chemical compound N.C1=CC=C2C(=O)NS(=O)(=O)C2=C1 XTPLQANXHDDXIH-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229940054066 benzamide antipsychotics Drugs 0.000 description 1
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- CMWCNAHHOODXNR-UHFFFAOYSA-N benzyl 2,6-dichloro-4-hydroxybenzoate Chemical compound ClC1=CC(O)=CC(Cl)=C1C(=O)OCC1=CC=CC=C1 CMWCNAHHOODXNR-UHFFFAOYSA-N 0.000 description 1
- SYXSMTCXQUGEIJ-UHFFFAOYSA-N benzyl 4-(2-hydroxyethyl)piperidine-1-carboxylate Chemical compound C1CC(CCO)CCN1C(=O)OCC1=CC=CC=C1 SYXSMTCXQUGEIJ-UHFFFAOYSA-N 0.000 description 1
- CRXCATWWXVJNJF-UHFFFAOYSA-N benzyl 4-hydroxybutanoate Chemical compound OCCCC(=O)OCC1=CC=CC=C1 CRXCATWWXVJNJF-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- 150000004768 bromobenzenes Chemical class 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DLIJPAHLBJIQHE-UHFFFAOYSA-N butylphosphane Chemical compound CCCCP DLIJPAHLBJIQHE-UHFFFAOYSA-N 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ULDHMXUKGWMISQ-UHFFFAOYSA-N carvone Natural products CC(=C)C1CC=C(C)C(=O)C1 ULDHMXUKGWMISQ-UHFFFAOYSA-N 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- SATLIFYHNYMKJB-UHFFFAOYSA-N chloromethyl 2,6-dichlorobenzoate Chemical compound ClCOC(=O)C1=C(Cl)C=CC=C1Cl SATLIFYHNYMKJB-UHFFFAOYSA-N 0.000 description 1
- BOXZXICVMMSYPE-UHFFFAOYSA-N chloromethyl benzoate Chemical compound ClCOC(=O)C1=CC=CC=C1 BOXZXICVMMSYPE-UHFFFAOYSA-N 0.000 description 1
- AZFVLHQDIIJLJG-UHFFFAOYSA-N chloromethylsilane Chemical compound [SiH3]CCl AZFVLHQDIIJLJG-UHFFFAOYSA-N 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- LEKPFOXEZRZPGW-UHFFFAOYSA-N copper;dicyanide Chemical compound [Cu+2].N#[C-].N#[C-] LEKPFOXEZRZPGW-UHFFFAOYSA-N 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229960003280 cupric chloride Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 1
- GHVNFZFCNZKVNT-UHFFFAOYSA-M decanoate Chemical compound CCCCCCCCCC([O-])=O GHVNFZFCNZKVNT-UHFFFAOYSA-M 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000004783 dichloromethoxy group Chemical group ClC(O*)Cl 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000005332 diethylamines Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- NPDFLGVJJBBMLK-UHFFFAOYSA-N dimethyl 1-chlorosulfonylcyclohexa-3,5-diene-1,2-dicarboxylate Chemical compound COC(=O)C1C=CC=CC1(C(=O)OC)S(Cl)(=O)=O NPDFLGVJJBBMLK-UHFFFAOYSA-N 0.000 description 1
- VEJKSNHPNFHCLF-UHFFFAOYSA-N dimethyl 3-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(N)=C1C(=O)OC VEJKSNHPNFHCLF-UHFFFAOYSA-N 0.000 description 1
- QTWYVCOKMRCERE-UHFFFAOYSA-N dimethyl 3-sulfamoylbenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(S(N)(=O)=O)=C1C(=O)OC QTWYVCOKMRCERE-UHFFFAOYSA-N 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000002532 enzyme inhibitor Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- SJMLNDPIJZBEKY-UHFFFAOYSA-N ethyl 2,2,2-trichloroacetate Chemical compound CCOC(=O)C(Cl)(Cl)Cl SJMLNDPIJZBEKY-UHFFFAOYSA-N 0.000 description 1
- GEATWTXBCNOEFI-UHFFFAOYSA-N ethyl 2-(dibenzylamino)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GEATWTXBCNOEFI-UHFFFAOYSA-N 0.000 description 1
- IRSJDVYTJUCXRV-UHFFFAOYSA-N ethyl 2-bromo-2,2-difluoroacetate Chemical compound CCOC(=O)C(F)(F)Br IRSJDVYTJUCXRV-UHFFFAOYSA-N 0.000 description 1
- YIUMLILLUMQKHK-UHFFFAOYSA-N ethyl 2-chlorosulfonyl-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1S(Cl)(=O)=O YIUMLILLUMQKHK-UHFFFAOYSA-N 0.000 description 1
- KWXBNUYCDMPLEQ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1O KWXBNUYCDMPLEQ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- XTJLXXCARCJVPJ-UHFFFAOYSA-N hepta-2,4-diene Chemical compound CCC=CC=CC XTJLXXCARCJVPJ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- VBZWSGALLODQNC-UHFFFAOYSA-N hexafluoroacetone Chemical compound FC(F)(F)C(=O)C(F)(F)F VBZWSGALLODQNC-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229960001680 ibuprofen Drugs 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- TWWRFGHXMHBSBA-UHFFFAOYSA-M lithium;3-(triphenyl-$l^{5}-phosphanylidene)propanoate Chemical compound [Li+].C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CCC(=O)[O-])C1=CC=CC=C1 TWWRFGHXMHBSBA-UHFFFAOYSA-M 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- CYCHFUMPPITFHT-UHFFFAOYSA-N methyl 1,1,3-trioxo-1,2-benzothiazole-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1C(=O)NS2(=O)=O CYCHFUMPPITFHT-UHFFFAOYSA-N 0.000 description 1
- QCHGUEIECOASJU-UHFFFAOYSA-N methyl 1,3-benzodioxole-5-carboxylate Chemical compound COC(=O)C1=CC=C2OCOC2=C1 QCHGUEIECOASJU-UHFFFAOYSA-N 0.000 description 1
- VQMDSJOGHWUVSO-UHFFFAOYSA-N methyl 2,6-dichloro-3-hydroxybenzoate Chemical compound COC(=O)C1=C(Cl)C=CC(O)=C1Cl VQMDSJOGHWUVSO-UHFFFAOYSA-N 0.000 description 1
- QODPBEHOIIOUNV-UHFFFAOYSA-N methyl 2,6-dichloro-3-phenylmethoxybenzoate Chemical compound COC(=O)C1=C(Cl)C=CC(OCC=2C=CC=CC=2)=C1Cl QODPBEHOIIOUNV-UHFFFAOYSA-N 0.000 description 1
- PXJKQTNNXCVMOY-UHFFFAOYSA-N methyl 2,6-dichloro-4-methoxybenzoate Chemical compound COC(=O)C1=C(Cl)C=C(OC)C=C1Cl PXJKQTNNXCVMOY-UHFFFAOYSA-N 0.000 description 1
- JCWPOAFRJQXRKG-UHFFFAOYSA-N methyl 2-chloro-6-chlorosulfonylbenzoate Chemical compound COC(=O)C1=C(Cl)C=CC=C1S(Cl)(=O)=O JCWPOAFRJQXRKG-UHFFFAOYSA-N 0.000 description 1
- TWTIKIBYZKYPLP-UHFFFAOYSA-N methyl 2-chlorosulfonyl-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1S(Cl)(=O)=O TWTIKIBYZKYPLP-UHFFFAOYSA-N 0.000 description 1
- WNAFVJVEADYQAI-UHFFFAOYSA-N methyl 2-phenylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C1=CC=CC=C1 WNAFVJVEADYQAI-UHFFFAOYSA-N 0.000 description 1
- 229940120152 methyl 3-hydroxybenzoate Drugs 0.000 description 1
- QCXIFBNFVHBKCI-UHFFFAOYSA-N methyl 4-hydroxy-2,6-dimethylbenzoate Chemical compound COC(=O)C1=C(C)C=C(O)C=C1C QCXIFBNFVHBKCI-UHFFFAOYSA-N 0.000 description 1
- XCLPMJCREWXBDF-UHFFFAOYSA-N methyl 4-methoxy-2-propoxybenzoate Chemical compound CCCOC1=CC(OC)=CC=C1C(=O)OC XCLPMJCREWXBDF-UHFFFAOYSA-N 0.000 description 1
- XYDYWTJEGDZLTH-UHFFFAOYSA-N methylenetriphenylphosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=C)C1=CC=CC=C1 XYDYWTJEGDZLTH-UHFFFAOYSA-N 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- PLSYPGKOSAWICF-UHFFFAOYSA-N n,n,2-triethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1CC PLSYPGKOSAWICF-UHFFFAOYSA-N 0.000 description 1
- VGIVLIHKENZQHQ-UHFFFAOYSA-N n,n,n',n'-tetramethylmethanediamine Chemical compound CN(C)CN(C)C VGIVLIHKENZQHQ-UHFFFAOYSA-N 0.000 description 1
- PYYRMECYOCNUAG-UHFFFAOYSA-N n,n-dibenzyl-2-bromoacetamide Chemical compound C=1C=CC=CC=1CN(C(=O)CBr)CC1=CC=CC=C1 PYYRMECYOCNUAG-UHFFFAOYSA-N 0.000 description 1
- MAFDZJAAWZBOGB-UHFFFAOYSA-N n,n-diethyl-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(C(F)(F)F)C(F)(F)F)C=CC=C1S(N)(=O)=O MAFDZJAAWZBOGB-UHFFFAOYSA-N 0.000 description 1
- CPOOVCYSZPXMSX-UHFFFAOYSA-N n,n-diethyl-2-(1,1,1-trifluoropropan-2-yl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(C)C(F)(F)F CPOOVCYSZPXMSX-UHFFFAOYSA-N 0.000 description 1
- UQMOFOIGNYOFLH-UHFFFAOYSA-N n,n-diethyl-2-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(Cl)(Cl)Cl UQMOFOIGNYOFLH-UHFFFAOYSA-N 0.000 description 1
- UKTAHUUHLAKXHN-UHFFFAOYSA-N n,n-diethyl-2-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(F)(F)F UKTAHUUHLAKXHN-UHFFFAOYSA-N 0.000 description 1
- ZFIIUAIWXACNKN-UHFFFAOYSA-N n,n-diethyl-2-methoxybenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1OC ZFIIUAIWXACNKN-UHFFFAOYSA-N 0.000 description 1
- XUJWEGBRMWSBLI-UHFFFAOYSA-N n,n-diethyl-2-pentan-3-yl-6-sulfamoylbenzamide Chemical compound CCC(CC)C1=CC=CC(S(N)(=O)=O)=C1C(=O)N(CC)CC XUJWEGBRMWSBLI-UHFFFAOYSA-N 0.000 description 1
- GCYCIZXGEFVREK-UHFFFAOYSA-N n,n-diethyl-2-propylbenzamide Chemical compound CCCC1=CC=CC=C1C(=O)N(CC)CC GCYCIZXGEFVREK-UHFFFAOYSA-N 0.000 description 1
- NOJMEBSLFMCECA-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-4-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1S(N)(=O)=O NOJMEBSLFMCECA-UHFFFAOYSA-N 0.000 description 1
- VWSZYIHFBWZHMH-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-4-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(F)(F)F)C=C1S(N)(=O)=O VWSZYIHFBWZHMH-UHFFFAOYSA-N 0.000 description 1
- JAUGIHJLEBTFHE-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(1,1,1-trifluoropropan-2-yl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)C(F)(F)F)C=CC=C1S(N)(=O)=O JAUGIHJLEBTFHE-UHFFFAOYSA-N 0.000 description 1
- MUENLESMFGCZMO-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(Cl)(Cl)Cl)C=CC=C1S(N)(=O)=O MUENLESMFGCZMO-UHFFFAOYSA-N 0.000 description 1
- TUMBBYOKEOPGDW-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(F)(F)F)C=CC=C1S(N)(=O)=O TUMBBYOKEOPGDW-UHFFFAOYSA-N 0.000 description 1
- OXTGQBUZGBZLPS-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C(OC)=C1C(C)C OXTGQBUZGBZLPS-UHFFFAOYSA-N 0.000 description 1
- JIINXSMAUVPAPI-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propylbenzamide Chemical compound CCCC1=C(OC)C(OC)=CC=C1C(=O)N(CC)CC JIINXSMAUVPAPI-UHFFFAOYSA-N 0.000 description 1
- NRTUBAKONZTQMO-UHFFFAOYSA-N n,n-diethyl-4,5-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC(OC)=C(OC)C=C1C(C)C NRTUBAKONZTQMO-UHFFFAOYSA-N 0.000 description 1
- OHUSWGCHTXXTKX-UHFFFAOYSA-N n,n-diethyl-4-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 OHUSWGCHTXXTKX-UHFFFAOYSA-N 0.000 description 1
- VJRNKTIPLLABAU-UHFFFAOYSA-N n,n-diethyl-4-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(F)(F)F)C=C1 VJRNKTIPLLABAU-UHFFFAOYSA-N 0.000 description 1
- WJHWLEBLOGOEHP-UHFFFAOYSA-N n,n-diethyl-4-fluoro-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)C)C=C(F)C=C1S(N)(=O)=O WJHWLEBLOGOEHP-UHFFFAOYSA-N 0.000 description 1
- QDLFLVWJFFVBSL-UHFFFAOYSA-N n,n-diethyl-4-fluoro-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(F)C=C1C(C)C QDLFLVWJFFVBSL-UHFFFAOYSA-N 0.000 description 1
- IDNGNZOXBMVMLM-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C=C1C(C)C IDNGNZOXBMVMLM-UHFFFAOYSA-N 0.000 description 1
- JRANTASDNKJMDA-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propoxy-6-sulfamoylbenzamide Chemical compound CCCOC1=CC(OC)=CC(S(N)(=O)=O)=C1C(=O)N(CC)CC JRANTASDNKJMDA-UHFFFAOYSA-N 0.000 description 1
- LGDSDEKQBNLQJE-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propoxybenzamide Chemical compound CCCOC1=CC(OC)=CC=C1C(=O)N(CC)CC LGDSDEKQBNLQJE-UHFFFAOYSA-N 0.000 description 1
- 229940078490 n,n-dimethylglycine Drugs 0.000 description 1
- PJSOCBVWZJGTHW-UHFFFAOYSA-N n-(1h-indazol-5-yl)-5-[3-methoxy-4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,3-oxazol-2-amine Chemical compound C1=C(OC)C(OCCOCCOC)=CC=C1C(O1)=CN=C1NC1=CC=C(NN=C2)C2=C1 PJSOCBVWZJGTHW-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NAEQOMGNFMHTGE-UHFFFAOYSA-N n-ethylethanamine;phosphane Chemical compound P.CCNCC NAEQOMGNFMHTGE-UHFFFAOYSA-N 0.000 description 1
- SEXOVMIIVBKGGM-UHFFFAOYSA-N naphthalene-1-thiol Chemical compound C1=CC=C2C(S)=CC=CC2=C1 SEXOVMIIVBKGGM-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- DKUHKFWGKPOCME-UHFFFAOYSA-N o-[(2-benzyl-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)] n,n-diethylcarbamothioate Chemical compound CC(C)C1=CC(OC(=S)N(CC)CC)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 DKUHKFWGKPOCME-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N ortho-methoxybenzoic acid Natural products COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 210000001819 pancreatic juice Anatomy 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- SNZXFRFQGXSSGN-UHFFFAOYSA-N phenylsulfanyloxysulfanylbenzene Chemical compound C=1C=CC=CC=1SOSC1=CC=CC=C1 SNZXFRFQGXSSGN-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- KNCYXPMJDCCGSJ-UHFFFAOYSA-N piperidine-2,6-dione Chemical class O=C1CCCC(=O)N1 KNCYXPMJDCCGSJ-UHFFFAOYSA-N 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 230000006965 reversible inhibition Effects 0.000 description 1
- 239000013037 reversible inhibitor Substances 0.000 description 1
- IXTYVGVNWHFZBK-UHFFFAOYSA-N s-benzyl benzenecarbothioate Chemical compound C=1C=CC=CC=1C(=O)SCC1=CC=CC=C1 IXTYVGVNWHFZBK-UHFFFAOYSA-N 0.000 description 1
- ZCTQGTTXIYCGGC-UHFFFAOYSA-N salicylic acid benzyl ester Natural products OC1=CC=CC=C1C(=O)OCC1=CC=CC=C1 ZCTQGTTXIYCGGC-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000003001 serine protease inhibitor Substances 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- XYGBKMMCQDZQOZ-UHFFFAOYSA-M sodium;4-hydroxybutanoate Chemical compound [Na+].OCCCC([O-])=O XYGBKMMCQDZQOZ-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- LFJTTZCBJLCUIV-UHFFFAOYSA-N tert-butyl 4-(2-bromoacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CBr)CC1 LFJTTZCBJLCUIV-UHFFFAOYSA-N 0.000 description 1
- YZUAOVCUGSBIPP-UHFFFAOYSA-N tert-butyl N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate Chemical compound C1=CC=CN2C(C(NC(=O)OC(C)(C)C)C)=NN=C21 YZUAOVCUGSBIPP-UHFFFAOYSA-N 0.000 description 1
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 101150054171 thf1 gene Proteins 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- ZCPSWAFANXCCOT-UHFFFAOYSA-N trichloromethanesulfonyl chloride Chemical compound ClC(Cl)(Cl)S(Cl)(=O)=O ZCPSWAFANXCCOT-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- GRGCWBWNLSTIEN-UHFFFAOYSA-N trifluoromethanesulfonyl chloride Chemical compound FC(F)(F)S(Cl)(=O)=O GRGCWBWNLSTIEN-UHFFFAOYSA-N 0.000 description 1
- MFLLMKMFWIUACU-UHFFFAOYSA-N trifluoromethanethiol Chemical compound FC(F)(F)S MFLLMKMFWIUACU-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000002753 trypsin inhibitor Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6536—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms
- C07F9/6539—Five-membered rings
- C07F9/6541—Five-membered rings condensed with carbocyclic rings or carbocyclic ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Rheumatology (AREA)
- Pulmonology (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Indole Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Peptides Or Proteins (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Detergent Compositions (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/965,593 US5306818A (en) | 1990-11-01 | 1992-10-23 | Tetrahydro 2-saccharinylmerthyl aryl carboxylates |
| US965593 | 1993-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| JPH06211849A true JPH06211849A (ja) | 1994-08-02 |
Family
ID=25510194
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP5231485A Withdrawn JPH06211849A (ja) | 1992-10-23 | 1993-09-17 | タンパク質分解酵素阻害剤として有用な新規なアリールカルボン酸2−サッカリニルメチル類、その組成物および使用方法 |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US5306818A (enExample) |
| EP (1) | EP0594257B1 (enExample) |
| JP (1) | JPH06211849A (enExample) |
| KR (1) | KR940009183A (enExample) |
| AT (1) | ATE140227T1 (enExample) |
| AU (1) | AU679446B2 (enExample) |
| CA (1) | CA2105731A1 (enExample) |
| CZ (1) | CZ221093A3 (enExample) |
| DE (1) | DE69303573T2 (enExample) |
| DK (1) | DK0594257T3 (enExample) |
| ES (1) | ES2092751T3 (enExample) |
| FI (1) | FI934675A7 (enExample) |
| GR (1) | GR3021300T3 (enExample) |
| HU (1) | HUT68879A (enExample) |
| IL (2) | IL107315A (enExample) |
| MX (1) | MX9305196A (enExample) |
| MY (1) | MY131384A (enExample) |
| NO (1) | NO304375B1 (enExample) |
| NZ (1) | NZ248360A (enExample) |
| SG (1) | SG50627A1 (enExample) |
| SK (1) | SK116693A3 (enExample) |
| TW (1) | TW272973B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5550139A (en) * | 1994-01-03 | 1996-08-27 | The Wichita State University | Serine protease inhibitors |
| DE4427997A1 (de) * | 1994-08-08 | 1996-02-15 | Basf Ag | 5-Hydroxypyrazol-4-yl-carbonyl-substituierte Saccharinderivate |
| DE4427995A1 (de) * | 1994-08-08 | 1996-02-15 | Basf Ag | Saccharinderivate |
| DE4427998A1 (de) * | 1994-08-08 | 1996-02-15 | Basf Ag | Saccharinderivate |
| US5556909A (en) * | 1994-12-02 | 1996-09-17 | Sanofi Winthrop Inc. | Substituted 2-arylcarbonyloxymethyl-1,2,5-thiadiazolidin-3-one 1,1-dioxide derivatives and compositions and method of use thereof |
| HUP0000957A3 (en) * | 1997-03-10 | 2001-02-28 | Basf Ag | Saccharine-5-carbonyl-cyclohexane-1,3,5-trione derivatives, and herbicide compositions containing these compounds |
| US6420401B1 (en) | 1997-08-22 | 2002-07-16 | Wichita State University | 1,2,5, thiadiazolidin-3-one 1,1-dioxide derivatives |
| WO2001017501A1 (en) * | 1999-09-10 | 2001-03-15 | The Procter & Gamble Company | Enzyme inhibitors |
| TWI462745B (zh) * | 2005-04-28 | 2014-12-01 | Takeda Pharmaceutical | 安定的乳化組成物 |
| US10058542B1 (en) | 2014-09-12 | 2018-08-28 | Thioredoxin Systems Ab | Composition comprising selenazol or thiazolone derivatives and silver and method of treatment therewith |
| CN110709396A (zh) | 2017-04-06 | 2020-01-17 | 伊文蒂瓦公司 | Yap/taz-tead相互作用的新化合物抑制剂及其在治疗恶性间皮瘤中的用途 |
| EP3632908A1 (en) | 2018-10-02 | 2020-04-08 | Inventiva | Inhibitors of the yap/taz-tead interaction and their use in the treatment of cancer |
| CN119751424B (zh) * | 2025-01-04 | 2025-12-05 | 重庆圣华曦药业股份有限公司 | 一种合成甲磺酸贝舒地尔的方法 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3002884A (en) * | 1959-04-15 | 1961-10-03 | Rohm & Haas | Horticultural process with n-halomethyl-1,2-benzisothiazolin - 3 - one-1,1-dioxides for controlling fungus diseases |
| US3314960A (en) * | 1964-08-25 | 1967-04-18 | American Home Prod | Benzisothiazol glutarimides |
| FR1451417A (fr) * | 1965-07-15 | 1966-01-07 | Roussel Uclaf | Nouveaux esters d'acides cycliques et leur procédé de préparation |
| JPS4835457A (enExample) * | 1971-09-02 | 1973-05-24 | ||
| US4195023A (en) * | 1975-08-20 | 1980-03-25 | Merck & Co., Inc. | 2-(2-Furoyl)1,2-benzisothiazole-3-one, 2-(2-furoyl) saccharin, and 2-(2-thenoyl) saccharin |
| US4276298A (en) * | 1978-03-24 | 1981-06-30 | Merck & Co., Inc. | 2-Aryl-1,2-benzisothiazolinone-1,1-dioxides and their use as selective protease inhibitors |
| US4263393A (en) * | 1979-09-06 | 1981-04-21 | Eastman Kodak Company | Novel electron donor precursors and photographic element containing them |
| ATE7296T1 (de) * | 1979-10-08 | 1984-05-15 | Merck & Co. Inc. | 2-aryl-1,2-benzisothiazolinon-1,1-dioxide und sie enthaltende pharmazeutische zusammensetzungen. |
| US4350752A (en) * | 1980-12-29 | 1982-09-21 | Eastman Kodak Company | Photographic elements and film units containing imidomethyl blocked photographic reagents |
| US4363865A (en) * | 1981-03-04 | 1982-12-14 | Eastman Kodak Company | Imido methyl blocked photographic dyes and dye releasing compounds |
| US4410618A (en) * | 1982-06-11 | 1983-10-18 | Eastman Kodak Company | Blocked photographic reagents |
| US4623645A (en) * | 1983-04-18 | 1986-11-18 | Merck & Co., Inc. | Substituted cephalosporin sulfoxides as anti-inflammatory and antidegenerative agents |
| US4547371A (en) * | 1983-04-18 | 1985-10-15 | Merck & Co., Inc. | Substituted cephalosporin sulfones as anti-inflammatory and anti-degenerative agents |
| US4659855A (en) * | 1983-05-09 | 1987-04-21 | Georgia Tech Research Corporation | Aryl sulfonyl fluoride compounds |
| DE3617976A1 (de) * | 1986-05-28 | 1988-01-14 | Alter Sa | 1,4-dihydropyridin, verfahren zu dessen herstellung und dessen verwendung in antithrombotischen medikamenten |
| US5236917A (en) * | 1989-05-04 | 1993-08-17 | Sterling Winthrop Inc. | Saccharin derivatives useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| JPH04507095A (ja) * | 1989-05-04 | 1992-12-10 | サノフィ | 蛋白分解酵素阻害剤として有用なサッカリン誘導体及びその製造 |
| FR2659327A1 (fr) * | 1990-03-08 | 1991-09-13 | Centre Nat Rech Scient | Derives du benzisothiazolinone-1-dioxyde, utilisables comme inhibiteurs des elastases. |
| AU642537B2 (en) * | 1990-11-01 | 1993-10-21 | Sanofi | 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| AU656027B2 (en) * | 1991-11-15 | 1995-01-19 | Sanofi | Saccharin derivative proteolytic enzime inhibitors |
| AU653279B2 (en) * | 1991-12-30 | 1994-09-22 | Sanofi | Novel 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| TW226016B (enExample) * | 1991-12-30 | 1994-07-01 | Sterling Winthrop Inc |
-
1992
- 1992-10-23 US US07/965,593 patent/US5306818A/en not_active Expired - Fee Related
-
1993
- 1993-08-09 NZ NZ248360A patent/NZ248360A/en unknown
- 1993-08-10 AU AU44526/93A patent/AU679446B2/en not_active Ceased
- 1993-08-20 KR KR1019930016236A patent/KR940009183A/ko not_active Ceased
- 1993-09-08 CA CA002105731A patent/CA2105731A1/en not_active Abandoned
- 1993-09-17 JP JP5231485A patent/JPH06211849A/ja not_active Withdrawn
- 1993-09-22 TW TW082107789A patent/TW272973B/zh active
- 1993-09-26 MX MX9305196A patent/MX9305196A/es not_active IP Right Cessation
- 1993-10-18 IL IL10731593A patent/IL107315A/en not_active IP Right Cessation
- 1993-10-18 IL IL107315A patent/IL107315A0/xx unknown
- 1993-10-19 CZ CZ932210A patent/CZ221093A3/cs unknown
- 1993-10-20 EP EP93202925A patent/EP0594257B1/en not_active Expired - Lifetime
- 1993-10-20 DK DK93202925.9T patent/DK0594257T3/da active
- 1993-10-20 AT AT93202925T patent/ATE140227T1/de not_active IP Right Cessation
- 1993-10-20 SG SG1996007173A patent/SG50627A1/en unknown
- 1993-10-20 ES ES93202925T patent/ES2092751T3/es not_active Expired - Lifetime
- 1993-10-20 DE DE69303573T patent/DE69303573T2/de not_active Expired - Fee Related
- 1993-10-22 NO NO933817A patent/NO304375B1/no unknown
- 1993-10-22 HU HU9303009A patent/HUT68879A/hu unknown
- 1993-10-22 SK SK1166-93A patent/SK116693A3/sk unknown
- 1993-10-22 FI FI934675A patent/FI934675A7/fi unknown
- 1993-10-22 MY MYPI93002196A patent/MY131384A/en unknown
-
1996
- 1996-10-09 GR GR960402671T patent/GR3021300T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE69303573D1 (de) | 1996-08-14 |
| GR3021300T3 (en) | 1997-01-31 |
| DE69303573T2 (de) | 1997-02-27 |
| CZ221093A3 (en) | 1994-05-18 |
| FI934675A0 (fi) | 1993-10-22 |
| IL107315A0 (en) | 1994-01-25 |
| MX9305196A (es) | 1994-05-31 |
| SK116693A3 (en) | 1995-02-08 |
| DK0594257T3 (da) | 1996-11-11 |
| EP0594257B1 (en) | 1996-07-10 |
| HU9303009D0 (en) | 1994-01-28 |
| TW272973B (enExample) | 1996-03-21 |
| US5306818A (en) | 1994-04-26 |
| AU679446B2 (en) | 1997-07-03 |
| EP0594257A1 (en) | 1994-04-27 |
| NO933817D0 (no) | 1993-10-22 |
| AU4452693A (en) | 1994-05-05 |
| NZ248360A (en) | 1995-08-28 |
| FI934675A7 (fi) | 1994-04-24 |
| ES2092751T3 (es) | 1996-12-01 |
| ATE140227T1 (de) | 1996-07-15 |
| KR940009183A (ko) | 1994-05-20 |
| NO933817L (no) | 1994-04-25 |
| SG50627A1 (en) | 1998-07-20 |
| HUT68879A (en) | 1995-08-28 |
| CA2105731A1 (en) | 1994-04-24 |
| NO304375B1 (no) | 1998-12-07 |
| MY131384A (en) | 2007-08-30 |
| IL107315A (en) | 1999-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5783589A (en) | 2-saccharinylmethyl aryl and arloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| JPH06211849A (ja) | タンパク質分解酵素阻害剤として有用な新規なアリールカルボン酸2−サッカリニルメチル類、その組成物および使用方法 | |
| US5488062A (en) | 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| FI103112B (fi) | Menetelmä proteolyyttisen entsyymin inhibiittoreina käyttökelpoisten 2 -sakkarinyylimetyyliaryylikarboksylaattien valmistamiseksi | |
| US5128339A (en) | Proteolytic enzyme inhibition method | |
| US5250696A (en) | 2-saccharinylmethyl aryl carboxylate | |
| RU2091377C1 (ru) | 2-сахаринилметил- или 4,5,6,7-тетрагидро-2-сахаринилметилфосфаты, -фосфонаты или -фосфинаты и фармацевтическая композиция на их основе | |
| US5597841A (en) | 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| JPH06228177A (ja) | タンパク質分解酵素阻害剤として有用な新規2−サッカリニルメチルホスフェート、ホスホネート及びホスフィネート | |
| IL119685A (en) | 4,5,6,7-tetrahydro-2-saccharinylmethyl aryl and aryloxy acetates | |
| IL114773A (en) | 2-Tetrahydro-saccharinylmethyl aryl carboxylates their preparation and pharmaceutical compositions containing them |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A300 | Application deemed to be withdrawn because no request for examination was validly filed |
Free format text: JAPANESE INTERMEDIATE CODE: A300 Effective date: 20001128 |