JPH0568466B2 - - Google Patents
Info
- Publication number
- JPH0568466B2 JPH0568466B2 JP8511122A JP1112285A JPH0568466B2 JP H0568466 B2 JPH0568466 B2 JP H0568466B2 JP 8511122 A JP8511122 A JP 8511122A JP 1112285 A JP1112285 A JP 1112285A JP H0568466 B2 JPH0568466 B2 JP H0568466B2
- Authority
- JP
- Japan
- Prior art keywords
- hydrogen
- formula
- oxo
- quinoline
- carboxylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims description 40
- -1 hydroxy-substituted phenyl group Chemical group 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 150000002431 hydrogen Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- GXGJIOMUZAGVEH-UHFFFAOYSA-N Chamazulene Chemical group CCC1=CC=C(C)C2=CC=C(C)C2=C1 GXGJIOMUZAGVEH-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims 6
- 125000003282 alkyl amino group Chemical group 0.000 claims 4
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 44
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 28
- 239000000203 mixture Substances 0.000 description 23
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 22
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 22
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 4
- IFNWESYYDINUHV-UHFFFAOYSA-N 2,6-dimethylpiperazine Chemical compound CC1CNCC(C)N1 IFNWESYYDINUHV-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- JHHZLHWJQPUNKB-UHFFFAOYSA-N pyrrolidin-3-ol Chemical compound OC1CCNC1 JHHZLHWJQPUNKB-UHFFFAOYSA-N 0.000 description 4
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical group C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 230000003115 biocidal effect Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- KWDVJYLIAJHEOW-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(F)C(F)=C1F KWDVJYLIAJHEOW-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- HDCCJUCOIKLZNM-UHFFFAOYSA-N n-pyrrolidin-3-ylacetamide Chemical compound CC(=O)NC1CCNC1 HDCCJUCOIKLZNM-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 150000003248 quinolines Chemical class 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical group C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical group CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 2
- SNZSGXYIECMAGY-UHFFFAOYSA-N 5-(4-fluorophenyl)-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid Chemical compound C12=CC=3OCOC=3C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 SNZSGXYIECMAGY-UHFFFAOYSA-N 0.000 description 2
- GWYWORGKFDQQDR-UHFFFAOYSA-N 5-(4-hydroxyphenyl)-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid Chemical compound C12=CC=3OCOC=3C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(O)C=C1 GWYWORGKFDQQDR-UHFFFAOYSA-N 0.000 description 2
- ZIVRWYNUCZNRHY-UHFFFAOYSA-N 5-(4-methoxyphenyl)-8-oxo-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid Chemical compound C1=CC(OC)=CC=C1N1C2=CC(OCO3)=C3C=C2C(=O)C(C(O)=O)=C1 ZIVRWYNUCZNRHY-UHFFFAOYSA-N 0.000 description 2
- UZMFIWOHBVVVQV-UHFFFAOYSA-N 6,8-difluoro-1-(4-fluorophenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 UZMFIWOHBVVVQV-UHFFFAOYSA-N 0.000 description 2
- WBSMYKBTVQONBQ-UHFFFAOYSA-N 6,8-difluoro-1-(4-hydroxyphenyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(O)C=C1 WBSMYKBTVQONBQ-UHFFFAOYSA-N 0.000 description 2
- BJBXYKUCVIHUPN-UHFFFAOYSA-N 6,8-difluoro-4-oxo-1-phenyl-7-pyrrolidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 BJBXYKUCVIHUPN-UHFFFAOYSA-N 0.000 description 2
- CZRQTENFPFMNKL-UHFFFAOYSA-N 6,8-difluoro-7-(2-hydroxyethylamino)-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical group FC=1C(NCCO)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=CC=C1 CZRQTENFPFMNKL-UHFFFAOYSA-N 0.000 description 2
- YDIMYCBPIFNBRM-UHFFFAOYSA-N 6,8-difluoro-7-(3-hydroxypyrrolidin-1-yl)-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C1C(O)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC=CC=3)C2=C1F YDIMYCBPIFNBRM-UHFFFAOYSA-N 0.000 description 2
- UATOSTMTFSFXKR-UHFFFAOYSA-N 6,8-difluoro-7-hydrazinyl-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound FC=1C(NN)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=CC=C1 UATOSTMTFSFXKR-UHFFFAOYSA-N 0.000 description 2
- MISWKBJYRUSEQI-UHFFFAOYSA-N 6,8-difluoro-7-morpholin-4-yl-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 MISWKBJYRUSEQI-UHFFFAOYSA-N 0.000 description 2
- PNEHWOALOQLSME-UHFFFAOYSA-N 6-fluoro-1-(4-fluorophenyl)-4-oxo-7-pyridin-4-ylquinoline-3-carboxylic acid Chemical compound C12=CC(C=3C=CN=CC=3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 PNEHWOALOQLSME-UHFFFAOYSA-N 0.000 description 2
- ZPXFWKRWHCLHDG-UHFFFAOYSA-N 6-fluoro-4-oxo-1-phenyl-7-pyridin-4-ylquinoline-3-carboxylic acid Chemical compound C12=CC(C=3C=CN=CC=3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 ZPXFWKRWHCLHDG-UHFFFAOYSA-N 0.000 description 2
- KNKODDVZZBFNQB-UHFFFAOYSA-N 7-(3,5-dimethylpiperazin-1-yl)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(C)NC(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(O)=CC=3)C2=C1F KNKODDVZZBFNQB-UHFFFAOYSA-N 0.000 description 2
- ZRAOKMRKMIUHBV-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(O)=CC=3)C2=C1F ZRAOKMRKMIUHBV-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 230000002458 infectious effect Effects 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical group COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical compound CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 1
- DTYLXDLAOLOTKT-UHFFFAOYSA-N 1,4-dihydroquinoline-3-carboxylic acid Chemical compound C1=CC=C2CC(C(=O)O)=CNC2=C1 DTYLXDLAOLOTKT-UHFFFAOYSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical class CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- SFKRXQKJTIYUAG-UHFFFAOYSA-N 2,3,4,5-tetrafluorobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C(F)=C1F SFKRXQKJTIYUAG-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical group NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- GUFVLIDVTHOZEJ-UHFFFAOYSA-N 4-oxo-7-piperazin-1-yl-1h-quinoline-3-carboxylic acid Chemical group C=1C=C2C(=O)C(C(=O)O)=CNC2=CC=1N1CCNCC1 GUFVLIDVTHOZEJ-UHFFFAOYSA-N 0.000 description 1
- NSRDBSTUJJKANY-UHFFFAOYSA-N 6,7,8-trifluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 NSRDBSTUJJKANY-UHFFFAOYSA-N 0.000 description 1
- AZPOPHWZZLZNJB-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 AZPOPHWZZLZNJB-UHFFFAOYSA-N 0.000 description 1
- DFIMGEUWHILFCF-UHFFFAOYSA-N 6,8-difluoro-1-(4-fluorophenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 DFIMGEUWHILFCF-UHFFFAOYSA-N 0.000 description 1
- HCEABVJPPQSYTI-UHFFFAOYSA-N 6,8-difluoro-1-(4-fluorophenyl)-4-oxo-7-pyrrolidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 HCEABVJPPQSYTI-UHFFFAOYSA-N 0.000 description 1
- KLKHDURINXBXNN-UHFFFAOYSA-N 6,8-difluoro-1-(4-fluorophenyl)-7-(3-hydroxypyrrolidin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(O)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(F)=CC=3)C2=C1F KLKHDURINXBXNN-UHFFFAOYSA-N 0.000 description 1
- YAYGJMVQQPDFOW-UHFFFAOYSA-N 6,8-difluoro-1-(4-fluorophenyl)-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 YAYGJMVQQPDFOW-UHFFFAOYSA-N 0.000 description 1
- HMLHICCPIUHQIK-UHFFFAOYSA-N 6,8-difluoro-1-(4-hydroxyphenyl)-4-oxo-7-piperidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(O)C=C1 HMLHICCPIUHQIK-UHFFFAOYSA-N 0.000 description 1
- JVACMVCHDLEBIP-UHFFFAOYSA-N 6,8-difluoro-1-(4-hydroxyphenyl)-7-(3-hydroxypyrrolidin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(O)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(O)=CC=3)C2=C1F JVACMVCHDLEBIP-UHFFFAOYSA-N 0.000 description 1
- ZZFGRSLBKNLDPF-UHFFFAOYSA-N 6,8-difluoro-4-oxo-1-phenyl-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 ZZFGRSLBKNLDPF-UHFFFAOYSA-N 0.000 description 1
- MOFNSPNUBJRLNH-UHFFFAOYSA-N 6,8-difluoro-4-oxo-1-phenyl-7-piperidin-1-ylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 MOFNSPNUBJRLNH-UHFFFAOYSA-N 0.000 description 1
- NLCHCTYJNASGGK-UHFFFAOYSA-N 6-fluoro-1-(4-methoxyphenyl)-4-oxo-7-pyridin-4-ylquinoline-3-carboxylic acid Chemical compound C1=CC(OC)=CC=C1N1C2=CC(C=3C=CN=CC=3)=C(F)C=C2C(=O)C(C(O)=O)=C1 NLCHCTYJNASGGK-UHFFFAOYSA-N 0.000 description 1
- ZVWFACDUYQZIAU-UHFFFAOYSA-N 7-(1,4-diazepan-1-yl)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(F)C=C1 ZVWFACDUYQZIAU-UHFFFAOYSA-N 0.000 description 1
- XKCYCPWUDDFATN-UHFFFAOYSA-N 7-(1,4-diazepan-1-yl)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=C(O)C=C1 XKCYCPWUDDFATN-UHFFFAOYSA-N 0.000 description 1
- VQVGOGKVACJJOU-UHFFFAOYSA-N 7-(1,4-diazepan-1-yl)-6,8-difluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C12=C(F)C(N3CCNCCC3)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 VQVGOGKVACJJOU-UHFFFAOYSA-N 0.000 description 1
- XABYJPIFFSLARM-UHFFFAOYSA-N 7-(2,2-dimethylhydrazinyl)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound CN(C)NC1=C(F)C2=C(C=C1F)C(=O)C(=CN2C1=CC=C(F)C=C1)C(O)=O XABYJPIFFSLARM-UHFFFAOYSA-N 0.000 description 1
- MIUZEHGTGIHQSQ-UHFFFAOYSA-N 7-(2,2-dimethylhydrazinyl)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C(NN(C)C)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=C(O)C=C1 MIUZEHGTGIHQSQ-UHFFFAOYSA-N 0.000 description 1
- HRTCDSIEOHEZPX-UHFFFAOYSA-N 7-(3,5-dimethylpiperazin-1-yl)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(C)NC(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(F)=CC=3)C2=C1F HRTCDSIEOHEZPX-UHFFFAOYSA-N 0.000 description 1
- VBTUWNUJKDMGDZ-UHFFFAOYSA-N 7-(3,5-dimethylpiperazin-1-yl)-6,8-difluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C1C(C)NC(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC=CC=3)C2=C1F VBTUWNUJKDMGDZ-UHFFFAOYSA-N 0.000 description 1
- KFHGSAPUJIZQBJ-UHFFFAOYSA-N 7-(3-acetamidopyrrolidin-1-yl)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC(=O)C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(F)=CC=3)C2=C1F KFHGSAPUJIZQBJ-UHFFFAOYSA-N 0.000 description 1
- VIGLEJIDDBINRU-UHFFFAOYSA-N 7-(3-acetamidopyrrolidin-1-yl)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC(=O)C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(O)=CC=3)C2=C1F VIGLEJIDDBINRU-UHFFFAOYSA-N 0.000 description 1
- IEYZQQXRGMRJFG-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-6,8-difluoro-1-(2-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C(=CC=CC=3)F)C2=C1F IEYZQQXRGMRJFG-UHFFFAOYSA-N 0.000 description 1
- XWBPBLQMORFHBV-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC(F)=CC=3)C2=C1F XWBPBLQMORFHBV-UHFFFAOYSA-N 0.000 description 1
- CSXBYQBATDXXAT-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-6,8-difluoro-4-oxo-1-phenylquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1C(N)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC=CC=3)C2=C1F CSXBYQBATDXXAT-UHFFFAOYSA-N 0.000 description 1
- ZXMGTLNDSFNZAZ-UHFFFAOYSA-N 7-(4-ethoxycarbonylpiperazin-1-yl)-6,8-difluoro-4-oxo-1-phenylquinoline-3-carboxylic acid Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C=3C=CC=CC=3)C2=C1F ZXMGTLNDSFNZAZ-UHFFFAOYSA-N 0.000 description 1
- AMFGDTWPQPDLCO-UHFFFAOYSA-N 7-(diethylamino)-6,8-difluoro-1-(4-fluorophenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C(N(CC)CC)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=C(F)C=C1 AMFGDTWPQPDLCO-UHFFFAOYSA-N 0.000 description 1
- ZMIRMURXRNUOCT-UHFFFAOYSA-N 7-(diethylamino)-6,8-difluoro-1-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC=1C(N(CC)CC)=C(F)C=C(C(C(C(O)=O)=C2)=O)C=1N2C1=CC=C(O)C=C1 ZMIRMURXRNUOCT-UHFFFAOYSA-N 0.000 description 1
- AFWPOUJETIZGDK-UHFFFAOYSA-N 8-oxo-5-phenyl-[1,3]dioxolo[4,5-g]quinoline-7-carboxylic acid Chemical compound C12=CC=3OCOC=3C=C2C(=O)C(C(=O)O)=CN1C1=CC=CC=C1 AFWPOUJETIZGDK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000589291 Acinetobacter Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 241000606125 Bacteroides Species 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 241000589562 Brucella Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 241000588923 Citrobacter Species 0.000 description 1
- 241000193403 Clostridium Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000606790 Haemophilus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000186660 Lactobacillus Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- HGINADPHJQTSKN-UHFFFAOYSA-N Monoethyl malonic acid Chemical compound CCOC(=O)CC(O)=O HGINADPHJQTSKN-UHFFFAOYSA-N 0.000 description 1
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical compound ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 1
- BLIXFGYGJGYPHL-UHFFFAOYSA-N OC1=CC=C(NC=C(C(=O)OCC)C(C2=C(C(=C(C(=C2)F)F)F)F)=O)C=C1 Chemical compound OC1=CC=C(NC=C(C(=O)OCC)C(C2=C(C(=C(C(=C2)F)F)F)F)=O)C=C1 BLIXFGYGJGYPHL-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- 241000206591 Peptococcus Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000192023 Sarcina Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000005041 acyloxyalkyl group Chemical group 0.000 description 1
- 241001148470 aerobic bacillus Species 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical group CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- GKROJQPXJJACRI-UHFFFAOYSA-N ethyl 3-anilino-2-(7-bromo-1,3-benzodioxole-5-carbonyl)prop-2-enoate Chemical compound C=1C=2OCOC=2C(Br)=CC=1C(=O)C(C(=O)OCC)=CNC1=CC=CC=C1 GKROJQPXJJACRI-UHFFFAOYSA-N 0.000 description 1
- LDWYYXGVGLLTCE-UHFFFAOYSA-N ethyl 6,7,8-trifluoro-4-oxo-1-phenylquinoline-3-carboxylate Chemical compound C12=C(F)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1=CC=CC=C1 LDWYYXGVGLLTCE-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 125000005984 hexahydro-1H-1,4-diazepinyl group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940039696 lactobacillus Drugs 0.000 description 1
- 229940099584 lactobionate Drugs 0.000 description 1
- JYTUSYBCFIZPBE-AMTLMPIISA-N lactobionic acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O JYTUSYBCFIZPBE-AMTLMPIISA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- AVAWMINJNRAQFS-UHFFFAOYSA-N n,n-dimethylpyrrolidin-3-amine Chemical compound CN(C)C1CCNC1 AVAWMINJNRAQFS-UHFFFAOYSA-N 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 238000006464 oxidative addition reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 description 1
- KVROVDQWRUAIID-UHFFFAOYSA-N quinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(C(=O)O)=CN=C21 KVROVDQWRUAIID-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 241001148471 unidentified anaerobic bacterium Species 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Landscapes
- Quinoline Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US574225 | 1975-05-05 | ||
US57411984A | 1984-01-26 | 1984-01-26 | |
US574119 | 1984-01-26 | ||
US574224 | 1984-01-26 |
Publications (2)
Publication Number | Publication Date |
---|---|
JPS60163866A JPS60163866A (ja) | 1985-08-26 |
JPH0568466B2 true JPH0568466B2 (xx) | 1993-09-29 |
Family
ID=24294778
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
JP1112285A Granted JPS60163866A (ja) | 1984-01-26 | 1985-01-25 | キノリン系抗菌性化合物 |
Country Status (1)
Country | Link |
---|---|
JP (1) | JPS60163866A (xx) |
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS61251667A (ja) * | 1985-04-30 | 1986-11-08 | Otsuka Pharmaceut Co Ltd | ベンゾヘテロ環化合物 |
ATE247089T1 (de) * | 1996-11-28 | 2003-08-15 | Wakunaga Pharma Co Ltd | Pyridoncarbonsäurederivate oder ihre salze und diese als aktive bestandteile enthaltende medikamente |
-
1985
- 1985-01-25 JP JP1112285A patent/JPS60163866A/ja active Granted
Also Published As
Publication number | Publication date |
---|---|
JPS60163866A (ja) | 1985-08-26 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR900005025B1 (ko) | 퀴놀린 화합물 및 그의 제조방법 | |
US4730000A (en) | Quinoline antibacterial compounds | |
KR920005112B1 (ko) | 7-아미노-1-시클로프로필-6,8-디할로게노-1,4-디히드로-4-옥소-3-퀴놀린카르복실산의 제조방법 | |
US4556658A (en) | 7-Amino-1-cyclopropyl-6,8-difluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acids and antibacterial agents containing these compounds | |
EP0154780B1 (en) | Quinoline antibacterial compounds | |
JPH06279411A (ja) | キノリンカルボン酸誘導体 | |
KR910006635B1 (ko) | 1,7-디아미노-1,4-디하이드로-4-옥소-3-(아자)퀴놀린카복실산의 제조방법 | |
HU195954B (en) | Process for producing 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-3-quinoline-carboxylic acid ester derivatives and pharmaceutics comprising the same | |
US4616019A (en) | Naphthyridine antibacterial compounds | |
EP0160284B1 (en) | Quino-benoxazine antibacterial compounds | |
US4774246A (en) | Quinoline antibacterial compounds | |
EP0288519A1 (en) | 1-tertiary-alkyl-substituted naphthyridine- and quinoline-carboxylic acid antibacterial agents | |
EP0153580B2 (en) | Naphthyridine antibacterial compounds | |
US4607032A (en) | Quino-benoxazine antibacterial compounds | |
US4533663A (en) | Quino-benzothiazine antibacterial compounds | |
JPS61186379A (ja) | 1‐シクロプロピル‐1,4‐ジヒドロ‐4‐オキソ‐7‐[4‐(2‐オキソ‐1,3‐ジオキソル‐4‐イル‐メチル)‐1‐ピペラジニル]‐3‐キノリンカルボン酸 | |
JPH0568466B2 (xx) | ||
EP0162333B1 (en) | Quino-benzothiazine antibacterial compounds | |
US4889857A (en) | Quinolonecarboxylic acid compounds and pharmaceutical use thereof | |
JPH0146512B2 (xx) | ||
JPH03188074A (ja) | 新規キノロン誘導体及びこれを含有する抗菌剤 | |
JPS6320829B2 (xx) | ||
CA1337600C (en) | Quinolone antibacterial compounds | |
US5468861A (en) | 8-chloro-1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid and alkyl esters thereof | |
KR920008164B1 (ko) | 항균작용을 갖는 퀴놀린계 유도체와 그의 제조방법 |