JPH0255413B2 - - Google Patents
Info
- Publication number
- JPH0255413B2 JPH0255413B2 JP61265413A JP26541386A JPH0255413B2 JP H0255413 B2 JPH0255413 B2 JP H0255413B2 JP 61265413 A JP61265413 A JP 61265413A JP 26541386 A JP26541386 A JP 26541386A JP H0255413 B2 JPH0255413 B2 JP H0255413B2
- Authority
- JP
- Japan
- Prior art keywords
- alkylation
- catalyst
- ortho
- tert
- toluenediamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000006243 chemical reaction Methods 0.000 claims description 112
- 239000003054 catalyst Substances 0.000 claims description 86
- 238000005804 alkylation reaction Methods 0.000 claims description 82
- 239000010457 zeolite Substances 0.000 claims description 79
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 70
- 150000004982 aromatic amines Chemical class 0.000 claims description 66
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 59
- 229910021536 Zeolite Inorganic materials 0.000 claims description 54
- 150000001336 alkenes Chemical class 0.000 claims description 43
- 238000000034 method Methods 0.000 claims description 42
- -1 aliphatic acyclic Chemical class 0.000 claims description 27
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 25
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 23
- 230000002378 acidificating effect Effects 0.000 claims description 23
- 229910052761 rare earth metal Inorganic materials 0.000 claims description 22
- 229910052680 mordenite Inorganic materials 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 239000002808 molecular sieve Substances 0.000 claims description 13
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims description 13
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 10
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 150000001768 cations Chemical class 0.000 claims description 7
- 230000002152 alkylating effect Effects 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- 150000002825 nitriles Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000004992 toluidines Chemical class 0.000 claims description 3
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical group CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 claims description 2
- 150000005675 cyclic monoalkenes Chemical class 0.000 claims 1
- AXNUJYHFQHQZBE-UHFFFAOYSA-N toluenediamine group Chemical group C1(=C(C(=CC=C1)N)N)C AXNUJYHFQHQZBE-UHFFFAOYSA-N 0.000 claims 1
- 230000029936 alkylation Effects 0.000 description 70
- 239000000047 product Substances 0.000 description 41
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 30
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 30
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 23
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 20
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 17
- 239000007795 chemical reaction product Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 17
- 238000012360 testing method Methods 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 230000000694 effects Effects 0.000 description 16
- 239000011148 porous material Substances 0.000 description 15
- 150000002910 rare earth metals Chemical group 0.000 description 15
- 229910052708 sodium Inorganic materials 0.000 description 15
- 239000011734 sodium Substances 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- 238000004817 gas chromatography Methods 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 10
- RLYCRLGLCUXUPO-UHFFFAOYSA-N 2,6-diaminotoluene Chemical compound CC1=C(N)C=CC=C1N RLYCRLGLCUXUPO-UHFFFAOYSA-N 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 239000000376 reactant Substances 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 150000001491 aromatic compounds Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 230000003197 catalytic effect Effects 0.000 description 7
- 229910001873 dinitrogen Inorganic materials 0.000 description 7
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 5
- HLDUVPFXLWEZOG-UHFFFAOYSA-N 4-tert-butyl-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(C(C)(C)C)=C(N)C=C1N HLDUVPFXLWEZOG-UHFFFAOYSA-N 0.000 description 5
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000007126 N-alkylation reaction Methods 0.000 description 5
- 239000002168 alkylating agent Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- 230000002153 concerted effect Effects 0.000 description 5
- FRCFWPVMFJMNDP-UHFFFAOYSA-N n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1 FRCFWPVMFJMNDP-UHFFFAOYSA-N 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 4
- JYBTVKOMMYMILH-UHFFFAOYSA-N 1-n-tert-butyl-4-methylbenzene-1,3-diamine Chemical compound CC1=CC=C(NC(C)(C)C)C=C1N JYBTVKOMMYMILH-UHFFFAOYSA-N 0.000 description 4
- OASWMXZSDYLPOU-UHFFFAOYSA-N 3-n,4-ditert-butyl-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(C(C)(C)C)=C(NC(C)(C)C)C=C1N OASWMXZSDYLPOU-UHFFFAOYSA-N 0.000 description 4
- LQIOQITTZDEHKW-UHFFFAOYSA-N 3-n-tert-butyl-4-methylbenzene-1,3-diamine Chemical compound CC1=CC=C(N)C=C1NC(C)(C)C LQIOQITTZDEHKW-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- JIRXMJWTBMPPPH-UHFFFAOYSA-N 1-n,4-ditert-butyl-2-methylbenzene-1,3-diamine Chemical compound CC1=C(NC(C)(C)C)C=CC(C(C)(C)C)=C1N JIRXMJWTBMPPPH-UHFFFAOYSA-N 0.000 description 3
- QIMYUXWJOZCBKT-UHFFFAOYSA-N 1-n,4-ditert-butyl-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(C(C)(C)C)=C(N)C=C1NC(C)(C)C QIMYUXWJOZCBKT-UHFFFAOYSA-N 0.000 description 3
- WKBALTUBRZPIPZ-UHFFFAOYSA-N 2,6-di(propan-2-yl)aniline Chemical compound CC(C)C1=CC=CC(C(C)C)=C1N WKBALTUBRZPIPZ-UHFFFAOYSA-N 0.000 description 3
- YKOLZVXSPGIIBJ-UHFFFAOYSA-N 2-Isopropylaniline Chemical compound CC(C)C1=CC=CC=C1N YKOLZVXSPGIIBJ-UHFFFAOYSA-N 0.000 description 3
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 3
- IUWZLTGXALKGRP-UHFFFAOYSA-N 4,6-ditert-butyl-2-methylbenzene-1,3-diamine Chemical compound CC1=C(N)C(C(C)(C)C)=CC(C(C)(C)C)=C1N IUWZLTGXALKGRP-UHFFFAOYSA-N 0.000 description 3
- DVPHIKHMYFQLKF-UHFFFAOYSA-N 4-tert-butyl-2-methylbenzene-1,3-diamine Chemical compound CC1=C(N)C=CC(C(C)(C)C)=C1N DVPHIKHMYFQLKF-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- WAIPAZQMEIHHTJ-UHFFFAOYSA-N [Cr].[Co] Chemical compound [Cr].[Co] WAIPAZQMEIHHTJ-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000004061 bleaching Methods 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 229910052593 corundum Inorganic materials 0.000 description 3
- 238000003795 desorption Methods 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 229910052901 montmorillonite Inorganic materials 0.000 description 3
- VSHTWPWTCXQLQN-UHFFFAOYSA-N n-butylaniline Chemical compound CCCCNC1=CC=CC=C1 VSHTWPWTCXQLQN-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- LRTFPLFDLJYEKT-UHFFFAOYSA-N para-isopropylaniline Chemical compound CC(C)C1=CC=C(N)C=C1 LRTFPLFDLJYEKT-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000012266 salt solution Substances 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 150000004998 toluenediamines Chemical class 0.000 description 3
- 229910001845 yogo sapphire Inorganic materials 0.000 description 3
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 2
- CTMHWPIWNRWQEG-UHFFFAOYSA-N 1-methylcyclohexene Chemical compound CC1=CCCCC1 CTMHWPIWNRWQEG-UHFFFAOYSA-N 0.000 description 2
- WDOSBGDKLUZTLD-UHFFFAOYSA-N 1-n,3-n-ditert-butyl-4-methylbenzene-1,3-diamine Chemical group CC1=CC=C(NC(C)(C)C)C=C1NC(C)(C)C WDOSBGDKLUZTLD-UHFFFAOYSA-N 0.000 description 2
- FQFPALKHIHTSNY-UHFFFAOYSA-N 2,4,6-tri(propan-2-yl)aniline Chemical group CC(C)C1=CC(C(C)C)=C(N)C(C(C)C)=C1 FQFPALKHIHTSNY-UHFFFAOYSA-N 0.000 description 2
- ZPDPRPHPYMTWMA-UHFFFAOYSA-N 2,4-di(propan-2-yl)aniline Chemical compound CC(C)C1=CC=C(N)C(C(C)C)=C1 ZPDPRPHPYMTWMA-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- GAFYTSWTNFTKFJ-UHFFFAOYSA-N 2-methyl-4-propan-2-ylbenzene-1,3-diamine Chemical compound CC(C)C1=CC=C(N)C(C)=C1N GAFYTSWTNFTKFJ-UHFFFAOYSA-N 0.000 description 2
- BSKTXZVFRLLJML-UHFFFAOYSA-N 3-n-tert-butyl-2-methylbenzene-1,3-diamine Chemical compound CC1=C(N)C=CC=C1NC(C)(C)C BSKTXZVFRLLJML-UHFFFAOYSA-N 0.000 description 2
- ZYCRBOCGBKATBL-UHFFFAOYSA-N 3-tert-butyl-6-methylbenzene-1,2-diamine Chemical compound CC1=CC=C(C(C)(C)C)C(N)=C1N ZYCRBOCGBKATBL-UHFFFAOYSA-N 0.000 description 2
- 239000010963 304 stainless steel Substances 0.000 description 2
- WRDWWAVNELMWAM-UHFFFAOYSA-N 4-tert-butylaniline Chemical compound CC(C)(C)C1=CC=C(N)C=C1 WRDWWAVNELMWAM-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 2
- USVMJSALORZVDV-SDBHATRESA-N N(6)-(Delta(2)-isopentenyl)adenosine Chemical compound C1=NC=2C(NCC=C(C)C)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O USVMJSALORZVDV-SDBHATRESA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229910052777 Praseodymium Inorganic materials 0.000 description 2
- 229910000589 SAE 304 stainless steel Inorganic materials 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- GWXLDORMOJMVQZ-UHFFFAOYSA-N cerium Chemical compound [Ce] GWXLDORMOJMVQZ-UHFFFAOYSA-N 0.000 description 2
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 125000006575 electron-withdrawing group Chemical group 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- 239000002815 homogeneous catalyst Substances 0.000 description 2
- 238000010813 internal standard method Methods 0.000 description 2
- 229910052746 lanthanum Inorganic materials 0.000 description 2
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 2
- ICAKDTKJOYSXGC-UHFFFAOYSA-K lanthanum(iii) chloride Chemical compound Cl[La](Cl)Cl ICAKDTKJOYSXGC-UHFFFAOYSA-K 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- IGFAUTSEOYDBII-UHFFFAOYSA-N n,2-di(propan-2-yl)aniline Chemical group CC(C)NC1=CC=CC=C1C(C)C IGFAUTSEOYDBII-UHFFFAOYSA-N 0.000 description 2
- ABRWESLGGMHKEA-UHFFFAOYSA-N n-tert-butylaniline Chemical compound CC(C)(C)NC1=CC=CC=C1 ABRWESLGGMHKEA-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- OESQNBNQRAJTBM-UHFFFAOYSA-N 1-benzyl-2-propylhydrazine Chemical compound CCCNNCC1=CC=CC=C1 OESQNBNQRAJTBM-UHFFFAOYSA-N 0.000 description 1
- ATQUFXWBVZUTKO-UHFFFAOYSA-N 1-methylcyclopentene Chemical compound CC1=CCCC1 ATQUFXWBVZUTKO-UHFFFAOYSA-N 0.000 description 1
- OTNLOKOKOGZHFO-UHFFFAOYSA-N 2,4-dicyclohexylaniline Chemical compound NC1=CC=C(C2CCCCC2)C=C1C1CCCCC1 OTNLOKOKOGZHFO-UHFFFAOYSA-N 0.000 description 1
- PISLZQACAJMAIO-UHFFFAOYSA-N 2,4-diethyl-6-methylbenzene-1,3-diamine Chemical compound CCC1=CC(C)=C(N)C(CC)=C1N PISLZQACAJMAIO-UHFFFAOYSA-N 0.000 description 1
- YTDHOCZRXNHNKS-UHFFFAOYSA-N 2,6-dicyclohexylaniline Chemical compound NC1=C(C2CCCCC2)C=CC=C1C1CCCCC1 YTDHOCZRXNHNKS-UHFFFAOYSA-N 0.000 description 1
- FOYHNROGBXVLLX-UHFFFAOYSA-N 2,6-diethylaniline Chemical compound CCC1=CC=CC(CC)=C1N FOYHNROGBXVLLX-UHFFFAOYSA-N 0.000 description 1
- PLNPTWCBWDTKLR-UHFFFAOYSA-N 2-chloro-4-propan-2-ylaniline Chemical compound CC(C)C1=CC=C(N)C(Cl)=C1 PLNPTWCBWDTKLR-UHFFFAOYSA-N 0.000 description 1
- CWTJQUNXOVZQJF-UHFFFAOYSA-N 2-chloro-6-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(Cl)=C1N CWTJQUNXOVZQJF-UHFFFAOYSA-N 0.000 description 1
- JCRMYLUIMGTZSR-UHFFFAOYSA-N 2-chloro-n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1Cl JCRMYLUIMGTZSR-UHFFFAOYSA-N 0.000 description 1
- CDEGDZUMZIYNRD-UHFFFAOYSA-N 2-cyclohexylaniline Chemical compound NC1=CC=CC=C1C1CCCCC1 CDEGDZUMZIYNRD-UHFFFAOYSA-N 0.000 description 1
- UHLWQRYLMMKFRU-UHFFFAOYSA-N 2-fluoro-4-propan-2-ylaniline Chemical compound CC(C)C1=CC=C(N)C(F)=C1 UHLWQRYLMMKFRU-UHFFFAOYSA-N 0.000 description 1
- VZWWFQXGHKEDAN-UHFFFAOYSA-N 2-fluoro-6-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(F)=C1N VZWWFQXGHKEDAN-UHFFFAOYSA-N 0.000 description 1
- WLWGNHRGJQRJIF-UHFFFAOYSA-N 2-fluoro-n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1F WLWGNHRGJQRJIF-UHFFFAOYSA-N 0.000 description 1
- VXHRHHAEVWHZBK-UHFFFAOYSA-N 2-methyl-4,6-di(propan-2-yl)benzene-1,3-diamine Chemical compound CC(C)C1=CC(C(C)C)=C(N)C(C)=C1N VXHRHHAEVWHZBK-UHFFFAOYSA-N 0.000 description 1
- WYWNLVJBQRJIOU-UHFFFAOYSA-N 2-methyl-4-propan-2-ylaniline Chemical compound CC(C)C1=CC=C(N)C(C)=C1 WYWNLVJBQRJIOU-UHFFFAOYSA-N 0.000 description 1
- DDTKYVBFPULMGN-UHFFFAOYSA-N 2-methyl-6-propan-2-ylaniline Chemical compound CC(C)C1=CC=CC(C)=C1N DDTKYVBFPULMGN-UHFFFAOYSA-N 0.000 description 1
- NKVWOHIEVZXVGP-UHFFFAOYSA-N 2-methyl-n-propan-2-ylaniline Chemical compound CC(C)NC1=CC=CC=C1C NKVWOHIEVZXVGP-UHFFFAOYSA-N 0.000 description 1
- UEYMSDNDMQRAGI-UHFFFAOYSA-N 3,5-di(propan-2-yl)benzene-1,2-diamine Chemical compound CC(C)C1=CC(N)=C(N)C(C(C)C)=C1 UEYMSDNDMQRAGI-UHFFFAOYSA-N 0.000 description 1
- RUYDVLHBIPMKNK-UHFFFAOYSA-N 3-propan-2-ylbenzene-1,2-diamine Chemical compound CC(C)C1=CC=CC(N)=C1N RUYDVLHBIPMKNK-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- AKZOLEPNYXGNEH-UHFFFAOYSA-N 4-methyl-2,6-di(propan-2-yl)benzene-1,3-diamine Chemical compound CC(C)C1=CC(C)=C(N)C(C(C)C)=C1N AKZOLEPNYXGNEH-UHFFFAOYSA-N 0.000 description 1
- CVSIGCPGGOVWDT-UHFFFAOYSA-N 4-methyl-6-propan-2-ylbenzene-1,3-diamine Chemical compound CC(C)C1=CC(C)=C(N)C=C1N CVSIGCPGGOVWDT-UHFFFAOYSA-N 0.000 description 1
- BGXBPVBZNZKDHH-UHFFFAOYSA-N 4-propan-2-ylbenzene-1,2-diamine Chemical compound CC(C)C1=CC=C(N)C(N)=C1 BGXBPVBZNZKDHH-UHFFFAOYSA-N 0.000 description 1
- 229910000838 Al alloy Inorganic materials 0.000 description 1
- 241001279686 Allium moly Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- ZGYMLMAOIVLZQE-UHFFFAOYSA-N C(C)(C)C1=C(N)C(=CC=C1)C.C(C)(C)C1=C(N)C(=CC=C1)C Chemical compound C(C)(C)C1=C(N)C(=CC=C1)C.C(C)(C)C1=C(N)C(=CC=C1)C ZGYMLMAOIVLZQE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004970 Chain extender Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 102100032373 Coiled-coil domain-containing protein 85B Human genes 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 241000341495 Fornax Species 0.000 description 1
- 101000868814 Homo sapiens Coiled-coil domain-containing protein 85B Proteins 0.000 description 1
- 229910052779 Neodymium Inorganic materials 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910020489 SiO3 Inorganic materials 0.000 description 1
- 229920001229 Starlite Polymers 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- JYIBXUUINYLWLR-UHFFFAOYSA-N aluminum;calcium;potassium;silicon;sodium;trihydrate Chemical compound O.O.O.[Na].[Al].[Si].[K].[Ca] JYIBXUUINYLWLR-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 229910001603 clinoptilolite Inorganic materials 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 125000000524 functional group Chemical class 0.000 description 1
- 229910001683 gmelinite Inorganic materials 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910000856 hastalloy Inorganic materials 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- GDOPTJXRTPNYNR-UHFFFAOYSA-N methyl-cyclopentane Natural products CC1CCCC1 GDOPTJXRTPNYNR-UHFFFAOYSA-N 0.000 description 1
- YZUAMPGJLAZNSP-UHFFFAOYSA-N n,2-dicyclohexylaniline Chemical compound C1CCCCC1NC1=CC=CC=C1C1CCCCC1 YZUAMPGJLAZNSP-UHFFFAOYSA-N 0.000 description 1
- GGARKJIWYNVMBF-UHFFFAOYSA-N n-(2-methylpropyl)aniline Chemical compound CC(C)CNC1=CC=CC=C1 GGARKJIWYNVMBF-UHFFFAOYSA-N 0.000 description 1
- LXZGVFCKZRHKMU-UHFFFAOYSA-N n-benzyl-n-methylaniline Chemical compound C=1C=CC=CC=1N(C)CC1=CC=CC=C1 LXZGVFCKZRHKMU-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- VIBIPXFOYXNBEO-UHFFFAOYSA-N n-cyclohexyl-4-methylaniline Chemical compound C1=CC(C)=CC=C1NC1CCCCC1 VIBIPXFOYXNBEO-UHFFFAOYSA-N 0.000 description 1
- TXTHKGMZDDTZFD-UHFFFAOYSA-N n-cyclohexylaniline Chemical compound C1CCCCC1NC1=CC=CC=C1 TXTHKGMZDDTZFD-UHFFFAOYSA-N 0.000 description 1
- CDZOGLJOFWFVOZ-UHFFFAOYSA-N n-propylaniline Chemical compound CCCNC1=CC=CC=C1 CDZOGLJOFWFVOZ-UHFFFAOYSA-N 0.000 description 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000002336 sorption--desorption measurement Methods 0.000 description 1
- 229910052678 stilbite Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 230000008016 vaporization Effects 0.000 description 1
- 239000006200 vaporizer Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229910000859 α-Fe Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/10—After treatment, characterised by the effect to be obtained
- B01J2229/16—After treatment, characterised by the effect to be obtained to increase the Si/Al ratio; Dealumination
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/796,465 US4740620A (en) | 1985-11-08 | 1985-11-08 | Alkylation of aromatic amines in the presence of acidic, crystalline molecular sieves |
| US796465 | 1985-11-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS62161748A JPS62161748A (ja) | 1987-07-17 |
| JPH0255413B2 true JPH0255413B2 (enExample) | 1990-11-27 |
Family
ID=25168251
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP61265413A Granted JPS62161748A (ja) | 1985-11-08 | 1986-11-07 | 酸性結晶性分子篩の存在下での芳香族アミンのアルキル化方法 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4740620A (enExample) |
| EP (1) | EP0226781A1 (enExample) |
| JP (1) | JPS62161748A (enExample) |
| KR (1) | KR890004364B1 (enExample) |
| BR (1) | BR8605413A (enExample) |
| CA (1) | CA1266683A (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5068435A (en) * | 1985-11-08 | 1991-11-26 | Air Products And Chemicals, Inc. | Ortho-alkylated aromatic amines via gamma alumina catalyst |
| US4876377A (en) * | 1985-11-08 | 1989-10-24 | Air Products And Chemicals, Inc. | Alkylation of aromatic amines with olefins on partially dealuminated zeolites |
| DE3783711T2 (de) * | 1986-10-31 | 1993-08-05 | Chevron Res & Tech | Verfahren zur herstellung von alkylanilin mit einem aluminosilikat-katalysator. |
| JPH0749411B2 (ja) * | 1987-03-23 | 1995-05-31 | 日立化成工業株式会社 | 5−又は6−アルコキシカルボニル−2,3−ジシアノナフタレンおよびその製造法 |
| US4851579A (en) * | 1987-04-07 | 1989-07-25 | Air Products And Chemicals, Inc. | Alkylation of aromatic amines over Al exchanged zeolites |
| US4892974A (en) * | 1988-03-10 | 1990-01-09 | Air Products And Chemicals, Inc. | Process for producing mono-ortho-tert-butyl-aniline using silica-alumina catalysts |
| US4967001A (en) * | 1988-06-30 | 1990-10-30 | Air Products And Chemicals, Inc. | Alkylation of toluenediamine and para-phenylenediamine with isobutylene in the presence of acidic, crystalline molecular sieves |
| US4908480A (en) * | 1988-07-15 | 1990-03-13 | Air Products And Chemicals, Inc. | Process for producing mono-ortho-ethyl-aniline using silica-alumina catalysts |
| US5262570A (en) * | 1988-11-22 | 1993-11-16 | Nippon Shokubai Kagaku Kogyo Co., Ltd. | Method of producing ethylenediamines |
| US5235107A (en) * | 1988-11-22 | 1993-08-10 | Nippon Shokubai Kagaku Kogyo Co., Ltd. | Method of producing ethylenediamines |
| US4914237A (en) * | 1988-11-29 | 1990-04-03 | Air Products And Chemicals, Inc. | Alkylation of toluenediamine and para-phenylenediamine with isobutylene in the presence of acidic, crystalline molecular sieves |
| US5026912A (en) * | 1990-03-27 | 1991-06-25 | Air Products And Chemicals, Inc. | Alkylation of aromatic amines over thermally pretreated zeolites |
| US5227517A (en) * | 1992-04-15 | 1993-07-13 | Air Products And Chemicals, Inc. | Process for preparing ethylidene diacetate using iodide catalysts |
| US5453478A (en) * | 1993-05-04 | 1995-09-26 | Air Products And Chemicals, Inc. | Ortho-alkylated tolidines |
| DE19539113A1 (de) * | 1995-10-20 | 1997-04-24 | Bayer Ag | Verfahren zur Herstellung von (Bi)Cycloalkylanilinen |
| CA2205098A1 (en) * | 1996-05-17 | 1997-11-17 | James D. Burrington | Alkylation of aromatic amines using a heteropoly catalyst |
| US7456319B2 (en) * | 2005-01-19 | 2008-11-25 | Exxonmobil Research And Engineering Company | Para-alkylation of aromatic primary amines |
| US7378554B2 (en) * | 2005-12-14 | 2008-05-27 | Chemtura Corporation | Ring alkylation of aniline or an aniline derivative using ionic liquid catalysts |
| US20110143920A1 (en) * | 2009-12-16 | 2011-06-16 | Uop Llc | Rare Earth Exchanged Catalyst for Use in Detergent Alkylation |
| US9126184B2 (en) * | 2009-12-16 | 2015-09-08 | Uop Llc | Detergent alkylation using a rare earth exchanged catalyst |
| CN102731319A (zh) * | 2012-07-09 | 2012-10-17 | 赤峰万泽制药有限责任公司 | 一种合成2-甲基-6-异丙基苯胺的方法 |
| US9617201B2 (en) * | 2013-10-14 | 2017-04-11 | Chemtura Corporation | Fixed bed process for clay catalyzed alkylation of aromatic amines |
| CN113045430B (zh) * | 2021-05-27 | 2021-08-31 | 东营海瑞宝新材料有限公司 | 一种二乙基甲苯二胺的制备方法 |
| CN113666829B (zh) * | 2021-09-26 | 2024-04-19 | 黑龙江立科新材料有限公司 | 4-氟-n-异丙基苯胺及氟噻草胺的制备方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1406739A (fr) * | 1963-05-21 | 1965-07-23 | Socony Mobil Oil Co | Procédé perfectionné d'alcoylation des composés aromatiques et hétérocycliques dans les noyaux |
| NL6407639A (enExample) * | 1964-07-06 | 1966-01-07 | ||
| DE2111194B2 (de) * | 1971-03-09 | 1979-10-04 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Alkylarylaminen |
| GB1536590A (en) * | 1976-06-17 | 1978-12-20 | Grace W R & Co | Preparation of an ultrastable faujasite having hydrogen and metal cations |
| DE3433982A1 (de) * | 1984-09-15 | 1986-04-10 | Hoechst Ag, 6230 Frankfurt | Verfahren zur isomerisierung von alkylanilinen |
-
1985
- 1985-11-08 US US06/796,465 patent/US4740620A/en not_active Expired - Fee Related
-
1986
- 1986-11-03 CA CA000522071A patent/CA1266683A/en not_active Expired - Lifetime
- 1986-11-03 BR BR8605413A patent/BR8605413A/pt unknown
- 1986-11-07 JP JP61265413A patent/JPS62161748A/ja active Granted
- 1986-11-07 EP EP86115446A patent/EP0226781A1/en not_active Withdrawn
- 1986-11-08 KR KR1019860009469A patent/KR890004364B1/ko not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1266683C (en) | 1990-03-13 |
| CA1266683A (en) | 1990-03-13 |
| BR8605413A (pt) | 1987-08-11 |
| KR890004364B1 (ko) | 1989-10-31 |
| US4740620A (en) | 1988-04-26 |
| KR870004938A (ko) | 1987-06-02 |
| JPS62161748A (ja) | 1987-07-17 |
| EP0226781A1 (en) | 1987-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0255413B2 (enExample) | ||
| US4760184A (en) | Alkylation of aromatic amines in the presence of non-zeolitic molecular sieves | |
| KR100385779B1 (ko) | 디아미노디페닐메탄 및 그것의 고급 동족체의 제조 방법 | |
| EP0286029B1 (en) | Alkylation of aromatic amines over a1 exchanged zeolites | |
| KR900001023B1 (ko) | 모노 삼차부틸 톨루엔디아민의 제조공정 | |
| US4876377A (en) | Alkylation of aromatic amines with olefins on partially dealuminated zeolites | |
| US5874621A (en) | Preparation of amines from olefins over NU-85 zeolites | |
| US2874193A (en) | Alkylation of ortho-alkyl phenols | |
| US5068435A (en) | Ortho-alkylated aromatic amines via gamma alumina catalyst | |
| US4721810A (en) | Catalytic alkylation of aromatic amines with ethers | |
| US5900508A (en) | Preparation of amines from olefins over zeolites of the type PSH-3, MCM-22, SSZ-25 or mixtures thereof | |
| US6143934A (en) | Preparation of amines from olefins over boron beta-zeolites | |
| EP0240018A2 (en) | Alkylation of aromatic amines with olefins on partially dealuminated zeolites | |
| US5030759A (en) | Selective N-alkylation of aniline in the presence of zeolite catalysts | |
| JP2843108B2 (ja) | アニリンの選択的環式アルキル化方法 | |
| US5001263A (en) | Formation of ortho-alkylated aromatic amines from N-alkylated aromatic amines | |
| US5026912A (en) | Alkylation of aromatic amines over thermally pretreated zeolites | |
| US4967001A (en) | Alkylation of toluenediamine and para-phenylenediamine with isobutylene in the presence of acidic, crystalline molecular sieves | |
| US5055617A (en) | Process for the preparation of N-alkylated anilines | |
| EP0073277B1 (en) | Process for producing orthoalkylated aromatic amines | |
| US4929764A (en) | Alkylation of aromatic amines | |
| US5087754A (en) | Process for the preparation of n,n-dialkylaniline | |
| US4914237A (en) | Alkylation of toluenediamine and para-phenylenediamine with isobutylene in the presence of acidic, crystalline molecular sieves | |
| JP2516887B2 (ja) | インド―ル類の製造方法 | |
| JPH04154743A (ja) | オルト―アルキルアニリン類の製造法 |