JP5710650B2 - Rock阻害剤としての複素環アミド - Google Patents
Rock阻害剤としての複素環アミド Download PDFInfo
- Publication number
- JP5710650B2 JP5710650B2 JP2012555446A JP2012555446A JP5710650B2 JP 5710650 B2 JP5710650 B2 JP 5710650B2 JP 2012555446 A JP2012555446 A JP 2012555446A JP 2012555446 A JP2012555446 A JP 2012555446A JP 5710650 B2 JP5710650 B2 JP 5710650B2
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- het
- group
- substituted
- aryl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- -1 Heterocyclic amides Chemical class 0.000 title claims description 709
- 239000011435 rock Substances 0.000 title claims description 105
- 239000003112 inhibitor Substances 0.000 title description 46
- 125000000217 alkyl group Chemical group 0.000 claims description 479
- 150000001875 compounds Chemical class 0.000 claims description 305
- 125000001424 substituent group Chemical group 0.000 claims description 214
- 239000000203 mixture Substances 0.000 claims description 150
- 239000001257 hydrogen Substances 0.000 claims description 92
- 229910052739 hydrogen Inorganic materials 0.000 claims description 92
- 125000003118 aryl group Chemical group 0.000 claims description 89
- 125000001072 heteroaryl group Chemical group 0.000 claims description 77
- 238000011282 treatment Methods 0.000 claims description 77
- 125000000623 heterocyclic group Chemical group 0.000 claims description 69
- 125000003342 alkenyl group Chemical group 0.000 claims description 63
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 63
- 229910052799 carbon Inorganic materials 0.000 claims description 60
- 230000002265 prevention Effects 0.000 claims description 51
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 46
- 201000010099 disease Diseases 0.000 claims description 40
- 125000005843 halogen group Chemical group 0.000 claims description 39
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 37
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 35
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 33
- 229910052736 halogen Inorganic materials 0.000 claims description 32
- 150000002367 halogens Chemical class 0.000 claims description 29
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 24
- 125000001544 thienyl group Chemical group 0.000 claims description 24
- 208000035475 disorder Diseases 0.000 claims description 23
- 208000030533 eye disease Diseases 0.000 claims description 23
- 125000004043 oxo group Chemical group O=* 0.000 claims description 23
- 125000003107 substituted aryl group Chemical group 0.000 claims description 23
- 201000001880 Sexual dysfunction Diseases 0.000 claims description 22
- 231100000872 sexual dysfunction Toxicity 0.000 claims description 22
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 20
- 206010020772 Hypertension Diseases 0.000 claims description 20
- 150000002148 esters Chemical group 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 19
- 125000004076 pyridyl group Chemical group 0.000 claims description 19
- 125000004414 alkyl thio group Chemical group 0.000 claims description 18
- 208000010412 Glaucoma Diseases 0.000 claims description 17
- 230000002757 inflammatory effect Effects 0.000 claims description 17
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 15
- 206010016654 Fibrosis Diseases 0.000 claims description 14
- 206010020751 Hypersensitivity Diseases 0.000 claims description 14
- 125000000304 alkynyl group Chemical group 0.000 claims description 14
- 208000029162 bladder disease Diseases 0.000 claims description 14
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 14
- 230000004761 fibrosis Effects 0.000 claims description 14
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 14
- 125000003386 piperidinyl group Chemical group 0.000 claims description 14
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 14
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 14
- 208000026533 urinary bladder disease Diseases 0.000 claims description 14
- IGERFAHWSHDDHX-UHFFFAOYSA-N 1,3-dioxanyl Chemical group [CH]1OCCCO1 IGERFAHWSHDDHX-UHFFFAOYSA-N 0.000 claims description 13
- 206010010904 Convulsion Diseases 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 230000036461 convulsion Effects 0.000 claims description 13
- 125000001041 indolyl group Chemical group 0.000 claims description 13
- 208000026935 allergic disease Diseases 0.000 claims description 12
- 230000001684 chronic effect Effects 0.000 claims description 12
- 125000002541 furyl group Chemical group 0.000 claims description 12
- 208000027866 inflammatory disease Diseases 0.000 claims description 11
- 238000007634 remodeling Methods 0.000 claims description 11
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 claims description 10
- 208000020084 Bone disease Diseases 0.000 claims description 10
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 10
- 241001465754 Metazoa Species 0.000 claims description 10
- 230000007815 allergy Effects 0.000 claims description 10
- 125000004122 cyclic group Chemical group 0.000 claims description 10
- 208000017169 kidney disease Diseases 0.000 claims description 10
- 230000000414 obstructive effect Effects 0.000 claims description 10
- 230000002062 proliferating effect Effects 0.000 claims description 10
- 239000012453 solvate Substances 0.000 claims description 10
- 206010052779 Transplant rejections Diseases 0.000 claims description 9
- 230000004054 inflammatory process Effects 0.000 claims description 9
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- 125000006647 (C3-C15) cycloalkyl group Chemical group 0.000 claims description 8
- 206010061323 Optic neuropathy Diseases 0.000 claims description 8
- 208000017442 Retinal disease Diseases 0.000 claims description 8
- 206010038923 Retinopathy Diseases 0.000 claims description 8
- 125000002757 morpholinyl group Chemical group 0.000 claims description 8
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 8
- 208000020911 optic nerve disease Diseases 0.000 claims description 8
- 125000004193 piperazinyl group Chemical group 0.000 claims description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 8
- 230000002207 retinal effect Effects 0.000 claims description 8
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 8
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 8
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 8
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 7
- 206010061218 Inflammation Diseases 0.000 claims description 7
- 208000004403 Prostatic Hyperplasia Diseases 0.000 claims description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 125000002883 imidazolyl group Chemical group 0.000 claims description 7
- 230000004770 neurodegeneration Effects 0.000 claims description 7
- 208000018569 Respiratory Tract disease Diseases 0.000 claims description 6
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 claims description 6
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 6
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000002971 oxazolyl group Chemical group 0.000 claims description 6
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 6
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 6
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 6
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 6
- 125000000335 thiazolyl group Chemical group 0.000 claims description 6
- 125000004306 triazinyl group Chemical group 0.000 claims description 6
- 230000003915 cell function Effects 0.000 claims description 5
- 230000004663 cell proliferation Effects 0.000 claims description 5
- 210000000329 smooth muscle myocyte Anatomy 0.000 claims description 5
- 230000005549 barrier dysfunction Effects 0.000 claims description 4
- 230000009610 hypersensitivity Effects 0.000 claims description 4
- 208000028774 intestinal disease Diseases 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 208000017520 skin disease Diseases 0.000 claims description 4
- 230000033115 angiogenesis Effects 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims description 2
- 201000001119 neuropathy Diseases 0.000 claims description 2
- 230000007823 neuropathy Effects 0.000 claims description 2
- 208000033808 peripheral neuropathy Diseases 0.000 claims description 2
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 15
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 122
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 109
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 108
- 239000011541 reaction mixture Substances 0.000 description 81
- 239000002904 solvent Substances 0.000 description 55
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 53
- 239000000543 intermediate Substances 0.000 description 52
- 235000019439 ethyl acetate Nutrition 0.000 description 49
- 238000000034 method Methods 0.000 description 45
- 229910001868 water Inorganic materials 0.000 description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 39
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 230000002829 reductive effect Effects 0.000 description 34
- 239000011734 sodium Substances 0.000 description 33
- 239000012044 organic layer Substances 0.000 description 32
- 208000024891 symptom Diseases 0.000 description 29
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 28
- 239000003814 drug Substances 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 24
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 21
- 238000004440 column chromatography Methods 0.000 description 20
- 229940079593 drug Drugs 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 229920006395 saturated elastomer Polymers 0.000 description 18
- 239000012267 brine Substances 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 15
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 15
- 239000007787 solid Substances 0.000 description 15
- 206010006458 Bronchitis chronic Diseases 0.000 description 14
- 206010006451 bronchitis Diseases 0.000 description 14
- 208000007451 chronic bronchitis Diseases 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 13
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 13
- 239000004698 Polyethylene Substances 0.000 description 13
- 208000006673 asthma Diseases 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 12
- 208000012902 Nervous system disease Diseases 0.000 description 12
- 208000025966 Neurological disease Diseases 0.000 description 12
- 206010012601 diabetes mellitus Diseases 0.000 description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 12
- 210000004072 lung Anatomy 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- 239000000546 pharmaceutical excipient Substances 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- 238000003556 assay Methods 0.000 description 10
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 10
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 9
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 9
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 125000004438 haloalkoxy group Chemical group 0.000 description 9
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 9
- 230000000926 neurological effect Effects 0.000 description 9
- 206010039083 rhinitis Diseases 0.000 description 9
- 0 *C(CO1)OC1=O Chemical compound *C(CO1)OC1=O 0.000 description 8
- 208000030507 AIDS Diseases 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 8
- 208000008589 Obesity Diseases 0.000 description 8
- 208000016222 Pancreatic disease Diseases 0.000 description 8
- 108091000080 Phosphotransferase Proteins 0.000 description 8
- 208000005107 Premature Birth Diseases 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 8
- 210000004027 cell Anatomy 0.000 description 8
- 208000015114 central nervous system disease Diseases 0.000 description 8
- 239000012043 crude product Substances 0.000 description 8
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 8
- 239000002158 endotoxin Substances 0.000 description 8
- 208000014951 hematologic disease Diseases 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 230000028709 inflammatory response Effects 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 230000004410 intraocular pressure Effects 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 229920006008 lipopolysaccharide Polymers 0.000 description 8
- 208000019423 liver disease Diseases 0.000 description 8
- 235000020824 obesity Nutrition 0.000 description 8
- 210000000056 organ Anatomy 0.000 description 8
- 239000008194 pharmaceutical composition Substances 0.000 description 8
- 102000020233 phosphotransferase Human genes 0.000 description 8
- 208000023504 respiratory system disease Diseases 0.000 description 8
- 230000004044 response Effects 0.000 description 8
- 210000001519 tissue Anatomy 0.000 description 8
- 201000003883 Cystic fibrosis Diseases 0.000 description 7
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 7
- 206010014561 Emphysema Diseases 0.000 description 7
- 206010035664 Pneumonia Diseases 0.000 description 7
- 208000007014 Retinitis pigmentosa Diseases 0.000 description 7
- 208000025865 Ulcer Diseases 0.000 description 7
- 125000002947 alkylene group Chemical group 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 230000027455 binding Effects 0.000 description 7
- 150000001721 carbon Chemical group 0.000 description 7
- 201000009151 chronic rhinitis Diseases 0.000 description 7
- 238000002875 fluorescence polarization Methods 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 201000001881 impotence Diseases 0.000 description 7
- 238000000338 in vitro Methods 0.000 description 7
- 238000001727 in vivo Methods 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 230000000670 limiting effect Effects 0.000 description 7
- 208000002780 macular degeneration Diseases 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 208000005069 pulmonary fibrosis Diseases 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 7
- 208000011231 Crohn disease Diseases 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 241000283973 Oryctolagus cuniculus Species 0.000 description 6
- 208000006011 Stroke Diseases 0.000 description 6
- 239000012317 TBTU Substances 0.000 description 6
- 208000007536 Thrombosis Diseases 0.000 description 6
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 6
- 208000037765 diseases and disorders Diseases 0.000 description 6
- 229940088598 enzyme Drugs 0.000 description 6
- 125000001188 haloalkyl group Chemical group 0.000 description 6
- 150000002596 lactones Chemical class 0.000 description 6
- 230000001404 mediated effect Effects 0.000 description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 6
- 102000000568 rho-Associated Kinases Human genes 0.000 description 6
- 108010041788 rho-Associated Kinases Proteins 0.000 description 6
- 125000000547 substituted alkyl group Chemical group 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- DBVFWZMQJQMJCB-UHFFFAOYSA-N 3-boronobenzoic acid Chemical compound OB(O)C1=CC=CC(C(O)=O)=C1 DBVFWZMQJQMJCB-UHFFFAOYSA-N 0.000 description 5
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 206010007559 Cardiac failure congestive Diseases 0.000 description 5
- 206010019280 Heart failures Diseases 0.000 description 5
- 206010020649 Hyperkeratosis Diseases 0.000 description 5
- 206010058359 Hypogonadism Diseases 0.000 description 5
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 5
- 102100040247 Tumor necrosis factor Human genes 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 5
- 125000003282 alkyl amino group Chemical group 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 125000004104 aryloxy group Chemical group 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 125000002993 cycloalkylene group Chemical group 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 238000005516 engineering process Methods 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 238000002347 injection Methods 0.000 description 5
- 239000007924 injection Substances 0.000 description 5
- 210000004185 liver Anatomy 0.000 description 5
- 201000005202 lung cancer Diseases 0.000 description 5
- 208000020816 lung neoplasm Diseases 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 210000005036 nerve Anatomy 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- 210000003491 skin Anatomy 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000001839 systemic circulation Effects 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 4
- LFJJGHGXHXXDFT-UHFFFAOYSA-N 3-bromooxolan-2-one Chemical compound BrC1CCOC1=O LFJJGHGXHXXDFT-UHFFFAOYSA-N 0.000 description 4
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 4
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 4
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 4
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 4
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 4
- 206010002556 Ankylosing Spondylitis Diseases 0.000 description 4
- 208000019901 Anxiety disease Diseases 0.000 description 4
- 108010008184 Aryldialkylphosphatase Proteins 0.000 description 4
- 102000006996 Aryldialkylphosphatase Human genes 0.000 description 4
- 201000001320 Atherosclerosis Diseases 0.000 description 4
- 208000005024 Castleman disease Diseases 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229920000858 Cyclodextrin Polymers 0.000 description 4
- 206010012438 Dermatitis atopic Diseases 0.000 description 4
- 206010012442 Dermatitis contact Diseases 0.000 description 4
- 208000003456 Juvenile Arthritis Diseases 0.000 description 4
- 206010059176 Juvenile idiopathic arthritis Diseases 0.000 description 4
- 208000001126 Keratosis Diseases 0.000 description 4
- 208000008839 Kidney Neoplasms Diseases 0.000 description 4
- 206010025323 Lymphomas Diseases 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- XZJKQEQKZAYDRM-UHFFFAOYSA-N N,N-diaminonitramide Chemical compound [N+](=O)([O-])N(N)N XZJKQEQKZAYDRM-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 208000001132 Osteoporosis Diseases 0.000 description 4
- 206010033128 Ovarian cancer Diseases 0.000 description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 description 4
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 4
- 206010060862 Prostate cancer Diseases 0.000 description 4
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 4
- 102000001708 Protein Isoforms Human genes 0.000 description 4
- 108010029485 Protein Isoforms Proteins 0.000 description 4
- 201000004681 Psoriasis Diseases 0.000 description 4
- 201000001263 Psoriatic Arthritis Diseases 0.000 description 4
- 208000036824 Psoriatic arthropathy Diseases 0.000 description 4
- 206010038389 Renal cancer Diseases 0.000 description 4
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 4
- 206010039491 Sarcoma Diseases 0.000 description 4
- 208000024770 Thyroid neoplasm Diseases 0.000 description 4
- 208000002495 Uterine Neoplasms Diseases 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 4
- 125000005094 alkyl carbonyl amino alkyl group Chemical group 0.000 description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 4
- 125000005360 alkyl sulfoxide group Chemical group 0.000 description 4
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 4
- 230000036506 anxiety Effects 0.000 description 4
- 125000005129 aryl carbonyl group Chemical group 0.000 description 4
- 201000008937 atopic dermatitis Diseases 0.000 description 4
- 150000001540 azides Chemical class 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004556 brain Anatomy 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- 201000011510 cancer Diseases 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 208000019069 chronic childhood arthritis Diseases 0.000 description 4
- 210000001072 colon Anatomy 0.000 description 4
- 208000010247 contact dermatitis Diseases 0.000 description 4
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 4
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 4
- 125000006547 cyclononyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 4
- 230000002526 effect on cardiovascular system Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 210000003128 head Anatomy 0.000 description 4
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 4
- 150000004677 hydrates Chemical class 0.000 description 4
- 210000000936 intestine Anatomy 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- 201000002215 juvenile rheumatoid arthritis Diseases 0.000 description 4
- 210000003734 kidney Anatomy 0.000 description 4
- 201000010982 kidney cancer Diseases 0.000 description 4
- 208000032839 leukemia Diseases 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 4
- 201000001441 melanoma Diseases 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 210000003739 neck Anatomy 0.000 description 4
- 208000004296 neuralgia Diseases 0.000 description 4
- 230000004766 neurogenesis Effects 0.000 description 4
- 208000021722 neuropathic pain Diseases 0.000 description 4
- 201000008482 osteoarthritis Diseases 0.000 description 4
- 210000001672 ovary Anatomy 0.000 description 4
- 210000000496 pancreas Anatomy 0.000 description 4
- 208000008443 pancreatic carcinoma Diseases 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 210000002307 prostate Anatomy 0.000 description 4
- 208000002815 pulmonary hypertension Diseases 0.000 description 4
- 230000008695 pulmonary vasoconstriction Effects 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000008085 renal dysfunction Effects 0.000 description 4
- 201000002793 renal fibrosis Diseases 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 4
- 230000001568 sexual effect Effects 0.000 description 4
- 230000036332 sexual response Effects 0.000 description 4
- 230000019491 signal transduction Effects 0.000 description 4
- 230000016160 smooth muscle contraction Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000017550 sodium carbonate Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 230000004936 stimulating effect Effects 0.000 description 4
- 238000001356 surgical procedure Methods 0.000 description 4
- 230000009885 systemic effect Effects 0.000 description 4
- 150000003573 thiols Chemical class 0.000 description 4
- 201000002510 thyroid cancer Diseases 0.000 description 4
- 238000011200 topical administration Methods 0.000 description 4
- 231100000397 ulcer Toxicity 0.000 description 4
- 206010046766 uterine cancer Diseases 0.000 description 4
- 210000004291 uterus Anatomy 0.000 description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- APLNPKYKKBGIGV-UHFFFAOYSA-N 3-bromo-4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(O)=O)C=C1Br APLNPKYKKBGIGV-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 3
- 208000024827 Alzheimer disease Diseases 0.000 description 3
- 206010002329 Aneurysm Diseases 0.000 description 3
- 206010002383 Angina Pectoris Diseases 0.000 description 3
- 206010003210 Arteriosclerosis Diseases 0.000 description 3
- 206010003225 Arteriospasm coronary Diseases 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 201000004569 Blindness Diseases 0.000 description 3
- 208000003174 Brain Neoplasms Diseases 0.000 description 3
- 101100356682 Caenorhabditis elegans rho-1 gene Proteins 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- 206010007572 Cardiac hypertrophy Diseases 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- 206010059109 Cerebral vasoconstriction Diseases 0.000 description 3
- 206010009900 Colitis ulcerative Diseases 0.000 description 3
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 3
- 208000016192 Demyelinating disease Diseases 0.000 description 3
- 208000037487 Endotoxemia Diseases 0.000 description 3
- 206010014950 Eosinophilia Diseases 0.000 description 3
- 208000010228 Erectile Dysfunction Diseases 0.000 description 3
- 206010057671 Female sexual dysfunction Diseases 0.000 description 3
- 208000032612 Glial tumor Diseases 0.000 description 3
- 206010018338 Glioma Diseases 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 208000032843 Hemorrhage Diseases 0.000 description 3
- 206010021143 Hypoxia Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229930195725 Mannitol Natural products 0.000 description 3
- 201000009906 Meningitis Diseases 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- 206010036590 Premature baby Diseases 0.000 description 3
- 101150111584 RHOA gene Proteins 0.000 description 3
- 208000003782 Raynaud disease Diseases 0.000 description 3
- 208000012322 Raynaud phenomenon Diseases 0.000 description 3
- 206010040047 Sepsis Diseases 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 3
- 201000006704 Ulcerative Colitis Diseases 0.000 description 3
- 206010047139 Vasoconstriction Diseases 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 210000001742 aqueous humor Anatomy 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 208000011775 arteriosclerosis disease Diseases 0.000 description 3
- 150000007860 aryl ester derivatives Chemical class 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 208000034158 bleeding Diseases 0.000 description 3
- 230000000740 bleeding effect Effects 0.000 description 3
- 230000017531 blood circulation Effects 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 3
- 208000029028 brain injury Diseases 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 210000003029 clitoris Anatomy 0.000 description 3
- 206010009887 colitis Diseases 0.000 description 3
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 229960004979 fampridine Drugs 0.000 description 3
- MHMNJMPURVTYEJ-UHFFFAOYSA-N fluorescein-5-isothiocyanate Chemical compound O1C(=O)C2=CC(N=C=S)=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 MHMNJMPURVTYEJ-UHFFFAOYSA-N 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 208000019622 heart disease Diseases 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- 201000001421 hyperglycemia Diseases 0.000 description 3
- 230000007954 hypoxia Effects 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 238000001802 infusion Methods 0.000 description 3
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 3
- 208000001286 intracranial vasospasm Diseases 0.000 description 3
- 208000028867 ischemia Diseases 0.000 description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 3
- 229940043355 kinase inhibitor Drugs 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 201000007270 liver cancer Diseases 0.000 description 3
- 208000014018 liver neoplasm Diseases 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 239000000594 mannitol Substances 0.000 description 3
- 235000010355 mannitol Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 239000003607 modifier Substances 0.000 description 3
- 201000006417 multiple sclerosis Diseases 0.000 description 3
- 210000000440 neutrophil Anatomy 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 210000003819 peripheral blood mononuclear cell Anatomy 0.000 description 3
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 3
- 125000004944 pyrazin-3-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 208000037803 restenosis Diseases 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000007962 solid dispersion Substances 0.000 description 3
- 208000020431 spinal cord injury Diseases 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 238000007920 subcutaneous administration Methods 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 208000011580 syndromic disease Diseases 0.000 description 3
- BUXRETHKBSIFRP-UHFFFAOYSA-N tert-butyl n-[1-[2-bromo-4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate Chemical compound C1=C(Br)C(C(NC(=O)OC(C)(C)C)C)=CC=C1C(=O)NC1=CC=NC=C1 BUXRETHKBSIFRP-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 3
- 238000002560 therapeutic procedure Methods 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- 230000025033 vasoconstriction Effects 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 2
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- 125000001724 1,2,3-oxadiazol-4-yl group Chemical group [H]C1=C(*)N=NO1 0.000 description 2
- 125000004503 1,2,3-oxadiazol-5-yl group Chemical group O1N=NC=C1* 0.000 description 2
- 125000001359 1,2,3-triazol-4-yl group Chemical group [H]N1N=NC([*])=C1[H] 0.000 description 2
- 125000001506 1,2,3-triazol-5-yl group Chemical group [H]N1N=NC([H])=C1[*] 0.000 description 2
- 125000001766 1,2,4-oxadiazol-3-yl group Chemical group [H]C1=NC(*)=NO1 0.000 description 2
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 description 2
- 125000004515 1,2,4-thiadiazol-3-yl group Chemical group S1N=C(N=C1)* 0.000 description 2
- 125000001401 1,2,4-triazol-4-yl group Chemical group N=1N=C([H])N([*])C=1[H] 0.000 description 2
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 description 2
- 125000004518 1,2,5-thiadiazol-3-yl group Chemical group S1N=C(C=N1)* 0.000 description 2
- 125000004317 1,3,5-triazin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=N1 0.000 description 2
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 2
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- RCBUSKUQKDOKSZ-UHFFFAOYSA-N 1-[2-bromo-4-(pyridin-4-ylcarbamoyl)phenyl]ethylcarbamic acid Chemical compound BrC1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)NC(O)=O RCBUSKUQKDOKSZ-UHFFFAOYSA-N 0.000 description 2
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- GQIRIWDEZSKOCN-UHFFFAOYSA-N 1-chloro-n,n,2-trimethylprop-1-en-1-amine Chemical compound CN(C)C(Cl)=C(C)C GQIRIWDEZSKOCN-UHFFFAOYSA-N 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- MOVOUQUXCQCPGW-UHFFFAOYSA-N 2-[3-[5-[(3-fluoropyridin-4-yl)carbamoyl]-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]phenoxy]acetic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(OCC(O)=O)=C1 MOVOUQUXCQCPGW-UHFFFAOYSA-N 0.000 description 2
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 2
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 2
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 2
- DDIDZOMSYGWECH-UHFFFAOYSA-N 2-methoxyoxolan-3-ol Chemical compound COC1OCCC1O DDIDZOMSYGWECH-UHFFFAOYSA-N 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 2
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 2
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 2
- 206010003011 Appendicitis Diseases 0.000 description 2
- 208000019838 Blood disease Diseases 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- MJCYUVOCINOVJH-UHFFFAOYSA-N CC1Oc(cccc2)c2OC1 Chemical compound CC1Oc(cccc2)c2OC1 MJCYUVOCINOVJH-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 2
- 102000004127 Cytokines Human genes 0.000 description 2
- 108090000695 Cytokines Proteins 0.000 description 2
- 208000005577 Gastroenteritis Diseases 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 102000015779 HDL Lipoproteins Human genes 0.000 description 2
- 108010010234 HDL Lipoproteins Proteins 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 102000052508 Lipopolysaccharide-binding protein Human genes 0.000 description 2
- 108010053632 Lipopolysaccharide-binding protein Proteins 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 206010057672 Male sexual dysfunction Diseases 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- 206010028594 Myocardial fibrosis Diseases 0.000 description 2
- QJPWUUJVYOJNMH-UHFFFAOYSA-N NC(CCO1)C1=O Chemical compound NC(CCO1)C1=O QJPWUUJVYOJNMH-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- 206010063837 Reperfusion injury Diseases 0.000 description 2
- 102100027609 Rho-related GTP-binding protein RhoD Human genes 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000006069 Suzuki reaction reaction Methods 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229940072056 alginate Drugs 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 125000004533 benzofuran-5-yl group Chemical group O1C=CC2=C1C=CC(=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004238 benzotriazol-4-yl group Chemical group [H]N1N=NC2=C(*)C([H])=C([H])C([H])=C12 0.000 description 2
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- 210000004204 blood vessel Anatomy 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000004067 bulking agent Substances 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 2
- 229960004484 carbachol Drugs 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 238000012512 characterization method Methods 0.000 description 2
- 210000000349 chromosome Anatomy 0.000 description 2
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 2
- 229940125844 compound 46 Drugs 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- 150000005676 cyclic carbonates Chemical class 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 125000000597 dioxinyl group Chemical group 0.000 description 2
- 230000006806 disease prevention Effects 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000008157 edible vegetable oil Substances 0.000 description 2
- 210000002615 epidermis Anatomy 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- NGOGFTYYXHNFQH-UHFFFAOYSA-N fasudil Chemical compound C=1C=CC2=CN=CC=C2C=1S(=O)(=O)N1CCCNCC1 NGOGFTYYXHNFQH-UHFFFAOYSA-N 0.000 description 2
- 229960002435 fasudil Drugs 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 208000035474 group of disease Diseases 0.000 description 2
- 208000018706 hematopoietic system disease Diseases 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004404 heteroalkyl group Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 2
- 229920001477 hydrophilic polymer Polymers 0.000 description 2
- 206010020718 hyperplasia Diseases 0.000 description 2
- 208000009326 ileitis Diseases 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 239000007943 implant Substances 0.000 description 2
- 230000002779 inactivation Effects 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 208000003243 intestinal obstruction Diseases 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 238000005461 lubrication Methods 0.000 description 2
- JMZFEHDNIAQMNB-UHFFFAOYSA-N m-aminophenylboronic acid Chemical compound NC1=CC=CC(B(O)O)=C1 JMZFEHDNIAQMNB-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000007726 management method Methods 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- QWUVZLCBSCYPBK-UHFFFAOYSA-N methyl 2-methoxyoxolane-3-carboxylate Chemical compound COC1OCCC1C(=O)OC QWUVZLCBSCYPBK-UHFFFAOYSA-N 0.000 description 2
- CFJQBNFFHMBNKQ-UHFFFAOYSA-N methyl 3-bromo-4-(bromomethyl)benzoate Chemical compound COC(=O)C1=CC=C(CBr)C(Br)=C1 CFJQBNFFHMBNKQ-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004220 muscle function Effects 0.000 description 2
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 231100000344 non-irritating Toxicity 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 230000036542 oxidative stress Effects 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 210000003899 penis Anatomy 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 230000002093 peripheral effect Effects 0.000 description 2
- 230000035699 permeability Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- 230000006920 protein precipitation Effects 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 2
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 2
- 230000004648 relaxation of smooth muscle Effects 0.000 description 2
- 230000029058 respiratory gaseous exchange Effects 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 230000002459 sustained effect Effects 0.000 description 2
- YXIMCNGUIIEJMO-UHFFFAOYSA-N tert-butyl 2-sulfanylacetate Chemical compound CC(C)(C)OC(=O)CS YXIMCNGUIIEJMO-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- JUFYFDBWQGVDOH-UHFFFAOYSA-N tert-butyl n-[1-[2-bromo-4-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]ethyl]carbamate Chemical compound C1=C(Br)C(C(NC(=O)OC(C)(C)C)C)=CC=C1C(=O)NC1=CC=NC=C1F JUFYFDBWQGVDOH-UHFFFAOYSA-N 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 description 2
- 125000005307 thiatriazolyl group Chemical group S1N=NN=C1* 0.000 description 2
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- 206010044008 tonsillitis Diseases 0.000 description 2
- 208000004371 toothache Diseases 0.000 description 2
- 210000003437 trachea Anatomy 0.000 description 2
- 210000005062 tracheal ring Anatomy 0.000 description 2
- 210000005090 tracheal smooth muscle Anatomy 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 230000036269 ulceration Effects 0.000 description 2
- 230000002227 vasoactive effect Effects 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- LSPHULWDVZXLIL-UHFFFAOYSA-N (+/-)-Camphoric acid Chemical compound CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- YDMRDHQUQIVWBE-UHFFFAOYSA-N (2-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1O YDMRDHQUQIVWBE-UHFFFAOYSA-N 0.000 description 1
- NWHMWIVWIQTQIT-UHFFFAOYSA-N (2-methoxyoxolan-3-yl)methanol Chemical compound COC1OCCC1CO NWHMWIVWIQTQIT-UHFFFAOYSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- MZOFCQQQCNRIBI-VMXHOPILSA-N (3s)-4-[[(2s)-1-[[(2s)-1-[[(1s)-1-carboxy-2-hydroxyethyl]amino]-4-methyl-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-[[2-[[(2s)-2,6-diaminohexanoyl]amino]acetyl]amino]-4-oxobutanoic acid Chemical compound OC[C@@H](C(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@@H](N)CCCCN MZOFCQQQCNRIBI-VMXHOPILSA-N 0.000 description 1
- TYRJBOCNOIHLHD-UHFFFAOYSA-N (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound O1C(=O)OC(COC(=O)C=2C=C(C=CC=2)C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1C TYRJBOCNOIHLHD-UHFFFAOYSA-N 0.000 description 1
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- TWBNMYSKRDRHAT-RCWTXCDDSA-N (S)-timolol hemihydrate Chemical compound O.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1.CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 TWBNMYSKRDRHAT-RCWTXCDDSA-N 0.000 description 1
- SLLFVLKNXABYGI-UHFFFAOYSA-N 1,2,3-benzoxadiazole Chemical compound C1=CC=C2ON=NC2=C1 SLLFVLKNXABYGI-UHFFFAOYSA-N 0.000 description 1
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 description 1
- 125000004529 1,2,3-triazinyl group Chemical group N1=NN=C(C=C1)* 0.000 description 1
- 125000001607 1,2,3-triazol-1-yl group Chemical group [*]N1N=NC([H])=C1[H] 0.000 description 1
- 125000004516 1,2,4-thiadiazol-5-yl group Chemical group S1N=CN=C1* 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 1
- 125000004507 1,2,5-oxadiazol-3-yl group Chemical group O1N=C(C=N1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004519 1,2,5-thiadiazol-4-yl group Chemical group S1N=CC(=N1)* 0.000 description 1
- 125000004509 1,3,4-oxadiazol-2-yl group Chemical group O1C(=NN=C1)* 0.000 description 1
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004227 1,3-benzoxazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)OC2=C1[H] 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- BGPJLYIFDLICMR-UHFFFAOYSA-N 1,4,2,3-dioxadithiolan-5-one Chemical compound O=C1OSSO1 BGPJLYIFDLICMR-UHFFFAOYSA-N 0.000 description 1
- HKDFRDIIELOLTJ-UHFFFAOYSA-N 1,4-dithianyl Chemical group [CH]1CSCCS1 HKDFRDIIELOLTJ-UHFFFAOYSA-N 0.000 description 1
- 125000000183 1,4-thiazinyl group Chemical group S1C(C=NC=C1)* 0.000 description 1
- LLAPDLPYIYKTGQ-UHFFFAOYSA-N 1-aminoethyl Chemical group C[CH]N LLAPDLPYIYKTGQ-UHFFFAOYSA-N 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- SKIDNYUZJPMKFC-UHFFFAOYSA-N 1-iododecane Chemical compound CCCCCCCCCCI SKIDNYUZJPMKFC-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- WRAZVLLSRSIBMX-UHFFFAOYSA-N 1-o,4-o-ditert-butyl 2-o-methyl 5-(aminomethyl)-6-bromobenzene-1,2,4-tricarboxylate Chemical compound COC(=O)C1=CC(C(=O)OC(C)(C)C)=C(CN)C(Br)=C1C(=O)OC(C)(C)C WRAZVLLSRSIBMX-UHFFFAOYSA-N 0.000 description 1
- ABEXEQSGABRUHS-UHFFFAOYSA-N 16-methylheptadecyl 16-methylheptadecanoate Chemical compound CC(C)CCCCCCCCCCCCCCCOC(=O)CCCCCCCCCCCCCCC(C)C ABEXEQSGABRUHS-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- AWBOSXFRPFZLOP-UHFFFAOYSA-N 2,1,3-benzoxadiazole Chemical compound C1=CC=CC2=NON=C21 AWBOSXFRPFZLOP-UHFFFAOYSA-N 0.000 description 1
- HDIJZFORGDBEKL-UHFFFAOYSA-N 2,3,4-trimethylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(C)=C1C HDIJZFORGDBEKL-UHFFFAOYSA-N 0.000 description 1
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- UQOJWKCPHDCNQS-UHFFFAOYSA-N 2-(3-boronophenyl)acetic acid Chemical compound OB(O)C1=CC=CC(CC(O)=O)=C1 UQOJWKCPHDCNQS-UHFFFAOYSA-N 0.000 description 1
- HQCVEDWBQGQKLC-UHFFFAOYSA-N 2-[3-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]acetic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(CC(O)=O)=C1 HQCVEDWBQGQKLC-UHFFFAOYSA-N 0.000 description 1
- DVUBPTVPBITVNY-UHFFFAOYSA-N 2-[3-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(pyridin-4-ylcarbamoyl)phenyl]phenoxy]acetic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(OCC(O)=O)=C1 DVUBPTVPBITVNY-UHFFFAOYSA-N 0.000 description 1
- IYHFKTYTWCCSGL-UHFFFAOYSA-N 2-[3-[5-[(3-fluoropyridin-4-yl)carbamoyl]-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]phenoxy]acetic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(OCC(O)=O)=C1 IYHFKTYTWCCSGL-UHFFFAOYSA-N 0.000 description 1
- UXGVMFHEKMGWMA-UHFFFAOYSA-N 2-benzofuran Chemical compound C1=CC=CC2=COC=C21 UXGVMFHEKMGWMA-UHFFFAOYSA-N 0.000 description 1
- BLFLNQAELCDVEH-UHFFFAOYSA-N 2-methoxy-3-(2-phenylmethoxyethoxy)oxolane Chemical compound COC1OCCC1OCCOCC1=CC=CC=C1 BLFLNQAELCDVEH-UHFFFAOYSA-N 0.000 description 1
- BRHKXZQTYRKWFC-UHFFFAOYSA-N 2-methoxy-3-(phenylmethoxymethyl)oxolane Chemical compound COC1OCCC1COCC1=CC=CC=C1 BRHKXZQTYRKWFC-UHFFFAOYSA-N 0.000 description 1
- 229940080296 2-naphthalenesulfonate Drugs 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- YZXBSWMTSIAHKH-UHFFFAOYSA-N 2-phenylethyl 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1C(=O)OCCC1=CC=CC=C1 YZXBSWMTSIAHKH-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- CUZKCNWZBXLAJX-UHFFFAOYSA-N 2-phenylmethoxyethanol Chemical compound OCCOCC1=CC=CC=C1 CUZKCNWZBXLAJX-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- GACDQMDRPRGCTN-KQYNXXCUSA-N 3'-phospho-5'-adenylyl sulfate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OS(O)(=O)=O)[C@@H](OP(O)(O)=O)[C@H]1O GACDQMDRPRGCTN-KQYNXXCUSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- ITFPVXFWLJYGQA-UHFFFAOYSA-N 3-(2-hydroxyethoxy)oxolan-2-one Chemical compound OCCOC1CCOC1=O ITFPVXFWLJYGQA-UHFFFAOYSA-N 0.000 description 1
- RFANUTVLJNRERD-UHFFFAOYSA-N 3-(2-hydroxyethylsulfanyl)oxolan-2-one Chemical compound OCCSC1CCOC1=O RFANUTVLJNRERD-UHFFFAOYSA-N 0.000 description 1
- HOLUZKROLGGVNE-UHFFFAOYSA-N 3-(2-phenylmethoxyethoxy)oxolan-2-ol Chemical compound OC1OCCC1OCCOCC1=CC=CC=C1 HOLUZKROLGGVNE-UHFFFAOYSA-N 0.000 description 1
- ZGSSBWINUSIRRL-UHFFFAOYSA-N 3-(2-phenylmethoxyethoxy)oxolan-2-one Chemical compound O=C1OCCC1OCCOCC1=CC=CC=C1 ZGSSBWINUSIRRL-UHFFFAOYSA-N 0.000 description 1
- JJBQHOJBARDWRZ-UHFFFAOYSA-N 3-(3-boronophenyl)propanoic acid Chemical compound OB(O)C1=CC=CC(CCC(O)=O)=C1 JJBQHOJBARDWRZ-UHFFFAOYSA-N 0.000 description 1
- SSSQQFFLOVVOAX-UHFFFAOYSA-N 3-(3-hydroxypropylsulfanyl)oxolan-2-one Chemical compound OCCCSC1CCOC1=O SSSQQFFLOVVOAX-UHFFFAOYSA-N 0.000 description 1
- FVHFAHVQMVXTRN-UHFFFAOYSA-N 3-(bromomethyl)oxetan-2-one Chemical compound BrCC1COC1=O FVHFAHVQMVXTRN-UHFFFAOYSA-N 0.000 description 1
- SQGFUXSRIIEVCU-UHFFFAOYSA-N 3-(hydroxymethyl)oxolan-2-one Chemical compound OCC1CCOC1=O SQGFUXSRIIEVCU-UHFFFAOYSA-N 0.000 description 1
- YPKRMUSSUFMDID-UHFFFAOYSA-N 3-(piperidin-4-ylmethylsulfanyl)oxolan-2-one Chemical compound O=C1OCCC1SCC1CCNCC1 YPKRMUSSUFMDID-UHFFFAOYSA-N 0.000 description 1
- MQRMDGZRJXOYKM-UHFFFAOYSA-N 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoic acid Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(C(O)=O)=C1 MQRMDGZRJXOYKM-UHFFFAOYSA-N 0.000 description 1
- LEADNSBXCMYZAL-UHFFFAOYSA-N 3-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-5-(pyridin-4-ylcarbamoyl)phenyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(C(O)=O)=C1 LEADNSBXCMYZAL-UHFFFAOYSA-N 0.000 description 1
- KMNWCEFLRKXRLI-UHFFFAOYSA-N 3-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-5-(pyridin-4-ylcarbamoyl)phenyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(C(O)=O)=C1 KMNWCEFLRKXRLI-UHFFFAOYSA-N 0.000 description 1
- JELMQWNNMPMEQQ-UHFFFAOYSA-N 3-[3-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(CCC(O)=O)=C1 JELMQWNNMPMEQQ-UHFFFAOYSA-N 0.000 description 1
- WIPQQAANXBLISX-UHFFFAOYSA-N 3-[5-[(3-fluoropyridin-4-yl)carbamoyl]-2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(C(O)=O)=C1 WIPQQAANXBLISX-UHFFFAOYSA-N 0.000 description 1
- QXSHWSKXCHIMMV-UHFFFAOYSA-N 3-[5-[(3-fluoropyridin-4-yl)carbamoyl]-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(C(O)=O)=C1 QXSHWSKXCHIMMV-UHFFFAOYSA-N 0.000 description 1
- LDAUOUCZZYZWKW-UHFFFAOYSA-N 3-bromo-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(O)=O)C=C1Br LDAUOUCZZYZWKW-UHFFFAOYSA-N 0.000 description 1
- ZFJOMUKPDWNRFI-UHFFFAOYSA-N 3-bromo-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1Br ZFJOMUKPDWNRFI-UHFFFAOYSA-N 0.000 description 1
- ASVKKRLMJCWVQF-UHFFFAOYSA-N 3-buten-1-amine Chemical compound NCCC=C ASVKKRLMJCWVQF-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- UFIKBUVVVGSMGW-UHFFFAOYSA-N 3-fluoropyridin-4-amine Chemical compound NC1=CC=NC=C1F UFIKBUVVVGSMGW-UHFFFAOYSA-N 0.000 description 1
- VWRMWPLRVMCHFX-UHFFFAOYSA-N 3-hydroxypropyl 3-[2-(1-aminoethyl)-5-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]benzoate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(C(=O)OCCCO)=C1 VWRMWPLRVMCHFX-UHFFFAOYSA-N 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-M 3-phenylpropionate Chemical compound [O-]C(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-M 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- SHLSSLVZXJBVHE-UHFFFAOYSA-N 3-sulfanylpropan-1-ol Chemical compound OCCCS SHLSSLVZXJBVHE-UHFFFAOYSA-N 0.000 description 1
- LZPWAYBEOJRFAX-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2$l^{2}-dioxaborolane Chemical compound CC1(C)O[B]OC1(C)C LZPWAYBEOJRFAX-UHFFFAOYSA-N 0.000 description 1
- FQQWHVHIVIXPKN-UHFFFAOYSA-N 4-(1-aminoethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethoxy]phenyl]-N-pyridin-4-ylbenzamide Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1OCCSC1CCOC1=O FQQWHVHIVIXPKN-UHFFFAOYSA-N 0.000 description 1
- APKVHAVFMYAIPG-UHFFFAOYSA-N 4-(1-aminoethyl)-3-[3-[[2-(2-oxo-3,4-dihydrochromen-4-yl)acetyl]amino]phenyl]-n-pyridin-4-ylbenzamide Chemical compound C1=C(C=2C=C(NC(=O)CC3C4=CC=CC=C4OC(=O)C3)C=CC=2)C(C(N)C)=CC=C1C(=O)NC1=CC=NC=C1 APKVHAVFMYAIPG-UHFFFAOYSA-N 0.000 description 1
- AMGAOADKNTZBEQ-UHFFFAOYSA-N 4-(1-aminoethyl)-3-bromobenzoic acid Chemical compound CC(N)C1=CC=C(C(O)=O)C=C1Br AMGAOADKNTZBEQ-UHFFFAOYSA-N 0.000 description 1
- ROEMPJJKJHRVET-UHFFFAOYSA-N 4-(2-aminoethyl)-1,3-dioxolan-2-one Chemical compound NCCC1COC(=O)O1 ROEMPJJKJHRVET-UHFFFAOYSA-N 0.000 description 1
- LXWWDAJPGMMYHS-UHFFFAOYSA-N 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)oxyethoxy]phenyl]-n-pyridin-4-ylbenzamide Chemical compound NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1OCCOC1CCOC1=O LXWWDAJPGMMYHS-UHFFFAOYSA-N 0.000 description 1
- MXTMOTYWZYDQMM-UHFFFAOYSA-N 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)oxyethylamino]phenyl]-n-pyridin-4-ylbenzamide Chemical compound NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1NCCOC1CCOC1=O MXTMOTYWZYDQMM-UHFFFAOYSA-N 0.000 description 1
- DNCQFDLUBQNDHX-UHFFFAOYSA-N 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethoxy]phenyl]benzoic acid Chemical compound NCC1=CC=C(C=C1C1=CC(=CC=C1)OCCSC1C(OCC1)=O)C(=O)O DNCQFDLUBQNDHX-UHFFFAOYSA-N 0.000 description 1
- RVIIYETYOXDZCL-UHFFFAOYSA-N 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethylamino]phenyl]-n-pyridin-4-ylbenzamide Chemical compound NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1NCCSC1CCOC1=O RVIIYETYOXDZCL-UHFFFAOYSA-N 0.000 description 1
- FZPISHBKJNBHQH-UHFFFAOYSA-N 4-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]-1H-indole-2-carboxylic acid Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=C2C=C(NC2=CC=C1)C(=O)O FZPISHBKJNBHQH-UHFFFAOYSA-N 0.000 description 1
- YNNSGXGPSDCOJW-UHFFFAOYSA-N 4-acetyl-3-bromobenzoic acid Chemical compound CC(=O)C1=CC=C(C(O)=O)C=C1Br YNNSGXGPSDCOJW-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- DMAYBPBPEUFIHJ-UHFFFAOYSA-N 4-bromobut-1-ene Chemical compound BrCCC=C DMAYBPBPEUFIHJ-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- CPFWDKHAGLQDFF-UHFFFAOYSA-N 5-(2-hydroxyethyl)-3h-furan-2-one Chemical compound OCCC1=CCC(=O)O1 CPFWDKHAGLQDFF-UHFFFAOYSA-N 0.000 description 1
- LZCNOHUBDTVPDY-UHFFFAOYSA-N 5-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]-N-[(2-oxothiolan-3-yl)methyl]thiophene-2-carboxamide Chemical compound NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(S1)=CC=C1C(=O)NCC1CCSC1=O LZCNOHUBDTVPDY-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 208000020053 Abnormal inflammatory response Diseases 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- 208000036065 Airway Remodeling Diseases 0.000 description 1
- 229920001450 Alpha-Cyclodextrin Polymers 0.000 description 1
- XYLJNLCSTIOKRM-UHFFFAOYSA-N Alphagan Chemical compound C1=CC2=NC=CN=C2C(Br)=C1NC1=NCCN1 XYLJNLCSTIOKRM-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108091006515 Anion channels Proteins 0.000 description 1
- 102000037829 Anion channels Human genes 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- RWUJRZKIQZESPS-UHFFFAOYSA-N B(O)O.COC(=O)C=1N(C2=CC=CC=C2C1)Br Chemical compound B(O)O.COC(=O)C=1N(C2=CC=CC=C2C1)Br RWUJRZKIQZESPS-UHFFFAOYSA-N 0.000 description 1
- NDNMNGGYLKRZAX-UHFFFAOYSA-N B(O)O.COC(=O)C=1NC=CC1 Chemical compound B(O)O.COC(=O)C=1NC=CC1 NDNMNGGYLKRZAX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CVQXXAVJXWFBLN-UHFFFAOYSA-N BrC1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)NC(O)=O Chemical compound BrC1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)NC(O)=O CVQXXAVJXWFBLN-UHFFFAOYSA-N 0.000 description 1
- 206010006482 Bronchospasm Diseases 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- XSWGSXGSKSFUAJ-UHFFFAOYSA-N C(C)(C)(C)OC(=O)NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C=1C=CNC1 Chemical compound C(C)(C)(C)OC(=O)NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C=1C=CNC1 XSWGSXGSKSFUAJ-UHFFFAOYSA-N 0.000 description 1
- FVICMYUHOUZEOT-UHFFFAOYSA-N C(C)(C)(C)OC(NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)N)=O.C(C)(C)(C)OC(NCC1=C(C=C(C=C1)C(NC1=C(C=NC=C1)F)=O)C1=CC(=CC=C1)O)=O Chemical compound C(C)(C)(C)OC(NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)N)=O.C(C)(C)(C)OC(NCC1=C(C=C(C=C1)C(NC1=C(C=NC=C1)F)=O)C1=CC(=CC=C1)O)=O FVICMYUHOUZEOT-UHFFFAOYSA-N 0.000 description 1
- CQJSEWCHMBSTKK-UHFFFAOYSA-N C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN Chemical compound C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN CQJSEWCHMBSTKK-UHFFFAOYSA-N 0.000 description 1
- RVQOOAGPFYMSJH-UHFFFAOYSA-N C(C)SC(=O)C1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(C)SC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN Chemical compound C(C)SC(=O)C1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(C)SC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN RVQOOAGPFYMSJH-UHFFFAOYSA-N 0.000 description 1
- TWVAKNPSDFSSFR-UHFFFAOYSA-N C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N.C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N.C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N TWVAKNPSDFSSFR-UHFFFAOYSA-N 0.000 description 1
- QOLUDVKOJWQQKL-UHFFFAOYSA-N C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N Chemical compound C(CC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(C)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N QOLUDVKOJWQQKL-UHFFFAOYSA-N 0.000 description 1
- SZXUOLQNCOTHSR-UHFFFAOYSA-N C(CCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(CCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound C(CCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.C(CCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N SZXUOLQNCOTHSR-UHFFFAOYSA-N 0.000 description 1
- UIWDVOUOPFNRRO-UHFFFAOYSA-N C(CCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN Chemical compound C(CCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN UIWDVOUOPFNRRO-UHFFFAOYSA-N 0.000 description 1
- XRRYPYRXGPOFIW-UHFFFAOYSA-N C(CCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound C(CCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N XRRYPYRXGPOFIW-UHFFFAOYSA-N 0.000 description 1
- DDPYTNRYQPEZDY-UHFFFAOYSA-N C(CCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound C(CCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N DDPYTNRYQPEZDY-UHFFFAOYSA-N 0.000 description 1
- UZIRPRQVSDMWKR-UHFFFAOYSA-N C(CCCCCCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound C(CCCCCCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.C(CCCCCCCCCCCC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N UZIRPRQVSDMWKR-UHFFFAOYSA-N 0.000 description 1
- RZNZDKYXMJOUMN-UHFFFAOYSA-N C1(=CC=CC=C1)OC(CCC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N)=O.C(CC)OC(CCC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N)=O Chemical compound C1(=CC=CC=C1)OC(CCC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N)=O.C(CC)OC(CCC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N)=O RZNZDKYXMJOUMN-UHFFFAOYSA-N 0.000 description 1
- ALZLTHLQMAFAPA-UHFFFAOYSA-N CC(C1)COC1=O Chemical compound CC(C1)COC1=O ALZLTHLQMAFAPA-UHFFFAOYSA-N 0.000 description 1
- KMCGEYKRTBLDNR-UHFFFAOYSA-N CC(C1)c(cccc2)c2OC1=O Chemical compound CC(C1)c(cccc2)c2OC1=O KMCGEYKRTBLDNR-UHFFFAOYSA-N 0.000 description 1
- RZTOWFMDBDPERY-UHFFFAOYSA-N CC(CCC1)OC1=O Chemical compound CC(CCC1)OC1=O RZTOWFMDBDPERY-UHFFFAOYSA-N 0.000 description 1
- QPMYQKYOEKLGIF-UHFFFAOYSA-N CC(CCS1)C1=O Chemical compound CC(CCS1)C1=O QPMYQKYOEKLGIF-UHFFFAOYSA-N 0.000 description 1
- RUOJZAUFBMNUDX-UHFFFAOYSA-N CC(CO1)OC1=O Chemical compound CC(CO1)OC1=O RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 1
- VKACUMNDDKMYEC-UHFFFAOYSA-N CC(Cc(cccc1)c1O1)C1=O Chemical compound CC(Cc(cccc1)c1O1)C1=O VKACUMNDDKMYEC-UHFFFAOYSA-N 0.000 description 1
- QYIOFABFKUOIBV-UHFFFAOYSA-N CC(O1)=C(C)OC1=O Chemical compound CC(O1)=C(C)OC1=O QYIOFABFKUOIBV-UHFFFAOYSA-N 0.000 description 1
- SMTDIEBUWFHPON-UHFFFAOYSA-N CC(O1)=C(CI)OC1=O Chemical compound CC(O1)=C(CI)OC1=O SMTDIEBUWFHPON-UHFFFAOYSA-N 0.000 description 1
- ULVAFTSBGFLYID-UHFFFAOYSA-N CC(O1)=C(N)OC1=O Chemical compound CC(O1)=C(N)OC1=O ULVAFTSBGFLYID-UHFFFAOYSA-N 0.000 description 1
- JSJKAEKKWQOCEZ-UHFFFAOYSA-N CC(c1ccc(C)cc1O1)C1=O Chemical compound CC(c1ccc(C)cc1O1)C1=O JSJKAEKKWQOCEZ-UHFFFAOYSA-N 0.000 description 1
- FXRCXFODHPDFBX-UHFFFAOYSA-N CCOC(CSCC(NC1=CC=CC(C2=C(C(C)N)C=CC(C(NC3=CC=NC=C3)=O)=C2)=C1)=O)=O.NC1=CC=NC=C1 Chemical compound CCOC(CSCC(NC1=CC=CC(C2=C(C(C)N)C=CC(C(NC3=CC=NC=C3)=O)=C2)=C1)=O)=O.NC1=CC=NC=C1 FXRCXFODHPDFBX-UHFFFAOYSA-N 0.000 description 1
- WBLCWXCOJNVVPO-UHFFFAOYSA-N COC(=O)C1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN Chemical compound COC(=O)C1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN.COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN WBLCWXCOJNVVPO-UHFFFAOYSA-N 0.000 description 1
- ZYYDFUUPNATOJR-UHFFFAOYSA-N COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=NC=NC=C1)=O)CN Chemical compound COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N.COC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=NC=NC=C1)=O)CN ZYYDFUUPNATOJR-UHFFFAOYSA-N 0.000 description 1
- VBDYTIGXLYROFL-UHFFFAOYSA-N COC(C(CCCC1)N1C(C1=CC=CC(C2=C(CN)C=CC(C(NC3=CC=NC=C3)=O)=C2)=C1)=O)=O.NC1=CC=NC=C1 Chemical compound COC(C(CCCC1)N1C(C1=CC=CC(C2=C(CN)C=CC(C(NC3=CC=NC=C3)=O)=C2)=C1)=O)=O.NC1=CC=NC=C1 VBDYTIGXLYROFL-UHFFFAOYSA-N 0.000 description 1
- KGOWZEPKOPUQSS-UHFFFAOYSA-N COC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.COC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound COC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.COC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O KGOWZEPKOPUQSS-UHFFFAOYSA-N 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 108090000397 Caspase 3 Proteins 0.000 description 1
- 102100032616 Caspase-2 Human genes 0.000 description 1
- 108090000552 Caspase-2 Proteins 0.000 description 1
- 102100029855 Caspase-3 Human genes 0.000 description 1
- LVILGAOSPDLNRM-UHFFFAOYSA-N Cc1ccncn1 Chemical compound Cc1ccncn1 LVILGAOSPDLNRM-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 238000002965 ELISA Methods 0.000 description 1
- 102100030013 Endoribonuclease Human genes 0.000 description 1
- 101710199605 Endoribonuclease Proteins 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UQGHMTABJOWJAI-UHFFFAOYSA-N FCSC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound FCSC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O UQGHMTABJOWJAI-UHFFFAOYSA-N 0.000 description 1
- XMNIDBDHJWLMBX-UHFFFAOYSA-N FCSC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound FCSC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(COC1=CC=C(C=C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O XMNIDBDHJWLMBX-UHFFFAOYSA-N 0.000 description 1
- WXCVKTFMMPCMHZ-UHFFFAOYSA-N FCSC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound FCSC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O.C(C)SC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O WXCVKTFMMPCMHZ-UHFFFAOYSA-N 0.000 description 1
- 239000001116 FEMA 4028 Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 102000013446 GTP Phosphohydrolases Human genes 0.000 description 1
- 102000030782 GTP binding Human genes 0.000 description 1
- 108091000058 GTP-Binding Proteins 0.000 description 1
- 108091006109 GTPases Proteins 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 102000001398 Granzyme Human genes 0.000 description 1
- 108060005986 Granzyme Proteins 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000946889 Homo sapiens Monocyte differentiation antigen CD14 Proteins 0.000 description 1
- 101000763314 Homo sapiens Thrombomodulin Proteins 0.000 description 1
- 101000938391 Homo sapiens Transmembrane protein Proteins 0.000 description 1
- 206010020565 Hyperaemia Diseases 0.000 description 1
- 206010020880 Hypertrophy Diseases 0.000 description 1
- PCHGYPNRADCIKG-UHFFFAOYSA-N Ic1ccnc2c1cc[nH]2 Chemical compound Ic1ccnc2c1cc[nH]2 PCHGYPNRADCIKG-UHFFFAOYSA-N 0.000 description 1
- USYVBQLOSZDDBE-UHFFFAOYSA-N Ic1ncncc1 Chemical compound Ic1ncncc1 USYVBQLOSZDDBE-UHFFFAOYSA-N 0.000 description 1
- 108090001005 Interleukin-6 Proteins 0.000 description 1
- 241000764238 Isis Species 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241000343235 Maso Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 102100035877 Monocyte differentiation antigen CD14 Human genes 0.000 description 1
- 102000011131 Myosin-Light-Chain Phosphatase Human genes 0.000 description 1
- 108010037801 Myosin-Light-Chain Phosphatase Proteins 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- PICDPHKLXWGOSN-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=C(C=NC=C1)F)=O)C1=CC(=CC=C1)OCC(=O)O.C(CC)OC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N)=O Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=C(C=NC=C1)F)=O)C1=CC(=CC=C1)OCC(=O)O.C(CC)OC(COC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N)=O PICDPHKLXWGOSN-UHFFFAOYSA-N 0.000 description 1
- ISNWNVLCQMGEIJ-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=C2C(=NC=C1)NC=C2)=O)C2=CC(=CC=C2)C(=O)O.COC(=O)C=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=C(C=NC=C2)F)=O)C(C)N Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=C2C(=NC=C1)NC=C2)=O)C2=CC(=CC=C2)C(=O)O.COC(=O)C=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=C(C=NC=C2)F)=O)C(C)N ISNWNVLCQMGEIJ-UHFFFAOYSA-N 0.000 description 1
- JURMHJULCHGESK-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=C2C=C(NC2=CC=C1)C(=O)O.COC(=O)C=1NC2=CC=CC(=C2C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=C2C=C(NC2=CC=C1)C(=O)O.COC(=O)C=1NC2=CC=CC(=C2C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N JURMHJULCHGESK-UHFFFAOYSA-N 0.000 description 1
- GYWFZWYLRVBOET-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C(=O)O.COC=1C=C(C=C(C1OC)OC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C(=O)O.COC=1C=C(C=C(C1OC)OC)OC(=O)C=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=C(C=NC=C1)F)=O)C(C)N GYWFZWYLRVBOET-UHFFFAOYSA-N 0.000 description 1
- CCIVKSFXTXRGLU-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C(=O)O.[N+](=O)([O-])C1=C(COC(=O)C=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=CC=NC=C2)=O)C(C)N)C=CC=C1 Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C(=O)O.[N+](=O)([O-])C1=C(COC(=O)C=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=CC=NC=C2)=O)C(C)N)C=CC=C1 CCIVKSFXTXRGLU-UHFFFAOYSA-N 0.000 description 1
- ZNYYWMHQWHSVPI-UHFFFAOYSA-N NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C=1C=C(NC1)C(=O)O.COC(=O)C=1NC=C(C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N Chemical compound NC(C)C1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C=1C=C(NC1)C(=O)O.COC(=O)C=1NC=C(C1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)C(C)N ZNYYWMHQWHSVPI-UHFFFAOYSA-N 0.000 description 1
- BGUKKOBXMBMTRI-UHFFFAOYSA-N NC(C)C1=CC=C(C=C1C1=CC(=CC=C1)OC1C(OCC1)=O)C(=O)O.N1=CC=C(C=C1)NC(=O)C=1C=C(C(=CC1)CN)C1=CC(=CC=C1)OCC1C(SCC1)=O Chemical compound NC(C)C1=CC=C(C=C1C1=CC(=CC=C1)OC1C(OCC1)=O)C(=O)O.N1=CC=C(C=C1)NC(=O)C=1C=C(C(=CC1)CN)C1=CC(=CC=C1)OCC1C(SCC1)=O BGUKKOBXMBMTRI-UHFFFAOYSA-N 0.000 description 1
- IKBRMDDLVOHKDI-UHFFFAOYSA-N NC(C)C1=CC=C(C=C1C1=CC(=CC=C1)OCCCSC1C(OCC1)=O)C(=O)O Chemical compound NC(C)C1=CC=C(C=C1C1=CC(=CC=C1)OCCCSC1C(OCC1)=O)C(=O)O IKBRMDDLVOHKDI-UHFFFAOYSA-N 0.000 description 1
- BBGZTSZVGWIYER-UHFFFAOYSA-N NC(CCCO1)C1=O Chemical compound NC(CCCO1)C1=O BBGZTSZVGWIYER-UHFFFAOYSA-N 0.000 description 1
- BERHIXIZFDTNBN-UHFFFAOYSA-N NC(CCO1)CC1=O Chemical compound NC(CCO1)CC1=O BERHIXIZFDTNBN-UHFFFAOYSA-N 0.000 description 1
- MFBFZXUSFVXOQA-UHFFFAOYSA-N NC(CO1)OC1=O Chemical compound NC(CO1)OC1=O MFBFZXUSFVXOQA-UHFFFAOYSA-N 0.000 description 1
- JAQJSYBJAYWJDP-UHFFFAOYSA-N NC(O1)=CCC1=O Chemical compound NC(O1)=CCC1=O JAQJSYBJAYWJDP-UHFFFAOYSA-N 0.000 description 1
- WAYKFXCXLXZFJB-UHFFFAOYSA-N NCC1=C(C=C(C(=O)N(C2=CC=NC=C2)N(C(C2=CC(=C(C=C2)CN)C2=CC=CC=3CC(OC32)=O)=O)C3=CC=NC=C3)C=C1)C1=CC3=C(CC(O3)=O)C=C1 Chemical compound NCC1=C(C=C(C(=O)N(C2=CC=NC=C2)N(C(C2=CC(=C(C=C2)CN)C2=CC=CC=3CC(OC32)=O)=O)C3=CC=NC=C3)C=C1)C1=CC3=C(CC(O3)=O)C=C1 WAYKFXCXLXZFJB-UHFFFAOYSA-N 0.000 description 1
- CCVGYIPUDWKJNL-UHFFFAOYSA-N NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C=CC(=O)OCOC(CCC)=O.COC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)C=CC(=O)OCOC(CCC)=O.COC(C=CC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O CCVGYIPUDWKJNL-UHFFFAOYSA-N 0.000 description 1
- JJDHPICLFSOVMJ-UHFFFAOYSA-N NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)OCC(=O)O.O1C(COC2=C1C=CC=C2)COC(COC=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=CC=NC=C2)=O)CN)=O Chemical compound NCC1=C(C=C(C=C1)C(NC1=CC=NC=C1)=O)C1=CC(=CC=C1)OCC(=O)O.O1C(COC2=C1C=CC=C2)COC(COC=2C=C(C=CC2)C2=C(C=CC(=C2)C(NC2=CC=NC=C2)=O)CN)=O JJDHPICLFSOVMJ-UHFFFAOYSA-N 0.000 description 1
- DIFXTLBXMTUYPU-UHFFFAOYSA-N NCC1=CC=C(C=C1C1=CC(=CC=C1)NC(CC=1OC(CC1)=O)=O)C(=O)O.COC(CC(=O)NC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O Chemical compound NCC1=CC=C(C=C1C1=CC(=CC=C1)NC(CC=1OC(CC1)=O)=O)C(=O)O.COC(CC(=O)NC=1C=C(C=CC1)C1=C(C=CC(=C1)C(NC1=CC=NC=C1)=O)CN)=O DIFXTLBXMTUYPU-UHFFFAOYSA-N 0.000 description 1
- 208000028389 Nerve injury Diseases 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- BDSCFBJWBIJLDH-UHFFFAOYSA-N O=C(C1)OCC1I Chemical compound O=C(C1)OCC1I BDSCFBJWBIJLDH-UHFFFAOYSA-N 0.000 description 1
- 208000022873 Ocular disease Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 229920002230 Pectic acid Polymers 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 206010038687 Respiratory distress Diseases 0.000 description 1
- 102000002278 Ribosomal Proteins Human genes 0.000 description 1
- 108010000605 Ribosomal Proteins Proteins 0.000 description 1
- 101710113029 Serine/threonine-protein kinase Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 208000032851 Subarachnoid Hemorrhage Diseases 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 1
- HDYANYHVCAPMJV-LXQIFKJMSA-N UDP-alpha-D-glucuronic acid Chemical compound C([C@@H]1[C@H]([C@H]([C@@H](O1)N1C(NC(=O)C=C1)=O)O)O)OP(O)(=O)OP(O)(=O)O[C@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O HDYANYHVCAPMJV-LXQIFKJMSA-N 0.000 description 1
- HDYANYHVCAPMJV-UHFFFAOYSA-N Uridine diphospho-D-glucuronic acid Natural products O1C(N2C(NC(=O)C=C2)=O)C(O)C(O)C1COP(O)(=O)OP(O)(=O)OC1OC(C(O)=O)C(O)C(O)C1O HDYANYHVCAPMJV-UHFFFAOYSA-N 0.000 description 1
- 206010047163 Vasospasm Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- FEDUSEIJGFSNPS-UHFFFAOYSA-N [2-(4-bromophenyl)-2-oxoethyl] 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1C(=O)OCC(=O)C1=CC=C(Br)C=C1 FEDUSEIJGFSNPS-UHFFFAOYSA-N 0.000 description 1
- SZPWXAOBLNYOHY-UHFFFAOYSA-N [C]1=CC=NC2=CC=CC=C12 Chemical group [C]1=CC=NC2=CC=CC=C12 SZPWXAOBLNYOHY-UHFFFAOYSA-N 0.000 description 1
- ZIHQUWYJSTVYAT-UHFFFAOYSA-N [NH-][N+]([O-])=O Chemical compound [NH-][N+]([O-])=O ZIHQUWYJSTVYAT-UHFFFAOYSA-N 0.000 description 1
- XJLXINKUBYWONI-DQQFMEOOSA-N [[(2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2s,3r,4s,5s)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate Chemical compound NC(=O)C1=CC=C[N+]([C@@H]2[C@H]([C@@H](O)[C@H](COP([O-])(=O)OP(O)(=O)OC[C@@H]3[C@H]([C@@H](OP(O)(O)=O)[C@@H](O3)N3C4=NC=NC(N)=C4N=C3)O)O2)O)=C1 XJLXINKUBYWONI-DQQFMEOOSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 208000037883 airway inflammation Diseases 0.000 description 1
- 210000005091 airway smooth muscle Anatomy 0.000 description 1
- 210000005057 airway smooth muscle cell Anatomy 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004419 alkynylene group Chemical group 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- AEMOLEFTQBMNLQ-BKBMJHBISA-N alpha-D-galacturonic acid Chemical compound O[C@H]1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-BKBMJHBISA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- HFHDHCJBZVLPGP-RWMJIURBSA-N alpha-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO HFHDHCJBZVLPGP-RWMJIURBSA-N 0.000 description 1
- 229940043377 alpha-cyclodextrin Drugs 0.000 description 1
- AWUCVROLDVIAJX-UHFFFAOYSA-N alpha-glycerophosphate Natural products OCC(O)COP(O)(O)=O AWUCVROLDVIAJX-UHFFFAOYSA-N 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003098 androgen Substances 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 125000002078 anthracen-1-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([*])=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000000748 anthracen-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C([H])=C([*])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 210000003433 aortic smooth muscle cell Anatomy 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229940114079 arachidonic acid Drugs 0.000 description 1
- 235000021342 arachidonic acid Nutrition 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 230000037007 arousal Effects 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 230000001363 autoimmune Effects 0.000 description 1
- 230000005784 autoimmunity Effects 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 125000004532 benzofuran-3-yl group Chemical group O1C=C(C2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004534 benzothien-2-yl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004197 benzothien-3-yl group Chemical group [H]C1=C(*)C2=C([H])C([H])=C([H])C([H])=C2S1 0.000 description 1
- 125000004535 benzothien-5-yl group Chemical group S1C=CC2=C1C=CC(=C2)* 0.000 description 1
- 229940007550 benzyl acetate Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940125388 beta agonist Drugs 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229940097320 beta blocking agent Drugs 0.000 description 1
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 1
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 1
- XMIIGOLPHOKFCH-UHFFFAOYSA-N beta-phenylpropanoic acid Natural products OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 1
- 229960004853 betadex Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000012148 binding buffer Substances 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- 229960003679 brimonidine Drugs 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 239000004044 bronchoconstricting agent Substances 0.000 description 1
- 230000007885 bronchoconstriction Effects 0.000 description 1
- 230000003435 bronchoconstrictive effect Effects 0.000 description 1
- 230000007883 bronchodilation Effects 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- WFGFUMLJADNANX-UHFFFAOYSA-N but-3-enoic acid Chemical compound [CH2]\C=C\C(O)=O WFGFUMLJADNANX-UHFFFAOYSA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 229960001714 calcium phosphate Drugs 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical class C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 210000004413 cardiac myocyte Anatomy 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000006727 cell loss Effects 0.000 description 1
- 230000012292 cell migration Effects 0.000 description 1
- 230000010307 cell transformation Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000004242 cinnolin-3-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)N=NC2=C1[H] 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 229960002896 clonidine Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003026 cod liver oil Substances 0.000 description 1
- 235000012716 cod liver oil Nutrition 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000037020 contractile activity Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 210000004087 cornea Anatomy 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000011461 current therapy Methods 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 229940097362 cyclodextrins Drugs 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004980 cyclopropylene group Chemical group 0.000 description 1
- NOFZGTZIKPVJKL-UHFFFAOYSA-N cyclopropylmethyl 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1C(=O)OCC1CC1 NOFZGTZIKPVJKL-UHFFFAOYSA-N 0.000 description 1
- 230000003436 cytoskeletal effect Effects 0.000 description 1
- 210000004292 cytoskeleton Anatomy 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000012217 deletion Methods 0.000 description 1
- 230000037430 deletion Effects 0.000 description 1
- 239000007933 dermal patch Substances 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- MOXUSPIFBCWPHJ-UHFFFAOYSA-N diazidoamine Chemical compound [N-]=[N+]=NNN=[N+]=[N-] MOXUSPIFBCWPHJ-UHFFFAOYSA-N 0.000 description 1
- LMEDOLJKVASKTP-UHFFFAOYSA-N dibutyl sulfate Chemical compound CCCCOS(=O)(=O)OCCCC LMEDOLJKVASKTP-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- GAFRWLVTHPVQGK-UHFFFAOYSA-N dipentyl sulfate Chemical compound CCCCCOS(=O)(=O)OCCCCC GAFRWLVTHPVQGK-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000009429 distress Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 239000003596 drug target Substances 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 230000008497 endothelial barrier function Effects 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 210000003979 eosinophil Anatomy 0.000 description 1
- 210000005225 erectile tissue Anatomy 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- ROAYSRAUMPWBQX-UHFFFAOYSA-N ethanol;sulfuric acid Chemical compound CCO.OS(O)(=O)=O ROAYSRAUMPWBQX-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- VANSJUIGVMTCPJ-UHFFFAOYSA-N ethyl 1-[2-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenoxy]acetyl]piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)CCN1C(=O)COC1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 VANSJUIGVMTCPJ-UHFFFAOYSA-N 0.000 description 1
- FRMFSKOUMLRATD-UHFFFAOYSA-N ethyl 3-[[3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoyl]amino]propanoate Chemical compound CCOC(=O)CCNC(=O)C1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)C(C)N)=C1 FRMFSKOUMLRATD-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 210000000744 eyelid Anatomy 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000004785 fluoromethoxy group Chemical group [H]C([H])(F)O* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 210000001650 focal adhesion Anatomy 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 125000004281 furazan-3-yl group Chemical group [H]C1=NON=C1* 0.000 description 1
- GDSRMADSINPKSL-HSEONFRVSA-N gamma-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO GDSRMADSINPKSL-HSEONFRVSA-N 0.000 description 1
- 229940080345 gamma-cyclodextrin Drugs 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 210000004392 genitalia Anatomy 0.000 description 1
- 239000003862 glucocorticoid Substances 0.000 description 1
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical compound CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 1
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- FUBSIWRBTDTCKE-UHFFFAOYSA-N hexyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound CCCCCCOC(=O)C1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 FUBSIWRBTDTCKE-UHFFFAOYSA-N 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical group O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 238000013299 hypertensive rat model Methods 0.000 description 1
- 238000005417 image-selected in vivo spectroscopy Methods 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 1
- 125000000336 imidazol-5-yl group Chemical group [H]N1C([H])=NC([H])=C1[*] 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 125000004531 indol-5-yl group Chemical group [H]N1C([H])=C([H])C2=C([H])C(*)=C([H])C([H])=C12 0.000 description 1
- 125000004247 indolizin-1-yl group Chemical group [H]C1=C([H])C(*)=C2C([H])=C([H])C([H])=C([H])N12 0.000 description 1
- 125000004538 indolizin-3-yl group Chemical group C=1C=C(N2C=CC=CC12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 210000004969 inflammatory cell Anatomy 0.000 description 1
- 230000004941 influx Effects 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 238000012739 integrated shape imaging system Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000004249 isobenzofuran-1-yl group Chemical group [H]C1=C2C([H])=C([H])C([H])=C([H])C2=C(*)O1 0.000 description 1
- 125000004252 isoindol-1-yl group Chemical group [H]N1C([H])=C2C([H])=C([H])C([H])=C([H])C2=C1* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000004254 isoquinolin-1-yl group Chemical group [H]C1=C([H])C2=C([H])C([H])=C([H])C([H])=C2C(*)=N1 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 125000004552 isoquinolin-4-yl group Chemical group C1=NC=C(C2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001793 isothiazol-3-yl group Chemical group [H]C1=C([H])C(*)=NS1 0.000 description 1
- 125000004500 isothiazol-4-yl group Chemical group S1N=CC(=C1)* 0.000 description 1
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 1
- 125000004498 isoxazol-4-yl group Chemical group O1N=CC(=C1)* 0.000 description 1
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000003971 isoxazolinyl group Chemical group 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 229960001375 lactose Drugs 0.000 description 1
- 230000004576 lipid-binding Effects 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 230000009245 menopause Effects 0.000 description 1
- NZWOPGCLSHLLPA-UHFFFAOYSA-N methacholine Chemical compound C[N+](C)(C)CC(C)OC(C)=O NZWOPGCLSHLLPA-UHFFFAOYSA-N 0.000 description 1
- 229960002329 methacholine Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- QPRKDMHWMCEFPE-UHFFFAOYSA-N methyl 1-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoyl]piperidine-3-carboxylate Chemical compound C1C(C(=O)OC)CCCN1C(=O)C1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 QPRKDMHWMCEFPE-UHFFFAOYSA-N 0.000 description 1
- LDZBHDOYCNYNDE-UHFFFAOYSA-N methyl 1-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoyl]pyrrolidine-2-carboxylate Chemical compound COC(=O)C1CCCN1C(=O)C1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 LDZBHDOYCNYNDE-UHFFFAOYSA-N 0.000 description 1
- DYTJRAJQQXMBCJ-UHFFFAOYSA-N methyl 2-[3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enoylamino]acetate Chemical compound COC(=O)CNC(=O)C=CC1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 DYTJRAJQQXMBCJ-UHFFFAOYSA-N 0.000 description 1
- JRYTYRWEZPXFOI-UHFFFAOYSA-N methyl 2-[[2-[3-[2-(aminomethyl)-5-(1h-pyrrolo[2,3-b]pyridin-4-ylcarbamoyl)phenyl]phenoxy]acetyl]amino]acetate Chemical compound COC(=O)CNC(=O)COC1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=3C=CNC=3N=CC=2)CN)=C1 JRYTYRWEZPXFOI-UHFFFAOYSA-N 0.000 description 1
- PQCVTAGUXDAIIU-UHFFFAOYSA-N methyl 2-[[2-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenoxy]acetyl]amino]acetate Chemical compound COC(=O)CNC(=O)COC1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C=CN=CC=2)CN)=C1 PQCVTAGUXDAIIU-UHFFFAOYSA-N 0.000 description 1
- PODLCYZNIYAGLP-UHFFFAOYSA-N methyl 2-[[2-[3-[2-(aminomethyl)-5-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]phenoxy]acetyl]amino]acetate Chemical compound COC(=O)CNC(=O)COC1=CC=CC(C=2C(=CC=C(C=2)C(=O)NC=2C(=CN=CC=2)F)CN)=C1 PODLCYZNIYAGLP-UHFFFAOYSA-N 0.000 description 1
- KUCOPWOXZBGXJJ-UHFFFAOYSA-N methyl 3-bromo-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate Chemical compound COC(=O)C1=CC=C(CNC(=O)OC(C)(C)C)C(Br)=C1 KUCOPWOXZBGXJJ-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 210000000107 myocyte Anatomy 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-M naphthalene-2-sulfonate Chemical compound C1=CC=CC2=CC(S(=O)(=O)[O-])=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-M 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 230000008764 nerve damage Effects 0.000 description 1
- 210000002241 neurite Anatomy 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 210000001328 optic nerve Anatomy 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229940092253 ovalbumin Drugs 0.000 description 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 description 1
- 125000003145 oxazol-4-yl group Chemical group O1C=NC(=C1)* 0.000 description 1
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- 239000001301 oxygen Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229940023569 palmate Drugs 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 230000003836 peripheral circulation Effects 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- CCSMKGBSQQLMMC-UHFFFAOYSA-N phenyl 2-[3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]acetate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1CC(=O)OC1=CC=CC=C1 CCSMKGBSQQLMMC-UHFFFAOYSA-N 0.000 description 1
- FGBNVBPJHVJJLO-UHFFFAOYSA-N phenyl 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CC=CC=1C(=O)OC1=CC=CC=C1 FGBNVBPJHVJJLO-UHFFFAOYSA-N 0.000 description 1
- NCZWXWZAOOYHEC-UHFFFAOYSA-N phenyl 4-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]-1h-indole-2-carboxylate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1C=2)=CC=CC=1NC=2C(=O)OC1=CC=CC=C1 NCZWXWZAOOYHEC-UHFFFAOYSA-N 0.000 description 1
- RZVJKBJPLXNHSP-UHFFFAOYSA-N phenyl 4-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]-1h-pyrrole-2-carboxylate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C(C=1)=CNC=1C(=O)OC1=CC=CC=C1 RZVJKBJPLXNHSP-UHFFFAOYSA-N 0.000 description 1
- 230000026731 phosphorylation Effects 0.000 description 1
- 238000006366 phosphorylation reaction Methods 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- 230000010118 platelet activation Effects 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- 230000034190 positive regulation of NF-kappaB transcription factor activity Effects 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 208000005333 pulmonary edema Diseases 0.000 description 1
- 125000004258 purin-2-yl group Chemical group [H]N1C2=NC(*)=NC([H])=C2N([H])C1([H])[H] 0.000 description 1
- 125000004542 purin-6-yl group Chemical group N1=CN=C2N=CNC2=C1* 0.000 description 1
- 125000004543 purin-7-yl group Chemical group N1=CN=C2N=CN(C2=C1)* 0.000 description 1
- 125000004544 purin-8-yl group Chemical group N1=CN=C2N=C(NC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000004546 quinazolin-4-yl group Chemical group N1=CN=C(C2=CC=CC=C12)* 0.000 description 1
- 125000004547 quinazolin-6-yl group Chemical group N1=CN=CC2=CC(=CC=C12)* 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000004548 quinolin-3-yl group Chemical group N1=CC(=CC2=CC=CC=C12)* 0.000 description 1
- 125000004549 quinolin-4-yl group Chemical group N1=CC=C(C2=CC=CC=C12)* 0.000 description 1
- 125000004550 quinolin-6-yl group Chemical group N1=CC=CC2=CC(=CC=C12)* 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 1
- 125000004553 quinoxalin-5-yl group Chemical group N1=CC=NC2=C(C=CC=C12)* 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000033904 relaxation of vascular smooth muscle Effects 0.000 description 1
- 230000010410 reperfusion Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- JWHOQZUREKYPBY-UHFFFAOYSA-N rubonic acid Natural products CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(=O)C(C)(C)C5CC(=O)C34C)C2C1)C(=O)O JWHOQZUREKYPBY-UHFFFAOYSA-N 0.000 description 1
- CPNNZYVOJCVFTJ-UHFFFAOYSA-N s-(fluoromethyl) 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzenecarbothioate Chemical compound NCC1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(C(=O)SCF)=C1 CPNNZYVOJCVFTJ-UHFFFAOYSA-N 0.000 description 1
- CSCHGYMVZGKTCI-UHFFFAOYSA-N s-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate Chemical compound CC(=O)SCCCNC(=O)OC(C)(C)C CSCHGYMVZGKTCI-UHFFFAOYSA-N 0.000 description 1
- WQZZQNDBRZICLV-UHFFFAOYSA-N s-tert-butyl 3-[2-(1-aminoethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzenecarbothioate Chemical compound CC(N)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(C(=O)SC(C)(C)C)=C1 WQZZQNDBRZICLV-UHFFFAOYSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000026799 smooth muscle cell apoptotic process Effects 0.000 description 1
- 230000015590 smooth muscle cell migration Effects 0.000 description 1
- AWUCVROLDVIAJX-GSVOUGTGSA-N sn-glycerol 3-phosphate Chemical compound OC[C@@H](O)COP(O)(O)=O AWUCVROLDVIAJX-GSVOUGTGSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- ZNJHFNUEQDVFCJ-UHFFFAOYSA-M sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;hydroxide Chemical compound [OH-].[Na+].OCCN1CCN(CCS(O)(=O)=O)CC1 ZNJHFNUEQDVFCJ-UHFFFAOYSA-M 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012058 sterile packaged powder Substances 0.000 description 1
- 210000003518 stress fiber Anatomy 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000004426 substituted alkynyl group Chemical group 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940037128 systemic glucocorticoids Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- KUYMVWXKHQSIAS-UHFFFAOYSA-N tert-butyl 2-chloroacetate Chemical compound CC(C)(C)OC(=O)CCl KUYMVWXKHQSIAS-UHFFFAOYSA-N 0.000 description 1
- CTEDVGRUGMPBHE-UHFFFAOYSA-N tert-butyl 4-(hydroxymethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(CO)CC1 CTEDVGRUGMPBHE-UHFFFAOYSA-N 0.000 description 1
- LFKDJXLFVYVEFG-UHFFFAOYSA-N tert-butyl carbamate Chemical compound CC(C)(C)OC(N)=O LFKDJXLFVYVEFG-UHFFFAOYSA-N 0.000 description 1
- GSJJCZSHYJNRPN-UHFFFAOYSA-N tert-butyl n-(2-sulfanylethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCS GSJJCZSHYJNRPN-UHFFFAOYSA-N 0.000 description 1
- CREVAUHFJDMFLX-UHFFFAOYSA-N tert-butyl n-[1-[2-(3-aminophenyl)-4-(pyridin-4-ylcarbamoyl)phenyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C=CN=CC=2)C=C1C1=CC=CC(N)=C1 CREVAUHFJDMFLX-UHFFFAOYSA-N 0.000 description 1
- BDABHILCPRWPDD-UHFFFAOYSA-N tert-butyl n-[1-[2-(3-aminophenyl)-4-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NC(C)C1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(N)=C1 BDABHILCPRWPDD-UHFFFAOYSA-N 0.000 description 1
- HPTQEUJULIVCGV-UHFFFAOYSA-N tert-butyl n-[[2-(3-aminophenyl)-4-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]methyl]carbamate Chemical compound CC(C)(C)OC(=O)NCC1=CC=C(C(=O)NC=2C(=CN=CC=2)F)C=C1C1=CC=CC(N)=C1 HPTQEUJULIVCGV-UHFFFAOYSA-N 0.000 description 1
- IDIQVRHHGAAGNM-UHFFFAOYSA-N tert-butyl n-[[2-bromo-4-(pyridin-4-ylcarbamoyl)phenyl]methyl]carbamate Chemical compound C1=C(Br)C(CNC(=O)OC(C)(C)C)=CC=C1C(=O)NC1=CC=NC=C1 IDIQVRHHGAAGNM-UHFFFAOYSA-N 0.000 description 1
- XUMDVBGFMVGEGU-UHFFFAOYSA-N tert-butyl n-[[2-bromo-4-[(3-fluoropyridin-4-yl)carbamoyl]phenyl]methyl]carbamate Chemical compound C1=C(Br)C(CNC(=O)OC(C)(C)C)=CC=C1C(=O)NC1=CC=NC=C1F XUMDVBGFMVGEGU-UHFFFAOYSA-N 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 description 1
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- GKTQKQTXHNUFSP-UHFFFAOYSA-N thieno[3,4-c]pyrrole-4,6-dione Chemical compound S1C=C2C(=O)NC(=O)C2=C1 GKTQKQTXHNUFSP-UHFFFAOYSA-N 0.000 description 1
- 125000002053 thietanyl group Chemical group 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- WCNFFKHKJLERFM-UHFFFAOYSA-N thiomorpholinyl sulfone group Chemical group N1(CCSCC1)S(=O)(=O)N1CCSCC1 WCNFFKHKJLERFM-UHFFFAOYSA-N 0.000 description 1
- ZCAGUOCUDGWENZ-UHFFFAOYSA-N thiomorpholinyl sulfoxide group Chemical group N1(CCSCC1)S(=O)N1CCSCC1 ZCAGUOCUDGWENZ-UHFFFAOYSA-N 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 229960004605 timolol Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000001256 tonic effect Effects 0.000 description 1
- 210000001585 trabecular meshwork Anatomy 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- LSGOVYNHVSXFFJ-UHFFFAOYSA-N vanadate(3-) Chemical compound [O-][V]([O-])([O-])=O LSGOVYNHVSXFFJ-UHFFFAOYSA-N 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 210000005166 vasculature Anatomy 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000000273 veterinary drug Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 230000004393 visual impairment Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB201018996A GB201018996D0 (en) | 2010-11-10 | 2010-11-10 | Novel ROCK inhibitors |
| GB1018996.7 | 2010-11-10 | ||
| PCT/EP2011/053343 WO2011107608A1 (en) | 2010-03-02 | 2011-03-04 | Heterocyclic amides as rock inhibitors |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2013527136A JP2013527136A (ja) | 2013-06-27 |
| JP2013527136A5 JP2013527136A5 (enExample) | 2014-02-13 |
| JP5710650B2 true JP5710650B2 (ja) | 2015-04-30 |
Family
ID=43414658
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2012555446A Expired - Fee Related JP5710650B2 (ja) | 2010-11-10 | 2011-03-04 | Rock阻害剤としての複素環アミド |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JP5710650B2 (enExample) |
| CN (2) | CN103316000A (enExample) |
| GB (1) | GB201018996D0 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2560830T3 (es) * | 2011-08-31 | 2016-02-23 | Amakem Nv | Inhibidores novedosos de ROCK suaves |
| CN107935986A (zh) * | 2017-12-31 | 2018-04-20 | 佛山市赛维斯医药科技有限公司 | 异丙胺和卤代噻吩酰胺类结构化合物、其制备方法及用途 |
| CN108191821A (zh) * | 2017-12-31 | 2018-06-22 | 佛山市赛维斯医药科技有限公司 | 一种含甲基萘和腈基噻吩酰胺类结构的rock抑制剂及用途 |
| CN108129452A (zh) * | 2017-12-31 | 2018-06-08 | 佛山市赛维斯医药科技有限公司 | 一种含异丙基萘和丙二醇硝基噻吩酰胺类化合物及其用途 |
| CN108191820A (zh) * | 2017-12-31 | 2018-06-22 | 佛山市赛维斯医药科技有限公司 | 一种含异丙胺和噻吩酰胺类结构的化合物 |
| CN108047194A (zh) * | 2017-12-31 | 2018-05-18 | 佛山市赛维斯医药科技有限公司 | 含甲基萘和丙二醇噻吩酰胺类化合物、制备方法及其用途 |
| CN108101885A (zh) * | 2017-12-31 | 2018-06-01 | 佛山市赛维斯医药科技有限公司 | 含异丙胺和硝基噻吩酰胺类结构化合物、其制备方法及用途 |
| CN108047193A (zh) * | 2017-12-31 | 2018-05-18 | 佛山市赛维斯医药科技有限公司 | 烷氧噻吩酰胺类rock抑制剂、制备方法及其用途 |
| CN107935987A (zh) * | 2017-12-31 | 2018-04-20 | 佛山市赛维斯医药科技有限公司 | 含甲基萘和噻吩酰胺结构的rock抑制剂、制备方法及其用途 |
| CN107915717A (zh) * | 2017-12-31 | 2018-04-17 | 佛山市赛维斯医药科技有限公司 | 一类含异丙基萘和丙二醇噻吩酰胺类化合物及其用途 |
| CN108047195A (zh) * | 2017-12-31 | 2018-05-18 | 佛山市赛维斯医药科技有限公司 | 一种含丙二醇腈基噻吩酰胺类化合物及其用途 |
| CN114956977B (zh) * | 2022-06-09 | 2024-03-26 | 朗捷睿(苏州)生物科技有限公司 | 一种联苯类化合物、药物组合物及其制备方法和应用 |
| WO2024149366A1 (zh) * | 2023-01-13 | 2024-07-18 | 武汉朗来科技发展有限公司 | 一种rock抑制剂中间体的制备方法 |
| CN117126072A (zh) * | 2023-08-24 | 2023-11-28 | 中国药科大学 | 一种含酯链pd-1/pd-l1小分子抑制剂及其制备方法和应用 |
| CN119569655B (zh) * | 2024-11-21 | 2025-11-11 | 西北大学 | 含吡唑甲酰胺基的苯甲酸氟甲基硫酯类化合物及其制备方法与应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101248046A (zh) * | 2005-07-11 | 2008-08-20 | 德福根有限公司 | 作为激酶抑制剂的酰胺衍生物 |
| JP2009500437A (ja) * | 2005-07-11 | 2009-01-08 | デブジェン エヌブイ | キナーゼ阻害剤としてのアミド誘導体 |
| US20090233960A1 (en) * | 2005-10-13 | 2009-09-17 | Devgen Nv | Kinase Inhibitors |
| WO2007133622A2 (en) * | 2006-05-12 | 2007-11-22 | Vertex Pharmaceuticals Incorporated | Selective inhibitors of rock protein kinase and uses thereof |
| EP2193119B1 (en) * | 2007-08-27 | 2014-01-01 | Abbvie Deutschland GmbH & Co. KG | 4-(4-pyridinyl)-benzamides and their use as rock activity modulators |
| BRPI0918045A2 (pt) * | 2008-09-18 | 2015-12-01 | Astellas Pharma Inc | compostos de carboxamida heterocíclicos |
-
2010
- 2010-11-10 GB GB201018996A patent/GB201018996D0/en not_active Ceased
-
2011
- 2011-03-04 CN CN2013102026660A patent/CN103316000A/zh active Pending
- 2011-03-04 CN CN201180011949.6A patent/CN102884049B/zh not_active Expired - Fee Related
- 2011-03-04 JP JP2012555446A patent/JP5710650B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| CN102884049A (zh) | 2013-01-16 |
| CN102884049B (zh) | 2016-08-24 |
| CN103316000A (zh) | 2013-09-25 |
| GB201018996D0 (en) | 2010-12-22 |
| JP2013527136A (ja) | 2013-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP5710650B2 (ja) | Rock阻害剤としての複素環アミド | |
| EP2542528B1 (en) | Heterocyclic amides as rock inhibitors | |
| JP2014512406A (ja) | 新規のrock阻害剤 | |
| JP6205425B2 (ja) | 新規のrock阻害剤 | |
| JP2014525426A (ja) | 新規のソフトrock阻害剤 | |
| WO2013030216A1 (en) | Novel soft rock inhibitors | |
| AU2012293589A1 (en) | Novel soft PDE4 inhibitors | |
| HK1178891A (en) | Heterocyclic amides as rock inhibitors | |
| HK1178891B (en) | Heterocyclic amides as rock inhibitors | |
| HK1193809A (zh) | 新的rock抑制剂 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20131220 |
|
| A621 | Written request for application examination |
Free format text: JAPANESE INTERMEDIATE CODE: A621 Effective date: 20131220 |
|
| A871 | Explanation of circumstances concerning accelerated examination |
Free format text: JAPANESE INTERMEDIATE CODE: A871 Effective date: 20131220 |
|
| A975 | Report on accelerated examination |
Free format text: JAPANESE INTERMEDIATE CODE: A971005 Effective date: 20140116 |
|
| A131 | Notification of reasons for refusal |
Free format text: JAPANESE INTERMEDIATE CODE: A131 Effective date: 20141110 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20150113 |
|
| A521 | Request for written amendment filed |
Free format text: JAPANESE INTERMEDIATE CODE: A523 Effective date: 20150122 |
|
| TRDD | Decision of grant or rejection written | ||
| A01 | Written decision to grant a patent or to grant a registration (utility model) |
Free format text: JAPANESE INTERMEDIATE CODE: A01 Effective date: 20150218 |
|
| A61 | First payment of annual fees (during grant procedure) |
Free format text: JAPANESE INTERMEDIATE CODE: A61 Effective date: 20150304 |
|
| R150 | Certificate of patent or registration of utility model |
Ref document number: 5710650 Country of ref document: JP Free format text: JAPANESE INTERMEDIATE CODE: R150 |
|
| S111 | Request for change of ownership or part of ownership |
Free format text: JAPANESE INTERMEDIATE CODE: R313113 |
|
| R350 | Written notification of registration of transfer |
Free format text: JAPANESE INTERMEDIATE CODE: R350 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| R250 | Receipt of annual fees |
Free format text: JAPANESE INTERMEDIATE CODE: R250 |
|
| LAPS | Cancellation because of no payment of annual fees |