JP2020535199A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2020535199A5 JP2020535199A5 JP2020518000A JP2020518000A JP2020535199A5 JP 2020535199 A5 JP2020535199 A5 JP 2020535199A5 JP 2020518000 A JP2020518000 A JP 2020518000A JP 2020518000 A JP2020518000 A JP 2020518000A JP 2020535199 A5 JP2020535199 A5 JP 2020535199A5
- Authority
- JP
- Japan
- Prior art keywords
- immunoglobulin
- group
- fatty acid
- region
- protein
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 108090000765 processed proteins & peptides Proteins 0.000 claims description 110
- 235000018102 proteins Nutrition 0.000 claims description 78
- 102000004169 proteins and genes Human genes 0.000 claims description 78
- 108090000623 proteins and genes Proteins 0.000 claims description 78
- 238000004519 manufacturing process Methods 0.000 claims description 63
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 62
- 229930195729 fatty acid Natural products 0.000 claims description 62
- 239000000194 fatty acid Substances 0.000 claims description 62
- 150000004665 fatty acids Chemical class 0.000 claims description 62
- 229920001184 polypeptide Polymers 0.000 claims description 60
- 102000004196 processed proteins & peptides Human genes 0.000 claims description 60
- 108060003951 Immunoglobulin Proteins 0.000 claims description 57
- 102000018358 immunoglobulin Human genes 0.000 claims description 57
- 229920000642 polymer Polymers 0.000 claims description 40
- -1 antibodies Substances 0.000 claims description 32
- 102000004877 Insulin Human genes 0.000 claims description 20
- 108090001061 Insulin Proteins 0.000 claims description 20
- 235000001014 amino acid Nutrition 0.000 claims description 18
- 229940024606 amino acid Drugs 0.000 claims description 18
- 150000001413 amino acids Chemical class 0.000 claims description 18
- 102000018071 Immunoglobulin Fc Fragments Human genes 0.000 claims description 16
- 108010091135 Immunoglobulin Fc Fragments Proteins 0.000 claims description 16
- 230000000975 bioactive effect Effects 0.000 claims description 16
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 14
- 239000012539 chromatography resin Substances 0.000 claims description 13
- 239000003102 growth factor Substances 0.000 claims description 10
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical class O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 claims description 10
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- 229920002873 Polyethylenimine Polymers 0.000 claims description 8
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 claims description 8
- 238000001042 affinity chromatography Methods 0.000 claims description 8
- 125000003172 aldehyde group Chemical group 0.000 claims description 8
- 238000005571 anion exchange chromatography Methods 0.000 claims description 8
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 claims description 8
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 8
- 238000005277 cation exchange chromatography Methods 0.000 claims description 8
- 239000003638 chemical reducing agent Substances 0.000 claims description 8
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 claims description 8
- 229920000669 heparin Polymers 0.000 claims description 8
- 229960002897 heparin Drugs 0.000 claims description 8
- 229940088597 hormone Drugs 0.000 claims description 8
- 239000005556 hormone Substances 0.000 claims description 8
- 230000002209 hydrophobic effect Effects 0.000 claims description 8
- 238000001542 size-exclusion chromatography Methods 0.000 claims description 8
- 239000011347 resin Substances 0.000 claims description 7
- 229920005989 resin Polymers 0.000 claims description 7
- 239000002202 Polyethylene glycol Substances 0.000 claims description 6
- 229960000182 blood factors Drugs 0.000 claims description 6
- 230000010437 erythropoiesis Effects 0.000 claims description 6
- 229940125396 insulin Drugs 0.000 claims description 6
- 125000005439 maleimidyl group Chemical group C1(C=CC(N1*)=O)=O 0.000 claims description 6
- 229920001223 polyethylene glycol Polymers 0.000 claims description 6
- DDYAPMZTJAYBOF-ZMYDTDHYSA-N (3S)-4-[[(2S)-1-[[(2S)-1-[[(2S)-5-amino-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-4-amino-1-[[(2S,3R)-1-[[(2S)-6-amino-1-[[(2S)-1-[[(2S)-4-amino-1-[[(2S)-1-[[(2S)-4-amino-1-[[(2S)-4-amino-1-[[(2S,3S)-1-[[(1S)-1-carboxyethyl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-5-carbamimidamido-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1,5-dioxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-2-[[(2S)-2-[[(2S,3R)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-imidazol-4-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]-3-hydroxybutanoyl]amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoyl]amino]-3-carboxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]-3-carboxypropanoyl]amino]-3-hydroxypropanoyl]amino]-5-carbamimidamidopentanoyl]amino]-5-carbamimidamidopentanoyl]amino]propanoyl]amino]-5-oxopentanoyl]amino]-4-oxobutanoic acid Chemical class [H]N[C@@H](CC1=CNC=N1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC1=CC=C(O)C=C1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC1=CNC2=C1C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O DDYAPMZTJAYBOF-ZMYDTDHYSA-N 0.000 claims description 4
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 108090000790 Enzymes Proteins 0.000 claims description 4
- 102000004190 Enzymes Human genes 0.000 claims description 4
- 108010088406 Glucagon-Like Peptides Proteins 0.000 claims description 4
- 102000002265 Human Growth Hormone Human genes 0.000 claims description 4
- 108010000521 Human Growth Hormone Proteins 0.000 claims description 4
- 239000000854 Human Growth Hormone Substances 0.000 claims description 4
- 108090000723 Insulin-Like Growth Factor I Proteins 0.000 claims description 4
- 108010063738 Interleukins Proteins 0.000 claims description 4
- 102000015696 Interleukins Human genes 0.000 claims description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 229920000805 Polyaspartic acid Polymers 0.000 claims description 4
- 239000012506 Sephacryl® Substances 0.000 claims description 4
- 229920005654 Sephadex Polymers 0.000 claims description 4
- 239000012507 Sephadex™ Substances 0.000 claims description 4
- 102000013275 Somatomedins Human genes 0.000 claims description 4
- 239000012505 Superdex™ Substances 0.000 claims description 4
- 239000012190 activator Substances 0.000 claims description 4
- 239000000427 antigen Substances 0.000 claims description 4
- 102000036639 antigens Human genes 0.000 claims description 4
- 108091007433 antigens Proteins 0.000 claims description 4
- 210000004027 cell Anatomy 0.000 claims description 4
- 238000004587 chromatography analysis Methods 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 229940088598 enzyme Drugs 0.000 claims description 4
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 claims description 4
- 210000002540 macrophage Anatomy 0.000 claims description 4
- 229910021645 metal ion Inorganic materials 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 230000011164 ossification Effects 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 4
- 239000010452 phosphate Substances 0.000 claims description 4
- 108010064470 polyaspartate Proteins 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 238000000746 purification Methods 0.000 claims description 4
- 102000005962 receptors Human genes 0.000 claims description 4
- 108020003175 receptors Proteins 0.000 claims description 4
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 4
- 229960005486 vaccine Drugs 0.000 claims description 4
- 238000004581 coalescence Methods 0.000 claims description 3
- 239000000470 constituent Substances 0.000 claims description 3
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 claims description 2
- ZDNGLXCKYXBSRI-UHFFFAOYSA-N 2-(2,5-dioxopyrrolidin-1-yl)butanoic acid Chemical compound CCC(C(O)=O)N1C(=O)CCC1=O ZDNGLXCKYXBSRI-UHFFFAOYSA-N 0.000 claims description 2
- MQGWDJWJIUAJFS-UHFFFAOYSA-N 2-(2,5-dioxopyrrolidin-1-yl)pentanoic acid Chemical compound CCCC(C(O)=O)N1C(=O)CCC1=O MQGWDJWJIUAJFS-UHFFFAOYSA-N 0.000 claims description 2
- DCESWPKOLYIMNH-UHFFFAOYSA-N 2-(2,5-dioxopyrrolidin-1-yl)propanoic acid Chemical compound OC(=O)C(C)N1C(=O)CCC1=O DCESWPKOLYIMNH-UHFFFAOYSA-N 0.000 claims description 2
- UHSLQTXODZNPMT-UHFFFAOYSA-N 2-[(2,5-dioxopyrrolidin-1-yl)methyl]butanoic acid Chemical compound CCC(C(O)=O)CN1C(=O)CCC1=O UHSLQTXODZNPMT-UHFFFAOYSA-N 0.000 claims description 2
- HZBZJPPGHQBJNZ-UHFFFAOYSA-N 3-(2,5-dioxopyrrolidin-1-yl)-2-methylpropanoic acid Chemical compound OC(=O)C(C)CN1C(=O)CCC1=O HZBZJPPGHQBJNZ-UHFFFAOYSA-N 0.000 claims description 2
- HFDKKNHCYWNNNQ-YOGANYHLSA-N 75976-10-2 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(N)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@@H](NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](C)N)C(C)C)[C@@H](C)O)C1=CC=C(O)C=C1 HFDKKNHCYWNNNQ-YOGANYHLSA-N 0.000 claims description 2
- 102000009027 Albumins Human genes 0.000 claims description 2
- 108010088751 Albumins Proteins 0.000 claims description 2
- 102400000068 Angiostatin Human genes 0.000 claims description 2
- 108010079709 Angiostatins Proteins 0.000 claims description 2
- 108010064733 Angiotensins Proteins 0.000 claims description 2
- 102000015427 Angiotensins Human genes 0.000 claims description 2
- 102100029470 Apolipoprotein E Human genes 0.000 claims description 2
- 101710095339 Apolipoprotein E Proteins 0.000 claims description 2
- 102100033367 Appetite-regulating hormone Human genes 0.000 claims description 2
- DCXYFEDJOCDNAF-UHFFFAOYSA-N Asparagine Chemical group OC(=O)C(N)CC(N)=O DCXYFEDJOCDNAF-UHFFFAOYSA-N 0.000 claims description 2
- 102000002723 Atrial Natriuretic Factor Human genes 0.000 claims description 2
- 101800001288 Atrial natriuretic factor Proteins 0.000 claims description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical group CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 claims description 2
- 108010074051 C-Reactive Protein Proteins 0.000 claims description 2
- 102100032752 C-reactive protein Human genes 0.000 claims description 2
- 108060001064 Calcitonin Proteins 0.000 claims description 2
- 102000055006 Calcitonin Human genes 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 229920002101 Chitin Polymers 0.000 claims description 2
- 108010022152 Corticotropin-Releasing Hormone Proteins 0.000 claims description 2
- 102000012289 Corticotropin-Releasing Hormone Human genes 0.000 claims description 2
- 239000000055 Corticotropin-Releasing Hormone Substances 0.000 claims description 2
- 102000004127 Cytokines Human genes 0.000 claims description 2
- 108090000695 Cytokines Proteins 0.000 claims description 2
- 229920002307 Dextran Polymers 0.000 claims description 2
- 102000009024 Epidermal Growth Factor Human genes 0.000 claims description 2
- 101800003838 Epidermal growth factor Proteins 0.000 claims description 2
- 108010011459 Exenatide Proteins 0.000 claims description 2
- 102000009123 Fibrin Human genes 0.000 claims description 2
- 108010073385 Fibrin Proteins 0.000 claims description 2
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 claims description 2
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 claims description 2
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 claims description 2
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 claims description 2
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 claims description 2
- 101710198884 GATA-type zinc finger protein 1 Proteins 0.000 claims description 2
- 102400000321 Glucagon Human genes 0.000 claims description 2
- 108060003199 Glucagon Proteins 0.000 claims description 2
- DTHNMHAUYICORS-KTKZVXAJSA-N Glucagon-like peptide 1 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC=1N=CNC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 DTHNMHAUYICORS-KTKZVXAJSA-N 0.000 claims description 2
- 102000004269 Granulocyte Colony-Stimulating Factor Human genes 0.000 claims description 2
- 108010017080 Granulocyte Colony-Stimulating Factor Proteins 0.000 claims description 2
- 239000000095 Growth Hormone-Releasing Hormone Substances 0.000 claims description 2
- 102000001554 Hemoglobins Human genes 0.000 claims description 2
- 108010054147 Hemoglobins Proteins 0.000 claims description 2
- 102000007625 Hirudins Human genes 0.000 claims description 2
- 108010007267 Hirudins Proteins 0.000 claims description 2
- 206010020751 Hypersensitivity Diseases 0.000 claims description 2
- 102000008394 Immunoglobulin Fragments Human genes 0.000 claims description 2
- 108010021625 Immunoglobulin Fragments Proteins 0.000 claims description 2
- 101710186643 Insulin-2 Proteins 0.000 claims description 2
- 102000001617 Interferon Receptors Human genes 0.000 claims description 2
- 108010054267 Interferon Receptors Proteins 0.000 claims description 2
- 102000006992 Interferon-alpha Human genes 0.000 claims description 2
- 108010047761 Interferon-alpha Proteins 0.000 claims description 2
- 102000014150 Interferons Human genes 0.000 claims description 2
- 108010050904 Interferons Proteins 0.000 claims description 2
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 claims description 2
- DCXYFEDJOCDNAF-REOHCLBHSA-N L-asparagine Chemical group OC(=O)[C@@H](N)CC(N)=O DCXYFEDJOCDNAF-REOHCLBHSA-N 0.000 claims description 2
- 102000004407 Lactalbumin Human genes 0.000 claims description 2
- 108090000942 Lactalbumin Proteins 0.000 claims description 2
- 206010024229 Leprosy Diseases 0.000 claims description 2
- 108010092277 Leptin Proteins 0.000 claims description 2
- 102000016267 Leptin Human genes 0.000 claims description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 claims description 2
- 108010025020 Nerve Growth Factor Proteins 0.000 claims description 2
- 102000007072 Nerve Growth Factors Human genes 0.000 claims description 2
- 102000018886 Pancreatic Polypeptide Human genes 0.000 claims description 2
- 102000003982 Parathyroid hormone Human genes 0.000 claims description 2
- 108090000445 Parathyroid hormone Proteins 0.000 claims description 2
- 102000010780 Platelet-Derived Growth Factor Human genes 0.000 claims description 2
- 108010038512 Platelet-Derived Growth Factor Proteins 0.000 claims description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 2
- 102100040918 Pro-glucagon Human genes 0.000 claims description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical group CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 claims description 2
- 101800004937 Protein C Proteins 0.000 claims description 2
- 108090000103 Relaxin Proteins 0.000 claims description 2
- 102000003743 Relaxin Human genes 0.000 claims description 2
- 102400000827 Saposin-D Human genes 0.000 claims description 2
- 101800001700 Saposin-D Proteins 0.000 claims description 2
- 102100037505 Secretin Human genes 0.000 claims description 2
- 108010086019 Secretin Proteins 0.000 claims description 2
- 102100022831 Somatoliberin Human genes 0.000 claims description 2
- 101710142969 Somatoliberin Proteins 0.000 claims description 2
- 101710172711 Structural protein Proteins 0.000 claims description 2
- 102000019197 Superoxide Dismutase Human genes 0.000 claims description 2
- 108010012715 Superoxide dismutase Proteins 0.000 claims description 2
- 101000983124 Sus scrofa Pancreatic prohormone precursor Proteins 0.000 claims description 2
- 210000001744 T-lymphocyte Anatomy 0.000 claims description 2
- 102000000479 TCF Transcription Factors Human genes 0.000 claims description 2
- 108010016283 TCF Transcription Factors Proteins 0.000 claims description 2
- 108090000190 Thrombin Proteins 0.000 claims description 2
- 102000003790 Thrombin receptors Human genes 0.000 claims description 2
- 108090000166 Thrombin receptors Proteins 0.000 claims description 2
- 108010079274 Thrombomodulin Proteins 0.000 claims description 2
- 102000012607 Thrombomodulin Human genes 0.000 claims description 2
- 102100030951 Tissue factor pathway inhibitor Human genes 0.000 claims description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 claims description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 claims description 2
- 102000001742 Tumor Suppressor Proteins Human genes 0.000 claims description 2
- 108010040002 Tumor Suppressor Proteins Proteins 0.000 claims description 2
- 108090000435 Urokinase-type plasminogen activator Proteins 0.000 claims description 2
- 102000003990 Urokinase-type plasminogen activator Human genes 0.000 claims description 2
- 241000700605 Viruses Species 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 235000004279 alanine Nutrition 0.000 claims description 2
- 125000003295 alanine group Chemical group N[C@@H](C)C(=O)* 0.000 claims description 2
- 208000026935 allergic disease Diseases 0.000 claims description 2
- 230000007815 allergy Effects 0.000 claims description 2
- 102000015395 alpha 1-Antitrypsin Human genes 0.000 claims description 2
- 108010050122 alpha 1-Antitrypsin Proteins 0.000 claims description 2
- 229940024142 alpha 1-antitrypsin Drugs 0.000 claims description 2
- 229940053198 antiepileptics succinimide derivative Drugs 0.000 claims description 2
- 125000000637 arginyl group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 claims description 2
- 235000009582 asparagine Nutrition 0.000 claims description 2
- 229960001230 asparagine Drugs 0.000 claims description 2
- FZCSTZYAHCUGEM-UHFFFAOYSA-N aspergillomarasmine B Natural products OC(=O)CNC(C(O)=O)CNC(C(O)=O)CC(O)=O FZCSTZYAHCUGEM-UHFFFAOYSA-N 0.000 claims description 2
- 210000003719 b-lymphocyte Anatomy 0.000 claims description 2
- 102000023732 binding proteins Human genes 0.000 claims description 2
- 108091008324 binding proteins Proteins 0.000 claims description 2
- 229920002988 biodegradable polymer Polymers 0.000 claims description 2
- 239000004621 biodegradable polymer Substances 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- TWNDEXHSZJGRBX-UHFFFAOYSA-N boric acid;n-methylmethanamine Chemical compound CNC.OB(O)O TWNDEXHSZJGRBX-UHFFFAOYSA-N 0.000 claims description 2
- PWYPGEFOZYBWDP-UHFFFAOYSA-N boric acid;pyridine Chemical compound OB(O)O.C1=CC=NC=C1 PWYPGEFOZYBWDP-UHFFFAOYSA-N 0.000 claims description 2
- 210000004899 c-terminal region Anatomy 0.000 claims description 2
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 claims description 2
- 229960004015 calcitonin Drugs 0.000 claims description 2
- 229950008486 carperitide Drugs 0.000 claims description 2
- NSQLIUXCMFBZME-MPVJKSABSA-N carperitide Chemical compound C([C@H]1C(=O)NCC(=O)NCC(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@H](C(NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CSSC[C@@H](C(=O)N1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(O)=O)=O)[C@@H](C)CC)C1=CC=CC=C1 NSQLIUXCMFBZME-MPVJKSABSA-N 0.000 claims description 2
- 210000000845 cartilage Anatomy 0.000 claims description 2
- 230000010261 cell growth Effects 0.000 claims description 2
- JUFFVKRROAPVBI-PVOYSMBESA-N chembl1210015 Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(=O)N[C@H]1[C@@H]([C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO[C@]3(O[C@@H](C[C@H](O)[C@H](O)CO)[C@H](NC(C)=O)[C@@H](O)C3)C(O)=O)O2)O)[C@@H](CO)O1)NC(C)=O)C(=O)NCC(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CO)C(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C(C)C)C1=CC=CC=C1 JUFFVKRROAPVBI-PVOYSMBESA-N 0.000 claims description 2
- DDPFHDCZUJFNAT-PZPWKVFESA-N chembl2104402 Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1N=CNC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CCCCCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 DDPFHDCZUJFNAT-PZPWKVFESA-N 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- 239000003246 corticosteroid Substances 0.000 claims description 2
- 235000018417 cysteine Nutrition 0.000 claims description 2
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 claims description 2
- 102000026898 cytokine binding proteins Human genes 0.000 claims description 2
- 108091008470 cytokine binding proteins Proteins 0.000 claims description 2
- 239000000539 dimer Substances 0.000 claims description 2
- 108700032313 elcatonin Proteins 0.000 claims description 2
- 229960000756 elcatonin Drugs 0.000 claims description 2
- 210000001339 epidermal cell Anatomy 0.000 claims description 2
- 210000002919 epithelial cell Anatomy 0.000 claims description 2
- 229960001519 exenatide Drugs 0.000 claims description 2
- 229950003499 fibrin Drugs 0.000 claims description 2
- 229940028334 follicle stimulating hormone Drugs 0.000 claims description 2
- 108010077689 gamma-aminobutyryl-2-methyltryptophyl-2-methyltryptophyl-2-methyltryptophyl-lysinamide Proteins 0.000 claims description 2
- MASNOZXLGMXCHN-ZLPAWPGGSA-N glucagon Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(O)=O)C(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 MASNOZXLGMXCHN-ZLPAWPGGSA-N 0.000 claims description 2
- 229960004666 glucagon Drugs 0.000 claims description 2
- 229930195712 glutamate Natural products 0.000 claims description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-L glutamate group Chemical group N[C@@H](CCC(=O)[O-])C(=O)[O-] WHUUTDBJXJRKMK-VKHMYHEASA-L 0.000 claims description 2
- 150000004676 glycans Chemical class 0.000 claims description 2
- WQPDUTSPKFMPDP-OUMQNGNKSA-N hirudin Chemical compound C([C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC=1C=CC(OS(O)(=O)=O)=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(O)=O)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CCCCN)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]1NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)[C@@H]2CSSC[C@@H](C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(NCC(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N2)=O)CSSC1)C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H]1NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=2C=CC(O)=CC=2)NC(=O)[C@@H](NC(=O)[C@@H](N)C(C)C)C(C)C)[C@@H](C)O)CSSC1)C(C)C)[C@@H](C)O)[C@@H](C)O)C1=CC=CC=C1 WQPDUTSPKFMPDP-OUMQNGNKSA-N 0.000 claims description 2
- 229940006607 hirudin Drugs 0.000 claims description 2
- 125000000487 histidyl group Chemical group [H]N([H])C(C(=O)O*)C([H])([H])C1=C([H])N([H])C([H])=N1 0.000 claims description 2
- 229920002674 hyaluronan Polymers 0.000 claims description 2
- 229960003160 hyaluronic acid Drugs 0.000 claims description 2
- 229940051026 immunotoxin Drugs 0.000 claims description 2
- 230000002637 immunotoxin Effects 0.000 claims description 2
- 239000002596 immunotoxin Substances 0.000 claims description 2
- 231100000608 immunotoxin Toxicity 0.000 claims description 2
- 238000001727 in vivo Methods 0.000 claims description 2
- 230000001939 inductive effect Effects 0.000 claims description 2
- 239000003112 inhibitor Substances 0.000 claims description 2
- 229940047124 interferons Drugs 0.000 claims description 2
- 102000002467 interleukin receptors Human genes 0.000 claims description 2
- 108010093036 interleukin receptors Proteins 0.000 claims description 2
- 229940047122 interleukins Drugs 0.000 claims description 2
- FZWBNHMXJMCXLU-BLAUPYHCSA-N isomaltotriose Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)O1 FZWBNHMXJMCXLU-BLAUPYHCSA-N 0.000 claims description 2
- 235000021242 lactoferrin Nutrition 0.000 claims description 2
- 229940039781 leptin Drugs 0.000 claims description 2
- NRYBAZVQPHGZNS-ZSOCWYAHSA-N leptin Chemical compound O=C([C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CC(C)C)CCSC)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CS)C(O)=O NRYBAZVQPHGZNS-ZSOCWYAHSA-N 0.000 claims description 2
- 239000003446 ligand Substances 0.000 claims description 2
- 150000002632 lipids Chemical class 0.000 claims description 2
- 108010013555 lipoprotein-associated coagulation inhibitor Proteins 0.000 claims description 2
- 230000006510 metastatic growth Effects 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 230000001338 necrotic effect Effects 0.000 claims description 2
- 239000000199 parathyroid hormone Substances 0.000 claims description 2
- 229960001319 parathyroid hormone Drugs 0.000 claims description 2
- 230000002688 persistence Effects 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 229920001583 poly(oxyethylated polyols) Polymers 0.000 claims description 2
- 229920001451 polypropylene glycol Polymers 0.000 claims description 2
- 229920001282 polysaccharide Polymers 0.000 claims description 2
- 239000005017 polysaccharide Substances 0.000 claims description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 2
- 230000001737 promoting effect Effects 0.000 claims description 2
- 229960000856 protein c Drugs 0.000 claims description 2
- 239000002464 receptor antagonist Substances 0.000 claims description 2
- 229940044551 receptor antagonist Drugs 0.000 claims description 2
- 239000003488 releasing hormone Substances 0.000 claims description 2
- 239000002461 renin inhibitor Substances 0.000 claims description 2
- 229940086526 renin-inhibitors Drugs 0.000 claims description 2
- 229960002101 secretin Drugs 0.000 claims description 2
- OWMZNFCDEHGFEP-NFBCVYDUSA-N secretin human Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CCC(O)=O)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(N)=O)[C@@H](C)O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC=1NC=NC=1)[C@@H](C)O)C1=CC=CC=C1 OWMZNFCDEHGFEP-NFBCVYDUSA-N 0.000 claims description 2
- 230000004936 stimulating effect Effects 0.000 claims description 2
- 229960002317 succinimide Drugs 0.000 claims description 2
- 229960004072 thrombin Drugs 0.000 claims description 2
- 210000001685 thyroid gland Anatomy 0.000 claims description 2
- 210000001519 tissue Anatomy 0.000 claims description 2
- 108091008023 transcriptional regulators Proteins 0.000 claims description 2
- 229960005356 urokinase Drugs 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 235000021241 α-lactalbumin Nutrition 0.000 claims description 2
- 102000004862 Gastrin releasing peptide Human genes 0.000 claims 1
- 108090001053 Gastrin releasing peptide Proteins 0.000 claims 1
- PUBCCFNQJQKCNC-XKNFJVFFSA-N gastrin-releasingpeptide Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC(C)C)NC(=O)[C@H]1N(CCC1)C(=O)[C@@H](N)C(C)C)[C@@H](C)O)C(C)C)[C@@H](C)O)C(C)C)C1=CNC=N1 PUBCCFNQJQKCNC-XKNFJVFFSA-N 0.000 claims 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| KR10-2017-0127418 | 2017-09-29 | ||
| KR20170127418 | 2017-09-29 | ||
| PCT/KR2018/011616 WO2019066603A1 (ko) | 2017-09-29 | 2018-10-01 | 효력이 향상된 지속성 단백질 결합체 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2020535199A JP2020535199A (ja) | 2020-12-03 |
| JP2020535199A5 true JP2020535199A5 (enExample) | 2021-11-11 |
Family
ID=65902223
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2020518000A Pending JP2020535199A (ja) | 2017-09-29 | 2018-10-01 | 効力が向上した持続性タンパク質結合体 |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US20200283492A1 (enExample) |
| EP (1) | EP3689914A4 (enExample) |
| JP (1) | JP2020535199A (enExample) |
| KR (1) | KR20190038456A (enExample) |
| CN (1) | CN111406073A (enExample) |
| WO (1) | WO2019066603A1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR102645064B1 (ko) * | 2017-02-03 | 2024-03-08 | 한미약품 주식회사 | 지속성이 증가된 생리활성 물질의 결합체 및 이의 용도 |
| US10729763B2 (en) | 2017-06-10 | 2020-08-04 | Inventprise, Llc | Mixtures of polysaccharide-protein pegylated compounds |
| NZ770284A (en) | 2018-05-10 | 2025-11-28 | Regeneron Pharma | High concentration vegf receptor fusion protein containing formulations |
| KR102883648B1 (ko) * | 2020-09-16 | 2025-11-10 | 한미약품 주식회사 | 폴리에틸렌글리콜 유도체, 이를 포함하는 조성물 및 이를 이용한 생리활성 폴리펩타이드 결합체의 제조 방법 |
Family Cites Families (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH01254699A (ja) * | 1988-04-05 | 1989-10-11 | Kodama Kk | インスリン誘導体及びその用途 |
| DE69428134T2 (de) * | 1993-09-17 | 2002-05-02 | Novo Nordisk A/S, Bagsvaerd | Acyliertes insulin |
| US6410008B1 (en) | 1994-12-12 | 2002-06-25 | Beth Israel Hospital Association | Chimeric IL-10 proteins and uses thereof |
| US6096871A (en) | 1995-04-14 | 2000-08-01 | Genentech, Inc. | Polypeptides altered to contain an epitope from the Fc region of an IgG molecule for increased half-life |
| US6750334B1 (en) | 1996-02-02 | 2004-06-15 | Repligen Corporation | CTLA4-immunoglobulin fusion proteins having modified effector functions and uses therefor |
| WO1997034631A1 (en) | 1996-03-18 | 1997-09-25 | Board Of Regents, The University Of Texas System | Immunoglobin-like domains with increased half lives |
| US6277375B1 (en) | 1997-03-03 | 2001-08-21 | Board Of Regents, The University Of Texas System | Immunoglobulin-like domains with increased half-lives |
| CN1635900A (zh) * | 2001-08-28 | 2005-07-06 | 伊莱利利公司 | Glp－1和基础胰岛素的预混合物 |
| US20050176108A1 (en) * | 2003-03-13 | 2005-08-11 | Young-Min Kim | Physiologically active polypeptide conjugate having prolonged in vivo half-life |
| BRPI0406606A (pt) * | 2003-11-13 | 2005-12-06 | Hanmi Pharm Ind Co Ltd | Composição farmacêutica compreendendo uma região fc de imunoglobulina como um veìculo |
| KR100754667B1 (ko) * | 2005-04-08 | 2007-09-03 | 한미약품 주식회사 | 비펩타이드성 중합체로 개질된 면역글로불린 Ｆｃ 단편 및이를 포함하는 약제학적 조성물 |
| TW200722436A (en) * | 2005-10-21 | 2007-06-16 | Hoffmann La Roche | A peptide-immunoglobulin-conjugate |
| JP2008169195A (ja) | 2007-01-05 | 2008-07-24 | Hanmi Pharmaceutical Co Ltd | キャリア物質を用いたインスリン分泌ペプチド薬物結合体 |
| UA113626C2 (xx) * | 2011-06-02 | 2017-02-27 | Композиція для лікування діабету, що містить кон'югат інсуліну тривалої дії та кон'югат інсулінотропного пептиду тривалої дії | |
| KR20130049671A (ko) * | 2011-11-04 | 2013-05-14 | 한미사이언스 주식회사 | 생리활성 폴리펩타이드 결합체 제조 방법 |
| AR090281A1 (es) * | 2012-03-08 | 2014-10-29 | Hanmi Science Co Ltd | Proceso mejorado para la preparacion de un complejo polipeptidico fisiologicamente activo |
| AR091902A1 (es) * | 2012-07-25 | 2015-03-11 | Hanmi Pharm Ind Co Ltd | Formulacion liquida de un conjugado de insulina de accion prolongada |
| AR092862A1 (es) * | 2012-07-25 | 2015-05-06 | Hanmi Pharm Ind Co Ltd | Formulacion liquida de insulina de accion prolongada y un peptido insulinotropico y metodo de preparacion |
| KR101993393B1 (ko) * | 2012-11-06 | 2019-10-01 | 한미약품 주식회사 | 옥신토모듈린 유도체를 포함하는 당뇨병 또는 비만성 당뇨병 치료용 조성물 |
| ES2738676T3 (es) * | 2013-02-26 | 2020-01-24 | Hanmi Pharm Ind Co Ltd | Conjugado de insulina específico de sitio |
| BR112015019985A2 (pt) * | 2013-02-26 | 2017-08-29 | Hanmi Pharm Ind Co Ltd | Novo análogo de insulina e sua utilização |
| PT2966083T (pt) * | 2013-03-05 | 2019-09-17 | Hanmi Pharm Ind Co Ltd | Método de preparação melhorado para produção de alto rendimento de conjugado de polipéptido fisiologicamente ativo |
| KR101895634B1 (ko) * | 2013-05-31 | 2018-09-05 | 한미약품 주식회사 | 변이된 힌지 영역을 포함하는 IgG4 Fc 단편 |
| AR096891A1 (es) * | 2013-07-12 | 2016-02-03 | Hanmi Pharm Ind Co Ltd | Conjugado de monómero polipéptido biológicamente activo y conjugado de fragmento fc de inmunoglobulina, que muestra aclaramiento mediado por receptor reducido, y el método para la preparación del mismo |
| MX369656B (es) * | 2014-01-20 | 2019-11-15 | Hanmi Pharm Ind Co Ltd | Insulina de accion prolongada y uso de la misma. |
| AR100639A1 (es) * | 2014-05-29 | 2016-10-19 | Hanmi Pharm Ind Co Ltd | Composición para tratar diabetes que comprende conjugados de análogos de insulina de acción prolongada y conjugados de péptidos insulinotrópicos de acción prolongada |
| TWI684458B (zh) * | 2014-05-30 | 2020-02-11 | 南韓商韓美藥品股份有限公司 | 包含胰島素及ｇｌｐ-１/昇糖素雙重促效劑之治療糖尿病之組成物 |
| KR20150140177A (ko) * | 2014-06-05 | 2015-12-15 | 한미약품 주식회사 | 단백질 및 펩타이드의 면역원성을 감소시키는 방법 |
| CR20180034A (es) * | 2015-06-30 | 2018-04-16 | Hanmi Pharm Ind Co Ltd | Derivados de glucagón y una composición que comprende un conjugado de acción prolongada del mismo. |
| EP3384935A4 (en) * | 2015-12-02 | 2019-08-21 | Hanmi Pharm. Co., Ltd. | PROTEIN COMPLEX WITH FATTY ACID DERIVATIVE AND MANUFACTURING METHOD THEREFOR |
-
2018
- 2018-10-01 CN CN201880076078.8A patent/CN111406073A/zh active Pending
- 2018-10-01 US US16/651,921 patent/US20200283492A1/en not_active Abandoned
- 2018-10-01 KR KR1020180116837A patent/KR20190038456A/ko not_active Ceased
- 2018-10-01 EP EP18862750.9A patent/EP3689914A4/en active Pending
- 2018-10-01 JP JP2020518000A patent/JP2020535199A/ja active Pending
- 2018-10-01 WO PCT/KR2018/011616 patent/WO2019066603A1/ko not_active Ceased
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP6976400B2 (ja) | 受容体媒介クリアランスが減少した、生理活性ポリペプチド単量体と免疫グロブリンＦｃ断片との結合体及びその製造方法 | |
| RU2312868C2 (ru) | Физиологически активный полипептидный конъюгат, обладающий пролонгированным периодом полувыведения in vivo | |
| ES2523043T3 (es) | Un complejo polipeptídico que comprende un polímero no peptidílico que tiene tres extremos funcionales | |
| KR102231217B1 (ko) | 면역글로불린 단편의 특정 위치를 연결 부위로 이용한 단백질 결합체 | |
| EP3406627B1 (en) | Igg4 fc fragment comprising modified hinge region | |
| JP2020535199A5 (enExample) | ||
| JP2007536211A5 (enExample) | ||
| RU2005120240A (ru) | Белковый комплекс, полученный с использованием фрагмента иммуноглобулина, и способ получения такого комплекса | |
| EP3020732B1 (en) | An immunoglobulin fc conjugate which maintains binding affinity of immunoglobulin fc fragment to fcrn | |
| RU2014138621A (ru) | Улучшенный способ получения комплекса физиологически активного полипептида | |
| JP2020535199A (ja) | 効力が向上した持続性タンパク質結合体 | |
| HK1221957B (en) | An immunoglobulin fc conjugate which maintains binding affinity of immunoglobulin fc fragment to fcrn | |
| EA040604B1 (ru) | Конъюгаты, связывающие белок-лекарственное средство, содержащие производные антрациклина | |
| NZ716251B2 (en) | Conjugate of biologically active polypeptide monomer and immunoglobulin fc fragment with reduced receptor-mediated clearance, and the method for preparing the same |