JP2018504415A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2018504415A5 JP2018504415A5 JP2017539023A JP2017539023A JP2018504415A5 JP 2018504415 A5 JP2018504415 A5 JP 2018504415A5 JP 2017539023 A JP2017539023 A JP 2017539023A JP 2017539023 A JP2017539023 A JP 2017539023A JP 2018504415 A5 JP2018504415 A5 JP 2018504415A5
- Authority
- JP
- Japan
- Prior art keywords
- phenyl
- methyl
- oxazol
- ethoxymethyl
- pyrazol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 claims description 194
- -1 1,2-diazinyl Chemical group 0.000 claims description 88
- 239000001257 hydrogen Substances 0.000 claims description 60
- 229910052739 hydrogen Inorganic materials 0.000 claims description 60
- 125000000217 alkyl group Chemical group 0.000 claims description 59
- 150000003839 salts Chemical class 0.000 claims description 54
- 230000003381 solubilizing effect Effects 0.000 claims description 43
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 42
- 125000000623 heterocyclic group Chemical group 0.000 claims description 42
- 201000010099 disease Diseases 0.000 claims description 40
- 125000001072 heteroaryl group Chemical group 0.000 claims description 37
- 238000002360 preparation method Methods 0.000 claims description 36
- 150000002431 hydrogen Chemical group 0.000 claims description 35
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 31
- 206010028980 Neoplasm Diseases 0.000 claims description 30
- 125000003118 aryl group Chemical group 0.000 claims description 28
- 125000003545 alkoxy group Chemical group 0.000 claims description 27
- 201000011510 cancer Diseases 0.000 claims description 26
- 230000002062 proliferating effect Effects 0.000 claims description 23
- 239000003814 drug Substances 0.000 claims description 22
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 22
- 239000008194 pharmaceutical composition Substances 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 208000014951 hematologic disease Diseases 0.000 claims description 17
- 238000011282 treatment Methods 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 239000008186 active pharmaceutical agent Substances 0.000 claims description 12
- 125000001425 triazolyl group Chemical group 0.000 claims description 12
- 125000002971 oxazolyl group Chemical group 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000000335 thiazolyl group Chemical group 0.000 claims description 10
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims description 8
- 208000019838 Blood disease Diseases 0.000 claims description 8
- ZPMUGFCTFPDKHI-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1SC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C ZPMUGFCTFPDKHI-UHFFFAOYSA-N 0.000 claims description 8
- 206010035226 Plasma cell myeloma Diseases 0.000 claims description 8
- 208000018706 hematopoietic system disease Diseases 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 125000002883 imidazolyl group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000003386 piperidinyl group Chemical group 0.000 claims description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 8
- 150000003573 thiols Chemical class 0.000 claims description 8
- ZBAFYGYLXHEICJ-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(NCC1)=O)C ZBAFYGYLXHEICJ-UHFFFAOYSA-N 0.000 claims description 7
- HKHLLEPTTVBSDM-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-thiazol-4-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1SC=C(N=1)C1=CC=C(C=C1)N1C(NCC1)=O)C HKHLLEPTTVBSDM-UHFFFAOYSA-N 0.000 claims description 7
- 201000003793 Myelodysplastic syndrome Diseases 0.000 claims description 7
- PFQUSHNGTYPQTP-UHFFFAOYSA-N N-(5-methoxy-2-methylphenyl)-5-(6-pyrazol-1-ylpyridin-3-yl)-1,3-oxazol-2-amine Chemical compound COC=1C=CC(=C(C=1)NC=1OC(=CN=1)C=1C=NC(=CC=1)N1N=CC=C1)C PFQUSHNGTYPQTP-UHFFFAOYSA-N 0.000 claims description 7
- CEJUBYJYSXUBGM-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(3-methoxy-4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC(=C(C=C1)N1N=CC=C1)OC)C CEJUBYJYSXUBGM-UHFFFAOYSA-N 0.000 claims description 7
- 125000004193 piperazinyl group Chemical group 0.000 claims description 7
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 7
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 claims description 6
- 206010006187 Breast cancer Diseases 0.000 claims description 6
- 208000026310 Breast neoplasm Diseases 0.000 claims description 6
- 206010009944 Colon cancer Diseases 0.000 claims description 6
- 208000001333 Colorectal Neoplasms Diseases 0.000 claims description 6
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims description 6
- 206010025323 Lymphomas Diseases 0.000 claims description 6
- 208000005718 Stomach Neoplasms Diseases 0.000 claims description 6
- 206010017758 gastric cancer Diseases 0.000 claims description 6
- 201000007270 liver cancer Diseases 0.000 claims description 6
- 208000014018 liver neoplasm Diseases 0.000 claims description 6
- 201000005202 lung cancer Diseases 0.000 claims description 6
- 208000020816 lung neoplasm Diseases 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- 201000011549 stomach cancer Diseases 0.000 claims description 6
- 125000004853 tetrahydropyridinyl group Chemical group N1(CCCC=C1)* 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 6
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 5
- 206010033128 Ovarian cancer Diseases 0.000 claims description 5
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 5
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 5
- 206010038389 Renal cancer Diseases 0.000 claims description 5
- 239000003937 drug carrier Substances 0.000 claims description 5
- 201000010536 head and neck cancer Diseases 0.000 claims description 5
- 208000014829 head and neck neoplasm Diseases 0.000 claims description 5
- 201000010982 kidney cancer Diseases 0.000 claims description 5
- 208000032839 leukemia Diseases 0.000 claims description 5
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 5
- 201000001441 melanoma Diseases 0.000 claims description 5
- 201000000050 myeloid neoplasm Diseases 0.000 claims description 5
- 201000008968 osteosarcoma Diseases 0.000 claims description 5
- 201000002528 pancreatic cancer Diseases 0.000 claims description 5
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 5
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 claims description 4
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 claims description 4
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 claims description 4
- 206010060862 Prostate cancer Diseases 0.000 claims description 4
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 4
- 208000005017 glioblastoma Diseases 0.000 claims description 4
- 230000001537 neural effect Effects 0.000 claims description 4
- 208000006168 Ewing Sarcoma Diseases 0.000 claims description 3
- 201000010915 Glioblastoma multiforme Diseases 0.000 claims description 3
- 208000034578 Multiple myelomas Diseases 0.000 claims description 3
- 206010028537 myelofibrosis Diseases 0.000 claims description 3
- QRCSISPIJNVFQQ-MRXNPFEDSA-N (5R)-1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-5-methylimidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(NC[C@H]1C)=O)C QRCSISPIJNVFQQ-MRXNPFEDSA-N 0.000 claims description 2
- KIECZPNABSVWNH-OAHLLOKOSA-N (5R)-1-[5-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]pyridin-2-yl]-5-methylimidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C=1C=CC(=NC=1)N1C(NC[C@H]1C)=O)C KIECZPNABSVWNH-OAHLLOKOSA-N 0.000 claims description 2
- GSYUXXIWIAFEEC-UHFFFAOYSA-N 1-(2-aminoethyl)-3-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound NCCN1C(N(CC1)C1=CC=C(C=C1)C1=CN=C(O1)NC1=C(C=CC(=C1)COCC)C)=O GSYUXXIWIAFEEC-UHFFFAOYSA-N 0.000 claims description 2
- DQLSBFQGLKMGEA-UHFFFAOYSA-N 1-[4-[2-(5-methoxy-2-methylanilino)-1,3-thiazol-5-yl]phenyl]imidazolidin-2-one Chemical compound COC=1C=CC(=C(C=1)NC=1SC(=CN=1)C1=CC=C(C=C1)N1C(NCC1)=O)C DQLSBFQGLKMGEA-UHFFFAOYSA-N 0.000 claims description 2
- SBJGWUJYRDHDBQ-UHFFFAOYSA-N 1-[4-[2-[3,5-bis(ethoxymethyl)anilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound CCOCC1=CC(NC2=NC=C(O2)C2=CC=C(C=C2)N2CCNC2=O)=CC(COCC)=C1 SBJGWUJYRDHDBQ-UHFFFAOYSA-N 0.000 claims description 2
- FIJFTLZRJFJJHH-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)-5-(2-hydroxyethoxy)anilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound CCOCC1=CC(OCCO)=CC(NC2=NC=C(O2)C2=CC=C(C=C2)N2CCNC2=O)=C1 FIJFTLZRJFJJHH-UHFFFAOYSA-N 0.000 claims description 2
- RQPXDZRYAPBRHH-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)-5-(2-methoxyethoxy)anilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound CCOCC1=CC(OCCOC)=CC(NC2=NC=C(O2)C2=CC=C(C=C2)N2CCNC2=O)=C1 RQPXDZRYAPBRHH-UHFFFAOYSA-N 0.000 claims description 2
- LLZOOVAINRMGQZ-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)-5-methylanilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=C(C=C(C=1)C)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(NCC1)=O LLZOOVAINRMGQZ-UHFFFAOYSA-N 0.000 claims description 2
- LAKSUMNYPLRTDS-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)-5-methylanilino]-1,3-thiazol-4-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=C(C=C(C=1)C)NC=1SC=C(N=1)C1=CC=C(C=C1)N1C(NCC1)=O LAKSUMNYPLRTDS-UHFFFAOYSA-N 0.000 claims description 2
- QGBQAFISZCLPMZ-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)anilino]-1,3-oxazol-5-yl]phenyl]imidazolidin-2-one Chemical compound CCOCC1=CC=CC(NC2=NC=C(O2)C2=CC=C(C=C2)N2CCNC2=O)=C1 QGBQAFISZCLPMZ-UHFFFAOYSA-N 0.000 claims description 2
- ZXWMOVQGEFDBGU-UHFFFAOYSA-N 1-[4-[2-[3-(ethoxymethyl)anilino]-1,3-thiazol-4-yl]phenyl]imidazolidin-2-one Chemical compound CCOCC1=CC=CC(NC2=NC(=CS2)C2=CC=C(C=C2)N2CCNC2=O)=C1 ZXWMOVQGEFDBGU-UHFFFAOYSA-N 0.000 claims description 2
- HWDNOMODJUYGCR-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-3-(2-methoxyethyl)imidazolidin-2-one Chemical compound CCOCC1=CC(NC2=NC=C(O2)C2=CC=C(C=C2)N2CCN(CCOC)C2=O)=C(C)C=C1 HWDNOMODJUYGCR-UHFFFAOYSA-N 0.000 claims description 2
- HFPQVVDIBFNORW-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-3-methylimidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(N(CC1)C)=O)C HFPQVVDIBFNORW-UHFFFAOYSA-N 0.000 claims description 2
- WPTJLPQUUQBCGM-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]pyridin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(C=CC=C1)=O)C WPTJLPQUUQBCGM-UHFFFAOYSA-N 0.000 claims description 2
- ILSJJAHMDZLZCZ-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]pyrrolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(CCC1)=O)C ILSJJAHMDZLZCZ-UHFFFAOYSA-N 0.000 claims description 2
- YYHQBSIXIZKFNY-UHFFFAOYSA-N 1-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-thiazol-5-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1SC(=CN=1)C1=CC=C(C=C1)N1C(NCC1)=O)C YYHQBSIXIZKFNY-UHFFFAOYSA-N 0.000 claims description 2
- VOKVJCQSCHSFJP-UHFFFAOYSA-N 1-[4-[5-[5-(ethoxymethyl)-2-methylanilino]-1,2,4-thiadiazol-3-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC1=NC(=NS1)C1=CC=C(C=C1)N1C(NCC1)=O)C VOKVJCQSCHSFJP-UHFFFAOYSA-N 0.000 claims description 2
- XGESFNUMDHJAJS-UHFFFAOYSA-N 1-[4-[5-[5-(ethoxymethyl)-2-methylanilino]-1,3,4-oxadiazol-2-yl]phenyl]imidazolidin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC1=NN=C(O1)C1=CC=C(C=C1)N1C(NCC1)=O)C XGESFNUMDHJAJS-UHFFFAOYSA-N 0.000 claims description 2
- RFUULTLARLJBKO-UHFFFAOYSA-N 1-[5-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]pyridin-2-yl]imidazolidin-2-one Chemical compound CCOCC1=CC(NC2=NC=C(O2)C2=CN=C(C=C2)N2CCNC2=O)=C(C)C=C1 RFUULTLARLJBKO-UHFFFAOYSA-N 0.000 claims description 2
- GVJOWQGYKUBCQE-UHFFFAOYSA-N 2-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-4H-1,2,4-triazol-3-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CNC1=O)C GVJOWQGYKUBCQE-UHFFFAOYSA-N 0.000 claims description 2
- RRIGSUOVCYJHHP-UHFFFAOYSA-N 2-[[4-methyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]phenyl]methoxy]ethanol Chemical compound CC1=C(C=C(COCCO)C=C1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 RRIGSUOVCYJHHP-UHFFFAOYSA-N 0.000 claims description 2
- JSWUEYLOGRTPSD-UHFFFAOYSA-N 3-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-1H-pyridin-2-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)C=1C(NC=CC=1)=O)C JSWUEYLOGRTPSD-UHFFFAOYSA-N 0.000 claims description 2
- FZZLWAAVIZYJIV-UHFFFAOYSA-N 4-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-3-methyl-1H-1,2,4-triazol-5-one Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(NN=C1C)=O)C FZZLWAAVIZYJIV-UHFFFAOYSA-N 0.000 claims description 2
- GSBIYGCUXADINY-UHFFFAOYSA-N 4-methyl-N-(2-morpholin-4-ylethyl)-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]benzamide Chemical compound CC1=C(C=C(C(=O)NCCN2CCOCC2)C=C1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 GSBIYGCUXADINY-UHFFFAOYSA-N 0.000 claims description 2
- QMRAFYAFAQQRNJ-UHFFFAOYSA-N 4-methyl-N-[2-(4-methylpiperazin-1-yl)ethyl]-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]benzamide Chemical compound CC1=C(C=C(C(=O)NCCN2CCN(CC2)C)C=C1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 QMRAFYAFAQQRNJ-UHFFFAOYSA-N 0.000 claims description 2
- 208000031261 Acute myeloid leukaemia Diseases 0.000 claims description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 claims description 2
- 206010058314 Dysplasia Diseases 0.000 claims description 2
- BQVYNKAYYQVEDE-UHFFFAOYSA-N N,4-dimethyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]benzamide Chemical compound CC1=C(C=C(C(=O)NC)C=C1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 BQVYNKAYYQVEDE-UHFFFAOYSA-N 0.000 claims description 2
- TWXLTOPJWOZTJL-UHFFFAOYSA-N N-(5-methoxy-2-methylphenyl)-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound COC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C TWXLTOPJWOZTJL-UHFFFAOYSA-N 0.000 claims description 2
- MKFYLBQJGUUPPH-UHFFFAOYSA-N N-(5-methoxy-2-methylphenyl)-5-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine Chemical compound COC=1C=CC(=C(C=1)NC=1SC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C MKFYLBQJGUUPPH-UHFFFAOYSA-N 0.000 claims description 2
- JNBIUWYKWYDSPW-UHFFFAOYSA-N N-[2-[3-[4-[2-[5-(ethoxymethyl)-2-methylanilino]-1,3-oxazol-5-yl]phenyl]-2-oxoimidazolidin-1-yl]ethyl]acetamide Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C(N(CC1)CCNC(C)=O)=O)C JNBIUWYKWYDSPW-UHFFFAOYSA-N 0.000 claims description 2
- CIOSLVWJVLMMGY-UHFFFAOYSA-N N-[2-[[4-methyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]phenyl]methoxy]ethyl]acetamide Chemical compound CC1=C(C=C(COCCNC(C)=O)C=C1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 CIOSLVWJVLMMGY-UHFFFAOYSA-N 0.000 claims description 2
- PJYYCUOWUUOHEC-UHFFFAOYSA-N N-[2-methyl-5-(2-morpholin-4-ylethoxy)phenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound CC1=C(C=C(C=C1)OCCN1CCOCC1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 PJYYCUOWUUOHEC-UHFFFAOYSA-N 0.000 claims description 2
- NYTQNUSFRYFORG-UHFFFAOYSA-N N-[2-methyl-5-[(2-morpholin-4-ylethylamino)methyl]phenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound CC1=C(C=C(C=C1)CNCCN1CCOCC1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 NYTQNUSFRYFORG-UHFFFAOYSA-N 0.000 claims description 2
- QRSGFQDESJIFLU-UHFFFAOYSA-N N-[3,5-bis(ethoxymethyl)phenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=C(C=C(C=1)COCC)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 QRSGFQDESJIFLU-UHFFFAOYSA-N 0.000 claims description 2
- WUCHRJRDCNDMFS-UHFFFAOYSA-N N-[3-(ethoxymethyl)-5-methylphenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=C(C=C(C=1)C)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 WUCHRJRDCNDMFS-UHFFFAOYSA-N 0.000 claims description 2
- ANBIJEYNXHJRIP-UHFFFAOYSA-N N-[3-(ethoxymethyl)phenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=C(C=CC=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 ANBIJEYNXHJRIP-UHFFFAOYSA-N 0.000 claims description 2
- ZLVGNONNILHECM-UHFFFAOYSA-N N-[5-(2-aminoethoxymethyl)-2-methylphenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound NCCOCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C ZLVGNONNILHECM-UHFFFAOYSA-N 0.000 claims description 2
- ZPQNZRRKCVTTFS-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-4-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1SC=C(N=1)C1=CC=C(C=C1)N1N=CC=C1)C ZPQNZRRKCVTTFS-UHFFFAOYSA-N 0.000 claims description 2
- BYAKYFUORWVDSV-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-4-(6-pyrazol-1-ylpyridin-3-yl)-1,3-thiazol-2-amine Chemical compound N1(N=CC=C1)C1=CC=C(C=N1)C=1N=C(SC=1)NC1=C(C=CC(=C1)COCC)C BYAKYFUORWVDSV-UHFFFAOYSA-N 0.000 claims description 2
- RMOPBHDDDOXMEO-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(4-imidazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1C=NC=C1)C RMOPBHDDDOXMEO-UHFFFAOYSA-N 0.000 claims description 2
- CIPHHAYPPQTPKX-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C CIPHHAYPPQTPKX-UHFFFAOYSA-N 0.000 claims description 2
- CHNMIPRFUCPMKF-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(4-pyridin-2-ylphenyl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)C1=NC=CC=C1)C CHNMIPRFUCPMKF-UHFFFAOYSA-N 0.000 claims description 2
- LKMRUUDOKIEMCA-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-(6-pyrazol-1-ylpyridin-3-yl)-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C=1C=NC(=CC=1)N1N=CC=C1)C LKMRUUDOKIEMCA-UHFFFAOYSA-N 0.000 claims description 2
- VXTMJCUGYPDWOT-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(1,2,4-triazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CN=C1)C VXTMJCUGYPDWOT-UHFFFAOYSA-N 0.000 claims description 2
- LJSZVNPEBAZKPB-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(1,3-thiazol-2-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)C=1SC=CN=1)C LJSZVNPEBAZKPB-UHFFFAOYSA-N 0.000 claims description 2
- QGUZRIQSXXKNJL-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(1H-pyrazol-4-yl)phenyl]-1,3-oxazol-2-amine Chemical compound N1N=CC(=C1)C1=CC=C(C=C1)C1=CN=C(O1)NC1=C(C=CC(=C1)COCC)C QGUZRIQSXXKNJL-UHFFFAOYSA-N 0.000 claims description 2
- KAFCXUQOMWBXEU-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(1H-pyrazol-5-yl)phenyl]-1,3-oxazol-2-amine Chemical compound N1N=CC=C1C1=CC=C(C=C1)C1=CN=C(O1)NC1=C(C=CC(=C1)COCC)C KAFCXUQOMWBXEU-UHFFFAOYSA-N 0.000 claims description 2
- PCSPJWVWQVRWNQ-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(2-methylpyrazol-3-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)C1=CC=NN1C)C PCSPJWVWQVRWNQ-UHFFFAOYSA-N 0.000 claims description 2
- HVDYDLAZKVAIDL-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(3-methoxypyrazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=C(C=C1)OC)C HVDYDLAZKVAIDL-UHFFFAOYSA-N 0.000 claims description 2
- WDXVGLKCUPRDAT-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(5-methylpyrazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1C)C WDXVGLKCUPRDAT-UHFFFAOYSA-N 0.000 claims description 2
- HEMVWJHGOITMEG-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(triazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=NC=C1)C HEMVWJHGOITMEG-UHFFFAOYSA-N 0.000 claims description 2
- VYVOOYRFWHJRTD-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(triazol-2-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=N1)C VYVOOYRFWHJRTD-UHFFFAOYSA-N 0.000 claims description 2
- BWULSSLKFQOIOE-UHFFFAOYSA-N N-[5-[2-(dimethylamino)ethoxy]-2-methylphenyl]-5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-amine Chemical compound CN(CCOC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1)C)C BWULSSLKFQOIOE-UHFFFAOYSA-N 0.000 claims description 2
- ZCGQJNVTNZOVGW-UHFFFAOYSA-N [4-methyl-3-[[4-(4-pyrazol-1-ylphenyl)-1,3-thiazol-2-yl]amino]phenyl]methanol Chemical compound CC1=C(C=C(C=C1)CO)NC=1SC=C(N=1)C1=CC=C(C=C1)N1N=CC=C1 ZCGQJNVTNZOVGW-UHFFFAOYSA-N 0.000 claims description 2
- YCRXUCBVRHVZIK-UHFFFAOYSA-N [4-methyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]phenyl]methanol Chemical compound CC1=C(C=C(C=C1)CO)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC=C1 YCRXUCBVRHVZIK-UHFFFAOYSA-N 0.000 claims description 2
- IDSVPEUUTLWJBT-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(3-methylpyrazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=C(C=C1)C)C IDSVPEUUTLWJBT-UHFFFAOYSA-N 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- 239000000543 intermediate Substances 0.000 description 64
- 239000000243 solution Substances 0.000 description 59
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 239000000203 mixture Substances 0.000 description 42
- 235000019439 ethyl acetate Nutrition 0.000 description 39
- 238000000034 method Methods 0.000 description 37
- 239000011541 reaction mixture Substances 0.000 description 35
- 210000004027 cell Anatomy 0.000 description 32
- 239000003480 eluent Substances 0.000 description 24
- 238000010898 silica gel chromatography Methods 0.000 description 24
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 23
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 19
- 239000012074 organic phase Substances 0.000 description 19
- 239000012467 final product Substances 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 235000019441 ethanol Nutrition 0.000 description 15
- 229940079593 drug Drugs 0.000 description 14
- 108091000080 Phosphotransferase Proteins 0.000 description 13
- 102000020233 phosphotransferase Human genes 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 125000005842 heteroatom Chemical group 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 10
- 210000004881 tumor cell Anatomy 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 230000034994 death Effects 0.000 description 8
- 231100000517 death Toxicity 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N dichloromethane Natural products ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- QIQVXWSUXZGFKN-UHFFFAOYSA-N 2-chloro-5-(6-pyrazol-1-ylpyridin-3-yl)-1,3-oxazole Chemical compound N1(N=CC=C1)C1=CC=C(C=N1)C1=CN=C(O1)Cl QIQVXWSUXZGFKN-UHFFFAOYSA-N 0.000 description 7
- LOALOYGMBJHKKV-UHFFFAOYSA-N 5-(6-bromopyridin-3-yl)-1,3-oxazole Chemical compound Brc1ccc(cn1)-c1cnco1 LOALOYGMBJHKKV-UHFFFAOYSA-N 0.000 description 7
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 230000002194 synthesizing effect Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 0 CC*c1c(*(C)=C)c(N)c(*CC)c(**C2=C*C(*)C=C2)c1* Chemical compound CC*c1c(*(C)=C)c(N)c(*CC)c(**C2=C*C(*)C=C2)c1* 0.000 description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000000969 carrier Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- VKLYSIQGYYNIHS-UHFFFAOYSA-N n-(5-methoxy-2-methylphenyl)acetamide Chemical compound COC1=CC=C(C)C(NC(C)=O)=C1 VKLYSIQGYYNIHS-UHFFFAOYSA-N 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 6
- OCGXAWPOUKOFAT-UHFFFAOYSA-N 5-(6-pyrazol-1-ylpyridin-3-yl)-1,3-oxazole Chemical compound N1(N=CC=C1)C1=CC=C(C=N1)C1=CN=CO1 OCGXAWPOUKOFAT-UHFFFAOYSA-N 0.000 description 5
- LKLZWRDXQKCZRO-UHFFFAOYSA-N 5-(ethoxymethyl)-2-methylaniline Chemical compound CCOCC1=CC=C(C)C(N)=C1 LKLZWRDXQKCZRO-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- OOSOSILODXVVFZ-UHFFFAOYSA-N [5-(ethoxymethyl)-2-methylphenyl]thiourea Chemical compound C(C)OCC=1C=CC(=C(C=1)NC(=S)N)C OOSOSILODXVVFZ-UHFFFAOYSA-N 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 230000001028 anti-proliverative effect Effects 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 230000004663 cell proliferation Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- 229940093915 gynecological organic acid Drugs 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 235000005985 organic acids Nutrition 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 230000035515 penetration Effects 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- JZHANKFEAOAAMF-UHFFFAOYSA-N tert-butyl 4-methyl-3-nitrobenzoate Chemical compound CC1=CC=C(C(=O)OC(C)(C)C)C=C1[N+]([O-])=O JZHANKFEAOAAMF-UHFFFAOYSA-N 0.000 description 5
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 5
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 4
- PTVPLWXZLYCKRY-UHFFFAOYSA-N 2-bromo-5-(dibromomethyl)pyridine Chemical compound BrC(Br)C1=CC=C(Br)N=C1 PTVPLWXZLYCKRY-UHFFFAOYSA-N 0.000 description 4
- WWENFMYXNAASAC-UHFFFAOYSA-N 2-chloro-5-(4-pyrazol-1-ylphenyl)-1,3-oxazole Chemical compound N1(N=CC=C1)C1=CC=C(C=C1)C1=CN=C(O1)Cl WWENFMYXNAASAC-UHFFFAOYSA-N 0.000 description 4
- XAJVTPGVGZRHEO-UHFFFAOYSA-N 2-methoxy-4-(1,3-oxazol-5-yl)aniline Chemical compound C1=C(N)C(OC)=CC(C=2OC=NC=2)=C1 XAJVTPGVGZRHEO-UHFFFAOYSA-N 0.000 description 4
- IKTBKWVZXRXIIJ-UHFFFAOYSA-N 4-(ethoxymethyl)-1-methyl-2-nitrobenzene Chemical compound CCOCC1=CC=C(C)C([N+]([O-])=O)=C1 IKTBKWVZXRXIIJ-UHFFFAOYSA-N 0.000 description 4
- WONMWQKEEOGYSU-UHFFFAOYSA-N 4-methyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]benzoic acid Chemical compound N1(N=CC=C1)C1=CC=C(C=C1)C1=CN=C(O1)NC=1C=C(C(=O)O)C=CC=1C WONMWQKEEOGYSU-UHFFFAOYSA-N 0.000 description 4
- HWQVKWIRGPBCFT-UHFFFAOYSA-N 5-(3-methoxy-4-nitrophenyl)-1,3-oxazole Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(C=2OC=NC=2)=C1 HWQVKWIRGPBCFT-UHFFFAOYSA-N 0.000 description 4
- OZUDDHOEEYGZJH-UHFFFAOYSA-N 5-(3-methoxy-4-pyrazol-1-ylphenyl)-1,3-oxazole Chemical compound COC=1C=C(C=CC=1N1N=CC=C1)C1=CN=CO1 OZUDDHOEEYGZJH-UHFFFAOYSA-N 0.000 description 4
- SCTOIAATFFMPML-UHFFFAOYSA-N 5-(4-bromophenyl)-2-chloro-1,3-oxazole Chemical compound O1C(Cl)=NC=C1C1=CC=C(Br)C=C1 SCTOIAATFFMPML-UHFFFAOYSA-N 0.000 description 4
- PVUKGNBRJFTFNJ-UHFFFAOYSA-N 6-bromopyridine-3-carbaldehyde Chemical compound BrC1=CC=C(C=O)C=N1 PVUKGNBRJFTFNJ-UHFFFAOYSA-N 0.000 description 4
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- MTVOQYQALLICJF-UHFFFAOYSA-N [2-methoxy-4-(1,3-oxazol-5-yl)phenyl]hydrazine Chemical compound N(N)C1=C(C=C(C=C1)C1=CN=CO1)OC MTVOQYQALLICJF-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002480 mineral oil Substances 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 238000012216 screening Methods 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000012453 solvate Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- CAJILMZUSYPCPQ-UHFFFAOYSA-N 2-chloro-5-(3-methoxy-4-pyrazol-1-ylphenyl)-1,3-oxazole Chemical compound ClC=1OC(=CN=1)C1=CC(=C(C=C1)N1N=CC=C1)OC CAJILMZUSYPCPQ-UHFFFAOYSA-N 0.000 description 3
- WUTIWOZYHHSBBU-UHFFFAOYSA-N 3-methoxy-4-nitrobenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1[N+]([O-])=O WUTIWOZYHHSBBU-UHFFFAOYSA-N 0.000 description 3
- AOLARYRQJVCIHE-UHFFFAOYSA-N 4-(4-bromophenyl)-N-[5-(ethoxymethyl)-2-methylphenyl]-1,3-thiazol-2-amine Chemical compound BrC1=CC=C(C=C1)C=1N=C(SC=1)NC1=C(C=CC(=C1)COCC)C AOLARYRQJVCIHE-UHFFFAOYSA-N 0.000 description 3
- PPGRDLZPSDHBIC-UHFFFAOYSA-N 4-pyrazol-1-ylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1N1N=CC=C1 PPGRDLZPSDHBIC-UHFFFAOYSA-N 0.000 description 3
- FEBCQOHEPVLTLY-UHFFFAOYSA-N 5-(4-bromophenyl)-1,3-oxazole Chemical compound C1=CC(Br)=CC=C1C1=CN=CO1 FEBCQOHEPVLTLY-UHFFFAOYSA-N 0.000 description 3
- GTMSMBBVXWUBGW-UHFFFAOYSA-N 5-(4-bromophenyl)-N-[5-(ethoxymethyl)-2-methylphenyl]-1,3-oxazol-2-amine Chemical compound BrC1=CC=C(C=C1)C1=CN=C(O1)NC1=C(C=CC(=C1)COCC)C GTMSMBBVXWUBGW-UHFFFAOYSA-N 0.000 description 3
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 102000001253 Protein Kinase Human genes 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 201000008736 Systemic mastocytosis Diseases 0.000 description 3
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- GVJHHUAWPYXKBD-UHFFFAOYSA-N d-alpha-tocopherol Natural products OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 125000001715 oxadiazolyl group Chemical group 0.000 description 3
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 3
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 230000001737 promoting effect Effects 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 108060006633 protein kinase Proteins 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 238000003419 tautomerization reaction Methods 0.000 description 3
- VCTNRDXENQABOD-UHFFFAOYSA-N tert-butyl 3-acetamido-4-methylbenzoate Chemical compound C(C)(=O)NC=1C=C(C(=O)OC(C)(C)C)C=CC=1C VCTNRDXENQABOD-UHFFFAOYSA-N 0.000 description 3
- XCGNZFAHSHDHJE-UHFFFAOYSA-N tert-butyl 3-amino-4-methylbenzoate Chemical compound CC1=CC=C(C(=O)OC(C)(C)C)C=C1N XCGNZFAHSHDHJE-UHFFFAOYSA-N 0.000 description 3
- JBPXLQSUEFKWBF-UHFFFAOYSA-N tert-butyl 4-methyl-3-[[5-(4-pyrazol-1-ylphenyl)-1,3-oxazol-2-yl]amino]benzoate Chemical compound N1(N=CC=C1)C1=CC=C(C=C1)C1=CN=C(O1)NC=1C=C(C(=O)OC(C)(C)C)C=CC=1C JBPXLQSUEFKWBF-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000001113 thiadiazolyl group Chemical group 0.000 description 3
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 3
- 150000003585 thioureas Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 2
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical class NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 2
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 2
- RZUKHJWGZWHLAB-UHFFFAOYSA-N 2-(thian-2-ylsulfinyl)thiane Chemical compound C1CCCSC1S(=O)C1CCCCS1 RZUKHJWGZWHLAB-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- WHBMMWSBFZVSSR-UHFFFAOYSA-N 3-hydroxybutyric acid Chemical compound CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 2
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- 208000027190 Peripheral T-cell lymphomas Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000031672 T-Cell Peripheral Lymphoma Diseases 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 208000016025 Waldenstroem macroglobulinemia Diseases 0.000 description 2
- 208000033559 Waldenström macroglobulinemia Diseases 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 229920013820 alkyl cellulose Polymers 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 230000000259 anti-tumor effect Effects 0.000 description 2
- 229940041181 antineoplastic drug Drugs 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 150000003934 aromatic aldehydes Chemical class 0.000 description 2
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 2
- 235000015165 citric acid Nutrition 0.000 description 2
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 239000002254 cytotoxic agent Substances 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 231100000599 cytotoxic agent Toxicity 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 206010012818 diffuse large B-cell lymphoma Diseases 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000003974 emollient agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002084 enol ethers Chemical class 0.000 description 2
- 210000002615 epidermis Anatomy 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 201000003444 follicular lymphoma Diseases 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000000174 gluconic acid Substances 0.000 description 2
- 235000012208 gluconic acid Nutrition 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 201000005787 hematologic cancer Diseases 0.000 description 2
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000002563 ionic surfactant Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 201000007924 marginal zone B-cell lymphoma Diseases 0.000 description 2
- 208000021937 marginal zone lymphoma Diseases 0.000 description 2
- 208000020968 mature T-cell and NK-cell non-Hodgkin lymphoma Diseases 0.000 description 2
- 229960003194 meglumine Drugs 0.000 description 2
- 239000002207 metabolite Substances 0.000 description 2
- 230000009401 metastasis Effects 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 125000006578 monocyclic heterocycloalkyl group Chemical group 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 239000000419 plant extract Substances 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 210000002345 respiratory system Anatomy 0.000 description 2
- 238000012552 review Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 235000000346 sugar Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 229960000281 trometamol Drugs 0.000 description 2
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 2
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 2
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- XFQNWPYGEGCIMF-HCUGAJCMSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].[Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 XFQNWPYGEGCIMF-HCUGAJCMSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- KWMLJOLKUYYJFJ-GASJEMHNSA-N (2xi)-D-gluco-heptonic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C(O)=O KWMLJOLKUYYJFJ-GASJEMHNSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- XHTYQFMRBQUCPX-UHFFFAOYSA-N 1,1,3,3-tetramethoxypropane Chemical compound COC(OC)CC(OC)OC XHTYQFMRBQUCPX-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- ACTKAGSPIFDCMF-UHFFFAOYSA-N 1,3-oxazol-2-amine Chemical class NC1=NC=CO1 ACTKAGSPIFDCMF-UHFFFAOYSA-N 0.000 description 1
- MICMHFIQSAMEJG-UHFFFAOYSA-N 1-bromopyrrolidine-2,5-dione Chemical compound BrN1C(=O)CCC1=O.BrN1C(=O)CCC1=O MICMHFIQSAMEJG-UHFFFAOYSA-N 0.000 description 1
- ZTEHOZMYMCEYRM-UHFFFAOYSA-N 1-chlorodecane Chemical compound CCCCCCCCCCCl ZTEHOZMYMCEYRM-UHFFFAOYSA-N 0.000 description 1
- AXTGDCSMTYGJND-UHFFFAOYSA-N 1-dodecylazepan-2-one Chemical compound CCCCCCCCCCCCN1CCCCCC1=O AXTGDCSMTYGJND-UHFFFAOYSA-N 0.000 description 1
- NZJXADCEESMBPW-UHFFFAOYSA-N 1-methylsulfinyldecane Chemical compound CCCCCCCCCCS(C)=O NZJXADCEESMBPW-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- 125000003562 2,2-dimethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003660 2,3-dimethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003764 2,4-dimethylpentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- FKJSFKCZZIXQIP-UHFFFAOYSA-N 2-bromo-1-(4-bromophenyl)ethanone Chemical compound BrCC(=O)C1=CC=C(Br)C=C1 FKJSFKCZZIXQIP-UHFFFAOYSA-N 0.000 description 1
- YWNJQQNBJQUKME-UHFFFAOYSA-N 2-bromo-5-methylpyridine Chemical compound CC1=CC=C(Br)N=C1 YWNJQQNBJQUKME-UHFFFAOYSA-N 0.000 description 1
- SSXYKBHZZRYLLY-UHFFFAOYSA-N 2-chloro-1,3-oxazole Chemical class ClC1=NC=CO1 SSXYKBHZZRYLLY-UHFFFAOYSA-N 0.000 description 1
- RFVNOJDQRGSOEL-UHFFFAOYSA-N 2-hydroxyethyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCCO RFVNOJDQRGSOEL-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- LGCYVLDNGBSOOW-UHFFFAOYSA-N 2H-benzotriazol-4-ol 1-hydroxybenzotriazole Chemical compound OC1=CC=CC2=C1N=NN2.C1=CC=C2N(O)N=NC2=C1 LGCYVLDNGBSOOW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- AIPWPTPHMIYYOX-UHFFFAOYSA-N 3-bromo-2-methylpyridine Chemical compound CC1=NC=CC=C1Br AIPWPTPHMIYYOX-UHFFFAOYSA-N 0.000 description 1
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical compound C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 1
- ZRPLANDPDWYOMZ-UHFFFAOYSA-N 3-cyclopentylpropionic acid Chemical compound OC(=O)CCC1CCCC1 ZRPLANDPDWYOMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004337 3-ethylpentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- AUBBVPIQUDFRQI-UHFFFAOYSA-N 3-hydroxy-4-nitrobenzaldehyde Chemical compound OC1=CC(C=O)=CC=C1[N+]([O-])=O AUBBVPIQUDFRQI-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- DLTKEOYTIZIUKD-UHFFFAOYSA-N 4-(chloromethyl)-1-methyl-2-nitrobenzene Chemical compound CC1=CC=C(CCl)C=C1[N+]([O-])=O DLTKEOYTIZIUKD-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-M 4-aminobenzenesulfonate Chemical compound NC1=CC=C(S([O-])(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-M 0.000 description 1
- ZRYZBQLXDKPBDU-UHFFFAOYSA-N 4-bromobenzaldehyde Chemical compound BrC1=CC=C(C=O)C=C1 ZRYZBQLXDKPBDU-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- BBEWSMNRCUXQRF-UHFFFAOYSA-N 4-methyl-3-nitrobenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1[N+]([O-])=O BBEWSMNRCUXQRF-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- AWQSAIIDOMEEOD-UHFFFAOYSA-N 5,5-Dimethyl-4-(3-oxobutyl)dihydro-2(3H)-furanone Chemical compound CC(=O)CCC1CC(=O)OC1(C)C AWQSAIIDOMEEOD-UHFFFAOYSA-N 0.000 description 1
- WPNODROMNPJRBI-UHFFFAOYSA-N 5-(4-pyrazol-1-ylphenyl)-1,3-oxazole Chemical compound C1=CC=NN1C1=CC=C(C=2OC=NC=2)C=C1 WPNODROMNPJRBI-UHFFFAOYSA-N 0.000 description 1
- RPJXLEZOFUNGNZ-UHFFFAOYSA-N 5-methoxy-2-methylaniline Chemical compound COC1=CC=C(C)C(N)=C1 RPJXLEZOFUNGNZ-UHFFFAOYSA-N 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical group NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010005949 Bone cancer Diseases 0.000 description 1
- 208000018084 Bone neoplasm Diseases 0.000 description 1
- 208000011691 Burkitt lymphomas Diseases 0.000 description 1
- BBGVJCCISBVQDW-UHFFFAOYSA-N C=[Br]c(cc1)ncc1-c1cnc[o]1 Chemical compound C=[Br]c(cc1)ncc1-c1cnc[o]1 BBGVJCCISBVQDW-UHFFFAOYSA-N 0.000 description 1
- YHOGYQPCNHPXMP-UHFFFAOYSA-N CC1C=CC(OC)=CC1N Chemical compound CC1C=CC(OC)=CC1N YHOGYQPCNHPXMP-UHFFFAOYSA-N 0.000 description 1
- GXJRVMROUGHZJE-UHFFFAOYSA-N CCc(cc1)ccc1-[n]1nccc1 Chemical compound CCc(cc1)ccc1-[n]1nccc1 GXJRVMROUGHZJE-UHFFFAOYSA-N 0.000 description 1
- JRHPOFJADXHYBR-UHFFFAOYSA-N CNC(CCCC1)C1NC Chemical compound CNC(CCCC1)C1NC JRHPOFJADXHYBR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- LSPHULWDVZXLIL-UHFFFAOYSA-N Camphoric acid Natural products CC1(C)C(C(O)=O)CCC1(C)C(O)=O LSPHULWDVZXLIL-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- 102100031437 Cell cycle checkpoint protein RAD1 Human genes 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000007445 Chromatographic isolation Methods 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-YMDCURPLSA-N D-galactopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-YMDCURPLSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- XMSXQFUHVRWGNA-UHFFFAOYSA-N Decamethylcyclopentasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 XMSXQFUHVRWGNA-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000000461 Esophageal Neoplasms Diseases 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 230000005526 G1 to G0 transition Effects 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- 101001130384 Homo sapiens Cell cycle checkpoint protein RAD1 Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000003749 KINOMEscan Methods 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- 102100020870 La-related protein 6 Human genes 0.000 description 1
- 108050008265 La-related protein 6 Proteins 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241001108995 Messa Species 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- URNDZGDIXCGGGO-UHFFFAOYSA-N N-[5-(ethoxymethyl)-2-methylphenyl]-5-[4-(4-methylpyrazol-1-yl)phenyl]-1,3-oxazol-2-amine Chemical compound C(C)OCC=1C=CC(=C(C=1)NC=1OC(=CN=1)C1=CC=C(C=C1)N1N=CC(=C1)C)C URNDZGDIXCGGGO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 229920003189 Nylon 4,6 Polymers 0.000 description 1
- 206010030155 Oesophageal carcinoma Diseases 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229940079156 Proteasome inhibitor Drugs 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 206010039101 Rhinorrhoea Diseases 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- 206010040880 Skin irritation Diseases 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 206010047141 Vasodilatation Diseases 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 1
- 241001135917 Vitellaria paradoxa Species 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- UGAPHEBNTGUMBB-UHFFFAOYSA-N acetic acid;ethyl acetate Chemical compound CC(O)=O.CCOC(C)=O UGAPHEBNTGUMBB-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 235000014104 aloe vera supplement Nutrition 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 238000011394 anticancer treatment Methods 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940125648 antineoplastic drug candidate Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 229960001467 bortezomib Drugs 0.000 description 1
- GXJABQQUPOEUTA-RDJZCZTQSA-N bortezomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C=1N=CC=NC=1)C1=CC=CC=C1 GXJABQQUPOEUTA-RDJZCZTQSA-N 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- LSPHULWDVZXLIL-QUBYGPBYSA-N camphoric acid Chemical compound CC1(C)[C@H](C(O)=O)CC[C@]1(C)C(O)=O LSPHULWDVZXLIL-QUBYGPBYSA-N 0.000 description 1
- 239000012830 cancer therapeutic Substances 0.000 description 1
- 230000005773 cancer-related death Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000001516 cell proliferation assay Methods 0.000 description 1
- 229940106189 ceramide Drugs 0.000 description 1
- 150000001783 ceramides Chemical class 0.000 description 1
- 210000003679 cervix uteri Anatomy 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 229940086555 cyclomethicone Drugs 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 229950010286 diolamine Drugs 0.000 description 1
- 101150042537 dld1 gene Proteins 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000013583 drug formulation Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 201000004101 esophageal cancer Diseases 0.000 description 1
- 235000004626 essential fatty acids Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- LHWWETDBWVTKJO-UHFFFAOYSA-N et3n triethylamine Chemical compound CCN(CC)CC.CCN(CC)CC LHWWETDBWVTKJO-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 238000007306 functionalization reaction Methods 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 238000009650 gentamicin protection assay Methods 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- 229940075529 glyceryl stearate Drugs 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 229940100242 glycol stearate Drugs 0.000 description 1
- 208000035474 group of disease Diseases 0.000 description 1
- 230000002489 hematologic effect Effects 0.000 description 1
- 208000019691 hematopoietic and lymphoid cell neoplasm Diseases 0.000 description 1
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 description 1
- IIRDTKBZINWQAW-UHFFFAOYSA-N hexaethylene glycol Chemical compound OCCOCCOCCOCCOCCOCCO IIRDTKBZINWQAW-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 125000005946 imidazo[1,2-a]pyridyl group Chemical group 0.000 description 1
- 125000005945 imidazopyridyl group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940099563 lactobionic acid Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000009688 liquid atomisation Methods 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 208000008585 mastocytosis Diseases 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- SJFNDMHZXCUXSA-UHFFFAOYSA-M methoxymethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(COC)C1=CC=CC=C1 SJFNDMHZXCUXSA-UHFFFAOYSA-M 0.000 description 1
- 239000004530 micro-emulsion Substances 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000011859 microparticle Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PEECTLLHENGOKU-UHFFFAOYSA-N n,n-dimethylpyridin-4-amine Chemical compound CN(C)C1=CC=NC=C1.CN(C)C1=CC=NC=C1 PEECTLLHENGOKU-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000000133 nasal decongestant Substances 0.000 description 1
- 208000010753 nasal discharge Diseases 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229960001730 nitrous oxide Drugs 0.000 description 1
- 235000013842 nitrous oxide Nutrition 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 229950004864 olamine Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000013110 organic ligand Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000007978 oxazole derivatives Chemical class 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 229920003175 pectinic acid Polymers 0.000 description 1
- 229940119519 peg-32 stearate Drugs 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229940124531 pharmaceutical excipient Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000059 polyethylene glycol stearate Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000001818 polyoxyethylene sorbitan monostearate Substances 0.000 description 1
- 235000010989 polyoxyethylene sorbitan monostearate Nutrition 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 150000004804 polysaccharides Chemical class 0.000 description 1
- 229940113124 polysorbate 60 Drugs 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 239000003207 proteasome inhibitor Substances 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- HSSLDCABUXLXKM-UHFFFAOYSA-N resorufin Chemical compound C1=CC(=O)C=C2OC3=CC(O)=CC=C3N=C21 HSSLDCABUXLXKM-UHFFFAOYSA-N 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000011607 retinol Substances 0.000 description 1
- 229960003471 retinol Drugs 0.000 description 1
- 235000020944 retinol Nutrition 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229940057910 shea butter Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 230000036556 skin irritation Effects 0.000 description 1
- 231100000475 skin irritation Toxicity 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- WGRULTCAYDOGQK-UHFFFAOYSA-M sodium;sodium;hydroxide Chemical compound [OH-].[Na].[Na+] WGRULTCAYDOGQK-UHFFFAOYSA-M 0.000 description 1
- 239000004449 solid propellant Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229960004274 stearic acid Drugs 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000006092 tetrahydro-1,1-dioxothienyl group Chemical group 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000005888 tetrahydroindolyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005958 tetrahydrothienyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- WCNFFKHKJLERFM-UHFFFAOYSA-N thiomorpholinyl sulfone group Chemical group N1(CCSCC1)S(=O)(=O)N1CCSCC1 WCNFFKHKJLERFM-UHFFFAOYSA-N 0.000 description 1
- ZCAGUOCUDGWENZ-UHFFFAOYSA-N thiomorpholinyl sulfoxide group Chemical group N1(CCSCC1)S(=O)N1CCSCC1 ZCAGUOCUDGWENZ-UHFFFAOYSA-N 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 235000010384 tocopherol Nutrition 0.000 description 1
- 229930003799 tocopherol Natural products 0.000 description 1
- 229960001295 tocopherol Drugs 0.000 description 1
- 239000011732 tocopherol Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- KBEDMOMMPFPMQG-UHFFFAOYSA-N triphosphanium trichloride Chemical compound [PH4+].[PH4+].[PH4+].[Cl-].[Cl-].[Cl-] KBEDMOMMPFPMQG-UHFFFAOYSA-N 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 150000004917 tyrosine kinase inhibitor derivatives Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- GVJHHUAWPYXKBD-IEOSBIPESA-N α-tocopherol Chemical compound OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-IEOSBIPESA-N 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP15154028.3A EP3053920B1 (en) | 2015-02-05 | 2015-02-05 | Compounds with anti-tumoral activity |
| EP15154028.3 | 2015-02-05 | ||
| PCT/EP2016/052523 WO2016124747A1 (en) | 2015-02-05 | 2016-02-05 | Compounds with anti-tumoral activity |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| JP2018504415A JP2018504415A (ja) | 2018-02-15 |
| JP2018504415A5 true JP2018504415A5 (cg-RX-API-DMAC7.html) | 2019-03-07 |
| JP6713000B2 JP6713000B2 (ja) | 2020-06-24 |
Family
ID=52450012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2017539023A Active JP6713000B2 (ja) | 2015-02-05 | 2016-02-05 | 抗腫瘍活性を有する化合物 |
Country Status (24)
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2018106643A1 (en) * | 2016-12-06 | 2018-06-14 | Vertex Pharmaceuticals Incorporated | Heterocyclic azoles for the treatment of demyelinating diseases |
| CN109467531A (zh) * | 2017-09-08 | 2019-03-15 | 沈阳科创化学品有限公司 | 一种取代吡啶二羧酸衍生物的制备方法 |
| CN112225733B (zh) * | 2020-11-25 | 2022-12-09 | 湖南科技大学 | 一种含1,3,4-噻二唑吡啶-2-酮衍生物的制备方法和作为抗癌药物的应用 |
| AU2024225818A1 (en) * | 2023-02-24 | 2025-09-11 | Ab Science | Compounds for treating myeloid diseases with chromosomal abnormalities |
| CN117720459A (zh) * | 2023-12-26 | 2024-03-19 | 江苏希迪制药有限公司 | 一种阿贝西利中间体5-[(4-乙基哌嗪-1-基)甲基]吡啶-2-胺制备工艺 |
Family Cites Families (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US810665A (en) * | 1905-10-10 | 1906-01-23 | Joseph Mlada | Mold for butter. |
| US1346834A (en) * | 1918-08-17 | 1920-07-20 | Charles E Mcmanus | Resilient rod |
| US3740420A (en) | 1967-11-28 | 1973-06-19 | Crown Zellerbach Corp | Pharmaceutical compositions with dimethyl sulfoxide |
| US3743727A (en) | 1970-11-16 | 1973-07-03 | Crown Zellerbach Corp | Enhancing tissue penetration of certain antimicrobial agents with dimethyl sulfoxide |
| US3989816A (en) | 1975-06-19 | 1976-11-02 | Nelson Research & Development Company | Vehicle composition containing 1-substituted azacycloheptan-2-ones |
| US4405616A (en) | 1975-06-19 | 1983-09-20 | Nelson Research & Development Company | Penetration enhancers for transdermal drug delivery of systemic agents |
| CA1163561A (en) | 1979-11-06 | 1984-03-13 | Cyril Boroda | Preparation containing nitroglycerine and optionally other medicaments and preparation thereof |
| US4379454A (en) | 1981-02-17 | 1983-04-12 | Alza Corporation | Dosage for coadministering drug and percutaneous absorption enhancer |
| US4460372A (en) | 1981-02-17 | 1984-07-17 | Alza Corporation | Percutaneous absorption enhancer dispenser for use in coadministering drug and percutaneous absorption enhancer |
| US4411893A (en) | 1981-08-14 | 1983-10-25 | Minnesota Mining And Manufacturing Company | Topical medicament preparations |
| CA1236029A (en) | 1984-05-14 | 1988-05-03 | Edmund Sandborn | Pharmaceutical solutions comprising dimethyl sulfoxide |
| US4615699A (en) | 1985-05-03 | 1986-10-07 | Alza Corporation | Transdermal delivery system for delivering nitroglycerin at high transdermal fluxes |
| DE3815221C2 (de) | 1988-05-04 | 1995-06-29 | Gradinger F Hermes Pharma | Verwendung einer Retinol- und/oder Retinsäureester enthaltenden pharmazeutischen Zubereitung zur Inhalation zur Einwirkung auf die Schleimhäute des Tracheo-Bronchialtraktes einschließlich der Lungenalveolen |
| GB9622363D0 (en) * | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| US5906202A (en) | 1996-11-21 | 1999-05-25 | Aradigm Corporation | Device and method for directing aerosolized mist to a specific area of the respiratory tract |
| JP2002531503A (ja) * | 1998-12-07 | 2002-09-24 | スミスクライン・ビーチャム・コーポレイション | Myt1キナーゼ阻害剤 |
| JP4216947B2 (ja) * | 1999-05-18 | 2009-01-28 | 三井化学株式会社 | アミン化合物 |
| US8450302B2 (en) * | 2002-08-02 | 2013-05-28 | Ab Science | 2-(3-aminoaryl) amino-4-aryl-thiazoles and their use as c-kit inhibitors |
| ATE375342T1 (de) * | 2002-08-02 | 2007-10-15 | Ab Science | 2-(3-aminoaryl)amino-4-aryl-thiazole und ihre verwendung als c-kit inhibitoren |
| BRPI0410348A (pt) * | 2003-05-14 | 2006-05-30 | Torreypines Therapeutics Inc | compostos e usos dos mesmos na modulação de amilóide-beta |
| ATE465731T1 (de) * | 2003-10-23 | 2010-05-15 | Ab Science | 2-aminoaryloxazol-verbindungen als tyrosinkinase- hemmer |
| EP1789393A2 (en) | 2004-07-30 | 2007-05-30 | GPC Biotech AG | Pyridinylamines |
| JP2008510766A (ja) * | 2004-08-27 | 2008-04-10 | ゲーペーツェー ビオテック アーゲー | ピリミジン誘導体 |
| AU2006231929B2 (en) * | 2005-04-04 | 2012-09-06 | Ab Science | Substituted oxazole derivatives and their use as tyrosine kinase inhibitors |
| CN101247807A (zh) * | 2005-05-09 | 2008-08-20 | 艾其林医药公司 | 噻唑化合物及使用方法 |
| JP5214096B2 (ja) * | 2005-06-17 | 2013-06-19 | 富士フイルムファインケミカルズ株式会社 | 新規なビピリジン誘導体 |
| US20080207572A1 (en) * | 2005-07-14 | 2008-08-28 | Ab Science | Use of Dual C-Kit/Fgfr3 Inhibitors for Treating Multiple Myeloma |
| CA2617394C (en) * | 2005-09-13 | 2014-06-03 | Janssen Pharmaceutica N.V. | 2-aniline-4-aryl substituted thiazole derivatives |
| GB0524436D0 (en) * | 2005-11-30 | 2006-01-11 | Novartis Ag | Organic compounds |
| AU2007245059B2 (en) * | 2006-03-31 | 2011-07-28 | Novartis Ag | New compounds |
| JO3019B1 (ar) * | 2006-04-19 | 2016-09-05 | Janssen Pharmaceutica Nv | ثلاثي مستبدل 4،2،1-ثلاثي زولات |
| DE602007009085D1 (de) | 2006-05-12 | 2010-10-21 | Ab Science | Neues verfahren zur synthese von 2-aminooxazolverbindungen |
| FR2901273B1 (fr) * | 2006-05-19 | 2010-12-24 | Anaconda Pharma | Inhibiteurs du virus du papillome humain et les compositions pharmaceutiques les contenant |
| WO2008090181A1 (en) * | 2007-01-23 | 2008-07-31 | Palau Pharma, S. A. | Purine derivatives |
| EP2121675A1 (en) * | 2007-02-22 | 2009-11-25 | Irm Llc | Thiazole derivatives as modulators of g protein-coupled receptors |
| GB0709031D0 (en) * | 2007-05-10 | 2007-06-20 | Sareum Ltd | Pharmaceutical compounds |
| WO2010005841A1 (en) * | 2008-07-09 | 2010-01-14 | Merck & Co., Inc. | Inhibitors of janus kinases |
| JP2012180281A (ja) * | 2009-06-29 | 2012-09-20 | Dainippon Sumitomo Pharma Co Ltd | 新規オキサジアゾール誘導体 |
| AP2011006034A0 (en) * | 2009-07-15 | 2011-12-31 | Janssen Pharmaceuticals Inc | Substituted triazole and imidazole derivatives as gamma secretase modulators. |
| EP2499282B1 (en) * | 2009-11-09 | 2015-04-22 | NeuroGenetic Pharmaceuticals, Inc. | Gamma-secretase modulatory compounds, methods for identifying same, and uses therefor |
| AR079993A1 (es) * | 2010-01-12 | 2012-03-07 | Ab Science | Derivados de azol, composiciones farmaceuticas y sus usos para tratar trastornos mediados por una sobreactividad de quinasas |
| GB201012105D0 (en) | 2010-07-19 | 2010-09-01 | Domainex Ltd | Novel pyrimidine compounds |
| EP2616443A1 (en) * | 2010-09-14 | 2013-07-24 | Exelixis, Inc. | Phtalazine derivatives as jak1 inhibitors |
| US20120129843A1 (en) * | 2010-11-18 | 2012-05-24 | Yan Zhang | Pyridyl-thiazolyl inhibitors of pro-matrix metalloproteinase activation |
| WO2012162461A1 (en) * | 2011-05-25 | 2012-11-29 | Janssen Pharmaceutica Nv | Phenyl-thiazolyl inhibitors of pro-matrix metalloproteinase activation |
| EP2714667B1 (en) * | 2011-05-27 | 2020-11-25 | Laxman S. DESAI | Aminooxazole inhibitors of cyclin dependent kinases |
| KR101924247B1 (ko) * | 2011-07-27 | 2019-02-22 | 에이비 사이언스 | 선택적 프로테인 키나제 저해제로서 옥사졸 및 티아졸 유도체 |
| KR101896035B1 (ko) * | 2011-08-23 | 2018-09-07 | 덕산네오룩스 주식회사 | 유기전기소자용 신규 화합물, 이를 이용하는 유기전기소자 및 그 단말 |
| CN103436048B (zh) * | 2013-08-08 | 2014-12-03 | 陕西师范大学 | 硫脲供体双桥链有机染料及其应用 |
| US20150045353A1 (en) * | 2013-08-09 | 2015-02-12 | Neurogenetic Pharmaceuticals, Inc. | Formulations containing gamma secretase modulators, methods for preparation and delivery thereof |
| RU2016139031A (ru) * | 2014-03-24 | 2018-04-25 | Аб Сьянс | Производные оксазола, замещенные диазаспироалкалоном, в качестве ингибиторов тирозинкиназы селезенки |
| EP3144307A1 (en) * | 2015-09-18 | 2017-03-22 | AB Science | Novel oxazole derivatives that inhibit syk |
-
2015
- 2015-02-05 EP EP15154028.3A patent/EP3053920B1/en active Active
- 2015-02-05 ES ES15154028T patent/ES2796276T3/es active Active
-
2016
- 2016-02-05 AU AU2016214283A patent/AU2016214283B2/en active Active
- 2016-02-05 MX MX2017010157A patent/MX377742B/es active IP Right Grant
- 2016-02-05 BR BR112017016883-9A patent/BR112017016883B1/pt active IP Right Grant
- 2016-02-05 AR ARP160100337A patent/AR103629A1/es unknown
- 2016-02-05 ES ES16703138T patent/ES2905412T3/es active Active
- 2016-02-05 CA CA2975644A patent/CA2975644C/en active Active
- 2016-02-05 DK DK16703138.4T patent/DK3253749T3/da active
- 2016-02-05 HU HUE16703138A patent/HUE059063T2/hu unknown
- 2016-02-05 RS RS20220136A patent/RS62901B1/sr unknown
- 2016-02-05 WO PCT/EP2016/052523 patent/WO2016124747A1/en not_active Ceased
- 2016-02-05 EP EP16703138.4A patent/EP3253749B1/en active Active
- 2016-02-05 JP JP2017539023A patent/JP6713000B2/ja active Active
- 2016-02-05 LT LTEPPCT/EP2016/052523T patent/LT3253749T/lt unknown
- 2016-02-05 CN CN201680008641.9A patent/CN107531685B/zh active Active
- 2016-02-05 RU RU2017127484A patent/RU2758259C2/ru not_active Application Discontinuation
- 2016-02-05 US US15/548,451 patent/US10570122B2/en active Active
- 2016-02-05 KR KR1020177022077A patent/KR102544132B1/ko active Active
- 2016-02-05 PT PT167031384T patent/PT3253749T/pt unknown
- 2016-02-05 PL PL16703138T patent/PL3253749T3/pl unknown
- 2016-02-05 TW TW105103940A patent/TWI748938B/zh not_active IP Right Cessation
- 2016-02-05 HR HRP20220114TT patent/HRP20220114T1/hr unknown
-
2017
- 2017-08-01 IL IL253779A patent/IL253779A0/en active IP Right Grant
- 2017-08-15 ZA ZA201705537A patent/ZA201705537B/en unknown
-
2022
- 2022-02-02 CY CY20221100089T patent/CY1124948T1/el unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP7390415B2 (ja) | ニューロキニン-1受容体アンタゴニストとしての化合物およびその使用 | |
| US10105359B2 (en) | Tetrahydroisoquinoline derivatives | |
| CN105073738B (zh) | 作为钠通道调节剂的喹啉及喹喔啉酰胺类 | |
| JP6713000B2 (ja) | 抗腫瘍活性を有する化合物 | |
| CA2973773C (en) | 2-phenyl-3h-imidazo[4,5-b]pyridine derivatives useful as inhibitors of mammalian tyrosine kinase ror1 activity | |
| JP2018504415A5 (cg-RX-API-DMAC7.html) | ||
| CA3104521A1 (en) | Pikfyve inhibitors | |
| CA2943824A1 (en) | Inhibitors of histone demethylases | |
| JP2022019812A (ja) | MEK/PI3K及びmTOR/MEK/PI3K生物学的経路の多官能性阻害剤、並びに同多官能性阻害剤を用いた治療方法 | |
| BR112019022553A2 (pt) | novo derivado de tetrahidronaftil ureia | |
| US20180202388A1 (en) | Piston for an internal combustion engine and method for producing the piston for an internal combustion engine | |
| JP2025529797A (ja) | 複素環rbm39モジュレーター | |
| CA2943316A1 (en) | Diazaspiroalkaneone-substituted oxazole derivatives as spleen tyrosine kinase inhibitors | |
| JP2025535057A (ja) | フェニルオキシアミドキナーゼ阻害剤 | |
| TR201807174T4 (tr) | Kırılgan x sendromu, parkinson veya reflü hastalığının tedavisinde faydalı diazepinon türevleri. | |
| JP2024512024A (ja) | Lrrk2キナーゼ阻害剤として有用なピリミジン誘導体 | |
| HK1225031A1 (en) | Compounds with anti-tumoral activity | |
| HK1225031A (en) | Compounds with anti-tumoral activity | |
| HK1243700B (en) | Compounds with anti-tumoral activity |