JP2004500355A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2004500355A5 JP2004500355A5 JP2001541871A JP2001541871A JP2004500355A5 JP 2004500355 A5 JP2004500355 A5 JP 2004500355A5 JP 2001541871 A JP2001541871 A JP 2001541871A JP 2001541871 A JP2001541871 A JP 2001541871A JP 2004500355 A5 JP2004500355 A5 JP 2004500355A5
- Authority
- JP
- Japan
- Prior art keywords
- substituted
- embedded image
- alkyl
- alkenyl
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 125000000217 alkyl group Chemical group 0.000 description 22
- 125000003342 alkenyl group Chemical group 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 11
- 239000012453 solvate Substances 0.000 description 11
- -1 methylenedioxy Chemical group 0.000 description 9
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000008194 pharmaceutical composition Substances 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 5
- 125000001072 heteroaryl group Chemical group 0.000 description 5
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 239000002207 metabolite Substances 0.000 description 5
- 239000000651 prodrug Substances 0.000 description 5
- 229940002612 prodrug Drugs 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 0 CCC1=CC(*S(N(CCCC2)C2C(OC(COCc2ccccc2)COCc2ccccc2)=O)(=O)=O)=CC=CC1 Chemical compound CCC1=CC(*S(N(CCCC2)C2C(OC(COCc2ccccc2)COCc2ccccc2)=O)(=O)=O)=CC=CC1 0.000 description 4
- 208000012902 Nervous system disease Diseases 0.000 description 4
- 208000006011 Stroke Diseases 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 230000001537 neural effect Effects 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 201000004384 Alopecia Diseases 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 208000006373 Bell palsy Diseases 0.000 description 2
- 208000026139 Memory disease Diseases 0.000 description 2
- 208000028389 Nerve injury Diseases 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 208000036826 VIIth nerve paralysis Diseases 0.000 description 2
- 208000013521 Visual disease Diseases 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 208000028867 ischemia Diseases 0.000 description 2
- 201000006417 multiple sclerosis Diseases 0.000 description 2
- 201000006938 muscular dystrophy Diseases 0.000 description 2
- 206010028417 myasthenia gravis Diseases 0.000 description 2
- 230000008764 nerve damage Effects 0.000 description 2
- 208000004296 neuralgia Diseases 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 208000020431 spinal cord injury Diseases 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 108010025020 Nerve Growth Factor Proteins 0.000 description 1
- 102000007072 Nerve Growth Factors Human genes 0.000 description 1
- 231100000360 alopecia Toxicity 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 208000024963 hair loss Diseases 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 210000002161 motor neuron Anatomy 0.000 description 1
- 208000005264 motor neuron disease Diseases 0.000 description 1
- 239000003900 neurotrophic factor Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- GJVFBWCTGUSGDD-UHFFFAOYSA-L pentamethonium bromide Chemical compound [Br-].[Br-].C[N+](C)(C)CCCCC[N+](C)(C)C GJVFBWCTGUSGDD-UHFFFAOYSA-L 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000001228 trophic effect Effects 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16824699P | 1999-12-01 | 1999-12-01 | |
| PCT/US2000/032679 WO2001040185A1 (en) | 1999-12-01 | 2000-12-01 | Compounds, compositions, and methods for stimulating neuronal growth and elongation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2004500355A JP2004500355A (ja) | 2004-01-08 |
| JP2004500355A5 true JP2004500355A5 (https=) | 2008-01-10 |
Family
ID=22610717
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2001541871A Abandoned JP2004500355A (ja) | 1999-12-01 | 2000-12-01 | ニューロンの生長及び伸長を刺激する化合物、組成物及び方法 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US6544987B2 (https=) |
| EP (1) | EP1237869A1 (https=) |
| JP (1) | JP2004500355A (https=) |
| AR (1) | AR029411A1 (https=) |
| AU (1) | AU1810001A (https=) |
| BR (1) | BR0016150A (https=) |
| CA (1) | CA2389368A1 (https=) |
| CO (1) | CO5261615A1 (https=) |
| DO (1) | DOP2000000107A (https=) |
| GT (1) | GT200000203A (https=) |
| HK (1) | HK1048987A1 (https=) |
| HN (1) | HN2000000268A (https=) |
| MX (1) | MXPA02005510A (https=) |
| PA (1) | PA8508001A1 (https=) |
| PE (1) | PE20011101A1 (https=) |
| SV (1) | SV2002000233A (https=) |
| UY (1) | UY26464A1 (https=) |
| WO (1) | WO2001040185A1 (https=) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7405234B2 (en) * | 2002-05-17 | 2008-07-29 | Bristol-Myers Squibb Company | Bicyclic modulators of androgen receptor function |
| WO2004045518A2 (en) | 2002-11-15 | 2004-06-03 | Bristol-Myers Squibb Company | Open chain prolyl urea-related modulators of androgen receptor function |
| US7820702B2 (en) * | 2004-02-04 | 2010-10-26 | Bristol-Myers Squibb Company | Sulfonylpyrrolidine modulators of androgen receptor function and method |
| US7388027B2 (en) * | 2004-03-04 | 2008-06-17 | Bristol-Myers Squibb Company | Bicyclic compounds as modulators of androgen receptor function and method |
| US8354427B2 (en) * | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| LT2502911T (lt) | 2004-06-24 | 2017-09-11 | Vertex Pharmaceuticals Incorporated | Atp surišančios kasetės transporterių moduliatoriai |
| US7544171B2 (en) * | 2004-10-22 | 2009-06-09 | General Patent Llc | Methods for promoting nerve regeneration and neuronal growth and elongation |
| US7988648B2 (en) * | 2005-03-04 | 2011-08-02 | General Patent, Llc | Pancreas regeneration treatment for diabetics using extracorporeal acoustic shock waves |
| WO2006106423A2 (en) * | 2005-04-07 | 2006-10-12 | Pfizer Inc. | Amino sulfonyl derivatives as inhibitors of human 11-.beta.-hydrosysteroid dehydrogenase |
| EA013909B1 (ru) | 2005-09-09 | 2010-08-30 | Смитклайн Бичам Корпорейшн | Пиридиновые производные и их применение для лечения психотических расстройств |
| US7419394B2 (en) * | 2005-11-11 | 2008-09-02 | Rockwell Automation Technologies, Inc. | Electrical system having withdrawable unit with maintained control and communication connection |
| CA2634113A1 (en) * | 2005-12-24 | 2007-07-05 | Vertex Pharmaceuticals Incorporated | Quinolin- 4 - one derivatives as modulators of abc transporters |
| WO2007079139A2 (en) | 2005-12-28 | 2007-07-12 | Vertex Pharmaceuticals, Inc. | Solid forms of n-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| CN101569864B (zh) * | 2008-04-29 | 2011-08-03 | 中山大学 | 手性磺胺类有机小分子催化剂及其应用 |
| US12458635B2 (en) | 2008-08-13 | 2025-11-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| SI2408750T1 (sl) | 2009-03-20 | 2015-11-30 | Vertex Pharmaceuticals Incorporated | Postopek za izdelavo modulatorjev cistično-fibroznega transmembranskega regulatorja prevodnosti |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| EP2819670A1 (en) | 2012-02-27 | 2015-01-07 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administration thereof |
| KR20170063954A (ko) | 2014-10-07 | 2017-06-08 | 버텍스 파마슈티칼스 인코포레이티드 | 낭성 섬유증 막횡단 전도도 조절자의 조정제의 공-결정 |
| US11458069B2 (en) | 2016-04-18 | 2022-10-04 | Softwave Tissue Regeneration Technologies, Llc | Acoustic shock wave therapeutic methods to treat medical conditions using reflexology zones |
| US11389371B2 (en) | 2018-05-21 | 2022-07-19 | Softwave Tissue Regeneration Technologies, Llc | Acoustic shock wave therapeutic methods |
| US11389372B2 (en) | 2016-04-18 | 2022-07-19 | Softwave Tissue Regeneration Technologies, Llc | Acoustic shock wave therapeutic methods |
| US11389373B2 (en) | 2016-04-18 | 2022-07-19 | Softwave Tissue Regeneration Technologies, Llc | Acoustic shock wave therapeutic methods to prevent or treat opioid addiction |
| US11389370B2 (en) | 2016-04-18 | 2022-07-19 | Softwave Tissue Regeneration Technologies, Llc | Treatments for blood sugar levels and muscle tissue optimization using extracorporeal acoustic shock waves |
| HUE064664T2 (hu) * | 2018-01-30 | 2024-04-28 | Univ Texas | Pipekolinsav-észterek a proteaszóma gátlására |
| US20240327392A1 (en) * | 2021-06-25 | 2024-10-03 | Albius Sciences Alpha Private Limited | Heterocycloalkyl-substituted polyheteroazole derivatives as medicaments for treating and/or preventing rs virus infections |
| US12402898B2 (en) | 2023-01-27 | 2025-09-02 | Softwave Tissue Regeneration Technologies, Llc | Acoustic shock wave or pressure pulse treatment for proptosis or exophthalmos |
Family Cites Families (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3587308T2 (de) | 1984-12-20 | 1993-08-19 | Upjohn Co | Monobactame. |
| US5192773A (en) | 1990-07-02 | 1993-03-09 | Vertex Pharmaceuticals, Inc. | Immunosuppressive compounds |
| US5244905A (en) | 1990-08-31 | 1993-09-14 | Warner-Lambert Company | N-substituted cycloalkyl and polycycloalkyl polyhydro-β-carboline-phenylalanine- and phenethylamine derivatives |
| US5219851A (en) | 1991-03-05 | 1993-06-15 | Warner-Lambert Company | Tetrahydroisoquinoline-type renin inhibiting peptides |
| DE4141218A1 (de) | 1991-12-13 | 1993-06-17 | Luitpold Werk Chem Pharm | Thiadiazincarbonsaeureamidderivate, verfahren zu ihrer herstellung und arzneimittel |
| DE4217719A1 (de) | 1992-05-29 | 1993-12-02 | Bayer Ag | Zweifach heterocyclisch substituierte Sulfonylamino(thio)carbonylverbindungen |
| US5798355A (en) | 1995-06-07 | 1998-08-25 | Gpi Nil Holdings, Inc. | Inhibitors of rotamase enzyme activity |
| US5612350A (en) | 1993-11-30 | 1997-03-18 | Abbott Laboratories | Macrocyclic immunomodulators with novel cyclohexyl ring replacements |
| US5494925A (en) | 1994-12-02 | 1996-02-27 | Sterling Winthrop Inc. | 2-heterocyclyloxymethyl and 2-heterocyclylthiomethyl-1,2,5-thiadiazolidin-3-one 1,1-dioxides and compositions and method of use thereof |
| US5556909A (en) | 1994-12-02 | 1996-09-17 | Sanofi Winthrop Inc. | Substituted 2-arylcarbonyloxymethyl-1,2,5-thiadiazolidin-3-one 1,1-dioxide derivatives and compositions and method of use thereof |
| US5541168A (en) | 1994-12-02 | 1996-07-30 | Sterling Winthrop Inc. | Substituted 2-(phosphinyloxymethyl)-1,2,5-thiadiazolidin-3-one 1,1-dioxides and compositions and method of use thereof |
| US5859031A (en) | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| US5696135A (en) | 1995-06-07 | 1997-12-09 | Gpi Nil Holdings, Inc. | Inhibitors of rotamase enzyme activity effective at stimulating neuronal growth |
| US5614547A (en) | 1995-06-07 | 1997-03-25 | Guilford Pharmaceuticals Inc. | Small molecule inhibitors of rotamase enzyme |
| US6037370A (en) | 1995-06-08 | 2000-03-14 | Vertex Pharmaceuticals Incorporated | Methods and compositions for stimulating neurite growth |
| GB9521322D0 (en) | 1995-10-17 | 1995-12-20 | Sandoz Ltd | Organic compounds |
| US5801197A (en) | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| DE19542189A1 (de) | 1995-11-13 | 1997-05-15 | Hoechst Ag | Cyclische N-substituierte alpha-Iminohydroxamsäuren |
| US6207672B1 (en) | 1995-11-13 | 2001-03-27 | Aventis Pharma Deutschland Gmbh | Cyclic and heterocyclic N-substituted α-iminohydroxamic and carboxyclic acids |
| US5801187A (en) | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| US5786378A (en) | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| US5874449A (en) | 1996-12-31 | 1999-02-23 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of heterocyclic thioesters |
| US5935989A (en) | 1996-12-31 | 1999-08-10 | Gpi Nil Holdings Inc. | N-linked ureas and carbamates of heterocyclic thioesters |
| PL334846A1 (en) | 1997-01-23 | 2000-03-27 | Hoffmann La Roche | Sulphamidic inhibitors of metaloproteases |
| US5721256A (en) * | 1997-02-12 | 1998-02-24 | Gpi Nil Holdings, Inc. | Method of using neurotrophic sulfonamide compounds |
| ZA98825B (en) | 1997-02-27 | 1998-10-19 | Guilford Pharm Inc | Method of using neurotrophic carbamates and ureas |
| US5846979A (en) | 1997-02-28 | 1998-12-08 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic esters, amides, thioesters, and ketones |
| GB9804426D0 (en) * | 1998-03-02 | 1998-04-29 | Pfizer Ltd | Heterocycles |
| US6121280A (en) | 1998-03-24 | 2000-09-19 | Pfizer Inc. | Azabicyclic rotomase inhibitors |
| WO1999062511A1 (en) | 1998-06-02 | 1999-12-09 | Bristol-Myers Squibb Company | Neurotrophic difluoroamide agents |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| GB9815880D0 (en) | 1998-07-21 | 1998-09-16 | Pfizer Ltd | Heterocycles |
| CN1310629A (zh) | 1998-07-21 | 2001-08-29 | 沃尼尔·朗伯公司 | 用于治疗动脉粥样硬化损伤的acat和mmp抑制剂的合并给药 |
| HUP0300719A2 (hu) | 1998-09-18 | 2003-11-28 | Amgen, Inc. | Áthidalt heterociklusos vegyületek, ezeket tartalmazó gyógyszerkészítmények és alkalmazásuk |
| WO2000046181A1 (en) | 1999-02-03 | 2000-08-10 | Schering Aktiengesellschaft | Carboxylic acid derivatives, process for their preparation and their use as rotamase enzyme activity inhibitors |
-
2000
- 2000-11-30 DO DO2000000107A patent/DOP2000000107A/es unknown
- 2000-11-30 CO CO00091748A patent/CO5261615A1/es not_active Application Discontinuation
- 2000-11-30 GT GT200000203A patent/GT200000203A/es unknown
- 2000-12-01 PE PE2000001288A patent/PE20011101A1/es not_active Application Discontinuation
- 2000-12-01 HN HN2000000268A patent/HN2000000268A/es unknown
- 2000-12-01 HK HK03100726.8A patent/HK1048987A1/zh unknown
- 2000-12-01 JP JP2001541871A patent/JP2004500355A/ja not_active Abandoned
- 2000-12-01 BR BR0016150-0A patent/BR0016150A/pt not_active Application Discontinuation
- 2000-12-01 UY UY26464A patent/UY26464A1/es not_active Application Discontinuation
- 2000-12-01 EP EP00980901A patent/EP1237869A1/en not_active Withdrawn
- 2000-12-01 CA CA002389368A patent/CA2389368A1/en not_active Abandoned
- 2000-12-01 WO PCT/US2000/032679 patent/WO2001040185A1/en not_active Ceased
- 2000-12-01 AR ARP000106371A patent/AR029411A1/es not_active Application Discontinuation
- 2000-12-01 MX MXPA02005510A patent/MXPA02005510A/es active IP Right Grant
- 2000-12-01 US US09/726,314 patent/US6544987B2/en not_active Expired - Fee Related
- 2000-12-01 PA PA20008508001A patent/PA8508001A1/es unknown
- 2000-12-01 AU AU18100/01A patent/AU1810001A/en not_active Abandoned
- 2000-12-01 SV SV2000000233A patent/SV2002000233A/es unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2004500355A5 (https=) | ||
| WO2001040185B1 (en) | Compounds, compositions, and methods for stimulating neuronal growth and elongation | |
| ES2308839T3 (es) | Amidas n,n-disustituidas que inhiben la union de integrinas a sus receptores. | |
| ES2197152T3 (es) | Opiaceos de diarilmetilpiperacinas y piperidinas. | |
| CY1109273T1 (el) | Ενωσεις πιπεριδινης και φαρμακευτικες συνθεσεις που τις περιεχουν | |
| JP2002539128A5 (https=) | ||
| RU2007101685A (ru) | Модуляторы никотиновых ацетилхолиновых рецепторов альфа 7 и их терапевтические применения | |
| RU2005103244A (ru) | Производные 1h-1,2,4-триазол-3-карбоксамида в качестве лигандов рецептора каннабиноидов (cb1) | |
| JP2003529596A5 (https=) | ||
| RU2004107131A (ru) | Новые производные 4,5-дигидро-1h-пиразола, имеющие cb1- антагонистическую активность | |
| JP2012504133A5 (https=) | ||
| JP2003531821A5 (https=) | ||
| WO2005113537B1 (en) | Urea antagonists of p2y1 receptor useful in the treatment of thrombotic conditions | |
| RU2006116889A (ru) | Производные n-гетероциклилметилбензамидов, их получение и их применение в терапии | |
| JP2004533444A5 (https=) | ||
| WO2005056524A3 (en) | Therapeutic agents useful for treating pain | |
| EA200300424A1 (ru) | Соли изотиазол-4-карбоксамида и их применение в качестве антигиперпролиферативных агентов | |
| ATE403426T1 (de) | Opioid-rezeptor-aktive 4-(3-hydroxyphenyl) oder 4-(3-alkoxyphenyl)-1,2,4-triazol-verbindungen | |
| RU2015121044A (ru) | Производные фенилэтилпиридина в качестве ингибиторов pde4 | |
| RU2002133458A (ru) | Соединения пиперазина и пиперидина | |
| RU2007128085A (ru) | Соли четвертичного аммония в качестве антагонистов м3 | |
| RU2003131970A (ru) | Производные 4-(фенил-пиперидин-4-илиден-метил)-бензамида и их применение для лечения боли, тревоги или желудочно-кишечных расстройств | |
| JP2003516994A5 (https=) | ||
| JP2003529597A5 (https=) | ||
| RU2007128080A (ru) | Производные пирролидиния в качестве мускариновых рецепторов мз |