JP2002530389A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2002530389A5 JP2002530389A5 JP2000583879A JP2000583879A JP2002530389A5 JP 2002530389 A5 JP2002530389 A5 JP 2002530389A5 JP 2000583879 A JP2000583879 A JP 2000583879A JP 2000583879 A JP2000583879 A JP 2000583879A JP 2002530389 A5 JP2002530389 A5 JP 2002530389A5
- Authority
- JP
- Japan
- Prior art keywords
- stent device
- poly
- amine
- dimethoxy
- bicyclo
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 heteroaryloxySi Chemical group 0.000 description 23
- 238000000576 coating method Methods 0.000 description 14
- 239000011248 coating agent Substances 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 10
- 150000001875 compounds Chemical class 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000002861 polymer material Substances 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229920000052 poly(p-xylylene) Polymers 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 125000004423 acyloxy group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000000975 bioactive effect Effects 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229920001451 polypropylene glycol Polymers 0.000 description 4
- 229920001296 polysiloxane Polymers 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000005844 heterocyclyloxy group Chemical group 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical group CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 description 2
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical group C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- VLGMELKIRGCWAA-XYPYZODXSA-N COc1cc2ncc(O[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC Chemical compound COc1cc2ncc(O[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC VLGMELKIRGCWAA-XYPYZODXSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- ZFGMDIBRIDKWMY-PASTXAENSA-N heparin Chemical compound CC(O)=N[C@@H]1[C@@H](O)[C@H](O)[C@@H](COS(O)(=O)=O)O[C@@H]1O[C@@H]1[C@@H](C(O)=O)O[C@@H](O[C@H]2[C@@H]([C@@H](OS(O)(=O)=O)[C@@H](O[C@@H]3[C@@H](OC(O)[C@H](OS(O)(=O)=O)[C@H]3O)C(O)=O)O[C@@H]2O)CS(O)(=O)=O)[C@H](O)[C@H]1O ZFGMDIBRIDKWMY-PASTXAENSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- FTXKUBNATJTYSH-UHFFFAOYSA-N methyl 4-[(6,7-dimethoxyquinoxalin-2-yl)amino]cyclohexane-1-carboxylate Chemical compound C1CC(C(=O)OC)CCC1NC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 FTXKUBNATJTYSH-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 229920001432 poly(L-lactide) Polymers 0.000 description 2
- 229920002627 poly(phosphazenes) Polymers 0.000 description 2
- 229920001610 polycaprolactone Polymers 0.000 description 2
- 239000004632 polycaprolactone Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 208000037803 restenosis Diseases 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- KIUKXJAPPMFGSW-DNGZLQJQSA-N (2S,3S,4S,5R,6R)-6-[(2S,3R,4R,5S,6R)-3-Acetamido-2-[(2S,3S,4R,5R,6R)-6-[(2R,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-2-carboxy-4,5-dihydroxyoxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@H](O3)C(O)=O)O)[C@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](C(O)=O)O1 KIUKXJAPPMFGSW-DNGZLQJQSA-N 0.000 description 1
- MYWOJODOMFBVCB-UHFFFAOYSA-N 1,2,6-trimethylphenanthrene Chemical compound CC1=CC=C2C3=CC(C)=CC=C3C=CC2=C1C MYWOJODOMFBVCB-UHFFFAOYSA-N 0.000 description 1
- ICGQLNMKJVHCIR-UHFFFAOYSA-N 1,3,2-dioxazetidin-4-one Chemical compound O=C1ONO1 ICGQLNMKJVHCIR-UHFFFAOYSA-N 0.000 description 1
- QYCGBAJADAGLLK-UHFFFAOYSA-N 1-(cyclohepten-1-yl)cycloheptene Chemical group C1CCCCC=C1C1=CCCCCC1 QYCGBAJADAGLLK-UHFFFAOYSA-N 0.000 description 1
- VJIOUBTXSNPMNO-UHFFFAOYSA-N 2,7-dicyclohexyloxy-6-methoxyquinoxaline Chemical compound N1=C2C=C(OC3CCCCC3)C(OC)=CC2=NC=C1OC1CCCCC1 VJIOUBTXSNPMNO-UHFFFAOYSA-N 0.000 description 1
- UBIZPJMDFPWKAR-UHFFFAOYSA-N 2-(5-bicyclo[2.2.1]hept-2-enyloxy)-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1C(C=C2)CC2C1 UBIZPJMDFPWKAR-UHFFFAOYSA-N 0.000 description 1
- GRBVFGKKVXWZII-UHFFFAOYSA-N 2-(cyclopentylmethoxy)-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OCC1CCCC1 GRBVFGKKVXWZII-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- BEFUAVPFBGOHKT-UHFFFAOYSA-N 2-cyclohexyloxy-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1CCCCC1 BEFUAVPFBGOHKT-UHFFFAOYSA-N 0.000 description 1
- CSLYLUOENYVUID-UHFFFAOYSA-N 2-cyclopentyloxy-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1OC1CCCC1 CSLYLUOENYVUID-UHFFFAOYSA-N 0.000 description 1
- ZHAMQTUXCPUZFN-UHFFFAOYSA-N 2-cyclopentylsulfanyl-6,7-dimethoxyquinoxaline Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1SC1CCCC1 ZHAMQTUXCPUZFN-UHFFFAOYSA-N 0.000 description 1
- GWZMWHWAWHPNHN-UHFFFAOYSA-N 2-hydroxypropyl prop-2-enoate Chemical compound CC(O)COC(=O)C=C GWZMWHWAWHPNHN-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- OMHPHFWGEQHURJ-UHFFFAOYSA-N 6,7-dimethoxy-2-(4-methoxycyclohexyl)oxyquinoxaline Chemical compound C1CC(OC)CCC1OC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 OMHPHFWGEQHURJ-UHFFFAOYSA-N 0.000 description 1
- YEAUGSGQDBWJFI-UHFFFAOYSA-N 6,7-dimethoxy-n-(4-methoxycyclohexyl)quinoxalin-2-amine Chemical compound C1CC(OC)CCC1NC1=CN=C(C=C(OC)C(OC)=C2)C2=N1 YEAUGSGQDBWJFI-UHFFFAOYSA-N 0.000 description 1
- SAPGBCWOQLHKKZ-UHFFFAOYSA-N 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C SAPGBCWOQLHKKZ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 229920002126 Acrylic acid copolymer Polymers 0.000 description 1
- JNMIZMOJWOWVMI-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)Br.Cl Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)Br.Cl JNMIZMOJWOWVMI-UHFFFAOYSA-N 0.000 description 1
- BSNPPAQPTUSCIM-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)OC Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)NC3CCCCC3)OC BSNPPAQPTUSCIM-UHFFFAOYSA-N 0.000 description 1
- RGDIEMDLYDBGAY-UHFFFAOYSA-N COC1=C(C=C2C(=C1)C=CC(=N2)OC3CC4CCC3CC4)OC Chemical compound COC1=C(C=C2C(=C1)C=CC(=N2)OC3CC4CCC3CC4)OC RGDIEMDLYDBGAY-UHFFFAOYSA-N 0.000 description 1
- JDHYKJFPZBYRDS-XYPYZODXSA-N COc1cc2ncc(N[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC Chemical compound COc1cc2ncc(N[C@H]3CC[C@@H](CC3)C(O)=O)nc2cc1OC JDHYKJFPZBYRDS-XYPYZODXSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920000298 Cellophane Polymers 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 102000009123 Fibrin Human genes 0.000 description 1
- 108010073385 Fibrin Proteins 0.000 description 1
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
- 102000008946 Fibrinogen Human genes 0.000 description 1
- 108010049003 Fibrinogen Proteins 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- MWCLLHOVUTZFKS-UHFFFAOYSA-N Methyl cyanoacrylate Chemical compound COC(=O)C(=C)C#N MWCLLHOVUTZFKS-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229920001244 Poly(D,L-lactide) Polymers 0.000 description 1
- 229920001054 Poly(ethylene‐co‐vinyl acetate) Polymers 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920000331 Polyhydroxybutyrate Polymers 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 230000003143 atherosclerotic effect Effects 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical group CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000005026 carboxyaryl group Chemical group 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 229920006213 ethylene-alphaolefin copolymer Polymers 0.000 description 1
- 229950003499 fibrin Drugs 0.000 description 1
- 229940012952 fibrinogen Drugs 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 229920002674 hyaluronan Polymers 0.000 description 1
- 229960003160 hyaluronic acid Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 1
- 229960000448 lactic acid Drugs 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 description 1
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FVMOLSMWWNSWLX-UHFFFAOYSA-N n-(3-bicyclo[2.2.1]heptanyl)-6,7-dimethylquinoxalin-2-amine Chemical compound N1=C2C=C(C)C(C)=CC2=NC=C1NC1C(C2)CCC2C1 FVMOLSMWWNSWLX-UHFFFAOYSA-N 0.000 description 1
- WDTKJTQWHUMMDU-WOPDTQHZSA-N n-[(1r,3s,4s)-3-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(N[C@@H]3[C@@]4([H])CC[C@](C4)(C3)[H])=CN=C21 WDTKJTQWHUMMDU-WOPDTQHZSA-N 0.000 description 1
- WDTKJTQWHUMMDU-QJPTWQEYSA-N n-[(1s,3r,4r)-3-bicyclo[2.2.1]heptanyl]-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(N[C@H]3[C@]4([H])CC[C@@](C4)(C3)[H])=CN=C21 WDTKJTQWHUMMDU-QJPTWQEYSA-N 0.000 description 1
- NXGYOWSWPPHJLL-UHFFFAOYSA-N n-[(6,7-dimethoxyquinoxalin-2-yl)methyl]cyclohexanamine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1CNC1CCCCC1 NXGYOWSWPPHJLL-UHFFFAOYSA-N 0.000 description 1
- YFZQPHGDRHSTGB-UHFFFAOYSA-N n-cycloheptyl-6,7-dimethoxyquinoxalin-2-amine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1NC1CCCCCC1 YFZQPHGDRHSTGB-UHFFFAOYSA-N 0.000 description 1
- HFYHDNNINOTPHW-UHFFFAOYSA-N n-cyclohexyl-6,8-dimethylquinoxalin-2-amine Chemical compound C1=NC2=CC(C)=CC(C)=C2N=C1NC1CCCCC1 HFYHDNNINOTPHW-UHFFFAOYSA-N 0.000 description 1
- RHZYQTPCJHEBKB-UHFFFAOYSA-N n-cyclohexyl-6-methoxy-7-morpholin-4-ylquinoxalin-2-amine Chemical compound N1=C2C=C(N3CCOCC3)C(OC)=CC2=NC=C1NC1CCCCC1 RHZYQTPCJHEBKB-UHFFFAOYSA-N 0.000 description 1
- CFAAOOAZIREBHB-UHFFFAOYSA-N n-cyclohexyl-6-methoxyquinoxalin-2-amine Chemical compound C1=NC2=CC(OC)=CC=C2N=C1NC1CCCCC1 CFAAOOAZIREBHB-UHFFFAOYSA-N 0.000 description 1
- FBCVQPSZSMHQGK-UHFFFAOYSA-N n-cyclopentyl-6,7-dimethoxyquinoxalin-2-amine Chemical compound N1=C2C=C(OC)C(OC)=CC2=NC=C1NC1CCCC1 FBCVQPSZSMHQGK-UHFFFAOYSA-N 0.000 description 1
- VBXDPTHXXPWTNC-UHFFFAOYSA-N n-heptan-2-yl-6,7-dimethoxyquinoxalin-2-amine Chemical compound C1=C(OC)C(OC)=CC2=NC(NC(C)CCCCC)=CN=C21 VBXDPTHXXPWTNC-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- NRNFFDZCBYOZJY-UHFFFAOYSA-N p-quinodimethane Chemical group C=C1C=CC(=C)C=C1 NRNFFDZCBYOZJY-UHFFFAOYSA-N 0.000 description 1
- 229920001308 poly(aminoacid) Polymers 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 239000005015 poly(hydroxybutyrate) Substances 0.000 description 1
- 229920001606 poly(lactic acid-co-glycolic acid) Polymers 0.000 description 1
- 239000002745 poly(ortho ester) Substances 0.000 description 1
- 229920002463 poly(p-dioxanone) polymer Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000622 polydioxanone Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920006216 polyvinyl aromatic Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 229920006214 polyvinylidene halide Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000002964 rayon Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000005415 substituted alkoxy group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005338 substituted cycloalkoxy group Chemical group 0.000 description 1
- YFHICDDUDORKJB-UHFFFAOYSA-N trimethylene carbonate Chemical compound O=C1OCCCO1 YFHICDDUDORKJB-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/198,718 | 1998-11-24 | ||
| US09/198,718 US6180632B1 (en) | 1997-05-28 | 1998-11-24 | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| PCT/US1999/027825 WO2000031051A1 (en) | 1998-11-24 | 1999-11-23 | Quinoline and quinoxaline compounds as pdgf-receptor and/or lck tyrosine kinase inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2002530389A JP2002530389A (ja) | 2002-09-17 |
| JP2002530389A5 true JP2002530389A5 (https=) | 2007-01-18 |
Family
ID=22734514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000583879A Pending JP2002530389A (ja) | 1998-11-24 | 1999-11-23 | キノリン又はキノキサリン化合物 |
Country Status (22)
| Country | Link |
|---|---|
| US (5) | US6180632B1 (https=) |
| EP (1) | EP1133480A1 (https=) |
| JP (1) | JP2002530389A (https=) |
| KR (1) | KR100784291B1 (https=) |
| CN (1) | CN100390154C (https=) |
| AU (1) | AU777256B2 (https=) |
| BG (1) | BG65497B1 (https=) |
| BR (1) | BR9915653A (https=) |
| CA (1) | CA2352261A1 (https=) |
| CZ (1) | CZ20012276A3 (https=) |
| EA (1) | EA007534B1 (https=) |
| EE (1) | EE200100280A (https=) |
| HU (1) | HUP0104605A3 (https=) |
| ID (1) | ID29611A (https=) |
| IL (1) | IL143406A0 (https=) |
| MX (1) | MXPA01005317A (https=) |
| NO (1) | NO319801B1 (https=) |
| NZ (1) | NZ512096A (https=) |
| PL (1) | PL348979A1 (https=) |
| SK (1) | SK9062001A3 (https=) |
| UA (1) | UA76935C2 (https=) |
| WO (1) | WO2000031051A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8778375B2 (en) | 2005-04-29 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Amorphous poly(D,L-lactide) coating |
Families Citing this family (185)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6776792B1 (en) * | 1997-04-24 | 2004-08-17 | Advanced Cardiovascular Systems Inc. | Coated endovascular stent |
| US6180632B1 (en) | 1997-05-28 | 2001-01-30 | Aventis Pharmaceuticals Products Inc. | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| CA2326777C (en) * | 1998-04-01 | 2011-12-20 | Nortran Pharmaceuticals Inc. | Aminocyclohexyl ether compounds and uses thereof |
| US6455734B1 (en) * | 2000-08-09 | 2002-09-24 | Magnesium Diagnostics, Inc. | Antagonists of the magnesium binding defect as therapeutic agents and methods for treatment of abnormal physiological states |
| US7507545B2 (en) | 1999-03-31 | 2009-03-24 | Cardiome Pharma Corp. | Ion channel modulating activity method |
| US6790228B2 (en) * | 1999-12-23 | 2004-09-14 | Advanced Cardiovascular Systems, Inc. | Coating for implantable devices and a method of forming the same |
| US7807211B2 (en) * | 1999-09-03 | 2010-10-05 | Advanced Cardiovascular Systems, Inc. | Thermal treatment of an implantable medical device |
| US20070032853A1 (en) * | 2002-03-27 | 2007-02-08 | Hossainy Syed F | 40-O-(2-hydroxy)ethyl-rapamycin coated stent |
| US20050238686A1 (en) * | 1999-12-23 | 2005-10-27 | Advanced Cardiovascular Systems, Inc. | Coating for implantable devices and a method of forming the same |
| US9522217B2 (en) | 2000-03-15 | 2016-12-20 | Orbusneich Medical, Inc. | Medical device with coating for capturing genetically-altered cells and methods for using same |
| US8088060B2 (en) * | 2000-03-15 | 2012-01-03 | Orbusneich Medical, Inc. | Progenitor endothelial cell capturing with a drug eluting implantable medical device |
| US20160287708A9 (en) * | 2000-03-15 | 2016-10-06 | Orbusneich Medical, Inc. | Progenitor Endothelial Cell Capturing with a Drug Eluting Implantable Medical Device |
| US20050271701A1 (en) * | 2000-03-15 | 2005-12-08 | Orbus Medical Technologies, Inc. | Progenitor endothelial cell capturing with a drug eluting implantable medical device |
| US6953560B1 (en) | 2000-09-28 | 2005-10-11 | Advanced Cardiovascular Systems, Inc. | Barriers for polymer-coated implantable medical devices and methods for making the same |
| US7057053B2 (en) * | 2000-10-06 | 2006-06-06 | Cardiome Pharma Corp. | Ion channel modulating compounds and uses thereof |
| US7524879B2 (en) * | 2000-10-06 | 2009-04-28 | Cardiome Pharma Corp. | Ion channel modulating compounds and uses thereof |
| US6783793B1 (en) * | 2000-10-26 | 2004-08-31 | Advanced Cardiovascular Systems, Inc. | Selective coating of medical devices |
| US7807210B1 (en) | 2000-10-31 | 2010-10-05 | Advanced Cardiovascular Systems, Inc. | Hemocompatible polymers on hydrophobic porous polymers |
| GB0100761D0 (en) * | 2001-01-11 | 2001-02-21 | Biocompatibles Ltd | Drug delivery from stents |
| US6780424B2 (en) | 2001-03-30 | 2004-08-24 | Charles David Claude | Controlled morphologies in polymer drug for release of drugs from polymer films |
| SK287686B6 (sk) * | 2001-04-10 | 2011-06-06 | Ciba Specialty Chemicals Holding Inc. | Izolačná kompozícia na strednonapäťové a vysokonapäťové káble a spôsob jej výroby |
| US6743462B1 (en) * | 2001-05-31 | 2004-06-01 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for coating implantable devices |
| US8741378B1 (en) | 2001-06-27 | 2014-06-03 | Advanced Cardiovascular Systems, Inc. | Methods of coating an implantable device |
| US6695920B1 (en) * | 2001-06-27 | 2004-02-24 | Advanced Cardiovascular Systems, Inc. | Mandrel for supporting a stent and a method of using the mandrel to coat a stent |
| US6565659B1 (en) * | 2001-06-28 | 2003-05-20 | Advanced Cardiovascular Systems, Inc. | Stent mounting assembly and a method of using the same to coat a stent |
| US7682669B1 (en) | 2001-07-30 | 2010-03-23 | Advanced Cardiovascular Systems, Inc. | Methods for covalently immobilizing anti-thrombogenic material into a coating on a medical device |
| US8303651B1 (en) * | 2001-09-07 | 2012-11-06 | Advanced Cardiovascular Systems, Inc. | Polymeric coating for reducing the rate of release of a therapeutic substance from a stent |
| US6753071B1 (en) * | 2001-09-27 | 2004-06-22 | Advanced Cardiovascular Systems, Inc. | Rate-reducing membrane for release of an agent |
| CA2478772C (en) * | 2002-03-11 | 2011-01-18 | Alcon, Inc. | Implantable drug delivery system |
| AUPS275302A0 (en) * | 2002-05-31 | 2002-06-27 | Khouri, Anthony | Vehicle mounted concrete mixing drum and method of manufacture thereof |
| US8506617B1 (en) | 2002-06-21 | 2013-08-13 | Advanced Cardiovascular Systems, Inc. | Micronized peptide coated stent |
| US6994867B1 (en) | 2002-06-21 | 2006-02-07 | Advanced Cardiovascular Systems, Inc. | Biocompatible carrier containing L-arginine |
| US7033602B1 (en) * | 2002-06-21 | 2006-04-25 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of coating implantable medical devices |
| US7070798B1 (en) | 2002-06-21 | 2006-07-04 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical devices incorporating chemically-bound polymers and oligomers of L-arginine |
| US7794743B2 (en) * | 2002-06-21 | 2010-09-14 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of making the same |
| US7217426B1 (en) | 2002-06-21 | 2007-05-15 | Advanced Cardiovascular Systems, Inc. | Coatings containing polycationic peptides for cardiovascular therapy |
| US7011842B1 (en) | 2002-06-21 | 2006-03-14 | Advanced Cardiovascular Systems, Inc. | Polycationic peptide coatings and methods of making the same |
| US7056523B1 (en) | 2002-06-21 | 2006-06-06 | Advanced Cardiovascular Systems, Inc. | Implantable medical devices incorporating chemically conjugated polymers and oligomers of L-arginine |
| US6896965B1 (en) * | 2002-11-12 | 2005-05-24 | Advanced Cardiovascular Systems, Inc. | Rate limiting barriers for implantable devices |
| US7758880B2 (en) * | 2002-12-11 | 2010-07-20 | Advanced Cardiovascular Systems, Inc. | Biocompatible polyacrylate compositions for medical applications |
| US7776926B1 (en) * | 2002-12-11 | 2010-08-17 | Advanced Cardiovascular Systems, Inc. | Biocompatible coating for implantable medical devices |
| US7074276B1 (en) * | 2002-12-12 | 2006-07-11 | Advanced Cardiovascular Systems, Inc. | Clamp mandrel fixture and a method of using the same to minimize coating defects |
| US7758881B2 (en) * | 2004-06-30 | 2010-07-20 | Advanced Cardiovascular Systems, Inc. | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders with an implantable medical device |
| US7094256B1 (en) | 2002-12-16 | 2006-08-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical device containing polycationic peptides |
| US8435550B2 (en) * | 2002-12-16 | 2013-05-07 | Abbot Cardiovascular Systems Inc. | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders with an implantable medical device |
| US20060002968A1 (en) * | 2004-06-30 | 2006-01-05 | Gordon Stewart | Anti-proliferative and anti-inflammatory agent combination for treatment of vascular disorders |
| US7144419B2 (en) * | 2003-01-24 | 2006-12-05 | Medtronic Vascular, Inc. | Drug-polymer coated stent with blended phenoxy and styrenic block copolymers |
| US7063884B2 (en) * | 2003-02-26 | 2006-06-20 | Advanced Cardiovascular Systems, Inc. | Stent coating |
| US20080215137A1 (en) * | 2003-04-30 | 2008-09-04 | Boston Scientific Scimed, Inc. | Therapeutic driving layer for a medical device |
| US20040220656A1 (en) * | 2003-04-30 | 2004-11-04 | Epstein Samuel J. | Coated medical devices and methods of making the same |
| CA2524323C (en) * | 2003-05-02 | 2012-05-15 | Cardiome Pharma Corp. | Aminocyclohexyl ether compounds and uses thereof |
| US7345086B2 (en) * | 2003-05-02 | 2008-03-18 | Cardiome Pharma Corp. | Uses of ion channel modulating compounds |
| US20090041841A1 (en) * | 2003-05-02 | 2009-02-12 | Cardiome Pharma Corp. | Controlled release tablet formulations for the prevention of arrhythmias |
| US7279174B2 (en) * | 2003-05-08 | 2007-10-09 | Advanced Cardiovascular Systems, Inc. | Stent coatings comprising hydrophilic additives |
| US20050118344A1 (en) | 2003-12-01 | 2005-06-02 | Pacetti Stephen D. | Temperature controlled crimping |
| US20050021127A1 (en) * | 2003-07-21 | 2005-01-27 | Kawula Paul John | Porous glass fused onto stent for drug retention |
| US7619059B2 (en) * | 2003-07-29 | 2009-11-17 | Life Technologies Corporation | Bimolecular optical probes |
| US7727752B2 (en) | 2003-07-29 | 2010-06-01 | Life Technologies Corporation | Kinase and phosphatase assays |
| CA2445420A1 (en) * | 2003-07-29 | 2005-01-29 | Invitrogen Corporation | Kinase and phosphatase assays |
| US7785512B1 (en) | 2003-07-31 | 2010-08-31 | Advanced Cardiovascular Systems, Inc. | Method and system of controlled temperature mixing and molding of polymers with active agents for implantable medical devices |
| WO2005018635A2 (en) * | 2003-08-07 | 2005-03-03 | Cardiome Pharma Corp. | Ion channel modulating activity i |
| NZ592039A (en) | 2003-08-27 | 2013-03-28 | Ophthotech Corp | Combination therapy for the treatment of ocular neovascular disorders |
| JP2007505315A (ja) * | 2003-09-12 | 2007-03-08 | インヴィトロジェン コーポレーション | 多重結合および活性アッセイ |
| US7198675B2 (en) * | 2003-09-30 | 2007-04-03 | Advanced Cardiovascular Systems | Stent mandrel fixture and method for selectively coating surfaces of a stent |
| EP1687642B1 (en) * | 2003-10-07 | 2009-01-14 | Centelion | Screening methods for combinations of biological compounds |
| US7345087B2 (en) * | 2003-10-31 | 2008-03-18 | Cardiome Pharma Corp. | Aminocyclohexyl ether compounds and uses thereof |
| US7261946B2 (en) * | 2003-11-14 | 2007-08-28 | Advanced Cardiovascular Systems, Inc. | Block copolymers of acrylates and methacrylates with fluoroalkenes |
| US9114198B2 (en) * | 2003-11-19 | 2015-08-25 | Advanced Cardiovascular Systems, Inc. | Biologically beneficial coatings for implantable devices containing fluorinated polymers and methods for fabricating the same |
| US8192752B2 (en) * | 2003-11-21 | 2012-06-05 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable devices including biologically erodable polyesters and methods for fabricating the same |
| US7220816B2 (en) * | 2003-12-16 | 2007-05-22 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on poly(ester amides) and methods for fabricating the same |
| US7435788B2 (en) * | 2003-12-19 | 2008-10-14 | Advanced Cardiovascular Systems, Inc. | Biobeneficial polyamide/polyethylene glycol polymers for use with drug eluting stents |
| US7563324B1 (en) | 2003-12-29 | 2009-07-21 | Advanced Cardiovascular Systems Inc. | System and method for coating an implantable medical device |
| TWI332003B (en) * | 2004-01-30 | 2010-10-21 | Lilly Co Eli | Kinase inhibitors |
| US8685431B2 (en) * | 2004-03-16 | 2014-04-01 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on copolymers having ester bonds and methods for fabricating the same |
| US8778014B1 (en) | 2004-03-31 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Coatings for preventing balloon damage to polymer coated stents |
| MXPA06011419A (es) | 2004-04-01 | 2007-04-20 | Cardiome Pharma Corp | Profarmacos de compuestos moduladores de canales ionicos y usos de los mismos. |
| WO2005097087A2 (en) * | 2004-04-01 | 2005-10-20 | Cardiome Pharma Corp. | Merged ion channel modulating compounds and uses thereof |
| US7553377B1 (en) | 2004-04-27 | 2009-06-30 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for electrostatic coating of an abluminal stent surface |
| US20050265960A1 (en) * | 2004-05-26 | 2005-12-01 | Pacetti Stephen D | Polymers containing poly(ester amides) and agents for use with medical articles and methods of fabricating the same |
| US7820732B2 (en) * | 2004-04-30 | 2010-10-26 | Advanced Cardiovascular Systems, Inc. | Methods for modulating thermal and mechanical properties of coatings on implantable devices |
| US8293890B2 (en) * | 2004-04-30 | 2012-10-23 | Advanced Cardiovascular Systems, Inc. | Hyaluronic acid based copolymers |
| US20050288481A1 (en) * | 2004-04-30 | 2005-12-29 | Desnoyer Jessica R | Design of poly(ester amides) for the control of agent-release from polymeric compositions |
| US9561309B2 (en) * | 2004-05-27 | 2017-02-07 | Advanced Cardiovascular Systems, Inc. | Antifouling heparin coatings |
| US20050271700A1 (en) * | 2004-06-03 | 2005-12-08 | Desnoyer Jessica R | Poly(ester amide) coating composition for implantable devices |
| US7563780B1 (en) * | 2004-06-18 | 2009-07-21 | Advanced Cardiovascular Systems, Inc. | Heparin prodrugs and drug delivery stents formed therefrom |
| US20050287184A1 (en) | 2004-06-29 | 2005-12-29 | Hossainy Syed F A | Drug-delivery stent formulations for restenosis and vulnerable plaque |
| US8357391B2 (en) | 2004-07-30 | 2013-01-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable devices comprising poly (hydroxy-alkanoates) and diacid linkages |
| US7494665B1 (en) | 2004-07-30 | 2009-02-24 | Advanced Cardiovascular Systems, Inc. | Polymers containing siloxane monomers |
| US7311980B1 (en) | 2004-08-02 | 2007-12-25 | Advanced Cardiovascular Systems, Inc. | Polyactive/polylactic acid coatings for an implantable device |
| US7648727B2 (en) * | 2004-08-26 | 2010-01-19 | Advanced Cardiovascular Systems, Inc. | Methods for manufacturing a coated stent-balloon assembly |
| US7244443B2 (en) * | 2004-08-31 | 2007-07-17 | Advanced Cardiovascular Systems, Inc. | Polymers of fluorinated monomers and hydrophilic monomers |
| US8110211B2 (en) * | 2004-09-22 | 2012-02-07 | Advanced Cardiovascular Systems, Inc. | Medicated coatings for implantable medical devices including polyacrylates |
| US9011831B2 (en) | 2004-09-30 | 2015-04-21 | Advanced Cardiovascular Systems, Inc. | Methacrylate copolymers for medical devices |
| US7166680B2 (en) * | 2004-10-06 | 2007-01-23 | Advanced Cardiovascular Systems, Inc. | Blends of poly(ester amide) polymers |
| US20060083770A1 (en) * | 2004-10-15 | 2006-04-20 | Specialty Coating Systems, Inc. | Medical devices and methods of preparation and use |
| US20060089485A1 (en) * | 2004-10-27 | 2006-04-27 | Desnoyer Jessica R | End-capped poly(ester amide) copolymers |
| US8603634B2 (en) * | 2004-10-27 | 2013-12-10 | Abbott Cardiovascular Systems Inc. | End-capped poly(ester amide) copolymers |
| US7862835B2 (en) * | 2004-10-27 | 2011-01-04 | Boston Scientific Scimed, Inc. | Method of manufacturing a medical device having a porous coating thereon |
| US20060095122A1 (en) * | 2004-10-29 | 2006-05-04 | Advanced Cardiovascular Systems, Inc. | Implantable devices comprising biologically absorbable star polymers and methods for fabricating the same |
| US7390497B2 (en) * | 2004-10-29 | 2008-06-24 | Advanced Cardiovascular Systems, Inc. | Poly(ester amide) filler blends for modulation of coating properties |
| US7481835B1 (en) | 2004-10-29 | 2009-01-27 | Advanced Cardiovascular Systems, Inc. | Encapsulated covered stent |
| ES2483940T3 (es) * | 2004-11-08 | 2014-08-08 | Cardiome Pharma Corp. | Un nuevo régimen de dosificación para compuestos moduladores del canal iónico para el tratamiento de la fibrilación auricular aguda en un ser humano |
| US7214759B2 (en) | 2004-11-24 | 2007-05-08 | Advanced Cardiovascular Systems, Inc. | Biologically absorbable coatings for implantable devices based on polyesters and methods for fabricating the same |
| US8609123B2 (en) * | 2004-11-29 | 2013-12-17 | Advanced Cardiovascular Systems, Inc. | Derivatized poly(ester amide) as a biobeneficial coating |
| US20060115449A1 (en) * | 2004-11-30 | 2006-06-01 | Advanced Cardiovascular Systems, Inc. | Bioabsorbable, biobeneficial, tyrosine-based polymers for use in drug eluting stent coatings |
| US7892592B1 (en) | 2004-11-30 | 2011-02-22 | Advanced Cardiovascular Systems, Inc. | Coating abluminal surfaces of stents and other implantable medical devices |
| US7632307B2 (en) | 2004-12-16 | 2009-12-15 | Advanced Cardiovascular Systems, Inc. | Abluminal, multilayer coating constructs for drug-delivery stents |
| US7604818B2 (en) * | 2004-12-22 | 2009-10-20 | Advanced Cardiovascular Systems, Inc. | Polymers of fluorinated monomers and hydrocarbon monomers |
| US7419504B2 (en) * | 2004-12-27 | 2008-09-02 | Advanced Cardiovascular Systems, Inc. | Poly(ester amide) block copolymers |
| US8007775B2 (en) * | 2004-12-30 | 2011-08-30 | Advanced Cardiovascular Systems, Inc. | Polymers containing poly(hydroxyalkanoates) and agents for use with medical articles and methods of fabricating the same |
| US7202325B2 (en) * | 2005-01-14 | 2007-04-10 | Advanced Cardiovascular Systems, Inc. | Poly(hydroxyalkanoate-co-ester amides) and agents for use with medical articles |
| US9381279B2 (en) | 2005-03-24 | 2016-07-05 | Abbott Cardiovascular Systems Inc. | Implantable devices formed on non-fouling methacrylate or acrylate polymers |
| US7700659B2 (en) * | 2005-03-24 | 2010-04-20 | Advanced Cardiovascular Systems, Inc. | Implantable devices formed of non-fouling methacrylate or acrylate polymers |
| US20060216431A1 (en) * | 2005-03-28 | 2006-09-28 | Kerrigan Cameron K | Electrostatic abluminal coating of a stent crimped on a balloon catheter |
| US7795467B1 (en) | 2005-04-26 | 2010-09-14 | Advanced Cardiovascular Systems, Inc. | Bioabsorbable, biobeneficial polyurethanes for use in medical devices |
| US7637941B1 (en) | 2005-05-11 | 2009-12-29 | Advanced Cardiovascular Systems, Inc. | Endothelial cell binding coatings for rapid encapsulation of bioerodable stents |
| US7622070B2 (en) * | 2005-06-20 | 2009-11-24 | Advanced Cardiovascular Systems, Inc. | Method of manufacturing an implantable polymeric medical device |
| US7823533B2 (en) * | 2005-06-30 | 2010-11-02 | Advanced Cardiovascular Systems, Inc. | Stent fixture and method for reducing coating defects |
| US8021676B2 (en) | 2005-07-08 | 2011-09-20 | Advanced Cardiovascular Systems, Inc. | Functionalized chemically inert polymers for coatings |
| US7785647B2 (en) * | 2005-07-25 | 2010-08-31 | Advanced Cardiovascular Systems, Inc. | Methods of providing antioxidants to a drug containing product |
| US7735449B1 (en) | 2005-07-28 | 2010-06-15 | Advanced Cardiovascular Systems, Inc. | Stent fixture having rounded support structures and method for use thereof |
| US20070128246A1 (en) * | 2005-12-06 | 2007-06-07 | Hossainy Syed F A | Solventless method for forming a coating |
| US20070135909A1 (en) * | 2005-12-08 | 2007-06-14 | Desnoyer Jessica R | Adhesion polymers to improve stent retention |
| US7976891B1 (en) | 2005-12-16 | 2011-07-12 | Advanced Cardiovascular Systems, Inc. | Abluminal stent coating apparatus and method of using focused acoustic energy |
| US7591841B2 (en) | 2005-12-16 | 2009-09-22 | Advanced Cardiovascular Systems, Inc. | Implantable devices for accelerated healing |
| US7867547B2 (en) | 2005-12-19 | 2011-01-11 | Advanced Cardiovascular Systems, Inc. | Selectively coating luminal surfaces of stents |
| US7638156B1 (en) | 2005-12-19 | 2009-12-29 | Advanced Cardiovascular Systems, Inc. | Apparatus and method for selectively coating a medical article |
| US20070148390A1 (en) * | 2005-12-27 | 2007-06-28 | Specialty Coating Systems, Inc. | Fluorinated coatings |
| US20070196428A1 (en) * | 2006-02-17 | 2007-08-23 | Thierry Glauser | Nitric oxide generating medical devices |
| US7601383B2 (en) * | 2006-02-28 | 2009-10-13 | Advanced Cardiovascular Systems, Inc. | Coating construct containing poly (vinyl alcohol) |
| US7713637B2 (en) * | 2006-03-03 | 2010-05-11 | Advanced Cardiovascular Systems, Inc. | Coating containing PEGylated hyaluronic acid and a PEGylated non-hyaluronic acid polymer |
| US20070231363A1 (en) * | 2006-03-29 | 2007-10-04 | Yung-Ming Chen | Coatings formed from stimulus-sensitive material |
| US20070259101A1 (en) * | 2006-05-02 | 2007-11-08 | Kleiner Lothar W | Microporous coating on medical devices |
| US7985441B1 (en) | 2006-05-04 | 2011-07-26 | Yiwen Tang | Purification of polymers for coating applications |
| US8003156B2 (en) * | 2006-05-04 | 2011-08-23 | Advanced Cardiovascular Systems, Inc. | Rotatable support elements for stents |
| US8304012B2 (en) * | 2006-05-04 | 2012-11-06 | Advanced Cardiovascular Systems, Inc. | Method for drying a stent |
| US7775178B2 (en) * | 2006-05-26 | 2010-08-17 | Advanced Cardiovascular Systems, Inc. | Stent coating apparatus and method |
| US8568764B2 (en) * | 2006-05-31 | 2013-10-29 | Advanced Cardiovascular Systems, Inc. | Methods of forming coating layers for medical devices utilizing flash vaporization |
| US9561351B2 (en) * | 2006-05-31 | 2017-02-07 | Advanced Cardiovascular Systems, Inc. | Drug delivery spiral coil construct |
| US8703167B2 (en) | 2006-06-05 | 2014-04-22 | Advanced Cardiovascular Systems, Inc. | Coatings for implantable medical devices for controlled release of a hydrophilic drug and a hydrophobic drug |
| US20080124372A1 (en) * | 2006-06-06 | 2008-05-29 | Hossainy Syed F A | Morphology profiles for control of agent release rates from polymer matrices |
| US8778376B2 (en) | 2006-06-09 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Copolymer comprising elastin pentapeptide block and hydrophilic block, and medical device and method of treating |
| US20070286882A1 (en) * | 2006-06-09 | 2007-12-13 | Yiwen Tang | Solvent systems for coating medical devices |
| US20080095918A1 (en) * | 2006-06-14 | 2008-04-24 | Kleiner Lothar W | Coating construct with enhanced interfacial compatibility |
| US8114150B2 (en) | 2006-06-14 | 2012-02-14 | Advanced Cardiovascular Systems, Inc. | RGD peptide attached to bioabsorbable stents |
| US8603530B2 (en) | 2006-06-14 | 2013-12-10 | Abbott Cardiovascular Systems Inc. | Nanoshell therapy |
| US8048448B2 (en) * | 2006-06-15 | 2011-11-01 | Abbott Cardiovascular Systems Inc. | Nanoshells for drug delivery |
| US8017237B2 (en) * | 2006-06-23 | 2011-09-13 | Abbott Cardiovascular Systems, Inc. | Nanoshells on polymers |
| US8956640B2 (en) * | 2006-06-29 | 2015-02-17 | Advanced Cardiovascular Systems, Inc. | Block copolymers including a methoxyethyl methacrylate midblock |
| US20080008736A1 (en) * | 2006-07-06 | 2008-01-10 | Thierry Glauser | Random copolymers of methacrylates and acrylates |
| US9028859B2 (en) * | 2006-07-07 | 2015-05-12 | Advanced Cardiovascular Systems, Inc. | Phase-separated block copolymer coatings for implantable medical devices |
| US8703169B1 (en) | 2006-08-15 | 2014-04-22 | Abbott Cardiovascular Systems Inc. | Implantable device having a coating comprising carrageenan and a biostable polymer |
| US20080085293A1 (en) * | 2006-08-22 | 2008-04-10 | Jenchen Yang | Drug eluting stent and therapeutic methods using c-Jun N-terminal kinase inhibitor |
| EP2097119A4 (en) * | 2006-11-21 | 2012-10-17 | Abbott Lab | USE OF A TERPOLYMER OF TETRAFLUOROETHYLENE, HEXAFLUORPROPYLENE AND VINYLIDENE FLUORIDE IN MEDICAMENTAL COATINGS |
| US7713541B1 (en) * | 2006-11-21 | 2010-05-11 | Abbott Cardiovascular Systems Inc. | Zwitterionic terpolymers, method of making and use on medical devices |
| US20080118541A1 (en) * | 2006-11-21 | 2008-05-22 | Abbott Laboratories | Use of a terpolymer of tetrafluoroethylene, hexafluoropropylene, and vinylidene fluoride in drug eluting coatings on medical devices |
| US8597673B2 (en) * | 2006-12-13 | 2013-12-03 | Advanced Cardiovascular Systems, Inc. | Coating of fast absorption or dissolution |
| US8017141B2 (en) | 2006-12-15 | 2011-09-13 | Advanced Cardiovascular Systems, Inc. | Coatings of acrylamide-based copolymers |
| PE20090288A1 (es) * | 2007-05-10 | 2009-04-03 | Smithkline Beecham Corp | Derivados de quinoxalina como inhibidores de la pi3 quinasa |
| US20080286332A1 (en) | 2007-05-14 | 2008-11-20 | Pacetti Stephen D | Implantable medical devices with a topcoat layer of phosphoryl choline acrylate polymer for reduced thrombosis, and improved mechanical properties |
| US8147769B1 (en) | 2007-05-16 | 2012-04-03 | Abbott Cardiovascular Systems Inc. | Stent and delivery system with reduced chemical degradation |
| US9056155B1 (en) | 2007-05-29 | 2015-06-16 | Abbott Cardiovascular Systems Inc. | Coatings having an elastic primer layer |
| US8048441B2 (en) | 2007-06-25 | 2011-11-01 | Abbott Cardiovascular Systems, Inc. | Nanobead releasing medical devices |
| US8109904B1 (en) | 2007-06-25 | 2012-02-07 | Abbott Cardiovascular Systems Inc. | Drug delivery medical devices |
| US20090041845A1 (en) * | 2007-08-08 | 2009-02-12 | Lothar Walter Kleiner | Implantable medical devices having thin absorbable coatings |
| US10301265B2 (en) * | 2008-05-28 | 2019-05-28 | Virginia I. Roxas-Duncan | Small molecule inhibitors of botulinum neurotoxins |
| WO2010099139A2 (en) | 2009-02-25 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Combination anti-cancer therapy |
| JP2012519282A (ja) | 2009-02-27 | 2012-08-23 | オーエスアイ・ファーマシューティカルズ,エルエルシー | 間葉様腫瘍細胞またはその生成を阻害する薬剤を同定するための方法 |
| EP2401614A1 (en) | 2009-02-27 | 2012-01-04 | OSI Pharmaceuticals, LLC | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| WO2010099138A2 (en) | 2009-02-27 | 2010-09-02 | Osi Pharmaceuticals, Inc. | Methods for the identification of agents that inhibit mesenchymal-like tumor cells or their formation |
| EP2241557A1 (de) | 2009-04-02 | 2010-10-20 | Æterna Zentaris GmbH | Chinoxalin-Derivate und deren Anwendung zur Behandlung gutartiger und bösartiger Tumorerkrankungen |
| GB0908905D0 (en) | 2009-05-26 | 2009-07-01 | Sentinel Oncology Ltd | Pharmaceutical compounds |
| US10253020B2 (en) | 2009-06-12 | 2019-04-09 | Abivax | Compounds for preventing, inhibiting, or treating cancer, AIDS and/or premature aging |
| US8685433B2 (en) | 2010-03-31 | 2014-04-01 | Abbott Cardiovascular Systems Inc. | Absorbable coating for implantable device |
| KR101886459B1 (ko) | 2010-10-08 | 2018-08-07 | 니발리스 테라퓨틱스, 인코포레이티드 | S-나이트로소글루타티온 리덕타제 억제제로서의 신규한 치환된 퀴놀린 화합물 |
| JP5898230B2 (ja) | 2010-12-16 | 2016-04-06 | ニヴァリス・セラピューティクス・インコーポレーテッド | S−ニトロソグルタチオンレダクターゼ阻害薬としての新規な置換二環芳香族化合物 |
| EP2702173A1 (en) | 2011-04-25 | 2014-03-05 | OSI Pharmaceuticals, LLC | Use of emt gene signatures in cancer drug discovery, diagnostics, and treatment |
| WO2013152252A1 (en) | 2012-04-06 | 2013-10-10 | OSI Pharmaceuticals, LLC | Combination anti-cancer therapy |
| EP2757161A1 (en) | 2013-01-17 | 2014-07-23 | Splicos | miRNA-124 as a biomarker of viral infection |
| JP6491101B2 (ja) | 2013-10-25 | 2019-03-27 | 株式会社クラレ | ホットメルト接着剤組成物 |
| US20170027940A1 (en) | 2014-04-10 | 2017-02-02 | Stichting Het Nederlands Kanker Instituut | Method for treating cancer |
| EP2974729A1 (en) | 2014-07-17 | 2016-01-20 | Abivax | Quinoline derivatives for use in the treatment of inflammatory diseases |
| ES2745526T3 (es) | 2015-01-27 | 2020-03-02 | Kuraray Co | Copolímero de bloques acrílicos y composición adhesiva |
| WO2017044766A1 (en) | 2015-09-10 | 2017-03-16 | Nivalis Therapeutics, Inc. | Solid forms of an s-nitrosoglutathione reductase inhibitor |
| EP3669873A1 (en) | 2018-12-20 | 2020-06-24 | Abivax | Quinoline derivatives for use ine the traeatment of inflammation diseases |
Family Cites Families (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272824A (en) | 1962-12-06 | 1966-09-13 | Norwich Pharma Co | 4-amino-6, 7-di(lower) alkoxyquinolines |
| DE2913728A1 (de) | 1979-04-05 | 1980-10-16 | Bayer Ag | 2-sulfonyl-chinoxaline, verfahren zu ihrer herstellung sowie ihre verwendung als mikrobizide |
| NZ194196A (en) * | 1979-07-17 | 1983-07-15 | Ici Australia Ltd | -(quinoxalin-2-yl(oxy or thio) phen (oxy or ylthio)-alkanoic acid derivatives or precursors |
| US4358307A (en) | 1979-10-02 | 1982-11-09 | Ici Australia Limited | Herbicidal quinoxaline carboxylic acid derivatives |
| US4462994A (en) | 1981-05-19 | 1984-07-31 | Nissan Chemical Industries, Inc. | N-Containing heterocyclic ring-substituted O-arylphosphate derivatives, preparation thereof, and insecticides, acaricides and nematocides containing said derivatives |
| IT1226045B (it) * | 1981-07-29 | 1990-12-10 | Simes | Derivati tetraidrochinolici |
| US4661499A (en) | 1985-06-18 | 1987-04-28 | Merck Frosst Canada, Inc. | 2-[(substituted)-phenoxymethyl]quinolines |
| US4888427A (en) | 1987-04-07 | 1989-12-19 | University Of Florida | Amino acids containing dihydropyridine ring systems for site-specific delivery of peptides to the brain |
| US5120348A (en) | 1988-01-06 | 1992-06-09 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| US5319102A (en) | 1988-01-06 | 1994-06-07 | Uniroyal Chemical Company, Inc. | Heterocyclic-alkylene quinoxalinyloxyphenoxypropanoate herbicides |
| GB8907865D0 (en) * | 1989-04-07 | 1989-05-24 | Wyeth John & Brother Ltd | Tetrahydroquinoline derivatives |
| GB9004483D0 (en) | 1990-02-28 | 1990-04-25 | Erba Carlo Spa | New aryl-and heteroarylethenylene derivatives and process for their preparation |
| CA2049973C (en) * | 1990-02-28 | 2002-12-24 | Rodney G. Wolff | Intralumenal drug eluting prosthesis |
| US5710158A (en) | 1991-05-10 | 1998-01-20 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Aryl and heteroaryl quinazoline compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| US5409930A (en) | 1991-05-10 | 1995-04-25 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono- and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| US5480883A (en) | 1991-05-10 | 1996-01-02 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Bis mono- and bicyclic aryl and heteroaryl compounds which inhibit EGF and/or PDGF receptor tyrosine kinase |
| US5823853A (en) * | 1996-07-18 | 1998-10-20 | Speedfam Corporation | Apparatus for the in-process detection of workpieces with a monochromatic light source |
| US6177401B1 (en) | 1992-11-13 | 2001-01-23 | Max-Planck-Gesellschaft Zur Forderung Der Wissenschaften | Use of organic compounds for the inhibition of Flk-1 mediated vasculogenesis and angiogenesis |
| US5336518A (en) | 1992-12-11 | 1994-08-09 | Cordis Corporation | Treatment of metallic surfaces using radiofrequency plasma deposition and chemical attachment of bioactive agents |
| US5700823A (en) | 1994-01-07 | 1997-12-23 | Sugen, Inc. | Treatment of platelet derived growth factor related disorders such as cancers |
| WO1995024190A2 (en) | 1994-03-07 | 1995-09-14 | Sugen, Inc. | Receptor tyrosine kinase inhibitors for inhibiting cell proliferative disorders and compositions thereof |
| DE4426373A1 (de) | 1994-07-26 | 1996-02-01 | Bayer Ag | 3-Substituierte Chinolin-5-carbonsäurederivate und Verfahren zu ihrer Herstellung |
| US5637113A (en) | 1994-12-13 | 1997-06-10 | Advanced Cardiovascular Systems, Inc. | Polymer film for wrapping a stent structure |
| AU4355296A (en) | 1994-12-28 | 1996-07-19 | Sankyo Company Limited | Indole derivatives |
| US5605696A (en) | 1995-03-30 | 1997-02-25 | Advanced Cardiovascular Systems, Inc. | Drug loaded polymeric material and method of manufacture |
| US5721277A (en) | 1995-04-21 | 1998-02-24 | Sugen, Inc. | Compounds and methods for inhibiting hyper-proliferative cell growth |
| AU716005B2 (en) | 1995-06-07 | 2000-02-17 | Cook Medical Technologies Llc | Implantable medical device |
| JP3476604B2 (ja) * | 1995-08-22 | 2003-12-10 | 鐘淵化学工業株式会社 | 薬剤を付着・コーティングしたステントの製造方法 |
| AU3461697A (en) | 1996-07-19 | 1998-02-10 | Takeda Chemical Industries Ltd. | Heterocyclic compounds, their production and use |
| NZ336826A (en) * | 1997-01-21 | 2000-06-23 | Nissan Chemical Ind Ltd | Industrial antimicrobial/mildew-proofing agents, algicides and antifouling agents containing N-quinoxalylanilines |
| JP4422215B2 (ja) * | 1997-02-20 | 2010-02-24 | クック インコーポレイテッド | 被覆された移植可能な医療器具 |
| DE69828607T2 (de) | 1997-05-28 | 2006-01-05 | Aventis Pharmaceuticals Inc. | CHINOLIN- UND CHINOXALIN-VERBINDUNGEN DIE DEN VON BLUTPLÄTTCHEN ABSTAMMMENDEN WACHSTUMSFAKTOR UND/ODER PDGF- UND P56lck-TYROSIN-KINASE HEMMEN |
| US6180632B1 (en) * | 1997-05-28 | 2001-01-30 | Aventis Pharmaceuticals Products Inc. | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
| US6245760B1 (en) * | 1997-05-28 | 2001-06-12 | Aventis Pharmaceuticals Products, Inc | Quinoline and quinoxaline compounds which inhibit platelet-derived growth factor and/or p56lck tyrosine kinases |
-
1998
- 1998-11-24 US US09/198,718 patent/US6180632B1/en not_active Expired - Fee Related
-
1999
- 1999-11-23 CZ CZ20012276A patent/CZ20012276A3/cs unknown
- 1999-11-23 PL PL99348979A patent/PL348979A1/xx unknown
- 1999-11-23 AU AU18294/00A patent/AU777256B2/en not_active Ceased
- 1999-11-23 HU HU0104605A patent/HUP0104605A3/hu unknown
- 1999-11-23 MX MXPA01005317A patent/MXPA01005317A/es active IP Right Grant
- 1999-11-23 CN CNB998157880A patent/CN100390154C/zh not_active Expired - Fee Related
- 1999-11-23 CA CA002352261A patent/CA2352261A1/en not_active Abandoned
- 1999-11-23 IL IL14340699A patent/IL143406A0/xx unknown
- 1999-11-23 BR BR9915653-9A patent/BR9915653A/pt not_active Application Discontinuation
- 1999-11-23 EE EEP200100280A patent/EE200100280A/xx unknown
- 1999-11-23 WO PCT/US1999/027825 patent/WO2000031051A1/en not_active Ceased
- 1999-11-23 EP EP99961784A patent/EP1133480A1/en not_active Withdrawn
- 1999-11-23 EA EA200100579A patent/EA007534B1/ru not_active IP Right Cessation
- 1999-11-23 ID IDW00200101350A patent/ID29611A/id unknown
- 1999-11-23 SK SK906-2001A patent/SK9062001A3/sk unknown
- 1999-11-23 KR KR1020017006536A patent/KR100784291B1/ko not_active Expired - Fee Related
- 1999-11-23 JP JP2000583879A patent/JP2002530389A/ja active Pending
- 1999-11-23 NZ NZ512096A patent/NZ512096A/xx unknown
- 1999-11-23 UA UA2001064347A patent/UA76935C2/uk unknown
-
2000
- 2000-09-29 US US09/675,746 patent/US6528526B1/en not_active Expired - Fee Related
-
2001
- 2001-05-25 NO NO20012582A patent/NO319801B1/no unknown
- 2001-06-20 BG BG105625A patent/BG65497B1/bg unknown
-
2002
- 2002-12-12 US US10/317,464 patent/US6696434B2/en not_active Expired - Fee Related
-
2003
- 2003-02-04 US US10/357,882 patent/US6852712B2/en not_active Expired - Fee Related
- 2003-02-06 US US10/359,983 patent/US6821962B2/en not_active Expired - Fee Related
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US8778375B2 (en) | 2005-04-29 | 2014-07-15 | Advanced Cardiovascular Systems, Inc. | Amorphous poly(D,L-lactide) coating |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002530389A5 (https=) | ||
| JP2002530387A5 (https=) | ||
| Brintzinger et al. | Stereospecific olefin polymerization with chiral metallocene catalysts | |
| JP2843774B2 (ja) | 過増殖性血管疾患の治療薬 | |
| KR100784291B1 (ko) | 퀴놀린 및 퀴녹살린 화합물이 혼입된 중합체성 피복물을 갖는 스텐트 장치 | |
| US8883175B2 (en) | Block copolymers of acrylates and methacrylates with fluoroalkenes | |
| US6288184B1 (en) | Hydrolytically degradable olefin copolymers | |
| ES2374386T3 (es) | Polímeros de monómeros fluorados y monómeros de hidrocarburo. | |
| JP2001527135A (ja) | オレフィン重合用担持触媒系 | |
| Sipos et al. | Controlled delivery of paclitaxel from stent coatings using poly (hydroxystyrene-b-isobutylene-b-hydroxystyrene) and its acetylated derivative | |
| US20030008984A1 (en) | Novel catalyst system and the use thereof | |
| CA2360685A1 (en) | Methods for restoring and/or enhancing accommodation in pseudo phakia | |
| CA2449244A1 (en) | Negatively charged amphiphilic block copolymer as drug carrier and complex thereof with positively charged drug | |
| JP2003511540A5 (https=) | ||
| JP5016309B2 (ja) | 医療用テープ剤 | |
| TW200613312A (en) | Magnesium compound, catalyst for olefin polymerization and method for producing olefin polymer | |
| JP2007533824A5 (https=) | ||
| SG158131A1 (en) | Solid catalyst component and catalyst for olefin polymerization, and process for producing olefin polymer or copolymer | |
| EA015396B1 (ru) | Активирующие агенты для металлоценовых компонентов на основе гафния | |
| JPH1053605A (ja) | 反応遅延剤を添加するc2−c12アルケンポリマーの製造方法 | |
| CA2656079A1 (en) | Cyclic amine compound | |
| JP2001511450A5 (https=) | ||
| Soga et al. | Polymerization of propene with the XTiCl3/MgCl2–Al (i‐Bu) 3 catalyst system (X= cyclopentadienyl, pentamethylcyclopentadienyl, indenyl, and heptamethylindenyl) in the absence and presence of a lewis base | |
| DE50009515D1 (de) | Verfahren zur herstellung eines katalysatorfeststoffs zur olefinpolymerisation | |
| JP2008540618A5 (https=) |