JP2002515482A5 - - Google Patents
Download PDFInfo
- Publication number
- JP2002515482A5 JP2002515482A5 JP2000549586A JP2000549586A JP2002515482A5 JP 2002515482 A5 JP2002515482 A5 JP 2002515482A5 JP 2000549586 A JP2000549586 A JP 2000549586A JP 2000549586 A JP2000549586 A JP 2000549586A JP 2002515482 A5 JP2002515482 A5 JP 2002515482A5
- Authority
- JP
- Japan
- Prior art keywords
- alkyl
- halogenoalkyl
- formula
- optionally
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000000217 alkyl group Chemical group 0.000 description 32
- 125000001188 haloalkyl group Chemical group 0.000 description 19
- 239000001257 hydrogen Substances 0.000 description 15
- 229910052739 hydrogen Inorganic materials 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- -1 —CO—NR 4 R 5 Chemical group 0.000 description 14
- 125000003545 alkoxy group Chemical group 0.000 description 13
- 150000002431 hydrogen Chemical class 0.000 description 13
- 125000005843 halogen group Chemical group 0.000 description 12
- 125000003342 alkenyl group Chemical group 0.000 description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 9
- 229910052760 oxygen Inorganic materials 0.000 description 9
- 239000001301 oxygen Substances 0.000 description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 8
- 229910052736 halogen Inorganic materials 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 229910052717 sulfur Inorganic materials 0.000 description 8
- 239000011593 sulfur Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 125000004093 cyano group Chemical group *C#N 0.000 description 7
- 125000004438 haloalkoxy group Chemical group 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 125000000753 cycloalkyl group Chemical group 0.000 description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 6
- 125000005842 heteroatom Chemical group 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000003884 phenylalkyl group Chemical group 0.000 description 3
- 125000004665 trialkylsilyl group Chemical group 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 125000004450 alkenylene group Chemical group 0.000 description 2
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 description 2
- 125000005529 alkyleneoxy group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 125000004419 alkynylene group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000005702 oxyalkylene group Chemical group 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 125000005504 styryl group Chemical group 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- VCSGSRADSIJPBY-UHFFFAOYSA-N Cc(cccc1)c1C(CC1)=NC1[AlH2] Chemical compound Cc(cccc1)c1C(CC1)=NC1[AlH2] VCSGSRADSIJPBY-UHFFFAOYSA-N 0.000 description 1
- 0 Cc1ccccc1C(CCC(N)[Al])=*=* Chemical compound Cc1ccccc1C(CCC(N)[Al])=*=* 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Didodecyl thiobispropanoate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 description 1
- XPHBRTNHVJSEQD-UHFFFAOYSA-N anidoxime Chemical compound C=1C=CC=CC=1C(CCN(CC)CC)=NOC(=O)NC1=CC=C(OC)C=C1 XPHBRTNHVJSEQD-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- QDYBCIWLGJMJGO-UHFFFAOYSA-N dinitromethanone Chemical class [O-][N+](=O)C(=O)[N+]([O-])=O QDYBCIWLGJMJGO-UHFFFAOYSA-N 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 125000001326 naphthylalkyl group Chemical group 0.000 description 1
- 150000002826 nitrites Chemical class 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19822245A DE19822245A1 (de) | 1998-05-18 | 1998-05-18 | 2-(2-Methylphenyl)-3,4-dihydro-2H-pyrrol- Derivate |
| DE19822245.9 | 1998-05-18 | ||
| PCT/EP1999/003062 WO1999059967A1 (de) | 1998-05-18 | 1999-05-05 | 2-(2-methylphenyl)-3,4-dihydro-2h-pyrrol-derivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JP2002515482A JP2002515482A (ja) | 2002-05-28 |
| JP2002515482A5 true JP2002515482A5 (https=) | 2006-06-22 |
Family
ID=7868157
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP2000549586A Pending JP2002515482A (ja) | 1998-05-18 | 1999-05-05 | 2−(2−メチルフェニル)−3,4−ジヒドロ−2h−ピロール誘導体 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US6632833B1 (https=) |
| EP (1) | EP1077938B1 (https=) |
| JP (1) | JP2002515482A (https=) |
| KR (1) | KR100693354B1 (https=) |
| AR (1) | AR018612A1 (https=) |
| AT (1) | ATE293099T1 (https=) |
| AU (1) | AU742032B2 (https=) |
| BR (1) | BR9910540A (https=) |
| CA (1) | CA2332522A1 (https=) |
| DE (2) | DE19822245A1 (https=) |
| ES (1) | ES2241284T3 (https=) |
| HU (1) | HUP0103144A3 (https=) |
| IL (1) | IL139115A0 (https=) |
| TR (1) | TR200003390T2 (https=) |
| WO (1) | WO1999059967A1 (https=) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19648011A1 (de) * | 1996-11-20 | 1998-05-28 | Bayer Ag | Cyclische Imine |
| DE19822247A1 (de) * | 1998-05-18 | 1999-11-25 | Bayer Ag | 2-(2-Chlorphenyl)-3,4-dihydro-2H-pyrrol-Derivate |
| DE10047116A1 (de) * | 2000-09-22 | 2002-04-18 | Bayer Ag | DELTA·1·-Pyrroline |
| DE10047111A1 (de) * | 2000-09-22 | 2002-04-11 | Bayer Ag | Verfahren zur Herstellung von DELTA·1·-Pyrrolinen |
| DE10047110A1 (de) * | 2000-09-22 | 2002-04-18 | Bayer Ag | Optisch aktive 2,5-Bisaryl-DELTA·1·-Pyrroline |
| DE10047109A1 (de) * | 2000-09-22 | 2002-04-11 | Bayer Ag | Verfahren zur Herstellung von DELTA·1·-Pyrrolinen |
| MXPA03002363A (es) * | 2000-09-22 | 2004-09-10 | Bayer Cropscience Ag | Delta-1-pirrolinas. |
| DE10060412A1 (de) | 2000-12-05 | 2002-06-06 | Bayer Ag | DELTA1-Pyrroline |
| DE10106457A1 (de) | 2001-02-13 | 2002-08-14 | Bayer Ag | DELTA·1·-Pyrroline |
| DE10106455A1 (de) * | 2001-02-13 | 2002-08-14 | Bayer Ag | DELTA·1·-Pyrroline |
| DE10113965A1 (de) * | 2001-03-22 | 2002-09-26 | Bayer Ag | DELTA·1·-Pyrroline |
| CN1240678C (zh) | 2001-04-09 | 2006-02-08 | 拜尔农作物科学股份公司 | 制备△1-吡咯啉类化合物的方法 |
| DE10145772A1 (de) * | 2001-09-17 | 2003-04-10 | Bayer Cropscience Ag | DELTA·1·-Pyrroline |
| DE10154515A1 (de) * | 2001-11-07 | 2003-05-15 | Bayer Cropscience Ag | DELTA·1·-Pyrroline |
| DE10154517A1 (de) * | 2001-11-07 | 2003-05-15 | Bayer Cropscience Ag | DELTA·1·-Pyrroline |
| DE10204115A1 (de) * | 2002-02-01 | 2003-08-07 | Bayer Cropscience Ag | DELTA·1·-Pyrroline |
| DE10204116A1 (de) * | 2002-02-01 | 2003-08-07 | Bayer Cropscience Ag | DELTA·1·-Pyrroline |
| DE10205862A1 (de) * | 2002-02-13 | 2003-08-21 | Bayer Cropscience Ag | DELTA1-Pyrroline |
| DE10243939A1 (de) * | 2002-09-24 | 2004-04-01 | Bayer Cropscience Ag | Pyrroline |
| EP2080758A3 (de) | 2007-11-29 | 2009-08-26 | Bayer CropScience AG | Halogen substituierte delta-1-Pyrroline |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19648011A1 (de) * | 1996-11-20 | 1998-05-28 | Bayer Ag | Cyclische Imine |
-
1998
- 1998-05-18 DE DE19822245A patent/DE19822245A1/de not_active Withdrawn
-
1999
- 1999-05-05 ES ES99923526T patent/ES2241284T3/es not_active Expired - Lifetime
- 1999-05-05 US US09/700,288 patent/US6632833B1/en not_active Expired - Fee Related
- 1999-05-05 IL IL13911599A patent/IL139115A0/xx unknown
- 1999-05-05 EP EP99923526A patent/EP1077938B1/de not_active Expired - Lifetime
- 1999-05-05 WO PCT/EP1999/003062 patent/WO1999059967A1/de not_active Ceased
- 1999-05-05 HU HU0103144A patent/HUP0103144A3/hu unknown
- 1999-05-05 DE DE59911915T patent/DE59911915D1/de not_active Expired - Fee Related
- 1999-05-05 JP JP2000549586A patent/JP2002515482A/ja active Pending
- 1999-05-05 BR BR9910540-3A patent/BR9910540A/pt active Search and Examination
- 1999-05-05 KR KR1020007011879A patent/KR100693354B1/ko not_active Expired - Fee Related
- 1999-05-05 AT AT99923526T patent/ATE293099T1/de not_active IP Right Cessation
- 1999-05-05 TR TR2000/03390T patent/TR200003390T2/xx unknown
- 1999-05-05 AU AU40369/99A patent/AU742032B2/en not_active Ceased
- 1999-05-05 CA CA002332522A patent/CA2332522A1/en not_active Abandoned
- 1999-05-18 AR ARP990102363A patent/AR018612A1/es active IP Right Grant
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002515482A5 (https=) | ||
| JP2004538327A5 (https=) | ||
| WO2000029378A3 (en) | Acyclic and cyclic guanidine- and acetamidine derivatives, their preparation and their use as pesticides, esp. as parasiticides | |
| JP2010520866A5 (https=) | ||
| JP2006511485A5 (https=) | ||
| JP2003506352A5 (https=) | ||
| JP2004521097A5 (https=) | ||
| WO2010078906A3 (de) | Hydrazide, verfahren zu deren herstellung und deren verwendung als herbizide und insektizide | |
| JP2000281678A (ja) | 複素環置換イソオキサゾリジン化合物 | |
| CY1111185T1 (el) | Ανθρανιλαμιδια, μεθοδος για την παρασκευη αυτων και παραγοντες ελεγχου επιβλαβων εντομων που τα περιεχουν | |
| JP2001516749A5 (https=) | ||
| RU2002117428A (ru) | Аминогетероцикламиды в качестве пестицидов и антипаразитарных агентов | |
| DK200101216A (da) | Fremgangsmåde til fremstilling af citalopram | |
| NO954211D0 (no) | 3-(Hetero)arylkarboksylsyrederivater, fremgangsmåter ved fremstilling av den og mellomprodukter i deres fremstilling | |
| RU2002116255A (ru) | Аминогетероцикламидные производные, обладающие пестицидной активностью | |
| JP2004501144A5 (https=) | ||
| JP2001514171A5 (https=) | ||
| NO20001046D0 (no) | 6,7-asymmetriske disubstituerte kinoksalinkarboksylsyrederivater, addisjonssalter derav og fremgangsmõter ved fremstilling av begge | |
| WO2000059907A3 (en) | Pyrazolotriazines as crf antagonists | |
| HU178690B (en) | Process for producing 2-bracket-phenyl-imino-bracket closed-hexahydropyrimidine and -imidasolidine derivatives,and salts and complexes thereof,and fungicide compositions containing them as active agents | |
| US5190958A (en) | Piperidine derivatives | |
| CA2553328A1 (en) | Pyridinium and quinolinium derivatives | |
| JPS6217595B2 (https=) | ||
| SE457953B (sv) | Estrar av ketokarboxylsyror samt foerfarande foer framstaellning daerav | |
| RU2004137655A (ru) | N-ациламиноацетонитрильные производные и их применение для борьбы с паразитами |