IT961182B - Materie coloranti monoazo - Google Patents
Materie coloranti monoazoInfo
- Publication number
- IT961182B IT961182B IT2449372A IT2449372A IT961182B IT 961182 B IT961182 B IT 961182B IT 2449372 A IT2449372 A IT 2449372A IT 2449372 A IT2449372 A IT 2449372A IT 961182 B IT961182 B IT 961182B
- Authority
- IT
- Italy
- Prior art keywords
- coloring materials
- monoazo
- monoazo coloring
- materials
- coloring
- Prior art date
Links
- 238000004040 coloring Methods 0.000 title 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1527271A GB1387987A (en) | 1971-05-17 | 1971-05-17 | Monoazo dyestuffs |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IT961182B true IT961182B (it) | 1973-12-10 |
Family
ID=10056111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT2449372A IT961182B (it) | 1971-05-17 | 1972-05-17 | Materie coloranti monoazo |
Country Status (9)
| Country | Link |
|---|---|
| JP (2) | JPS556756B1 (OSRAM) |
| BE (1) | BE783629A (OSRAM) |
| CH (1) | CH586261A5 (OSRAM) |
| DE (2) | DE2224116C3 (OSRAM) |
| ES (1) | ES402826A1 (OSRAM) |
| FR (1) | FR2137974B1 (OSRAM) |
| GB (1) | GB1387987A (OSRAM) |
| IT (1) | IT961182B (OSRAM) |
| NL (1) | NL168541C (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4075200A (en) * | 1971-05-17 | 1978-02-21 | Imperial Chemical Industries Limited | 4(2'-Nitro-4'-sulfoanilino) phenyl azo hydroxyphenyl dyes |
| DE2422465C2 (de) * | 1974-05-09 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | Azofarbstoffe |
| DE3520551A1 (de) * | 1985-06-07 | 1986-12-11 | Pfister Gmbh, 8900 Augsburg | Vorrichtung zum kontinuierlichen, gravimetrischen dosieren und pneumatischen foerdern von schuettfaehigem gut |
| GB2236542B (en) * | 1989-10-06 | 1992-04-15 | Sandoz Ltd | Dye mixtures and their use in trichromatic dyeing processes |
-
1971
- 1971-05-17 GB GB1527271A patent/GB1387987A/en not_active Expired
-
1972
- 1972-05-16 NL NL7206574A patent/NL168541C/xx not_active IP Right Cessation
- 1972-05-16 FR FR7217494A patent/FR2137974B1/fr not_active Expired
- 1972-05-17 IT IT2449372A patent/IT961182B/it active
- 1972-05-17 BE BE783629A patent/BE783629A/xx not_active IP Right Cessation
- 1972-05-17 CH CH64276A patent/CH586261A5/xx not_active IP Right Cessation
- 1972-05-17 JP JP7249027A patent/JPS556756B1/ja active Pending
- 1972-05-17 DE DE19722224116 patent/DE2224116C3/de not_active Expired
- 1972-05-17 ES ES402826A patent/ES402826A1/es not_active Expired
- 1972-05-17 DE DE19722265443 patent/DE2265443C2/de not_active Expired
-
1978
- 1978-07-07 JP JP8283978A patent/JPS5548248A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2224116A1 (de) | 1972-11-30 |
| DE2265443C2 (de) | 1979-10-11 |
| FR2137974A1 (OSRAM) | 1972-12-29 |
| CH586261A5 (OSRAM) | 1977-03-31 |
| GB1387987A (en) | 1975-03-19 |
| DE2224116B2 (de) | 1979-05-03 |
| NL168541C (nl) | 1982-04-16 |
| BE783629A (OSRAM) | 1972-11-17 |
| FR2137974B1 (OSRAM) | 1980-03-14 |
| NL168541B (nl) | 1981-11-16 |
| NL7206574A (OSRAM) | 1972-11-21 |
| JPS556756B1 (OSRAM) | 1980-02-19 |
| ES402826A1 (es) | 1975-04-16 |
| JPS5548248A (en) | 1980-04-05 |
| DE2224116C3 (de) | 1979-12-20 |
| DE2265443B1 (de) | 1979-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT947927B (it) | Coloranti | |
| IT953554B (it) | Coloranti reattivi | |
| BE791251A (fr) | Pigments disazoiques | |
| BE781851A (fr) | Pigments | |
| IT964112B (it) | Coloranti cattionici | |
| IT948935B (it) | Coloranti poliazoici | |
| IT944599B (it) | Coloranti | |
| CH541661A (de) | Farbstoffpräparat | |
| IT950513B (it) | Coloranti | |
| IT971405B (it) | Coloranti monoazoici | |
| IT968716B (it) | Coloranti monoazoici | |
| IT961182B (it) | Materie coloranti monoazo | |
| IT969957B (it) | Composti azoici | |
| IT1001481B (it) | Coloranti azoici | |
| IT963995B (it) | Coloranti diazoici | |
| IT951892B (it) | Procedimento di colorazione | |
| TR18524A (tr) | Fungisoksik maddeler | |
| IT948009B (it) | Coloranti azoici | |
| IT971215B (it) | Coloranti monoazoici | |
| BE781015A (fr) | Pigments | |
| DE2345356A1 (de) | Disperse monoazofarbstoffe | |
| IT956939B (it) | Coloranti reattivi | |
| IT961158B (it) | Coloranti poliazoici | |
| BE791163A (fr) | Pigments | |
| BR7402107D0 (pt) | Corante monoazo |