IL90704A - Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene) - Google Patents
Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene)Info
- Publication number
- IL90704A IL90704A IL9070489A IL9070489A IL90704A IL 90704 A IL90704 A IL 90704A IL 9070489 A IL9070489 A IL 9070489A IL 9070489 A IL9070489 A IL 9070489A IL 90704 A IL90704 A IL 90704A
- Authority
- IL
- Israel
- Prior art keywords
- accordance
- stage
- propyl
- solvent
- amine
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 43
- CLFQSOIBYICELN-UHFFFAOYSA-N n-[2-(2,4,6-trichlorophenoxy)ethyl]propan-1-amine Chemical compound CCCNCCOC1=C(Cl)C=C(Cl)C=C1Cl CLFQSOIBYICELN-UHFFFAOYSA-N 0.000 title abstract description 4
- 239000002904 solvent Substances 0.000 claims abstract description 37
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims abstract description 16
- -1 tetra-alkyl ammonium halide Chemical class 0.000 claims abstract description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims abstract description 14
- VQUYNUJARXBNPK-UHFFFAOYSA-N 2-chloroethoxybenzene Chemical compound ClCCOC1=CC=CC=C1 VQUYNUJARXBNPK-UHFFFAOYSA-N 0.000 claims abstract description 11
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 claims abstract description 7
- FBRGWNDXBBWEHK-UHFFFAOYSA-N n-(2-phenoxyethyl)propan-1-amine Chemical compound CCCNCCOC1=CC=CC=C1 FBRGWNDXBBWEHK-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229960005323 phenoxyethanol Drugs 0.000 claims abstract description 7
- 230000003197 catalytic effect Effects 0.000 claims abstract description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 4
- 239000000460 chlorine Substances 0.000 claims abstract description 4
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 150000001412 amines Chemical class 0.000 claims description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000004202 carbamide Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 claims 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 3
- 235000019270 ammonium chloride Nutrition 0.000 claims 3
- 125000005207 tetraalkylammonium group Chemical group 0.000 claims 3
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 claims 2
- 229960003750 ethyl chloride Drugs 0.000 claims 2
- PRDUHXPVDHDGKN-UHFFFAOYSA-N tetrachloromethane;hydrate Chemical compound O.ClC(Cl)(Cl)Cl PRDUHXPVDHDGKN-UHFFFAOYSA-N 0.000 claims 2
- BSFODEXXVBBYOC-UHFFFAOYSA-N 8-[4-(dimethylamino)butan-2-ylamino]quinolin-6-ol Chemical group C1=CN=C2C(NC(CCN(C)C)C)=CC(O)=CC2=C1 BSFODEXXVBBYOC-UHFFFAOYSA-N 0.000 claims 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 claims 1
- 239000012046 mixed solvent Substances 0.000 claims 1
- 239000005820 Prochloraz Substances 0.000 description 6
- TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 description 6
- 231100000331 toxic Toxicity 0.000 description 6
- 230000002588 toxic effect Effects 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241000244317 Tillandsia usneoides Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 2
- HGUFODBRKLSHSI-UHFFFAOYSA-N 2,3,7,8-tetrachloro-dibenzo-p-dioxin Chemical compound O1C2=CC(Cl)=C(Cl)C=C2OC2=C1C=C(Cl)C(Cl)=C2 HGUFODBRKLSHSI-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000000711 cancerogenic effect Effects 0.000 description 2
- 231100000315 carcinogenic Toxicity 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- 150000004899 1,4-dioxins Chemical class 0.000 description 1
- LINPIYWFGCPVIE-UHFFFAOYSA-N 2,4,6-trichlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C=C1Cl LINPIYWFGCPVIE-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical group [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000002013 dioxins Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/02—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions involving the formation of amino groups from compounds containing hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Saccharide Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL9070489A IL90704A (en) | 1989-06-21 | 1989-06-21 | Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene) |
| ZA904573A ZA904573B (en) | 1989-06-21 | 1990-06-13 | An environmentally safe method of preparing a certain dialkylamine |
| DE69011977T DE69011977T2 (de) | 1989-06-21 | 1990-06-13 | In bezug auf die Umwelt sicheres Verfahren zur Herstellung eines bestimmten Dialkylamins. |
| AT90111202T ATE110710T1 (de) | 1989-06-21 | 1990-06-13 | In bezug auf die umwelt sicheres verfahren zur herstellung eines bestimmten dialkylamins. |
| EP90111202A EP0403952B1 (de) | 1989-06-21 | 1990-06-13 | In bezug auf die Umwelt sicheres Verfahren zur Herstellung eines bestimmten Dialkylamins |
| HU923863A HU207984B (en) | 1989-06-21 | 1990-06-13 | Process for producing n-/n-propyl/-n-/2-phenoxy-ethyl/-amine |
| HU903824A HU207709B (en) | 1989-06-21 | 1990-06-13 | Process for producing n-/n-propyl/-n-/2-/2,4,6-trichloro-phenoxy/-ethyl/-amine |
| US07/537,972 US5093526A (en) | 1989-06-21 | 1990-06-14 | Environmentally safe method of preparing a certain dialkylamine |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL9070489A IL90704A (en) | 1989-06-21 | 1989-06-21 | Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene) |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL90704A0 IL90704A0 (en) | 1990-01-18 |
| IL90704A true IL90704A (en) | 1994-10-07 |
Family
ID=11060075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL9070489A IL90704A (en) | 1989-06-21 | 1989-06-21 | Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene) |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5093526A (de) |
| EP (1) | EP0403952B1 (de) |
| AT (1) | ATE110710T1 (de) |
| DE (1) | DE69011977T2 (de) |
| HU (2) | HU207709B (de) |
| IL (1) | IL90704A (de) |
| ZA (1) | ZA904573B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL106118A (en) * | 1993-06-24 | 1997-08-14 | Agan Chemical Manufacturers | Process for preparing n-alkyl-3,4-dialkyl- 2,6-dinitro- anilines and intermediates thereof |
| SE9704834D0 (sv) * | 1997-12-22 | 1997-12-22 | Astra Ab | New process |
| CN100340550C (zh) * | 2005-09-16 | 2007-10-03 | 华南师范大学 | 咪酰胺的制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1469772A (en) * | 1973-06-21 | 1977-04-06 | Boots Co Ltd | Fungicidal imidazole derivatives |
| US4504484A (en) * | 1982-11-04 | 1985-03-12 | Chevron Research Company | Certain N,N-di-substituted-pyridine carboxamides, fungicidal compositions and fungicidal method of use |
| GB8609904D0 (en) * | 1986-04-23 | 1986-05-29 | Fbc Ltd | Preparation of metal phenates |
| GB8714920D0 (en) * | 1987-06-25 | 1987-07-29 | Shell Int Research | Thiazole derivatives |
-
1989
- 1989-06-21 IL IL9070489A patent/IL90704A/en not_active IP Right Cessation
-
1990
- 1990-06-13 DE DE69011977T patent/DE69011977T2/de not_active Expired - Fee Related
- 1990-06-13 AT AT90111202T patent/ATE110710T1/de not_active IP Right Cessation
- 1990-06-13 HU HU903824A patent/HU207709B/hu not_active IP Right Cessation
- 1990-06-13 EP EP90111202A patent/EP0403952B1/de not_active Expired - Lifetime
- 1990-06-13 ZA ZA904573A patent/ZA904573B/xx unknown
- 1990-06-13 HU HU923863A patent/HU207984B/hu not_active IP Right Cessation
- 1990-06-14 US US07/537,972 patent/US5093526A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| HU903824D0 (en) | 1990-11-28 |
| HU207709B (en) | 1993-05-28 |
| DE69011977T2 (de) | 1995-03-30 |
| US5093526A (en) | 1992-03-03 |
| ZA904573B (en) | 1992-01-29 |
| EP0403952A3 (de) | 1992-02-12 |
| ATE110710T1 (de) | 1994-09-15 |
| DE69011977D1 (de) | 1994-10-06 |
| HU9203863D0 (en) | 1993-03-29 |
| EP0403952B1 (de) | 1994-08-31 |
| IL90704A0 (en) | 1990-01-18 |
| HUT53864A (en) | 1990-12-28 |
| HU207984B (en) | 1993-07-28 |
| EP0403952A2 (de) | 1990-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4314086A (en) | Preparation of aliphatic/aromatic ethers | |
| IL90704A (en) | Method for the preparation of N-N-) 2,4,6-trichlorophenoxy (environmentally reliable ethylene) | |
| EP0147472B1 (de) | 4-chlor-4-methyl-5-methylen-1,3-dioxolan-2-on | |
| US5057633A (en) | Synthesis of perfluoroalkyl bromides | |
| US6353126B1 (en) | Process for the production of malononitrile | |
| US5091577A (en) | Method of preparing fungicidal intermediates | |
| JPH0745442B2 (ja) | ハロゲン化第4級アンモニウム化合物の製造法 | |
| US5091578A (en) | Method of preparing phenoxy ethers for use as agrochemical intermediates | |
| US4293702A (en) | Method for preparing 4-substituted-N-methylbenzothiazolone derivatives | |
| KR100619386B1 (ko) | 할로겐화 페닐말로네이트의 제조방법 | |
| US5510509A (en) | Preparation of esters of cyclopropane-1,1-dicarboxylic acid | |
| US7288678B2 (en) | Process for preparing terbinafine by using platinum as catalyst | |
| IL90702A (en) | Method of preparing n-n-propyl-n-2-(2,4,6-trichloro-phenoxy)-ethyl amine | |
| KR820001888B1 (ko) | N-알킬벤조티아졸론 유도체의 제조방법 | |
| US6037509A (en) | Process for producing 1-bromo-4-phenylbutane | |
| JPH08239338A (ja) | メチル−1,1−ジクロロメチルエーテルまたはエチル−1,1−ジクロロメチルエーテルの合成方法 | |
| EP0307106B1 (de) | P-oder m-tert-Butoxyphenethylalkohol und Verfahren zu dessen Herstellung | |
| US6706917B1 (en) | Preparing method of 2-phenylalkanoic acid derivatives | |
| GB2036720A (en) | Preparation of tetrachloro or tetrabromo cyclohexanone | |
| KR850001529B1 (ko) | 아미노산의 페놀에스테르 유도체의 제조방법 | |
| KR830002719B1 (ko) | 피레드로이드계 살충제 제조방법 | |
| EP0199506A2 (de) | Verfahren zur Herstellung von Alkylhalogeniden | |
| US20140336404A1 (en) | Method for producing pentafluorosulfanyl benzoic acid | |
| KR19980032426A (ko) | 아민 제조방법 | |
| JPH082895B2 (ja) | チオフェンジカルボン酸ジエステルを製造する方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RH | Patent void |