IL87427A - 5-Heterocyclic-substituted oxazolidine dihaloacetamides and compositions containing them - Google Patents
5-Heterocyclic-substituted oxazolidine dihaloacetamides and compositions containing themInfo
- Publication number
- IL87427A IL87427A IL8742788A IL8742788A IL87427A IL 87427 A IL87427 A IL 87427A IL 8742788 A IL8742788 A IL 8742788A IL 8742788 A IL8742788 A IL 8742788A IL 87427 A IL87427 A IL 87427A
- Authority
- IL
- Israel
- Prior art keywords
- rate
- methyl
- dote
- barnyard
- grass
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 84
- 150000002917 oxazolidines Chemical class 0.000 title description 4
- 235000011684 Sorghum saccharatum Nutrition 0.000 claims description 347
- 240000008042 Zea mays Species 0.000 claims description 254
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims description 254
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 254
- 235000005822 corn Nutrition 0.000 claims description 254
- 244000068988 Glycine max Species 0.000 claims description 192
- 235000010469 Glycine max Nutrition 0.000 claims description 192
- 230000002363 herbicidal effect Effects 0.000 claims description 159
- 235000021307 Triticum Nutrition 0.000 claims description 149
- 150000001875 compounds Chemical class 0.000 claims description 145
- 239000004009 herbicide Substances 0.000 claims description 136
- -1 hetero cyclic radical Chemical class 0.000 claims description 79
- 238000000034 method Methods 0.000 claims description 76
- WYNCHZVNFNFDNH-UHFFFAOYSA-N Oxazolidine Chemical compound C1COCN1 WYNCHZVNFNFDNH-UHFFFAOYSA-N 0.000 claims description 48
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 31
- 244000038559 crop plants Species 0.000 claims description 29
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 claims description 28
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 26
- 230000002605 anti-dotal effect Effects 0.000 claims description 22
- 229910052757 nitrogen Inorganic materials 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 19
- 125000005842 heteroatom Chemical group 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 claims description 16
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 claims description 16
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- 239000001301 oxygen Substances 0.000 claims description 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 15
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 claims description 14
- 239000005711 Benzoic acid Substances 0.000 claims description 13
- 235000010233 benzoic acid Nutrition 0.000 claims description 13
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 13
- 235000001968 nicotinic acid Nutrition 0.000 claims description 13
- 229960003512 nicotinic acid Drugs 0.000 claims description 13
- 239000011664 nicotinic acid Substances 0.000 claims description 13
- 125000000160 oxazolidinyl group Chemical group 0.000 claims description 13
- 150000003254 radicals Chemical class 0.000 claims description 13
- 150000004702 methyl esters Chemical class 0.000 claims description 12
- VTNQPKFIQCLBDU-UHFFFAOYSA-N Acetochlor Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000001188 haloalkyl group Chemical group 0.000 claims description 10
- 229960001413 acetanilide Drugs 0.000 claims description 9
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- WVQBLGZPHOPPFO-UHFFFAOYSA-N 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(C(C)COC)C(=O)CCl WVQBLGZPHOPPFO-UHFFFAOYSA-N 0.000 claims description 8
- QXDOFVVNXBGLKK-UHFFFAOYSA-N 3-Isoxazolidinone Chemical compound OC1=NOCC1 QXDOFVVNXBGLKK-UHFFFAOYSA-N 0.000 claims description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 8
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 claims description 7
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 claims description 6
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 claims description 6
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical group CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 claims description 6
- 240000006394 Sorghum bicolor Species 0.000 claims description 6
- 229940100389 Sulfonylurea Drugs 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000004434 sulfur atom Chemical group 0.000 claims description 6
- 231100000674 Phytotoxicity Toxicity 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002147 dimethylamino group Chemical class [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- YGTYRMDZBFYUCE-UHFFFAOYSA-N 2-chloro-n-(2-methoxy-6-methylphenyl)-n-(propan-2-yloxymethyl)acetamide Chemical compound COC1=CC=CC(C)=C1N(COC(C)C)C(=O)CCl YGTYRMDZBFYUCE-UHFFFAOYSA-N 0.000 claims description 3
- KTFNPLHWDYECSQ-UHFFFAOYSA-N 2-chloro-n-(ethoxymethyl)-n-[2-methyl-6-(trifluoromethyl)phenyl]acetamide Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1C(F)(F)F KTFNPLHWDYECSQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 150000003863 ammonium salts Chemical class 0.000 claims description 3
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 claims description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 3
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- UIWOZHBYBSGCOS-UHFFFAOYSA-N methoxy(oxido)phosphanium Chemical compound CO[PH2]=O UIWOZHBYBSGCOS-UHFFFAOYSA-N 0.000 claims description 3
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 claims description 3
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 claims description 3
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 claims description 3
- 125000006012 2-chloroethoxy group Chemical group 0.000 claims description 2
- DLXUBTVMCYYDGS-UHFFFAOYSA-N C1=C([N+]([O-])=O)C(C(=O)OCC)=C(OCC)C(OC=2C(=C(N(C)N=2)C(F)(F)F)Cl)=C1 Chemical compound C1=C([N+]([O-])=O)C(C(=O)OCC)=C(OCC)C(OC=2C(=C(N(C)N=2)C(F)(F)F)Cl)=C1 DLXUBTVMCYYDGS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 5
- 239000011593 sulfur Substances 0.000 claims 5
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 claims 4
- ZJULYDCRWUEPTK-UHFFFAOYSA-N dichloromethyl Chemical compound Cl[CH]Cl ZJULYDCRWUEPTK-UHFFFAOYSA-N 0.000 claims 3
- 125000004970 halomethyl group Chemical group 0.000 claims 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims 2
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 claims 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims 2
- SUSRORUBZHMPCO-UHFFFAOYSA-N MC-4379 Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 claims 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 2
- 239000002253 acid Substances 0.000 claims 2
- 239000004202 carbamide Substances 0.000 claims 2
- 150000002148 esters Chemical class 0.000 claims 2
- 125000000842 isoxazolyl group Chemical group 0.000 claims 2
- 150000003951 lactams Chemical class 0.000 claims 2
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical compound [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 claims 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 2
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 claims 1
- ZBMRKNMTMPPMMK-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid;azane Chemical compound [NH4+].CP(O)(=O)CCC(N)C([O-])=O ZBMRKNMTMPPMMK-UHFFFAOYSA-N 0.000 claims 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims 1
- WYFCZWSWFGJODV-MIANJLSGSA-N 4-[[(1s)-2-[(e)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]-5-(4-methyl-2-oxopiperazin-1-yl)-3,4-dihydro-1h-isoquinoline-1-carbonyl]amino]benzoic acid Chemical compound O=C1CN(C)CCN1C1=CC=CC2=C1CCN(C(=O)\C=C\C=1C(=CC=C(Cl)C=1F)N1N=NN=C1)[C@@H]2C(=O)NC1=CC=C(C(O)=O)C=C1 WYFCZWSWFGJODV-MIANJLSGSA-N 0.000 claims 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 1
- 244000098338 Triticum aestivum Species 0.000 claims 1
- 235000010716 Vigna mungo Nutrition 0.000 claims 1
- 240000001417 Vigna umbellata Species 0.000 claims 1
- 235000011453 Vigna umbellata Nutrition 0.000 claims 1
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 claims 1
- ZQOKGFJVSMHJSW-UHFFFAOYSA-N dimethyl 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)pyridine-3,5-dicarboxylate Chemical compound COC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)OC)=C1CC(C)C ZQOKGFJVSMHJSW-UHFFFAOYSA-N 0.000 claims 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- GVBSRTBYUFJDIW-UHFFFAOYSA-N pyridine-3,5-dicarbothioic s-acid Chemical compound OC(=S)C1=CN=CC(C(O)=S)=C1 GVBSRTBYUFJDIW-UHFFFAOYSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 424
- 230000000694 effects Effects 0.000 description 376
- 230000005764 inhibitory process Effects 0.000 description 373
- 244000237956 Amaranthus retroflexus Species 0.000 description 348
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 348
- 240000001592 Amaranthus caudatus Species 0.000 description 345
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 345
- 244000062793 Sorghum vulgare Species 0.000 description 341
- 244000025254 Cannabis sativa Species 0.000 description 239
- 235000013339 cereals Nutrition 0.000 description 176
- 235000004135 Amaranthus viridis Nutrition 0.000 description 175
- 235000009344 Chenopodium album Nutrition 0.000 description 175
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 175
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 175
- 235000014224 Ceanothus americanus Nutrition 0.000 description 173
- 235000001904 Ceanothus herbaceus Nutrition 0.000 description 173
- 241000209140 Triticum Species 0.000 description 148
- 240000007594 Oryza sativa Species 0.000 description 115
- 235000007164 Oryza sativa Nutrition 0.000 description 115
- 235000009566 rice Nutrition 0.000 description 115
- 239000000729 antidote Substances 0.000 description 106
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 67
- 240000003176 Digitaria ciliaris Species 0.000 description 67
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 67
- 235000005476 Digitaria cruciata Nutrition 0.000 description 67
- 235000006830 Digitaria didactyla Nutrition 0.000 description 67
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 67
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 67
- 235000014716 Eleusine indica Nutrition 0.000 description 67
- 239000002689 soil Substances 0.000 description 40
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 19
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000007787 solid Substances 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 230000006378 damage Effects 0.000 description 15
- 208000027418 Wounds and injury Diseases 0.000 description 14
- 208000014674 injury Diseases 0.000 description 14
- 229940075522 antidotes Drugs 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 229960005419 nitrogen Drugs 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 125000001984 thiazolidinyl group Chemical group 0.000 description 8
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical class CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 7
- 239000003815 herbicide antidote Substances 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical group O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 230000035945 sensitivity Effects 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- 238000010626 work up procedure Methods 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 238000007630 basic procedure Methods 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 230000001681 protective effect Effects 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical class C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 4
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical group CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 229940093499 ethyl acetate Drugs 0.000 description 4
- 235000019439 ethyl acetate Nutrition 0.000 description 4
- 238000011221 initial treatment Methods 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 230000003287 optical effect Effects 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 230000000007 visual effect Effects 0.000 description 4
- AZVSIHIBYRHSLB-UHFFFAOYSA-N 3-furaldehyde Chemical compound O=CC=1C=COC=1 AZVSIHIBYRHSLB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000015505 Sorghum bicolor subsp. bicolor Nutrition 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 3
- 125000004982 dihaloalkyl group Chemical group 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000010899 nucleation Methods 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 125000006684 polyhaloalkyl group Polymers 0.000 description 3
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ZPHGMBGIFODUMF-UHFFFAOYSA-N thiophen-2-ylmethanol Chemical group OCC1=CC=CS1 ZPHGMBGIFODUMF-UHFFFAOYSA-N 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- OKUGPJPKMAEJOE-UHFFFAOYSA-N S-propyl dipropylcarbamothioate Chemical compound CCCSC(=O)N(CCC)CCC OKUGPJPKMAEJOE-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 235000009430 Thespesia populnea Nutrition 0.000 description 2
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- SCCDDNKJYDZXMM-UHFFFAOYSA-N dimethachlor Chemical compound COCCN(C(=O)CCl)C1=C(C)C=CC=C1C SCCDDNKJYDZXMM-UHFFFAOYSA-N 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000006682 monohaloalkyl group Chemical group 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- LIXFJRLISFERDN-UHFFFAOYSA-N o-ethyl n,n-dipropylcarbamothioate Chemical compound CCCN(CCC)C(=S)OCC LIXFJRLISFERDN-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical group CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- OVRJVKCZJCNSOW-UHFFFAOYSA-N thian-4-one Chemical compound O=C1CCSCC1 OVRJVKCZJCNSOW-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 2
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- UAYWVJHJZHQCIE-UHFFFAOYSA-L zinc iodide Chemical compound I[Zn]I UAYWVJHJZHQCIE-UHFFFAOYSA-L 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- ZNCQAWVUPFJBRC-UHFFFAOYSA-N 1-amino-1-(furan-2-yl)ethanol Chemical compound CC(N)(O)C1=CC=CO1 ZNCQAWVUPFJBRC-UHFFFAOYSA-N 0.000 description 1
- RMNHQVOPFQZPBO-UHFFFAOYSA-N 1-amino-1-thiophen-2-ylethanol Chemical group CC(N)(O)C1=CC=CS1 RMNHQVOPFQZPBO-UHFFFAOYSA-N 0.000 description 1
- KMDUXADUKNTNFV-UHFFFAOYSA-N 2,2-dichloro-1-(1,3-oxazolidin-2-yl)ethanone Chemical compound ClC(Cl)C(=O)C1NCCO1 KMDUXADUKNTNFV-UHFFFAOYSA-N 0.000 description 1
- KMSJAVXTRNHMQH-UHFFFAOYSA-N 2,2-dichloro-1-[2,2-dimethyl-5-(oxolan-2-yl)-1,3-oxazolidin-3-yl]ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1OCCC1 KMSJAVXTRNHMQH-UHFFFAOYSA-N 0.000 description 1
- VFXYOVMPHZCCJZ-UHFFFAOYSA-N 2,2-dimethyl-5-thiophen-2-yl-1,3-oxazolidine Chemical compound O1C(C)(C)NCC1C1=CC=CS1 VFXYOVMPHZCCJZ-UHFFFAOYSA-N 0.000 description 1
- YUVKUEAFAVKILW-UHFFFAOYSA-N 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 YUVKUEAFAVKILW-UHFFFAOYSA-N 0.000 description 1
- IZXIZTKNFFYFOF-UHFFFAOYSA-N 2-Oxazolidone Chemical group O=C1NCCO1 IZXIZTKNFFYFOF-UHFFFAOYSA-N 0.000 description 1
- VJJUFFDBEYLMFG-UHFFFAOYSA-N 2-[(1-amino-2-chloro-6-ethyl-2h-1,3,5-triazin-4-yl)amino]-2-methylpropanenitrile Chemical compound CCC1=NC(NC(C)(C)C#N)=NC(Cl)N1N VJJUFFDBEYLMFG-UHFFFAOYSA-N 0.000 description 1
- JWQAFPHYLSGNSK-UHFFFAOYSA-N 2-amino-1-(furan-2-yl)ethanol Chemical compound NCC(O)C1=CC=CO1 JWQAFPHYLSGNSK-UHFFFAOYSA-N 0.000 description 1
- BTKNUYMZBBWHIM-UHFFFAOYSA-N 2-amino-1-pyridin-3-ylethanol Chemical compound NCC(O)C1=CC=CN=C1 BTKNUYMZBBWHIM-UHFFFAOYSA-N 0.000 description 1
- LQOQARMWPVWBJX-UHFFFAOYSA-N 2-benzofuran-1-ylmethanol Chemical compound C1=CC=CC2=C(CO)OC=C21 LQOQARMWPVWBJX-UHFFFAOYSA-N 0.000 description 1
- YVUFDPUKVYAZNX-UHFFFAOYSA-N 2-bromo-2-chloroacetyl chloride Chemical group ClC(Br)C(Cl)=O YVUFDPUKVYAZNX-UHFFFAOYSA-N 0.000 description 1
- TUYICDQKMSJMRE-UHFFFAOYSA-N 2-chloro-n-(propan-2-yloxymethyl)-n-[2-(trifluoromethyl)phenyl]acetamide Chemical compound CC(C)OCN(C(=O)CCl)C1=CC=CC=C1C(F)(F)F TUYICDQKMSJMRE-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- SKBLIYZUXDVPIX-UHFFFAOYSA-N 3,6-dichloro-2-ethoxybenzoic acid Chemical compound CCOC1=C(C(O)=O)C(Cl)=CC=C1Cl SKBLIYZUXDVPIX-UHFFFAOYSA-N 0.000 description 1
- UWLMUONZVXBOEP-UHFFFAOYSA-N 3-(furan-2-yl)-3-hydroxypropanenitrile Chemical compound N#CCC(O)C1=CC=CO1 UWLMUONZVXBOEP-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- VRUFTFZZSSSPML-UHFFFAOYSA-N 3-hydroxyoxolane-2-carbaldehyde Chemical compound OC1CCOC1C=O VRUFTFZZSSSPML-UHFFFAOYSA-N 0.000 description 1
- BSQKBHXYEKVKMN-UHFFFAOYSA-N 3-methylthiophene-2-carbaldehyde Chemical group CC=1C=CSC=1C=O BSQKBHXYEKVKMN-UHFFFAOYSA-N 0.000 description 1
- ZGKUOQNSLDHTHP-UHFFFAOYSA-N 4-chloro-3-(3-methoxy-4-nitrophenoxy)-1-methyl-5-(trifluoromethyl)pyrazole Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=C(N(C)N=2)C(F)(F)F)Cl)=C1 ZGKUOQNSLDHTHP-UHFFFAOYSA-N 0.000 description 1
- UMOHAXPHYCGZSR-UHFFFAOYSA-N 4-fluoro-3,3-bis(fluoromethyl)butan-2-one Chemical compound CC(=O)C(CF)(CF)CF UMOHAXPHYCGZSR-UHFFFAOYSA-N 0.000 description 1
- ILOZECIQNMSVCK-UHFFFAOYSA-N 4-methyl-n,n-dipropylaniline Chemical compound CCCN(CCC)C1=CC=C(C)C=C1 ILOZECIQNMSVCK-UHFFFAOYSA-N 0.000 description 1
- KMZIZRHLLMNWNT-UHFFFAOYSA-N 5-phenoxy-1h-pyrazole Chemical class C=1C=CC=CC=1OC=1C=CNN=1 KMZIZRHLLMNWNT-UHFFFAOYSA-N 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical group ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 1
- WFKSADNZWSKCRZ-UHFFFAOYSA-N Diethatyl-ethyl Chemical group CCOC(=O)CN(C(=O)CCl)C1=C(CC)C=CC=C1CC WFKSADNZWSKCRZ-UHFFFAOYSA-N 0.000 description 1
- 239000005508 Dimethachlor Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 1
- 241001063191 Elops affinis Species 0.000 description 1
- 235000002756 Erythrina berteroana Nutrition 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 239000005580 Metazachlor Substances 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- YIJZJEYQBAAWRJ-UHFFFAOYSA-N Thiazopyr Chemical compound N1=C(C(F)F)C(C(=O)OC)=C(CC(C)C)C(C=2SCCN=2)=C1C(F)(F)F YIJZJEYQBAAWRJ-UHFFFAOYSA-N 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 239000008351 acetate buffer Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- NLGSBXAWUUVELO-UHFFFAOYSA-N benzylcarbamodithioic acid Chemical compound SC(=S)NCC1=CC=CC=C1 NLGSBXAWUUVELO-UHFFFAOYSA-N 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 238000012925 biological evaluation Methods 0.000 description 1
- 230000008512 biological response Effects 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical class NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical class NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000006371 dihalo methyl group Chemical group 0.000 description 1
- MPFLRYZEEAQMLQ-UHFFFAOYSA-N dinicotinic acid Chemical compound OC(=O)C1=CN=CC(C(O)=O)=C1 MPFLRYZEEAQMLQ-UHFFFAOYSA-N 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- ZBHDTYQJAQDBIH-UHFFFAOYSA-N fluoroacetyl chloride Chemical compound FCC(Cl)=O ZBHDTYQJAQDBIH-UHFFFAOYSA-N 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- XPFVYQJUAUNWIW-UHFFFAOYSA-N furfuryl alcohol Chemical compound OCC1=CC=CO1 XPFVYQJUAUNWIW-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- CONWAEURSVPLRM-UHFFFAOYSA-N lactofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC(C)C(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 CONWAEURSVPLRM-UHFFFAOYSA-N 0.000 description 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 108010031620 mandelonitrile lyase Proteins 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N methyl acetate Chemical compound COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- OIRDBPQYVWXNSJ-UHFFFAOYSA-N methyl trifluoromethansulfonate Chemical compound COS(=O)(=O)C(F)(F)F OIRDBPQYVWXNSJ-UHFFFAOYSA-N 0.000 description 1
- GYNNXHKOJHMOHS-UHFFFAOYSA-N methyl-cycloheptane Natural products CC1CCCCCC1 GYNNXHKOJHMOHS-UHFFFAOYSA-N 0.000 description 1
- 238000000302 molecular modelling Methods 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000005004 perfluoroethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- DXBWJLDFSICTIH-UHFFFAOYSA-N pyrazine-2-carbaldehyde Chemical class O=CC1=CN=CC=N1 DXBWJLDFSICTIH-UHFFFAOYSA-N 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000023798 response to herbicide Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- DSXFPRKPFJRPIB-UHFFFAOYSA-N thiolan-3-one Chemical compound O=C1CCSC1 DSXFPRKPFJRPIB-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical group ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N25/00—Biocides, pest repellants or attractants, or plant growth regulators, characterised by their forms, or by their non-active ingredients or by their methods of application, e.g. seed treatment or sequential application; Substances for reducing the noxious effect of the active ingredients to organisms other than pests
- A01N25/32—Ingredients for reducing the noxious effect of the active substances to organisms other than pests, e.g. toxicity reducing compositions, self-destructing compositions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/12—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/96—Spiro-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/10—Spiro-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Toxicology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Pest Control & Pesticides (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Emergency Lowering Means (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8478687A | 1987-08-13 | 1987-08-13 | |
| US07/212,621 US5225570A (en) | 1987-08-13 | 1988-07-01 | 5-heterocyclic-substituted oxazolidine dihaloacetamides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL87427A0 IL87427A0 (en) | 1989-01-31 |
| IL87427A true IL87427A (en) | 1995-01-24 |
Family
ID=26771426
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL8742788A IL87427A (en) | 1987-08-13 | 1988-08-12 | 5-Heterocyclic-substituted oxazolidine dihaloacetamides and compositions containing them |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5225570A (enExample) |
| EP (1) | EP0304409B1 (enExample) |
| JP (1) | JPH0653737B2 (enExample) |
| CN (1) | CN1025141C (enExample) |
| AU (1) | AU608639B2 (enExample) |
| BG (1) | BG49813A3 (enExample) |
| BR (1) | BR8804098A (enExample) |
| CA (1) | CA1328108C (enExample) |
| DE (1) | DE3875556T2 (enExample) |
| DK (1) | DK451988A (enExample) |
| ES (1) | ES2010153T3 (enExample) |
| GR (1) | GR3006869T3 (enExample) |
| HU (1) | HU205826B (enExample) |
| IL (1) | IL87427A (enExample) |
| PL (1) | PL274217A1 (enExample) |
| RU (1) | RU2093029C1 (enExample) |
| UA (1) | UA35539C2 (enExample) |
| YU (1) | YU47061B (enExample) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5256625A (en) * | 1987-08-13 | 1993-10-26 | Monsanto Company | Safening imidazolinone herbicides |
| US5710100A (en) * | 1987-08-13 | 1998-01-20 | Monsanto Company | Safening imidazolinone herbicides |
| US5502025A (en) * | 1987-08-13 | 1996-03-26 | Monsanto Company | Safening herbicidal pyrazolylsulfonylureas |
| US5256630A (en) * | 1987-08-13 | 1993-10-26 | Monsanto Company | Safening mixtures of sulfonylurea and acetanilide herbicides |
| YU48319B (sh) * | 1988-08-01 | 1998-05-15 | Monsanto Company | Bezbednosni herbicidni derivati benzoeve kiseline |
| US5880066A (en) * | 1990-12-11 | 1999-03-09 | Monsanto Company | Safened herbicidal sulfonamide compositions |
| US5395816A (en) * | 1990-12-12 | 1995-03-07 | Imperial Chemical Industries Plc | Antidoting herbicidal 3-ixoxazolidinone compounds |
| US5527762A (en) * | 1990-12-12 | 1996-06-18 | Zeneca Limited | Antidoting herbicidal 3-isoxazolidinone compounds |
| ATE117169T1 (de) * | 1990-12-12 | 1995-02-15 | Zeneca Inc | Pflanzenschützende herbizide 3-isoxazolidinone zusammensetzungen. |
| US5691274A (en) * | 1990-12-12 | 1997-11-25 | Zeneca Limited | Antidoting herbicidal 3-isoxazolidinone compounds |
| US5484760A (en) * | 1990-12-31 | 1996-01-16 | Monsanto Company | Herbicide antidotes as safeners for reducing phytotoxicity resulting from synergistic interaction between herbicides and other pesticides |
| US5541148A (en) * | 1992-07-08 | 1996-07-30 | Ciba-Geigy Corporation | Selective safened herbicidal composition comprising 2-ethoxycarbonyl-3-(4,6-dimethoxypyrimidine-2-yl) oxy-pyridine and an acylsulfamoylphenyl-urea safener |
| US5470741A (en) * | 1992-07-22 | 1995-11-28 | Henkel Corporation | Mutant of Geotrichum candidum which produces novel enzyme system to selectively hydrolyze triglycerides |
| ES2131656T3 (es) * | 1993-03-22 | 1999-08-01 | Novartis Ag | Agente herbicida selectivo. |
| EE9500018A (et) | 1994-06-03 | 1995-12-15 | Ciba-Geigy Ag | Selektiivne herbitsiid ja meetod selle kasutamiseks |
| ATE171842T1 (de) * | 1994-08-30 | 1998-10-15 | Rohm & Haas | Zusammensetzungen aus phosphosulphonat-herbizide und dichloracetamide-safener und verwendungsmethoden |
| US5693590A (en) * | 1994-08-30 | 1997-12-02 | Rohm And Haas Company | Compositions containing phosphosulfonate herbicides and dichloroacetamide safeners |
| WO1997018712A1 (en) * | 1995-11-23 | 1997-05-29 | Novartis Ag | Herbicidal composition |
| US7071146B1 (en) | 1996-11-11 | 2006-07-04 | Syngenta Crop Protection, Inc. | Herbicidal composition |
| WO1998047356A2 (de) * | 1997-04-23 | 1998-10-29 | Novartis Ag | Dicamba und safener enthaltende herbizide mittel |
| US5905057A (en) * | 1997-11-06 | 1999-05-18 | Rhone-Poulenc Agrochimie | Herbicidal 4-benzoylisoxazole-3-carboxylate liquid compositions comprising N-alkylpyrrolidinone stabilizer |
| US20040142198A1 (en) * | 2003-01-21 | 2004-07-22 | Thomas Hubert Van Steenkiste | Magnetostrictive/magnetic material for use in torque sensors |
| RU2242123C1 (ru) * | 2003-08-04 | 2004-12-20 | Кубанский государственный технологический университет | Средство для снижения токсического действия гербицида 2,4-дихлорфеноксиуксусной кислоты на подсолнечнике |
| JP2008510755A (ja) | 2004-08-25 | 2008-04-10 | アクテリオン ファーマシューティカルズ リミテッド | ビシクロノネン誘導体 |
| RU2277329C1 (ru) * | 2005-02-07 | 2006-06-10 | Всероссийский научно-исследовательский институт биологической защиты растений | Способ защиты вегетирующих растений подсолнечника от повреждающего действия 2,4-д |
| RU2277332C1 (ru) * | 2005-02-09 | 2006-06-10 | Всероссийский научно-исследовательский институт биологической защиты растений | Способ защиты вегетирующих растений подсолнечника от повреждающего действия 2,4-д |
| RU2277333C1 (ru) * | 2005-02-14 | 2006-06-10 | Всероссийский научно-исследовательский институт биологической защиты растений | Способ защиты вегетирующих растений подсолнечника от повреждающего действия 2,4-д |
| RU2309571C1 (ru) * | 2006-05-02 | 2007-11-10 | Федеральное государственное образовательное учреждение высшего профессионального образования "Воронежский государственный аграрный университет имени К.Д. Глинки" (ФГОУ ВПО ВГАУ им. К.Д. Глинки) | Способ обогащения черноземной почвы при возделывании сельскохозяйственных культур |
| CN101069501A (zh) | 2007-05-28 | 2007-11-14 | 江苏龙灯化学有限公司 | 双取代长链烷基酰胺类作为结晶抑制剂在唑类农药液剂中的应用 |
| WO2009021987A1 (en) | 2007-08-16 | 2009-02-19 | Solvay (Société Anonyme) | Process for the preparation of esters of 4-fluorosubstituted 3-oxo-alcanoic acids |
| CN102617560A (zh) * | 2011-01-30 | 2012-08-01 | 南京理工大学 | 呋喃解草唑的制备方法 |
| AR091901A1 (es) | 2012-07-25 | 2015-03-11 | Amvac Chemical Corp | Composiciones herbicidas dispersables y metodos de uso de las mismas |
| CN106045861B (zh) * | 2016-05-26 | 2019-04-19 | 山东润博生物科技有限公司 | 一种连续化生产5-氟-2-硝基苯酚的方法及其系统 |
| CN107935858B (zh) * | 2016-10-12 | 2020-09-08 | 利尔化学股份有限公司 | 5-氟-2-硝基苯酚的制备方法 |
| CA3185623A1 (en) | 2020-06-02 | 2021-12-09 | Bayer Aktiengesellschaft | Selective herbicides based on substituted isoxazolin carboxamides and furilazole |
| WO2024197109A1 (en) * | 2023-03-23 | 2024-09-26 | Fmc Corporation | Substituted oxazolidinones and imidazolinones as herbicides |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4072688A (en) * | 1975-02-14 | 1978-02-07 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines-herbicidal antidotes |
| BR7600775A (pt) * | 1975-02-14 | 1977-05-10 | Stauffer Chemical Co | Processo para a obtencao de(tio)haloacil-(tia)oxazolidinas arisubstituidas e composicoes herbicidas sinergeticas que as contem |
| CA1075701A (en) * | 1975-08-28 | 1980-04-15 | Harold M. Pitt | Production of n-substituted oxazolidines |
| US4400200A (en) * | 1977-10-11 | 1983-08-23 | Stauffer Chemical Company | Haloacyl and thiohaloacyl aryl-substituted oxazolidines and thiazolidines - herbicidal antidotes |
| GB1538318A (en) * | 1976-08-09 | 1979-01-17 | Stauffer Chemical Co | Preparation of n-substituted oxazolidines |
| US4219655A (en) * | 1979-07-16 | 1980-08-26 | Stauffer Chemical Company | Process for the production of N-acyl substituted oxazolidines |
| WO1981000406A1 (en) * | 1979-08-03 | 1981-02-19 | Stauffer Chemical Co | Spirooxazolidines and thiazolidines as herbicide antidotes |
| BR8205085A (pt) * | 1981-09-08 | 1983-08-09 | Stauffer Chemical Co | Composicao de antidoto herbicida e processo para estabelecer seletividade herbicida |
| US4648894A (en) * | 1983-05-20 | 1987-03-10 | Stauffer Chemical Co. | Herbicide compositions of extended soil life |
| PL144076B1 (en) * | 1983-08-24 | 1988-04-30 | Stauffer Chemical Co | Herbicide |
| US4613083A (en) * | 1984-06-21 | 1986-09-23 | Nordson Corporation | Adjustable powder spray gun |
| EP0190105A3 (de) * | 1985-01-31 | 1988-10-26 | Ciba-Geigy Ag | Herbizides Mittel |
| DE3600288A1 (de) * | 1986-01-08 | 1987-07-16 | Bayer Ag | Verwendung von amiden zur verbesserung der kulturpflanzen-vertraeglichkeit von herbizid wirksamen sulfonylharnstoff-derivaten |
| DE3618004A1 (de) * | 1986-05-28 | 1987-12-03 | Bayer Ag | Verwendung von amiden zur verbesserung der kulturpflanzen-vertraeglichkeit von herbizid wirksamen sulfonyliso(thio)-harnstoff-derivaten |
| NZ222993A (en) * | 1986-12-22 | 1989-09-27 | Stauffer Agricultural Chemical | Herbicidal compositions containing an acyl substituted oxazolidone antidote and two active herbicides |
-
1988
- 1988-07-01 US US07/212,621 patent/US5225570A/en not_active Expired - Lifetime
- 1988-08-12 IL IL8742788A patent/IL87427A/en not_active IP Right Cessation
- 1988-08-12 AU AU20660/88A patent/AU608639B2/en not_active Ceased
- 1988-08-12 YU YU157188A patent/YU47061B/sh unknown
- 1988-08-12 RU SU884356197A patent/RU2093029C1/ru not_active IP Right Cessation
- 1988-08-12 BR BR8804098A patent/BR8804098A/pt not_active IP Right Cessation
- 1988-08-12 ES ES88870135T patent/ES2010153T3/es not_active Expired - Lifetime
- 1988-08-12 BG BG085225A patent/BG49813A3/xx unknown
- 1988-08-12 HU HU884342A patent/HU205826B/hu unknown
- 1988-08-12 CA CA000574701A patent/CA1328108C/en not_active Expired - Lifetime
- 1988-08-12 CN CN88104956A patent/CN1025141C/zh not_active Expired - Lifetime
- 1988-08-12 JP JP63201816A patent/JPH0653737B2/ja not_active Expired - Fee Related
- 1988-08-12 EP EP88870135A patent/EP0304409B1/en not_active Expired - Lifetime
- 1988-08-12 DK DK451988A patent/DK451988A/da not_active Application Discontinuation
- 1988-08-12 DE DE8888870135T patent/DE3875556T2/de not_active Expired - Lifetime
- 1988-08-12 UA UA4356197A patent/UA35539C2/uk unknown
- 1988-08-12 PL PL27421788A patent/PL274217A1/xx unknown
-
1993
- 1993-01-21 GR GR930400123T patent/GR3006869T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU47061B (sh) | 1994-12-28 |
| PL274217A1 (en) | 1989-04-17 |
| BR8804098A (pt) | 1989-03-07 |
| CN1031375A (zh) | 1989-03-01 |
| IL87427A0 (en) | 1989-01-31 |
| RU2093029C1 (ru) | 1997-10-20 |
| ES2010153T3 (es) | 1994-07-16 |
| DE3875556D1 (de) | 1992-12-03 |
| JPH0653737B2 (ja) | 1994-07-20 |
| CN1025141C (zh) | 1994-06-29 |
| DK451988A (da) | 1989-02-14 |
| AU2066088A (en) | 1989-02-16 |
| US5225570A (en) | 1993-07-06 |
| BG49813A3 (en) | 1992-02-14 |
| DE3875556T2 (de) | 1993-05-06 |
| EP0304409A1 (en) | 1989-02-22 |
| JPS6483079A (en) | 1989-03-28 |
| HUT47789A (en) | 1989-04-28 |
| AU608639B2 (en) | 1991-04-11 |
| UA35539C2 (uk) | 2001-04-16 |
| DK451988D0 (da) | 1988-08-12 |
| CA1328108C (en) | 1994-03-29 |
| GR3006869T3 (enExample) | 1993-06-30 |
| YU157188A (en) | 1990-08-31 |
| EP0304409B1 (en) | 1992-10-28 |
| HU205826B (en) | 1992-07-28 |
| ES2010153A4 (es) | 1989-11-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0304409B1 (en) | 5-heterocyclic-substituted oxazolidine haloacetamides | |
| EP0268554B1 (de) | 1,5-Diphenylpyrazol-3-carbonsäurederivate zum Schützen von Kulturpflanzen | |
| US5201933A (en) | Safening herbicidal benzoic acid derivatives | |
| JPH0576470B2 (enExample) | ||
| US5880066A (en) | Safened herbicidal sulfonamide compositions | |
| US5502025A (en) | Safening herbicidal pyrazolylsulfonylureas | |
| US5256630A (en) | Safening mixtures of sulfonylurea and acetanilide herbicides | |
| US5256625A (en) | Safening imidazolinone herbicides | |
| CA1243022A (en) | Benzoxazine and benzthiazine derivatives | |
| US4618361A (en) | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides | |
| US5256626A (en) | Herbicidal compositions safened by 5-heterocyclic-substituted oxazolidine dihaloacetamides compounds | |
| JPH07507276A (ja) | 殺節足動物性アミド類 | |
| AU624169B2 (en) | Safening herbicidal benzoic acid derivatives | |
| US5108482A (en) | N-phenylpyrrolidines | |
| US4897109A (en) | Compositions for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides | |
| US4755218A (en) | Haloacyl 1-substituted-1,2,3,4-tetrahydro-isoquinolines as herbicide antidotes | |
| US4818270A (en) | 2-(Heteroamino)-4,5-substituted-oxazole/thiazole compounds as herbicide antidotes, compositions and use | |
| CA2000509A1 (en) | Substituted indazoles as arthropodicides | |
| US5710100A (en) | Safening imidazolinone herbicides | |
| EP0531271A1 (en) | Safening herbicidal pyrazolysulfonylureas | |
| US6303542B1 (en) | Herbicidal 3-substituted-phenyl-1,2,3-benzotriazin-4-ones | |
| US4846880A (en) | 2-(Dichloroacetyl)-3-substituted-1,2,3,4-tetrahydroisoquinolines as herbicide antidotes | |
| KR100641971B1 (ko) | 살충성 디히드로-옥사디아진 | |
| JP2000505062A (ja) | 除草剤としての1,3―オキサジン―4―オン誘導体 | |
| JPS61180759A (ja) | フエノキシベンジル尿素誘導体及び除草剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| KB | Patent renewed | ||
| KB | Patent renewed | ||
| MM9K | Patent not in force due to non-payment of renewal fees |