IL76892A - Preparation of optically active azolyl-carbinol derivatives,optically active 2-(4-chlorophenoxymethyl)-3,3-dimethyl-1(1,2,4-triazol-1-yl)-2-butanol thus prepared and pharmaceutical compositions containing it - Google Patents
Preparation of optically active azolyl-carbinol derivatives,optically active 2-(4-chlorophenoxymethyl)-3,3-dimethyl-1(1,2,4-triazol-1-yl)-2-butanol thus prepared and pharmaceutical compositions containing itInfo
- Publication number
- IL76892A IL76892A IL76892A IL7689285A IL76892A IL 76892 A IL76892 A IL 76892A IL 76892 A IL76892 A IL 76892A IL 7689285 A IL7689285 A IL 7689285A IL 76892 A IL76892 A IL 76892A
- Authority
- IL
- Israel
- Prior art keywords
- optically active
- chlorophenoxymethyl
- azolyl
- triazol
- butanol
- Prior art date
Links
- OCQPZTCGZAFWSG-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)COC1=CC=C(Cl)C=C1 OCQPZTCGZAFWSG-UHFFFAOYSA-N 0.000 title 1
- KORIJXKQGMTQTO-UHFFFAOYSA-N 1h-pyrrol-2-ylmethanol Chemical class OCC1=CC=CN1 KORIJXKQGMTQTO-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19843440112 DE3440112A1 (de) | 1984-11-02 | 1984-11-02 | Verfahren zur herstellung optisch aktiver azolylcarbinol-derivate |
| DE19843440118 DE3440118A1 (de) | 1984-11-02 | 1984-11-02 | Optisch aktives 2-(4-chlorphenoxymethyl)-3,3-dimethyl-1-(1,2,4-triazol-l-yl)-2-butanol, verfahren zu seiner herstellung sowie seine verwendung als antimykotikum |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL76892A0 IL76892A0 (en) | 1986-02-28 |
| IL76892A true IL76892A (en) | 1989-12-15 |
Family
ID=25826192
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL76892A IL76892A (en) | 1984-11-02 | 1985-10-31 | Preparation of optically active azolyl-carbinol derivatives,optically active 2-(4-chlorophenoxymethyl)-3,3-dimethyl-1(1,2,4-triazol-1-yl)-2-butanol thus prepared and pharmaceutical compositions containing it |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4783538A (index.php) |
| EP (1) | EP0181529B1 (index.php) |
| KR (1) | KR860004033A (index.php) |
| AU (1) | AU578500B2 (index.php) |
| CA (1) | CA1260482A (index.php) |
| DE (1) | DE3582305D1 (index.php) |
| DK (1) | DK162989C (index.php) |
| ES (1) | ES8702376A1 (index.php) |
| FI (1) | FI854284A7 (index.php) |
| GR (1) | GR852624B (index.php) |
| HU (1) | HU193615B (index.php) |
| IL (1) | IL76892A (index.php) |
| PT (1) | PT81413B (index.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3627673A1 (de) * | 1986-08-14 | 1988-02-25 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| DE3703082A1 (de) * | 1987-02-03 | 1988-08-11 | Bayer Ag | Verfahren zur herstellung optisch aktiver 2-hydroxyethyl-azol-derivate |
| DE3716558A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-azolyl-derivate |
| DE3716560A1 (de) * | 1987-05-18 | 1988-12-01 | Bayer Ag | Hydroxyalkyl-triazolyl-derivate |
| CN102659696B (zh) * | 2012-05-04 | 2014-07-16 | 北京颖泰嘉和生物科技有限公司 | 一种提高戊唑醇抗结块性的方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4036970A (en) * | 1975-07-28 | 1977-07-19 | Syntex (U.S.A.) Inc. | Imidazol-1-yl propane derivatives |
| AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
| DE3018865A1 (de) * | 1980-05-16 | 1981-11-26 | Bayer Ag, 5090 Leverkusen | Antimikrobielle mittel |
| GB2080795A (en) * | 1980-07-28 | 1982-02-10 | Ici Ltd | Separation of optical isomers of 1-(4-chlorophenyl)-4,4-dimethyl-2- (1,2,4-triazol-1-yl)-pentan-3-ol |
| EP0131684B1 (en) * | 1980-08-18 | 1992-03-11 | Imperial Chemical Industries Plc | Use of triazolylethanol derivatives and their compositions as non-agricultural fungicides |
| AU544099B2 (en) * | 1980-12-15 | 1985-05-16 | Sumitomo Chemical Company, Limited | Triazolylpentenols |
| DE3202601A1 (de) * | 1982-01-27 | 1983-08-04 | Bayer Ag, 5090 Leverkusen | Substituierte 1 -hydroxyalkyl-azolyl-derivate, verfahren zu ihrer herstellung sowie ihrer verwendung als fungizide und pflanzenwachstumsregulatoren |
| US4504372A (en) * | 1982-03-12 | 1985-03-12 | Ciba-Geigy Corporation | Acid-curable composition containing a masked curing catalyst, and a process for its preparation |
| JPS58203973A (ja) * | 1982-05-24 | 1983-11-28 | Sumitomo Chem Co Ltd | 光学活性なイミダゾリルアルコ−ル誘導体およびその製造法 |
| GB8302500D0 (en) * | 1983-01-29 | 1983-03-02 | Pfizer Ltd | Antifungal agents |
| DE3407005A1 (de) * | 1983-09-26 | 1985-04-04 | Bayer Ag, 5090 Leverkusen | Hydroxyethylazolyl-oxim-derivate |
-
1985
- 1985-10-21 DE DE8585113314T patent/DE3582305D1/de not_active Expired - Lifetime
- 1985-10-21 EP EP85113314A patent/EP0181529B1/de not_active Expired - Lifetime
- 1985-10-25 US US06/791,237 patent/US4783538A/en not_active Expired - Fee Related
- 1985-10-31 HU HU854174A patent/HU193615B/hu not_active IP Right Cessation
- 1985-10-31 KR KR1019850008082A patent/KR860004033A/ko not_active Ceased
- 1985-10-31 PT PT81413A patent/PT81413B/pt not_active IP Right Cessation
- 1985-10-31 ES ES548432A patent/ES8702376A1/es not_active Expired
- 1985-10-31 FI FI854284A patent/FI854284A7/fi not_active IP Right Cessation
- 1985-10-31 GR GR852624A patent/GR852624B/el unknown
- 1985-10-31 CA CA000494353A patent/CA1260482A/en not_active Expired
- 1985-10-31 IL IL76892A patent/IL76892A/xx unknown
- 1985-11-01 DK DK504285A patent/DK162989C/da active
- 1985-11-04 AU AU49380/85A patent/AU578500B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| CA1260482A (en) | 1989-09-26 |
| ES8702376A1 (es) | 1986-12-16 |
| FI854284A7 (fi) | 1986-05-03 |
| HUT40791A (en) | 1987-02-27 |
| GR852624B (index.php) | 1986-03-03 |
| DK162989C (da) | 1992-05-25 |
| IL76892A0 (en) | 1986-02-28 |
| DE3582305D1 (de) | 1991-05-02 |
| EP0181529A2 (de) | 1986-05-21 |
| DK504285D0 (da) | 1985-11-01 |
| AU578500B2 (en) | 1988-10-27 |
| KR860004033A (ko) | 1986-06-16 |
| FI854284A0 (fi) | 1985-10-31 |
| PT81413A (en) | 1985-11-01 |
| US4783538A (en) | 1988-11-08 |
| AU4938085A (en) | 1986-05-08 |
| DK162989B (da) | 1992-01-06 |
| DK504285A (da) | 1986-05-03 |
| HU193615B (en) | 1987-11-30 |
| EP0181529B1 (de) | 1991-03-27 |
| PT81413B (pt) | 1988-02-17 |
| EP0181529A3 (en) | 1986-11-12 |
| ES548432A0 (es) | 1986-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL65963A (en) | 2-(2,4-difluorophenyl)-1,3-bis(1h-1,2,4-triazol-1-yl)propan-2-ol and salts thereof,their preparation and pharmaceutical compositions containing them | |
| IL74165A (en) | 1,2,3,9-tetrahydro-3-(1h-imidazole-1-yl methyl)-4h-carbazol-4-one compounds,their preparation and pharmaceutical compositions containing them | |
| IL65814A (en) | 3-phenylalkylaminoalkyl-3-benzazepine and 1,3-benzodiazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| PT84449A (en) | Process for the preparation of 3,5-disubstituted pyrocatechole derivatives and of pharmaceutical compositions containing the same | |
| IL73706A0 (en) | 2,2'-iminobisethanol derivatives,their preparation and pharmaceutical compositions containing them | |
| HUT41202A (en) | Herbicidal compositions comprising 2-(2'-alkylbenzoyl)-1,3 cyclohexandione derivatives as active substance and process for preparing their active substances | |
| IL76405A0 (en) | 1,3-diacyl-2-oxyindole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL65076A (en) | 3,4-dihydro-5h-2,3-benzo-diazepine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL84944A (en) | Pharmaceutical compositions containing 1,2-dihydro-3h-indazolone derivatives,some new such compounds and their preparation | |
| HUT39971A (en) | Pesticide compositions containing 3,5-diaryl-1,2,4-triazole derivatives as active ingredients and process for preparing the active substances | |
| IL66606A (en) | 4-oxo-3h-imizado(5,1-d)1,2,3,5-tetrazine-8-carboxamide derivatives,their preparation and pharmaceutical compositions containing them | |
| ZA859729B (en) | New imidazo derivatives,the preparation thereof and pharmaceutical compositions containing these compounds | |
| IL71042A (en) | Triazole derivatives,their preparation and pharmaceutical and agricultural antifungal compositions containing them | |
| IL84554A (en) | Imidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL71247A0 (en) | Triazole derivatives,their preparation and pharmaceutical and agricultural antifungal compositions containing them | |
| IL74270A0 (en) | 1,2,4-triazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62229A (en) | 3-substituted-5-amino-1,2,4-triazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL76892A (en) | Preparation of optically active azolyl-carbinol derivatives,optically active 2-(4-chlorophenoxymethyl)-3,3-dimethyl-1(1,2,4-triazol-1-yl)-2-butanol thus prepared and pharmaceutical compositions containing it | |
| IL75603A0 (en) | 1,3-dioxanylheptenoic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL76312A (en) | Xenocoumacins and derivatives thereof,their preparation and pharmaceutical compositions containing them | |
| DE3268487D1 (en) | 2,3,4-trinor-m-inter-phenylene-prostaglandin derivatives, their preparation and pharmaceutical compositions | |
| IL70478A (en) | 1-amino-phenyl-3-azabicyclo-(3,1,0)hexane-2,4-dione derivatives,their preparation and pharmaceutical compositions containing them | |
| IL82542A0 (en) | Triazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL75823A0 (en) | 2-benzyl-4-(4-pyridyl)thiazoles and derivatives thereof,their preparation and pharmaceutical compositions containing them | |
| IL74568A (en) | 2,4-dihalo-5-alkylthio-6-thiacyano pyrimidine derivatives,their preparation and fungicidal compositions containing them |