IL62720A - Phenyl-and thienyl-substituted tetrahydrotetramethylthiepinoimidazole derivatives,their manufacture and pharmaceutical compositions containing them - Google Patents
Phenyl-and thienyl-substituted tetrahydrotetramethylthiepinoimidazole derivatives,their manufacture and pharmaceutical compositions containing themInfo
- Publication number
- IL62720A IL62720A IL62720A IL6272081A IL62720A IL 62720 A IL62720 A IL 62720A IL 62720 A IL62720 A IL 62720A IL 6272081 A IL6272081 A IL 6272081A IL 62720 A IL62720 A IL 62720A
- Authority
- IL
- Israel
- Prior art keywords
- tetrahydrotetramethylthiepinoimidazole
- thienyl
- phenyl
- derivatives
- substituted
- Prior art date
Links
- OJJHZINVCFYCAU-UHFFFAOYSA-N 5,6,7,8-tetramethyl-2,3,3a,5-tetrahydro-1H-thiepino[2,3-d]imidazole Chemical class CC=1C(=C(C(SC2NCNC21)C)C)C OJJHZINVCFYCAU-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH330480 | 1980-04-29 | ||
| CH105781 | 1981-02-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL62720A0 IL62720A0 (en) | 1981-06-29 |
| IL62720A true IL62720A (en) | 1984-06-29 |
Family
ID=25686511
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL62720A IL62720A (en) | 1980-04-29 | 1981-04-27 | Phenyl-and thienyl-substituted tetrahydrotetramethylthiepinoimidazole derivatives,their manufacture and pharmaceutical compositions containing them |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US4382945A (cs) |
| EP (1) | EP0039081B1 (cs) |
| AR (1) | AR227783A1 (cs) |
| AU (1) | AU540807B1 (cs) |
| CA (1) | CA1160635A (cs) |
| CS (1) | CS220339B2 (cs) |
| DE (1) | DE3162239D1 (cs) |
| DK (1) | DK151632C (cs) |
| DO (1) | DOP1981003009A (cs) |
| ES (1) | ES501700A0 (cs) |
| FI (1) | FI74014C (cs) |
| HU (1) | HU182631B (cs) |
| IE (1) | IE51148B1 (cs) |
| IL (1) | IL62720A (cs) |
| MC (1) | MC1393A1 (cs) |
| NO (1) | NO155841C (cs) |
| NZ (1) | NZ196882A (cs) |
| PH (1) | PH17106A (cs) |
| PT (1) | PT72942B (cs) |
| ZW (1) | ZW7281A1 (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2022016343A1 (zh) * | 2020-07-20 | 2022-01-27 | 深圳迈瑞生物医疗电子股份有限公司 | 一种组合物的血小板解聚用途、解聚试剂及解聚方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3185691A (en) * | 1965-05-25 | Gycloocteno-pyrimroines | ||
| GB1127428A (en) | 1965-09-07 | 1968-09-18 | Sankyo Co | Tropylium compounds and process for preparing the same |
| US3615607A (en) * | 1967-03-13 | 1971-10-26 | Takako Watatani | Method of desensitizing light-sensitive silver halide photographic materials with cycloheptimidazole derivatives |
| DD99787A1 (cs) | 1969-06-23 | 1973-08-20 | ||
| US3707475A (en) | 1970-11-16 | 1972-12-26 | Pfizer | Antiinflammatory imidazoles |
| DE2132079C3 (de) | 1971-06-28 | 1980-04-10 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 1 ,3-Diazacycloalkenen |
| DE2262187A1 (de) | 1972-12-19 | 1974-06-20 | Bayer Ag | Cyclische aminale |
| DE2701372A1 (de) | 1977-01-14 | 1978-07-20 | Veba Chemie Ag | Verfahren zur herstellung cyclischer amidine |
-
1981
- 1981-03-20 DK DK128981A patent/DK151632C/da not_active IP Right Cessation
- 1981-03-24 CA CA000373731A patent/CA1160635A/en not_active Expired
- 1981-04-06 ZW ZW72/81A patent/ZW7281A1/xx unknown
- 1981-04-16 US US06/254,826 patent/US4382945A/en not_active Expired - Fee Related
- 1981-04-22 AU AU69731/81A patent/AU540807B1/en not_active Ceased
- 1981-04-22 NZ NZ196882A patent/NZ196882A/en unknown
- 1981-04-24 MC MC811513A patent/MC1393A1/fr unknown
- 1981-04-27 IL IL62720A patent/IL62720A/xx unknown
- 1981-04-27 PH PH25558A patent/PH17106A/en unknown
- 1981-04-27 HU HU811075A patent/HU182631B/hu unknown
- 1981-04-28 PT PT72942A patent/PT72942B/pt unknown
- 1981-04-28 DE DE8181103187T patent/DE3162239D1/de not_active Expired
- 1981-04-28 IE IE944/81A patent/IE51148B1/en unknown
- 1981-04-28 EP EP81103187A patent/EP0039081B1/de not_active Expired
- 1981-04-28 CS CS813164A patent/CS220339B2/cs unknown
- 1981-04-28 NO NO811452A patent/NO155841C/no unknown
- 1981-04-28 ES ES501700A patent/ES501700A0/es active Granted
- 1981-04-29 DO DO1981003009A patent/DOP1981003009A/es unknown
- 1981-04-29 AR AR285147A patent/AR227783A1/es active
- 1981-04-29 FI FI811346A patent/FI74014C/fi not_active IP Right Cessation
-
1983
- 1983-02-07 US US06/464,444 patent/US4493841A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NO811452L (no) | 1981-10-30 |
| IL62720A0 (en) | 1981-06-29 |
| EP0039081A1 (de) | 1981-11-04 |
| PH17106A (en) | 1984-05-29 |
| NO155841C (no) | 1987-06-10 |
| DK128981A (da) | 1981-10-30 |
| DK151632C (da) | 1988-06-27 |
| IE51148B1 (en) | 1986-10-15 |
| ZW7281A1 (en) | 1981-12-09 |
| CA1160635A (en) | 1984-01-17 |
| DOP1981003009A (es) | 1986-10-14 |
| HU182631B (en) | 1984-02-28 |
| NZ196882A (en) | 1984-05-31 |
| CS220339B2 (en) | 1983-03-25 |
| IE810944L (en) | 1981-10-29 |
| PT72942A (en) | 1981-05-01 |
| FI811346L (fi) | 1981-10-30 |
| NO155841B (no) | 1987-03-02 |
| FI74014C (fi) | 1987-12-10 |
| AU540807B1 (en) | 1984-12-06 |
| DE3162239D1 (en) | 1984-03-22 |
| PT72942B (en) | 1983-01-13 |
| EP0039081B1 (de) | 1984-02-15 |
| ES8203089A1 (es) | 1982-02-16 |
| FI74014B (fi) | 1987-08-31 |
| US4382945A (en) | 1983-05-10 |
| DK151632B (da) | 1987-12-21 |
| MC1393A1 (fr) | 1982-04-27 |
| US4493841A (en) | 1985-01-15 |
| ES501700A0 (es) | 1982-02-16 |
| AR227783A1 (es) | 1982-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL66501A0 (en) | Benzazepine-2-one derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL64315A (en) | 1-sulfo-oxoazetidine derivatives,their production and pharmaceutical compositions containing them | |
| IL63576A0 (en) | Imidazole derivatives,their manufacture and pharmaceutical compositions containing them | |
| JPS57116030A (en) | 2-phenylethanol amine derivative, manufacture and medicinal composition | |
| JPS5711949A (en) | Arylethanolamine derivatives,manufacture and medicinal composition containing them | |
| JPS5770882A (en) | Novel chromanol derivative, manufacture and medicinal composition containing same | |
| IL62912A0 (en) | Penam-3-carboxylic acid derivatives,their manufacture and pharmaceutical compositions containing them | |
| DE3169095D1 (en) | 3-aminopropoxyphenyl derivatives, their preparation and pharmaceutical compositions containing them | |
| IL63524A0 (en) | Imidazoquinazoline derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL64555A0 (en) | Pharmaceutical compositions containing 3-amine-2-pyrazoline derivatives,certain such novel derivatives and their preparation | |
| IL63145A (en) | Imidazothienopyrimidinedione derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL62167A0 (en) | Phenoxy-aminopropanol derivatives,their manufacture and pharmaceutical compositions containing them | |
| JPS5731686A (en) | Xanthine derivatives, manufacture and medicinal composition containing them | |
| IL63245A (en) | 3-aminopropoxyphenyl derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62970A0 (en) | Substituted phenoxy-aminopropanol derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62592A (en) | Octahydrophenyl-quinolizine derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL62431A0 (en) | Cephalosporin derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL62605A (en) | 2-isoxazol-4-yl-3-aminoethyl-1h-indole derivatives,their production and pharmaceutical compositions containing them | |
| IL63174A0 (en) | Dibenzindole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL63917A0 (en) | 2-aminoimidazoles,their manufacture and pharmaceutical compositions containing them | |
| JPS56139482A (en) | 3-chloro-quinoline derivative, manufacture and medicinal composition | |
| IL63369A (en) | 13-oxa-prostaglandin derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62116A (en) | Benzylidenimine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL62720A (en) | Phenyl-and thienyl-substituted tetrahydrotetramethylthiepinoimidazole derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL56529A0 (en) | Azathianaphthalene derivatives, their manufacture and pharmaceutical compositions containing them |