IL52073A - 1,1-diphenyl-2-(imidazol-1-yl)ethan-1-ol and 1,2-diphenyl-3-(imidazol-1-yl)propan-2-ol derivatives, their preparation and pharmaceutical compositions containing them - Google Patents
1,1-diphenyl-2-(imidazol-1-yl)ethan-1-ol and 1,2-diphenyl-3-(imidazol-1-yl)propan-2-ol derivatives, their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL52073A IL52073A IL52073A IL5207377A IL52073A IL 52073 A IL52073 A IL 52073A IL 52073 A IL52073 A IL 52073A IL 5207377 A IL5207377 A IL 5207377A IL 52073 A IL52073 A IL 52073A
- Authority
- IL
- Israel
- Prior art keywords
- imidazol
- diphenyl
- ethan
- propan
- derivatives
- Prior art date
Links
- QDJQJYQQNZELTI-UHFFFAOYSA-N 1-imidazol-1-yl-2,3-diphenylpropan-2-ol Chemical class C1=CN=CN1CC(C=1C=CC=CC=1)(O)CC1=CC=CC=C1 QDJQJYQQNZELTI-UHFFFAOYSA-N 0.000 title 1
- KHDWPSPLKWCDKN-UHFFFAOYSA-N 2-imidazol-1-yl-1,1-diphenylethanol Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)CN1C=CN=C1 KHDWPSPLKWCDKN-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2623129A DE2623129C3 (de) | 1976-05-22 | 1976-05-22 | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL52073A0 IL52073A0 (en) | 1977-07-31 |
| IL52073A true IL52073A (en) | 1981-02-27 |
Family
ID=5978816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL52073A IL52073A (en) | 1976-05-22 | 1977-05-12 | 1,1-diphenyl-2-(imidazol-1-yl)ethan-1-ol and 1,2-diphenyl-3-(imidazol-1-yl)propan-2-ol derivatives, their preparation and pharmaceutical compositions containing them |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4358458A (de) |
| JP (1) | JPS52142069A (de) |
| AT (1) | AT353264B (de) |
| AU (1) | AU513805B2 (de) |
| BE (1) | BE854886A (de) |
| CA (1) | CA1096873A (de) |
| CH (1) | CH630077A5 (de) |
| DE (1) | DE2623129C3 (de) |
| DK (1) | DK145644C (de) |
| FI (1) | FI771618A7 (de) |
| FR (1) | FR2351969A1 (de) |
| GB (1) | GB1532156A (de) |
| HU (1) | HU175143B (de) |
| IL (1) | IL52073A (de) |
| IN (1) | IN146218B (de) |
| LU (1) | LU77378A1 (de) |
| NL (1) | NL7705584A (de) |
| NO (1) | NO146394C (de) |
| PL (1) | PL104273B1 (de) |
| SE (1) | SE434640B (de) |
| ZA (1) | ZA772984B (de) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2736122A1 (de) * | 1977-08-11 | 1979-02-22 | Basf Ag | Fungizide |
| JPS5823442Y2 (ja) * | 1977-11-26 | 1983-05-19 | 日立造船株式会社 | 圧延用ミルのウェブガイド調整装置 |
| US4246274A (en) * | 1978-05-10 | 1981-01-20 | Bayer Aktiengesellschaft | Antimycotic hydroxypropyl-imidazoles |
| DE2851086A1 (de) * | 1978-11-25 | 1980-06-04 | Bayer Ag | Hydroxypropyl-triazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2851116A1 (de) * | 1978-11-25 | 1980-06-12 | Bayer Ag | Hydroxyethyl-azole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2851143A1 (de) * | 1978-11-25 | 1980-06-04 | Bayer Ag | Fluorenyl-azolylmethyl-carbinole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| BR8001317A (pt) * | 1979-03-07 | 1980-11-04 | Ici Ltd | Composto fungicida, processo para preparar um composto, sal ou complexo de metal e composicao fungicida |
| US4927839A (en) * | 1979-03-07 | 1990-05-22 | Imperial Chemical Industries Plc | Method of preventing fungal attack on wood, hides, leather or paint films using a triazole |
| US4551469A (en) * | 1979-03-07 | 1985-11-05 | Imperial Chemical Industries Plc | Antifungal triazole ethanol derivatives |
| US4654332A (en) * | 1979-03-07 | 1987-03-31 | Imperial Chemical Industries Plc | Heterocyclic compounds |
| DE2912288A1 (de) * | 1979-03-28 | 1980-10-09 | Bayer Ag | Verfahren zur herstellung von hydroxyethyl-azolen |
| JPS5828083Y2 (ja) * | 1979-04-25 | 1983-06-18 | ナショナル住宅産業株式会社 | 垂直パネルと水平パネルの連結金具 |
| DE2946956A1 (de) * | 1979-11-21 | 1981-06-19 | Bayer Ag, 5090 Leverkusen | Hydroxybutyl-imidazol-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2946957A1 (de) * | 1979-11-21 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Antimikrobielle mittel |
| DE3003933A1 (de) * | 1980-02-04 | 1981-08-13 | Basf Ag, 6700 Ludwigshafen | (beta) -imidazolylalkohole, verfahren zu ihrer herstellung, diese enthaltende fungizide und verfahren zur bekaempfung von pilzen mit ihnen |
| DE3018865A1 (de) * | 1980-05-16 | 1981-11-26 | Bayer Ag, 5090 Leverkusen | Antimikrobielle mittel |
| AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
| JPS57188533A (en) * | 1981-05-12 | 1982-11-19 | Ici Ltd | Manufacture of halohydrin and halohydrin compounds |
| DE3265363D1 (en) * | 1981-05-12 | 1985-09-19 | Ici Plc | 1,1-bis phenylalkan-1-ols and processes for their preparation |
| US4435399A (en) | 1981-07-18 | 1984-03-06 | Pfizer Inc. | 2-Aryl-1-(imidazol-1-yl)-8-(4-piperazin-1-ylphenoxy) octan-2-ol antifungal agents |
| GB8306351D0 (en) * | 1983-03-08 | 1983-04-13 | Ici Plc | Azole fungicides |
| GB2156807A (en) * | 1984-04-05 | 1985-10-16 | Ici Plc | Azolyl propanols |
| US4766140A (en) * | 1984-06-18 | 1988-08-23 | Eli Lilly And Company | Method of inhibiting aromatase |
| DE3427844A1 (de) * | 1984-07-27 | 1986-02-06 | Bayer Ag, 5090 Leverkusen | Substituierte hydroxyalkyl-azole, verfahren zu ihrer herstellung sowie diese enthaltende antimykotische mittel |
| US4859693A (en) * | 1988-08-10 | 1989-08-22 | E. I. Du Pont De Nemours And Company | Antiinflammatory carbinoloimidazoles |
| NZ270418A (en) | 1994-02-07 | 1997-09-22 | Eisai Co Ltd | Polycyclic triazole & imidazole derivatives, antifungal compositions |
| US11058738B2 (en) | 2015-07-09 | 2021-07-13 | Wyzsza Szkola Medyczna W Bialymstoku | Herbal preparation for accelerating wounds and skin inflammations healing, especially for treatment of herpes and acne, and its application |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3839574A (en) * | 1968-08-19 | 1974-10-01 | Janssen Pharmaceutica Nv | Antifungal and antibacterial compositions of certain imidazoles and methods of using same |
| SU557755A3 (ru) * | 1968-08-19 | 1977-05-05 | Янссен Фармасьютика Н.В. (Фирма) | Способ получени производных имидазола |
| US3658813A (en) * | 1970-01-13 | 1972-04-25 | Janssen Pharmaceutica Nv | 1-(beta-aryl-beta-(r-oxy)-ethyl)-imidazoles |
| US3679697A (en) * | 1970-10-08 | 1972-07-25 | Searle & Co | 1-({62 -halophenethyl)imidazoles |
-
1976
- 1976-05-22 DE DE2623129A patent/DE2623129C3/de not_active Expired
-
1977
- 1977-05-06 CH CH569677A patent/CH630077A5/de not_active IP Right Cessation
- 1977-05-12 IN IN714/CAL/77A patent/IN146218B/en unknown
- 1977-05-12 AT AT341677A patent/AT353264B/de not_active IP Right Cessation
- 1977-05-12 IL IL52073A patent/IL52073A/xx unknown
- 1977-05-13 US US05/796,613 patent/US4358458A/en not_active Expired - Lifetime
- 1977-05-16 AU AU25176/77A patent/AU513805B2/en not_active Expired
- 1977-05-18 ZA ZA00772984A patent/ZA772984B/xx unknown
- 1977-05-18 DK DK220177A patent/DK145644C/da not_active IP Right Cessation
- 1977-05-18 FR FR7715321A patent/FR2351969A1/fr active Granted
- 1977-05-19 CA CA278,773A patent/CA1096873A/en not_active Expired
- 1977-05-20 GB GB21297/77A patent/GB1532156A/en not_active Expired
- 1977-05-20 PL PL1977198268A patent/PL104273B1/pl unknown
- 1977-05-20 LU LU77378A patent/LU77378A1/xx unknown
- 1977-05-20 NL NL7705584A patent/NL7705584A/xx not_active Application Discontinuation
- 1977-05-20 HU HU77NO215A patent/HU175143B/hu unknown
- 1977-05-20 FI FI771618A patent/FI771618A7/fi not_active Application Discontinuation
- 1977-05-20 NO NO771767A patent/NO146394C/no unknown
- 1977-05-20 SE SE7705939A patent/SE434640B/xx not_active IP Right Cessation
- 1977-05-21 JP JP5822477A patent/JPS52142069A/ja active Pending
- 1977-05-23 BE BE2055928A patent/BE854886A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO771767L (no) | 1977-11-23 |
| PL104273B1 (pl) | 1979-08-31 |
| JPS52142069A (en) | 1977-11-26 |
| FR2351969B1 (de) | 1981-01-09 |
| LU77378A1 (de) | 1977-08-29 |
| US4358458A (en) | 1982-11-09 |
| ZA772984B (en) | 1978-05-30 |
| GB1532156A (en) | 1978-11-15 |
| HU175143B (hu) | 1980-05-28 |
| DK220177A (da) | 1977-11-23 |
| BE854886A (fr) | 1977-09-16 |
| IL52073A0 (en) | 1977-07-31 |
| FI771618A7 (de) | 1977-11-23 |
| ATA341677A (de) | 1979-04-15 |
| DK145644C (da) | 1983-07-04 |
| FR2351969A1 (fr) | 1977-12-16 |
| CH630077A5 (de) | 1982-05-28 |
| AU2517677A (en) | 1978-11-23 |
| DK145644B (da) | 1983-01-10 |
| DE2623129B2 (de) | 1979-08-09 |
| DE2623129A1 (de) | 1977-11-24 |
| PL198268A1 (pl) | 1978-04-10 |
| AT353264B (de) | 1979-11-12 |
| NO146394B (no) | 1982-06-14 |
| NL7705584A (nl) | 1977-11-24 |
| CA1096873A (en) | 1981-03-03 |
| SE7705939L (sv) | 1977-11-23 |
| SE434640B (sv) | 1984-08-06 |
| NO146394C (no) | 1982-09-22 |
| IN146218B (de) | 1979-03-24 |
| DE2623129C3 (de) | 1980-04-10 |
| AU513805B2 (en) | 1981-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL52073A (en) | 1,1-diphenyl-2-(imidazol-1-yl)ethan-1-ol and 1,2-diphenyl-3-(imidazol-1-yl)propan-2-ol derivatives, their preparation and pharmaceutical compositions containing them | |
| IL57178A0 (en) | 1,3,4-triazole derivatives their preparation and pharmaceutical compositions containing them | |
| IL51463A (en) | Insecticidal compositions containing n-benzyl-n-methyl-2-propynylamine derivatives,several novel n-benzyl-n-methyl-2-propynylamine derivatives and their preparation | |
| IL53043A (en) | N-heterocyclylalkyl-(1-aryloxy-2-hydroxy-3-amino-propane)derivatives,their preparation and pharmaceutical compositions containing them | |
| DE3064582D1 (en) | 5,6,7-trinor-4,8-inter-m-phenylene pgi2 derivatives and pharmaceutical compositions containing them | |
| IL57040A (en) | Imidazole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL51309A0 (en) | New 1,2-benzisothiazolin-3-ones,their preparation and pharmaceutical compositions containing them | |
| IL49325A (en) | 8-aza-11-deoxy-pge1 derivatives,their preparation and pharmaceutical compositions containing them | |
| IL51339A (en) | 3-(substituted)methylene-4-oxa-1-azabicyclo(3.2.0)heptan-7-one derivatives their preparation and pharmaceutical compositions containing them | |
| IL52466A (en) | 7(2-acyl-2-hydroxyiminoacetamido)-3-tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL50230A (en) | 4,5-diphenyl-2-(substituted thio-sulfonyl)imidazole derivatives their preparation and pharmaceutical compositions containing them | |
| IL52717A (en) | Derivatives of2-phenylamino-imidazoline-(2),their preparation and pharmaceutical compositions containing them | |
| IL57297A (en) | 4-amino-2-piperidinoquinazoline derivatives,their preparation and pharmaceutical compositions containing them | |
| IL47628A0 (en) | 1,2,4-triazole derivatives,their preparation and insecticidal compositions containing them | |
| DE2966204D1 (en) | Eburnane derivatives, their synthesis and pharmaceutical compositions containing them | |
| IL52857A (en) | Oxo-benzopyrane derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56808A0 (en) | 1-oxo-1h-pyrimido(6,1)benztheazole derivatives,process forthe preparation thereof and pharmaceutical compositions containing the same | |
| IL56856A (en) | 4,5-diaryl-pyrrole derivatives,their preparation and pharmaceutical compositions containing them | |
| IL52148A (en) | Substituted 1-phenoxy-2-hydroxy-3-aminopropanes,process for preparing same and pharmaceutical compositions containing them | |
| IL57720A0 (en) | Phenylpiperidine derivatives,their preparation and pharmaceutical compositions containing them | |
| IL56913A (en) | Sprio-steroid-oxazolidinone derivatives,their preparation and pharmaceutical compositions containing them | |
| DE2963868D1 (en) | Carbostyrile derivatives, their preparation and pharmaceutical compositions containing them | |
| IL51468A (en) | 17 -hydroxy- -d-homosteroid derivatives,their preparation and pharmaceutical compositions containing them | |
| IL52165A (en) | 2-cyano-2-oximinoacetamide derivatives, their preparation and fungicidal compositions containing them | |
| GB1549931A (en) | 2,2-dimethyl-19-nor-steroids processes for preparing them and pharmaceutical compositions containing them |