IL47060A - Quaternary ammonium salts of n-dialkylaminoalkyl-n-(2-indanyl)anilines - Google Patents
Quaternary ammonium salts of n-dialkylaminoalkyl-n-(2-indanyl)anilinesInfo
- Publication number
- IL47060A IL47060A IL47060A IL4706075A IL47060A IL 47060 A IL47060 A IL 47060A IL 47060 A IL47060 A IL 47060A IL 4706075 A IL4706075 A IL 4706075A IL 47060 A IL47060 A IL 47060A
- Authority
- IL
- Israel
- Prior art keywords
- indanyl
- compound
- anilino
- hydrogen
- ethyl
- Prior art date
Links
- 150000003242 quaternary ammonium salts Chemical class 0.000 title description 15
- 150000001448 anilines Chemical class 0.000 title description 2
- -1 pyrrolidino, piperidino Chemical group 0.000 claims description 46
- 150000001875 compounds Chemical class 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 150000003512 tertiary amines Chemical class 0.000 claims description 11
- 150000001450 anions Chemical class 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000002168 alkylating agent Substances 0.000 claims description 7
- 229940100198 alkylating agent Drugs 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical group I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 150000001649 bromium compounds Chemical group 0.000 claims 1
- 150000001805 chlorine compounds Chemical group 0.000 claims 1
- 150000003839 salts Chemical class 0.000 description 21
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 241000282472 Canis lupus familiaris Species 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 206010003119 arrhythmia Diseases 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- GQCWHYJQXLHKDD-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-1-yl)aniline Chemical compound NC1=CC=CC=C1C1C2=CC=CC=C2CC1 GQCWHYJQXLHKDD-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 230000033764 rhythmic process Effects 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000006793 arrhythmia Effects 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 239000003416 antiarrhythmic agent Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 4
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 4
- NZLBHDRPUJLHCE-UHFFFAOYSA-N aprindine Chemical compound C1C2=CC=CC=C2CC1N(CCCN(CC)CC)C1=CC=CC=C1 NZLBHDRPUJLHCE-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WCIIUCOXVNJJHD-UHFFFAOYSA-N 3-[N-(2,3-dihydro-1H-inden-2-yl)anilino]propyl-diethyl-methylazanium Chemical compound C(C)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(C)CC WCIIUCOXVNJJHD-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 238000005576 amination reaction Methods 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 230000003288 anthiarrhythmic effect Effects 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 3
- 229960004919 procaine Drugs 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- RFFWCKSTBQUTEH-UHFFFAOYSA-N 2,3-dihydro-1h-inden-2-ylmethanesulfonic acid Chemical compound C1=CC=C2CC(CS(=O)(=O)O)CC2=C1 RFFWCKSTBQUTEH-UHFFFAOYSA-N 0.000 description 2
- LMHHFZAXSANGGM-UHFFFAOYSA-N 2-aminoindane Chemical class C1=CC=C2CC(N)CC2=C1 LMHHFZAXSANGGM-UHFFFAOYSA-N 0.000 description 2
- LPMXVESGRSUGHW-UHFFFAOYSA-N Acolongiflorosid K Natural products OC1C(O)C(O)C(C)OC1OC1CC2(O)CCC3C4(O)CCC(C=5COC(=O)C=5)C4(C)CC(O)C3C2(CO)C(O)C1 LPMXVESGRSUGHW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- WHOLMYAZADNWQS-UHFFFAOYSA-N N-(3-chloropropyl)-N-phenyl-2,3-dihydro-1H-inden-2-amine Chemical compound ClCCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1 WHOLMYAZADNWQS-UHFFFAOYSA-N 0.000 description 2
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 2
- 244000166550 Strophanthus gratus Species 0.000 description 2
- FZPCYUUYIHUAIN-UHFFFAOYSA-M [I-].C(C)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(C)CC Chemical compound [I-].C(C)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(C)CC FZPCYUUYIHUAIN-UHFFFAOYSA-M 0.000 description 2
- 206010000891 acute myocardial infarction Diseases 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 150000004820 halides Chemical group 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229960004194 lidocaine Drugs 0.000 description 2
- 229960005015 local anesthetics Drugs 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 2
- 229960003343 ouabain Drugs 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 229960001404 quinidine Drugs 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- UPSXAPQYNGXVBF-UHFFFAOYSA-N 2-bromobutane Chemical compound CCC(C)Br UPSXAPQYNGXVBF-UHFFFAOYSA-N 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WWRXMKQRGARTAB-UHFFFAOYSA-N 6-iodohex-2-ene Chemical compound CC=CCCCI WWRXMKQRGARTAB-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZTHQBROSBNNGPU-UHFFFAOYSA-N Butyl hydrogen sulfate Chemical compound CCCCOS(O)(=O)=O ZTHQBROSBNNGPU-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 206010042434 Sudden death Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 206010047281 Ventricular arrhythmia Diseases 0.000 description 1
- JKHXPOMKDVFYEJ-UHFFFAOYSA-M [Br-].C(CCC)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(CC)CC Chemical compound [Br-].C(CCC)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(CC)CC JKHXPOMKDVFYEJ-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- XKMRRTOUMJRJIA-UHFFFAOYSA-N ammonia nh3 Chemical group N.N XKMRRTOUMJRJIA-UHFFFAOYSA-N 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 229940030611 beta-adrenergic blocking agent Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 210000004903 cardiac system Anatomy 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical class 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- JWAJUTZQGZBKFS-UHFFFAOYSA-N n,n-diethylprop-2-en-1-amine Chemical compound CCN(CC)CC=C JWAJUTZQGZBKFS-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- 229960000244 procainamide Drugs 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 1
- GIAPQOZCVIEHNY-UHFFFAOYSA-N propylazanium;iodide Chemical compound [I-].CCC[NH3+] GIAPQOZCVIEHNY-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 208000003663 ventricular fibrillation Diseases 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US460643A US3917679A (en) | 1974-04-12 | 1974-04-12 | Quaternary ammonium salts of N-dialkylaminoalkyl-N-(2-indanyl)anilines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL47060A0 IL47060A0 (en) | 1975-06-25 |
| IL47060A true IL47060A (en) | 1977-12-30 |
Family
ID=23829512
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL47060A IL47060A (en) | 1974-04-12 | 1975-04-09 | Quaternary ammonium salts of n-dialkylaminoalkyl-n-(2-indanyl)anilines |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3917679A (cs) |
| JP (1) | JPS50135211A (cs) |
| AR (1) | AR208307A1 (cs) |
| AT (1) | AT342037B (cs) |
| BE (1) | BE827764A (cs) |
| CA (1) | CA1026757A (cs) |
| CH (1) | CH609330A5 (cs) |
| CS (1) | CS199265B2 (cs) |
| DD (1) | DD118612A5 (cs) |
| DE (1) | DE2515548A1 (cs) |
| DK (1) | DK156975A (cs) |
| ES (1) | ES436555A1 (cs) |
| FR (1) | FR2267092B1 (cs) |
| GB (1) | GB1497149A (cs) |
| HU (1) | HU174568B (cs) |
| IE (1) | IE40971B1 (cs) |
| IL (1) | IL47060A (cs) |
| NL (1) | NL7504392A (cs) |
| PL (1) | PL98607B1 (cs) |
| RO (1) | RO75281A (cs) |
| SE (1) | SE7504099L (cs) |
| SU (1) | SU575022A3 (cs) |
| YU (1) | YU90375A (cs) |
| ZA (1) | ZA752333B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5259996A (en) * | 1975-11-12 | 1977-05-17 | Nippon Keibi Hosho Kk | Chemical fire extinguishing method |
| JPS5259995A (en) * | 1975-11-12 | 1977-05-17 | Nippon Keibi Hosho Kk | Chemical fire extinguishing method |
| US4321386A (en) * | 1981-01-28 | 1982-03-23 | Mead Johnson & Company | Quaternary piperidinium halides |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1768500A1 (de) * | 1968-05-18 | 1972-01-05 | Degussa | Verfahren zur Herstellung von Alkoxygruppen enthaltenden Aminoketonen II |
| FR127F (cs) * | 1964-03-27 | |||
| US3468951A (en) * | 1965-06-14 | 1969-09-23 | American Hospital Supply Corp | Bis-(alkoxyaryl)alkyl-n-alkenyl-and-alkynyl-amines |
| SE354866B (cs) * | 1968-10-09 | 1973-03-26 | Leo Ab | |
| US3875215A (en) * | 1971-07-19 | 1975-04-01 | Dow Chemical Co | Substituted phenoxyalkyl quaternary ammonium compounds |
-
1974
- 1974-04-12 US US460643A patent/US3917679A/en not_active Expired - Lifetime
-
1975
- 1975-01-01 AR AR258299A patent/AR208307A1/es active
- 1975-04-01 JP JP50040204A patent/JPS50135211A/ja active Pending
- 1975-04-09 FR FR7511072A patent/FR2267092B1/fr not_active Expired
- 1975-04-09 YU YU00903/76A patent/YU90375A/xx unknown
- 1975-04-09 DE DE19752515548 patent/DE2515548A1/de not_active Withdrawn
- 1975-04-09 SE SE7504099A patent/SE7504099L/xx unknown
- 1975-04-09 IE IE802/75A patent/IE40971B1/xx unknown
- 1975-04-09 IL IL47060A patent/IL47060A/en unknown
- 1975-04-09 SU SU7502121143A patent/SU575022A3/ru active
- 1975-04-09 CA CA224,219A patent/CA1026757A/en not_active Expired
- 1975-04-10 BE BE1006586A patent/BE827764A/xx unknown
- 1975-04-10 GB GB14664/75A patent/GB1497149A/en not_active Expired
- 1975-04-10 PL PL1975179520A patent/PL98607B1/pl unknown
- 1975-04-11 DD DD185391A patent/DD118612A5/xx unknown
- 1975-04-11 NL NL7504392A patent/NL7504392A/xx not_active Application Discontinuation
- 1975-04-11 AT AT278475A patent/AT342037B/de not_active IP Right Cessation
- 1975-04-11 HU HUEI000612 patent/HU174568B/hu unknown
- 1975-04-11 CH CH466375A patent/CH609330A5/xx not_active IP Right Cessation
- 1975-04-11 ZA ZA752333A patent/ZA752333B/xx unknown
- 1975-04-11 CS CS752529A patent/CS199265B2/cs unknown
- 1975-04-11 DK DK156975A patent/DK156975A/da unknown
- 1975-04-11 ES ES436555A patent/ES436555A1/es not_active Expired
- 1975-04-12 RO RO7581973A patent/RO75281A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU7999675A (en) | 1976-10-14 |
| SU575022A3 (ru) | 1977-09-30 |
| AR208307A1 (es) | 1976-12-20 |
| CH609330A5 (cs) | 1979-02-28 |
| FR2267092B1 (cs) | 1978-08-04 |
| FR2267092A1 (cs) | 1975-11-07 |
| HU174568B (hu) | 1980-02-28 |
| ES436555A1 (es) | 1977-04-01 |
| RO75281A (ro) | 1980-11-30 |
| CS199265B2 (en) | 1980-07-31 |
| US3917679A (en) | 1975-11-04 |
| DK156975A (da) | 1975-10-13 |
| AT342037B (de) | 1978-03-10 |
| DE2515548A1 (de) | 1975-10-23 |
| NL7504392A (cs) | 1975-10-14 |
| IL47060A0 (en) | 1975-06-25 |
| JPS50135211A (cs) | 1975-10-27 |
| SE7504099L (sv) | 1975-10-13 |
| BE827764A (fr) | 1975-10-10 |
| PL98607B1 (pl) | 1978-05-31 |
| DD118612A5 (cs) | 1976-03-12 |
| ATA278475A (de) | 1977-07-15 |
| GB1497149A (en) | 1978-01-05 |
| IE40971L (en) | 1975-10-12 |
| YU90375A (en) | 1982-02-28 |
| IE40971B1 (en) | 1979-09-26 |
| CA1026757A (en) | 1978-02-21 |
| ZA752333B (en) | 1976-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1424730A3 (ru) | Способ получени метилсульфонамидофенилалкиламинов или их фармацевтически приемлемых солей | |
| GB2089338A (en) | 7-Substituted benzopyranes | |
| US4067904A (en) | Alkylsulfonylphenoxypropanolamine derivatives | |
| CH643809A5 (de) | Aminoalkohol-derivate. | |
| CH638186A5 (de) | Neue pyridinyl-aminoalkylaether. | |
| Schwender et al. | Derivatives of 3, 4-dihydro-1 (2H)-naphthalenone as. beta.-adrenergic blocking agents. 1. Bunolol and related analogs | |
| US3742023A (en) | Novel 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes | |
| US4277501A (en) | Para-nitrophenylalkylamines and pharmaceutical compositions | |
| IL47060A (en) | Quaternary ammonium salts of n-dialkylaminoalkyl-n-(2-indanyl)anilines | |
| US3972935A (en) | Antiarrhythmic agents | |
| CY1272A (en) | Urea derivatives | |
| JPH0471067B2 (cs) | ||
| EP0113910B1 (en) | Isocarbostyril derivatives, processes for their preparation and pharmaceutical compositions containing them | |
| US4034011A (en) | 1,1-Diphenyl-4-(substituted-amino)butanes | |
| US3845123A (en) | Phenoxypropanolamine therapeutic agents | |
| US4218477A (en) | Primary aminoacylanilides, methods of making the same and use as antiarrhythmic drugs | |
| EP0011747A1 (de) | Aminopropanolderivate des 6-Hydroxy-2,3,4,5-tetrahydro-1H-1-benzazepin-2-ons, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| US3981872A (en) | Derivatives of 2-amino-(1,2,3,4-tetrahydronaphthalene) | |
| CA1094070A (en) | 1-phenyl-piperazine derivatives | |
| IE47283B1 (en) | Anti-inflammatory 1-phenylethanolamine derivatives, pharmaceutical compositions thereof and processes for their manufacture | |
| US4237068A (en) | Primary aminoacylanilides | |
| US4336269A (en) | Para-nitrophenylalkylamines | |
| US4035373A (en) | Preparation of piperidinyl-alkyl-benzamides | |
| FI58326B (fi) | Foerfarande foer framstaellning av som beta-adrenergiskt stimulerande medel anvaendbara alfa-aminometyl-4-hydroxi-3-metylsulfonyl-metylbensylalkoholer | |
| US4053603A (en) | Benzylisoquinoline derivatives, and use as anti-arrhythmic drugs |