IL41515A - 11-deoxyprostaglandin derivatives and their preparation - Google Patents
11-deoxyprostaglandin derivatives and their preparationInfo
- Publication number
- IL41515A IL41515A IL41515A IL4151573A IL41515A IL 41515 A IL41515 A IL 41515A IL 41515 A IL41515 A IL 41515A IL 4151573 A IL4151573 A IL 4151573A IL 41515 A IL41515 A IL 41515A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- hydrogen
- compound
- give
- treating
- Prior art date
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims 28
- 239000001257 hydrogen Substances 0.000 claims 28
- 150000001875 compounds Chemical class 0.000 claims 22
- 125000000217 alkyl group Chemical group 0.000 claims 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 11
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 9
- 125000001589 carboacyl group Chemical group 0.000 claims 8
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 8
- 239000002253 acid Substances 0.000 claims 7
- 150000002431 hydrogen Chemical class 0.000 claims 6
- 229910052783 alkali metal Inorganic materials 0.000 claims 5
- 150000001340 alkali metals Chemical class 0.000 claims 5
- 238000000034 method Methods 0.000 claims 4
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 claims 3
- 150000002576 ketones Chemical class 0.000 claims 3
- SRMCCEAXOINPMD-UHFFFAOYSA-N 1,5-dichloropenta-1,4-dien-3-one Chemical compound ClC=CC(=O)C=CCl SRMCCEAXOINPMD-UHFFFAOYSA-N 0.000 claims 2
- 150000004703 alkoxides Chemical class 0.000 claims 2
- 150000003973 alkyl amines Chemical class 0.000 claims 2
- 239000002585 base Substances 0.000 claims 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims 1
- 101150065749 Churc1 gene Proteins 0.000 claims 1
- 239000007818 Grignard reagent Substances 0.000 claims 1
- 102100038239 Protein Churchill Human genes 0.000 claims 1
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 claims 1
- -1 acetylene Grignard reagent Chemical class 0.000 claims 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000003153 chemical reaction reagent Substances 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- MNWFXJYAOYHMED-UHFFFAOYSA-M heptanoate Chemical compound CCCCCCC([O-])=O MNWFXJYAOYHMED-UHFFFAOYSA-M 0.000 claims 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 1
- 239000011981 lindlar catalyst Substances 0.000 claims 1
- ARNWQMJQALNBBV-UHFFFAOYSA-N lithium carbide Chemical compound [Li+].[Li+].[C-]#[C-] ARNWQMJQALNBBV-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 125000006239 protecting group Chemical group 0.000 claims 1
- 150000005691 triesters Chemical class 0.000 claims 1
- 150000004794 vinyl magnesium halides Chemical class 0.000 claims 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/93—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems condensed with a ring other than six-membered
- C07D307/935—Not further condensed cyclopenta [b] furans or hydrogenated cyclopenta [b] furans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00238650A US3849474A (en) | 1972-03-27 | 1972-03-27 | 11-deoxyprostaglandin derivatives and process therefor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL41515A0 IL41515A0 (en) | 1973-05-31 |
| IL41515A true IL41515A (en) | 1976-10-31 |
Family
ID=22898762
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49234A IL49234A (en) | 1972-03-27 | 1973-02-12 | Cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
| IL41515A IL41515A (en) | 1972-03-27 | 1973-02-12 | 11-deoxyprostaglandin derivatives and their preparation |
| IL49234A IL49234A0 (en) | 1972-03-27 | 1976-03-17 | Novel cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49234A IL49234A (en) | 1972-03-27 | 1973-02-12 | Cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL49234A IL49234A0 (en) | 1972-03-27 | 1976-03-17 | Novel cyclopropane-1,1-dicarboxylic acid derivatives and their preparation |
Country Status (13)
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4045577A (en) * | 1971-06-17 | 1977-08-30 | Alza Corporation | Valuable medicinial prostaglandin compounds prepared from material isolated from the sea |
| JPS5146114B2 (US07368563-20080506-C00056.png) * | 1972-09-01 | 1976-12-07 | ||
| US3987081A (en) * | 1973-04-16 | 1976-10-19 | American Home Products Corporation | Alkyl derivatives of prostanoic acids and preparation thereof |
| JPS5623984B2 (US07368563-20080506-C00056.png) * | 1973-04-19 | 1981-06-03 | ||
| DE2331081A1 (de) * | 1973-06-19 | 1975-01-23 | Hoechst Ag | Neue cyclopentanderivate und verfahren zu ihrer herstellung |
| US4052446A (en) * | 1973-08-06 | 1977-10-04 | Hoffmann-La Roche Inc. | 11,16-substituted prostaglandins |
| US3953435A (en) * | 1974-01-10 | 1976-04-27 | Ono Pharmaceutical Company | Aldehyde derivatives of prostaglandins |
| US3931282A (en) * | 1974-02-21 | 1976-01-06 | Syntex (U.S.A.) Inc. | 11α-Hydroxymethyl prostaglandins |
| US4034003A (en) * | 1974-04-11 | 1977-07-05 | Ono Pharmaceutical Co., Ltd. | 15-Cycloalkyl-prostaglandins |
| US3959263A (en) * | 1974-06-19 | 1976-05-25 | American Home Products Corporation | Prostaglandin intermediate |
| JPS5153758U (US07368563-20080506-C00056.png) * | 1974-10-22 | 1976-04-24 | ||
| US3996263A (en) * | 1975-05-05 | 1976-12-07 | Sankyo Company Limited | 9-Oxo-11α-methyl-15Ε-hyroxyprost-13(trans)-enoic acid derivatives and process for the preparaion thereof |
| US4086269A (en) * | 1975-07-07 | 1978-04-25 | American Home Products Corporation | 11-Deoxy-15-substituted prostaglandins |
| US4257981A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG2 compounds |
| US4257980A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG1 compounds |
| US4257979A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-PG compounds |
| US4257982A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-13,14-dihydro-PG2 compounds |
| US4257983A (en) * | 1979-04-02 | 1981-03-24 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19,20-didehydro-PG1 compounds |
| US4251463A (en) * | 1979-05-01 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-9-deoxy-9-methylene-5,6-didehydro-PGF1 compounds |
| US4251464A (en) * | 1979-07-05 | 1981-02-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6-oxo-PGE1 compounds |
| US4256667A (en) * | 1979-07-05 | 1981-03-17 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6a-carba-PGI2 compounds |
| US4255354A (en) * | 1979-07-05 | 1981-03-10 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-19-methyl-6-oxo-PGF1 compounds |
| US4254058A (en) * | 1979-07-05 | 1981-03-03 | The Upjohn Company | 2-Decarboxy-2-aminomethyl-19-hydroxy-6a-carba-PGI2 compounds |
| US4296241A (en) * | 1979-07-21 | 1981-10-20 | Bayer Aktiengesellschaft | Preparation of 3-(2,2-dichlorovinyl)-2,2-dimethyl-cyclopropane-1-carboxylic acid derivatives |
| JPH0192401A (ja) * | 1987-09-29 | 1989-04-11 | Tatsuji Nakajima | パンツの製造法 |
| EP2109597A1 (en) * | 2007-01-30 | 2009-10-21 | DSM IP Assets B.V. | Process for preparing dienones |
-
1972
- 1972-03-27 US US00238650A patent/US3849474A/en not_active Expired - Lifetime
-
1973
- 1973-02-12 IL IL49234A patent/IL49234A/en unknown
- 1973-02-12 IL IL41515A patent/IL41515A/en unknown
- 1973-02-16 AU AU52255/73A patent/AU476003B2/en not_active Expired
- 1973-03-20 DE DE2313868A patent/DE2313868A1/de active Pending
- 1973-03-23 GB GB1748375A patent/GB1422319A/en not_active Expired
- 1973-03-23 GB GB1748175A patent/GB1422318A/en not_active Expired
- 1973-03-23 GB GB1412873A patent/GB1422518A/en not_active Expired
- 1973-03-26 HU HUAE376A patent/HU167202B/hu unknown
- 1973-03-26 SE SE7304219A patent/SE391520B/xx unknown
- 1973-03-26 SU SU731900137A patent/SU655308A3/ru active
- 1973-03-26 FR FR7310802A patent/FR2187332B1/fr not_active Expired
- 1973-03-27 NL NL7304258A patent/NL7304258A/xx not_active Application Discontinuation
- 1973-03-27 JP JP48035005A patent/JPS495945A/ja active Pending
- 1973-03-27 CH CH441873A patent/CH609969A5/xx not_active IP Right Cessation
- 1973-03-27 CA CA167,338A patent/CA997341A/en not_active Expired
-
1975
- 1975-03-17 FR FR7508290A patent/FR2270234B1/fr not_active Expired
-
1976
- 1976-03-17 IL IL49234A patent/IL49234A0/xx unknown
- 1976-07-14 AU AU15895/76A patent/AU494525B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| HU167202B (US07368563-20080506-C00056.png) | 1975-09-27 |
| AU494525B2 (en) | 1976-09-30 |
| FR2187332A1 (US07368563-20080506-C00056.png) | 1974-01-18 |
| CA997341A (en) | 1976-09-21 |
| US3849474A (en) | 1974-11-19 |
| FR2270234B1 (US07368563-20080506-C00056.png) | 1978-02-03 |
| SU655308A3 (ru) | 1979-03-30 |
| GB1422518A (en) | 1976-01-28 |
| GB1422318A (en) | 1976-01-28 |
| CH609969A5 (US07368563-20080506-C00056.png) | 1979-03-30 |
| GB1422319A (en) | 1976-01-28 |
| SE391520B (sv) | 1977-02-21 |
| IL41515A0 (en) | 1973-05-31 |
| DE2313868A1 (de) | 1973-10-04 |
| NL7304258A (US07368563-20080506-C00056.png) | 1973-10-01 |
| FR2270234A1 (US07368563-20080506-C00056.png) | 1975-12-05 |
| FR2187332B1 (US07368563-20080506-C00056.png) | 1976-12-24 |
| IL49234A (en) | 1976-10-31 |
| JPS495945A (US07368563-20080506-C00056.png) | 1974-01-19 |
| IL49234A0 (en) | 1976-05-31 |
| AU5225573A (en) | 1974-08-22 |
| AU476003B2 (en) | 1976-09-09 |
| AU1589576A (en) | 1976-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL41515A (en) | 11-deoxyprostaglandin derivatives and their preparation | |
| CH647222A5 (de) | 9-desoxy-9a-methylen-isostere von pgi-2 und verfahren zu deren herstellung. | |
| DE2154309C3 (de) | 17-Phenyl-18,19,20-trinor-PGE↓2↓ und - PGF↓2↓ α und dieselben enthaltende Arzneimittel | |
| EP0043479A1 (en) | Novel cyclopentenone derivatives and methods for the preparation of the novel compounds | |
| AT367747B (de) | Verfahren zur herstellung von optisch aktiven oder racemischen prostaglandinen und ihren salzen | |
| DE2118686A1 (de) | Prostaglandinverbindungen und Verfahren zu ihrer Herstellung | |
| US3835179A (en) | Novel 15-substituted prostanoic acids and esters | |
| Samajdar et al. | Stereocontrolled approach to highly substituted cyclopentanones. Application in a formal synthesis of Δ9 (12)-capnellene | |
| CA1045131A (en) | Derivatives of 9-hydroxy-13-trans-prostenoic acid | |
| JPS594434B2 (ja) | チアプロスタグランジンユウドウタイオヨビソノセイゾウホウホウ | |
| DE69902788T2 (de) | Verfahren zu herstellung von simvastatin und zwischenprodukten | |
| Kenyon et al. | Alkylations of Phenylacetic, α-Alkylphenylacetic, and Diphenylacetic Esters by Means of Sodamide and Sodium Hydride1 | |
| DE2611788C2 (de) | Fluorprostaglandine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| US3576880A (en) | 5(2,6,6-trimethyl - 1 - hydroxy-cyclohex-2-enyl) -3 methyl-penta-2,4-dien-1-al derivatives | |
| US4255334A (en) | Process for preparing 3-azabicyclo(3.1.0)hexane-2-carboxylic acid | |
| US4130721A (en) | 11-Deoxy PGE2 compounds | |
| US3700694A (en) | Insect control | |
| FR2515642A1 (fr) | Nouvelles (11r)-11-deoxy-11-alkyl-6-oxo-prostaglandines et compositions pharmaceutiques les contenant | |
| US3711528A (en) | Racemic dihydro-pge{11 {11 and related compounds | |
| CH609027A5 (en) | New process for the preparation of lower alkyl esters of hemicaronaldehyde (hemicaronic aldehyde) | |
| US3988380A (en) | Process for preparing 1,2-disubstituted-trans-olefins | |
| EP0162235B1 (de) | Enantiomerenreine acetalisch mono-geschützte Diole, deren Herstellung und Verwendung | |
| Murphy et al. | Reactions directed towards the synthesis of 5-(β-hydroxyethyl)-2-isopropylcyclohexanone | |
| US4220798A (en) | 19-Methyl-9-keto-15-hydroxy-prost-18-enoic acid derivatives and process of their preparation | |
| IL44636A (en) | History N - Converted Alkanesulfonamido - Alkanesulfonamido - Al Cananoic Acids and 3 - Oxa - Alcanoic, Preparation and Raw Preparations |