IL36584A - Bite compounds) 4 - dialkylamino, - 3,5 - dinitropenyl (disulfides and process for their preparation - Google Patents
Bite compounds) 4 - dialkylamino, - 3,5 - dinitropenyl (disulfides and process for their preparationInfo
- Publication number
- IL36584A IL36584A IL36584A IL3658471A IL36584A IL 36584 A IL36584 A IL 36584A IL 36584 A IL36584 A IL 36584A IL 3658471 A IL3658471 A IL 3658471A IL 36584 A IL36584 A IL 36584A
- Authority
- IL
- Israel
- Prior art keywords
- bis
- disulfide
- dinitrophenyl
- chloro
- dialkylamino
- Prior art date
Links
- 150000002019 disulfides Chemical class 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- BLYYHVGDIRNVNY-UHFFFAOYSA-N (4-chloro-3,5-dinitrophenyl) thiocyanate Chemical compound [O-][N+](=O)C1=CC(SC#N)=CC([N+]([O-])=O)=C1Cl BLYYHVGDIRNVNY-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 2
- QHCCDDQKNUYGNC-UHFFFAOYSA-N n-ethylbutan-1-amine Chemical compound CCCCNCC QHCCDDQKNUYGNC-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000004009 herbicide Substances 0.000 description 8
- 230000002363 herbicidal effect Effects 0.000 description 7
- -1 potassium sulfonate derivative Chemical class 0.000 description 7
- 229940124530 sulfonamide Drugs 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical class NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 3
- 150000003456 sulfonamides Chemical class 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000002228 disulfide group Chemical group 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000007040 multi-step synthesis reaction Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BPPMIQPXQVIZNJ-UHFFFAOYSA-N 2-chloro-1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1Cl BPPMIQPXQVIZNJ-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- NSCBEXDNDMWCNW-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dinitrophenyl)disulfanyl]-2,6-dinitrophenol Chemical compound OC1=C(C=C(C=C1[N+](=O)[O-])SSC1=CC(=C(C(=C1)[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-] NSCBEXDNDMWCNW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 125000003277 amino group Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005007 materials handling Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- UOULCEYHQNCFFH-UHFFFAOYSA-M sodium;hydroxymethanesulfonate Chemical compound [Na+].OCS([O-])(=O)=O UOULCEYHQNCFFH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3022870A | 1970-04-20 | 1970-04-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL36584A0 IL36584A0 (en) | 1971-06-23 |
| IL36584A true IL36584A (en) | 1974-11-29 |
Family
ID=21853188
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL36584A IL36584A (en) | 1970-04-20 | 1971-04-09 | Bite compounds) 4 - dialkylamino, - 3,5 - dinitropenyl (disulfides and process for their preparation |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3725479A (online.php) |
| JP (1) | JPS5529070B2 (online.php) |
| AT (1) | AT308719B (online.php) |
| CH (2) | CH554850A (online.php) |
| HU (1) | HU163257B (online.php) |
| IE (1) | IE35061B1 (online.php) |
| IL (1) | IL36584A (online.php) |
| NL (1) | NL7103904A (online.php) |
| PL (1) | PL73565B1 (online.php) |
| SE (1) | SE391334B (online.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN107250493B (zh) | 2014-10-27 | 2020-06-05 | 康明斯公司 | 余热回收集成冷却模块 |
| US10619521B2 (en) | 2015-12-21 | 2020-04-14 | Cummins Inc. | Waste heat recovery power drive |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA462497A (en) * | 1950-01-17 | Timothy Paul Philip | Manufacture of dithio bis-arylamine | |
| NL132336C (online.php) * | 1951-01-28 |
-
1970
- 1970-04-20 US US00030228A patent/US3725479A/en not_active Expired - Lifetime
-
1971
- 1971-03-23 NL NL7103904A patent/NL7103904A/xx not_active Application Discontinuation
- 1971-04-09 IL IL36584A patent/IL36584A/en unknown
- 1971-04-14 AT AT315471A patent/AT308719B/de not_active IP Right Cessation
- 1971-04-15 IE IE465/71A patent/IE35061B1/xx unknown
- 1971-04-16 SE SE7105001A patent/SE391334B/xx unknown
- 1971-04-19 JP JP2460871A patent/JPS5529070B2/ja not_active Expired
- 1971-04-19 CH CH565271A patent/CH554850A/xx not_active IP Right Cessation
- 1971-04-19 HU HUEI376A patent/HU163257B/hu unknown
- 1971-04-19 PL PL1971147631A patent/PL73565B1/pl unknown
- 1971-04-19 CH CH1525473A patent/CH575389A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE391334B (sv) | 1977-02-14 |
| IL36584A0 (en) | 1971-06-23 |
| JPS5529070B2 (online.php) | 1980-07-31 |
| IE35061B1 (en) | 1975-10-29 |
| CH575389A5 (online.php) | 1976-05-14 |
| AT308719B (de) | 1973-07-25 |
| US3725479A (en) | 1973-04-03 |
| JPS465071A (online.php) | 1971-11-24 |
| IE35061L (en) | 1971-10-20 |
| CH554850A (de) | 1974-10-15 |
| PL73565B1 (online.php) | 1974-10-30 |
| HU163257B (online.php) | 1973-07-28 |
| NL7103904A (online.php) | 1971-10-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK159777B (da) | N-alkyl-norscopiner og fremgangsmaade til fremstilling heraf samt deres anvendelse som mellemprodukter | |
| JPS6259692B2 (online.php) | ||
| HU207723B (en) | Process for producing chloro-thiazol derivatives | |
| PL72709B1 (online.php) | ||
| US4061647A (en) | Thiazolidine derivatives | |
| US4129656A (en) | Thiazolidine derivatives, salidiuretic compositions and methods of effecting salidiuresis employing them | |
| US3920690A (en) | Herbicidal trifluoromethylsulfonamido-pyrazoles | |
| Engberts et al. | Chemistry of α‐diazosulfones: Part III. A simple preparation of N‐(sulfonylmethyl) urethanes by a Mannich condensation | |
| US3794642A (en) | Oxidation of substituted methanes to the corresponding substituted methanols | |
| US3923810A (en) | Perfluoroalkanesulfonamides N-substituted by heterocyclic groups | |
| IL36584A (en) | Bite compounds) 4 - dialkylamino, - 3,5 - dinitropenyl (disulfides and process for their preparation | |
| US3361752A (en) | Preparation of benzothiazolyl dithio carbamates | |
| CA1091695A (en) | 4-alkylthio-2-trifluoromethylalkane-sulfonanilides and derivatives thereof | |
| JPH01197474A (ja) | 4−アミノ−1,2,4−トリアゾール−5−オン類の製造方法 | |
| US3326967A (en) | Trihalomethylthio substituted n, n'-sulfonyl-bis-carbamates | |
| US2729645A (en) | 1-[2-(dithiocarboxyamino)polymethylene] quaternary ammonium inner salts | |
| US3847927A (en) | Sulfur-containing hydroxypyridones | |
| EP0134934B1 (de) | 2-Ketosulfonamide und Verfahren zu deren Herstellung | |
| US4125711A (en) | Process for preparing auranofin | |
| US3349125A (en) | Aromatic sulfonyl bis-ureas and process of preparation | |
| US4118501A (en) | Thiazolidine derivatives | |
| Tomé et al. | Chlorosulfonation of N-arylmaleimides | |
| SU1705282A1 (ru) | Способ получени арилсульфонилкарбаматов | |
| US2567839A (en) | 4 methoxyphenyl ester of 4-chloro-benzene sulfonic acid | |
| EP0170057B1 (de) | Verfahren zur Herstellung von N-Phenyl(Pyridyl)-sulfonyldiamiden |