IL34820A - Isoquinoline and benzazepine sulfonyl ureas,their preparation and pharmaceutical compositions containing them - Google Patents
Isoquinoline and benzazepine sulfonyl ureas,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL34820A IL34820A IL34820A IL3482070A IL34820A IL 34820 A IL34820 A IL 34820A IL 34820 A IL34820 A IL 34820A IL 3482070 A IL3482070 A IL 3482070A IL 34820 A IL34820 A IL 34820A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- compound
- tetrahydroisoquinoline
- group
- sulfonamide
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 9
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 7
- 229940100389 Sulfonylurea Drugs 0.000 title description 11
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 title description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 title 2
- 159000000000 sodium salts Chemical class 0.000 claims description 79
- 229940124530 sulfonamide Drugs 0.000 claims description 53
- 150000001875 compounds Chemical class 0.000 claims description 40
- -1 methoxy, methyl Chemical group 0.000 claims description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 23
- 150000003456 sulfonamides Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 16
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 12
- 229910052783 alkali metal Inorganic materials 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 125000003277 amino group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000003701 inert diluent Substances 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 150000007530 organic bases Chemical group 0.000 claims description 4
- WZHRJGWXUCLILI-UHFFFAOYSA-N sulfonylcarbamic acid Chemical compound OC(=O)N=S(=O)=O WZHRJGWXUCLILI-UHFFFAOYSA-N 0.000 claims description 4
- 239000002775 capsule Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 235000010290 biphenyl Nutrition 0.000 claims 1
- 239000004305 biphenyl Substances 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 79
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 47
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 45
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 43
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 40
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 238000001704 evaporation Methods 0.000 description 19
- 230000008020 evaporation Effects 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 239000004202 carbamide Substances 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 239000012670 alkaline solution Substances 0.000 description 6
- 239000003610 charcoal Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- AOCYHPQXGJBAQQ-UHFFFAOYSA-N ethyl n-sulfonylcarbamate Chemical compound CCOC(=O)N=S(=O)=O AOCYHPQXGJBAQQ-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000000967 suction filtration Methods 0.000 description 3
- UGLLZXSYRBMNOS-UHFFFAOYSA-N 1,2,3,4-tetrahydro-isoquinoline-7-sulfonic acid amide Chemical compound C1CNCC2=CC(S(=O)(=O)N)=CC=C21 UGLLZXSYRBMNOS-UHFFFAOYSA-N 0.000 description 2
- HFODCIWEQMGWCT-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-7-sulfonamide;hydrochloride Chemical compound Cl.C1CNCC2=CC(S(=O)(=O)N)=CC=C21 HFODCIWEQMGWCT-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NABUFFLEHQEQPH-UHFFFAOYSA-N 1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone Chemical compound C1CN(C(=O)C)CCC2=CC=CC=C21 NABUFFLEHQEQPH-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- PFDBEACWLCHWRZ-UHFFFAOYSA-N 2-(4-bromophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(Br)C=C1 PFDBEACWLCHWRZ-UHFFFAOYSA-N 0.000 description 2
- MFYSUUPKMDJYPF-UHFFFAOYSA-N 2-[(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-n-phenylbutanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C(=O)C)N=NC1=CC=C(C)C=C1[N+]([O-])=O MFYSUUPKMDJYPF-UHFFFAOYSA-N 0.000 description 2
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical compound CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 238000000297 Sandmeyer reaction Methods 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 238000003916 acid precipitation Methods 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 238000013329 compounding Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- APFVFNSFBWLKPD-UHFFFAOYSA-N (3-oxo-3-phenylpropyl) acetate Chemical compound CC(=O)OCCC(=O)C1=CC=CC=C1 APFVFNSFBWLKPD-UHFFFAOYSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical class C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 1
- XEIONDMOAYQBOA-UHFFFAOYSA-N 1-cyclohexyl-3-(1,2,3,4-tetrahydroisoquinolin-7-ylsulfonyl)urea Chemical compound C1NCCC2=CC=C(C=C12)S(=O)(=O)NC(=O)NC1CCCCC1 XEIONDMOAYQBOA-UHFFFAOYSA-N 0.000 description 1
- LOXPKSAIAHLVML-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-3-benzazepin-7-amine Chemical class C1CNCCC2=CC(N)=CC=C21 LOXPKSAIAHLVML-UHFFFAOYSA-N 0.000 description 1
- IRUXSKJXJFMZPQ-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-3-benzazepine-7-sulfonamide Chemical compound C1CNCCC2=CC(S(=O)(=O)N)=CC=C21 IRUXSKJXJFMZPQ-UHFFFAOYSA-N 0.000 description 1
- AAFGZKYAEMJTLZ-UHFFFAOYSA-N 2-(2-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound C1(=CC=CC=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C AAFGZKYAEMJTLZ-UHFFFAOYSA-N 0.000 description 1
- INQBKBZXXJVZEQ-UHFFFAOYSA-N 2-(3,3-diphenylpropanoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound C1(=CC=CC=C1)C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C1=CC=CC=C1 INQBKBZXXJVZEQ-UHFFFAOYSA-N 0.000 description 1
- OTVSGUXUQHZGNR-UHFFFAOYSA-N 2-(4-bromophenyl)propanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=C(Br)C=C1 OTVSGUXUQHZGNR-UHFFFAOYSA-N 0.000 description 1
- YOZILQVNIWNPFP-UHFFFAOYSA-N 2-(4-chlorophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(Cl)C=C1 YOZILQVNIWNPFP-UHFFFAOYSA-N 0.000 description 1
- APSGVUXOAHSBGR-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound ClC=1C=C(C=CC1Cl)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C APSGVUXOAHSBGR-UHFFFAOYSA-N 0.000 description 1
- ILJBSAAGDQNOHZ-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound ClC1=CC=C(C=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C ILJBSAAGDQNOHZ-UHFFFAOYSA-N 0.000 description 1
- UXSMEOLJRBKPKI-UHFFFAOYSA-N 2-[3-(3-chlorophenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound ClC=1C=C(C=CC1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N UXSMEOLJRBKPKI-UHFFFAOYSA-N 0.000 description 1
- MAUSSGMKFIPNAQ-UHFFFAOYSA-N 3-acetyl-1,2,4,5-tetrahydro-3-benzazepine-7-sulfonamide Chemical compound C(C)(=O)N1CCC2=C(CC1)C=CC(=C2)S(=O)(=O)N MAUSSGMKFIPNAQ-UHFFFAOYSA-N 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- XEFKQWGOXKOCHN-UHFFFAOYSA-N 4-[1,1-bis[4-(dimethylamino)phenyl]-2,2,2-trifluoroethyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C(C(F)(F)F)(C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 XEFKQWGOXKOCHN-UHFFFAOYSA-N 0.000 description 1
- IKQCKANHUYSABG-UHFFFAOYSA-N 4-ethylcyclohexan-1-amine Chemical compound CCC1CCC(N)CC1 IKQCKANHUYSABG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- GUCLPCNETRTMIK-UHFFFAOYSA-N C(C)OC1=CC=C(C=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C Chemical compound C(C)OC1=CC=C(C=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C GUCLPCNETRTMIK-UHFFFAOYSA-N 0.000 description 1
- UIWGHTMEJUQOTF-UHFFFAOYSA-N C1(=CC=C(C=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C Chemical compound C1(=CC=C(C=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C UIWGHTMEJUQOTF-UHFFFAOYSA-N 0.000 description 1
- WZYNHWTZPLQOAG-UHFFFAOYSA-N C1(=CC=CC=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C Chemical compound C1(=CC=CC=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C WZYNHWTZPLQOAG-UHFFFAOYSA-N 0.000 description 1
- DBESOTBONSCZLF-UHFFFAOYSA-N C1(=CC=CC=C1)C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C Chemical compound C1(=CC=CC=C1)C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C DBESOTBONSCZLF-UHFFFAOYSA-N 0.000 description 1
- WSBZVFWAVDZIJU-UHFFFAOYSA-N C1(=CC=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N Chemical compound C1(=CC=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N WSBZVFWAVDZIJU-UHFFFAOYSA-N 0.000 description 1
- MQSYDXZBYUDTTJ-UHFFFAOYSA-N CC(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)CC1=CC=CC=C1 Chemical compound CC(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)CC1=CC=CC=C1 MQSYDXZBYUDTTJ-UHFFFAOYSA-N 0.000 description 1
- FSWUULHCNDYMGQ-UHFFFAOYSA-N CC(C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C1=CC=CC=C1)C Chemical compound CC(C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C1=CC=CC=C1)C FSWUULHCNDYMGQ-UHFFFAOYSA-N 0.000 description 1
- GRALOFCMPMMESQ-UHFFFAOYSA-N COC1=C(C=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N Chemical compound COC1=C(C=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N GRALOFCMPMMESQ-UHFFFAOYSA-N 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- ALJDYAQEODFQCX-UHFFFAOYSA-N ethyl N-[[2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfonyl]carbamate Chemical compound CCOC(=O)NS(=O)(=O)C1=CC2=C(CCN(C2)C(=O)CCC2=CC=CC=C2)C=C1 ALJDYAQEODFQCX-UHFFFAOYSA-N 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical compound OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000008259 solid foam Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691933388 DE1933388A1 (de) | 1969-07-01 | 1969-07-01 | Neue Sulfonylharnstoffe und Verfahren zu ihrer Herstellung |
| DE19702027436 DE2027436A1 (en) | 1970-06-04 | 1970-06-04 | Sulphenylurea cpds, hypoglycaemics |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34820A0 IL34820A0 (en) | 1970-09-17 |
| IL34820A true IL34820A (en) | 1973-08-29 |
Family
ID=25757577
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34820A IL34820A (en) | 1969-07-01 | 1970-06-30 | Isoquinoline and benzazepine sulfonyl ureas,their preparation and pharmaceutical compositions containing them |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT301568B (enEXAMPLES) |
| BE (1) | BE752760A (enEXAMPLES) |
| BG (1) | BG18181A1 (enEXAMPLES) |
| CH (1) | CH536842A (enEXAMPLES) |
| DK (1) | DK127928B (enEXAMPLES) |
| ES (2) | ES381248A1 (enEXAMPLES) |
| FI (1) | FI49828C (enEXAMPLES) |
| FR (1) | FR2059465B1 (enEXAMPLES) |
| GB (1) | GB1313539A (enEXAMPLES) |
| IE (1) | IE34359B1 (enEXAMPLES) |
| IL (1) | IL34820A (enEXAMPLES) |
| NL (1) | NL7009704A (enEXAMPLES) |
| NO (1) | NO132094C (enEXAMPLES) |
| PL (1) | PL81112B1 (enEXAMPLES) |
| RO (1) | RO56857A (enEXAMPLES) |
| SE (1) | SE357745B (enEXAMPLES) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1283199A4 (en) | 2000-05-16 | 2003-12-17 | Takeda Chemical Industries Ltd | MELANINE CONCENTRATING HORMONE ANTAGONISTS |
-
1970
- 1970-06-17 FI FI701712A patent/FI49828C/fi active
- 1970-06-24 SE SE08771/70A patent/SE357745B/xx unknown
- 1970-06-25 RO RO63739A patent/RO56857A/ro unknown
- 1970-06-26 BG BG16831A patent/BG18181A1/xx unknown
- 1970-06-27 ES ES381248A patent/ES381248A1/es not_active Expired
- 1970-06-29 CH CH982470A patent/CH536842A/de not_active IP Right Cessation
- 1970-06-30 IL IL34820A patent/IL34820A/en unknown
- 1970-06-30 AT AT586870A patent/AT301568B/de not_active IP Right Cessation
- 1970-06-30 GB GB3172270A patent/GB1313539A/en not_active Expired
- 1970-06-30 IE IE856/70A patent/IE34359B1/xx unknown
- 1970-06-30 BE BE752760D patent/BE752760A/xx unknown
- 1970-06-30 NO NO2575/70A patent/NO132094C/no unknown
- 1970-06-30 PL PL1970141708A patent/PL81112B1/pl unknown
- 1970-06-30 DK DK338970AA patent/DK127928B/da unknown
- 1970-07-01 FR FR7024368A patent/FR2059465B1/fr not_active Expired
- 1970-07-01 NL NL7009704A patent/NL7009704A/xx unknown
-
1971
- 1971-07-19 ES ES393416A patent/ES393416A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NO132094B (enEXAMPLES) | 1975-06-09 |
| PL81112B1 (en) | 1975-08-30 |
| GB1313539A (en) | 1973-04-11 |
| ES393416A1 (es) | 1974-06-01 |
| SE357745B (enEXAMPLES) | 1973-07-09 |
| CH536842A (de) | 1973-05-15 |
| IE34359L (en) | 1971-01-01 |
| ES381248A1 (es) | 1972-11-01 |
| FI49828C (fi) | 1975-10-10 |
| NO132094C (enEXAMPLES) | 1975-09-17 |
| IE34359B1 (en) | 1975-04-16 |
| NL7009704A (enEXAMPLES) | 1971-01-05 |
| IL34820A0 (en) | 1970-09-17 |
| RO56857A (enEXAMPLES) | 1974-12-15 |
| FR2059465A1 (enEXAMPLES) | 1971-06-04 |
| BG18181A1 (enEXAMPLES) | 1974-09-02 |
| DK127928B (da) | 1974-02-04 |
| FI49828B (enEXAMPLES) | 1975-06-30 |
| AT301568B (de) | 1972-09-11 |
| FR2059465B1 (enEXAMPLES) | 1974-03-22 |
| BE752760A (fr) | 1970-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR0174752B1 (ko) | 이환식 헤테로환 함유 술폰아미드 유도체 및 그 제조방법 | |
| KR100621272B1 (ko) | 퀴놀린 및 퀴나졸린 유도체 | |
| AU672224B2 (en) | 2-thioindoles (selenoindoles) and related disulfides (selenides) which inhibit protein tyrosine kinases and whichhave antitumor properties | |
| JP3545461B2 (ja) | 二環式ヘテロ環含有スルホンアミド誘導体 | |
| US5252580A (en) | Indole derivatives and anti-ulcer compositions thereof | |
| US3471515A (en) | (2-hydroxy-3-substituted aminopropoxy)indoles | |
| JPH0242074A (ja) | ベンゾピラン誘導体およびその製造法 | |
| KR20040010709A (ko) | 5-ht6 수용체 친화력을 갖는 4-피페라지닐인돌 유도체 | |
| JPH02270874A (ja) | アザビシクロ化合物及びそれらの塩、それらの製造方法、それらを含有する製薬組成物並びにそれらの薬剤としての使用 | |
| HK75892A (en) | 1-benzyl-aminoalkyl-pyrrolidinones and their addition salts, process for their preparation and pharmaceutical compounds containing them | |
| IL108636A (en) | Polysubstituted 2-amino-thiazole derivatives their preparation and pharmaceutical compositions containing them | |
| KR100313180B1 (ko) | 5-아로일나프탈렌 유도체 | |
| JP2707936B2 (ja) | β−オキソ−β−ベンゼンプロパンチオアミド誘導体 | |
| US4169150A (en) | Benzodiazepine derivatives and pharmaceutical compositions containing said derivatives | |
| AU2005331482B2 (en) | Dihydropyridine derivatives | |
| CZ420498A3 (cs) | Indolinový derivát jako antagonista 5-HT-2C receptoru | |
| US5576327A (en) | Treatment of heart rhythym disorders by administration of 3-phenylsulfonyl-3, 7-diazabicyclo[3.3.1]nonane compounds | |
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| IL34820A (en) | Isoquinoline and benzazepine sulfonyl ureas,their preparation and pharmaceutical compositions containing them | |
| EA024767B1 (ru) | Сульфонамидные производные бензиламина для лечения заболеваний цнс | |
| AU2002331179B2 (en) | Aminopyrrole compounds as antiinflammatory agents | |
| JPS59512B2 (ja) | ピラゾ−ル −5− オンカゴウブツ ノ セイゾウホウホウ | |
| US4537975A (en) | 1-Phenylindazol-3-one compounds | |
| KR100525703B1 (ko) | 1-부틸-4-피페리디닐메틸아민의 제법 | |
| AU2002331179A1 (en) | Aminopyrrole compounds as antiinflammatory agents |