IL34468A - Acidic salt salts of the history of indonopyridine, their preparation and pharmaceutical preparations containing them - Google Patents
Acidic salt salts of the history of indonopyridine, their preparation and pharmaceutical preparations containing themInfo
- Publication number
- IL34468A IL34468A IL34468A IL3446870A IL34468A IL 34468 A IL34468 A IL 34468A IL 34468 A IL34468 A IL 34468A IL 3446870 A IL3446870 A IL 3446870A IL 34468 A IL34468 A IL 34468A
- Authority
- IL
- Israel
- Prior art keywords
- acid
- addition salt
- indeno
- acid addition
- tetrahydro
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 64
- 150000003839 salts Chemical class 0.000 title claims description 39
- PFWJFKBTIBAASX-UHFFFAOYSA-N 9h-indeno[2,1-b]pyridine Chemical class C1=CN=C2CC3=CC=CC=C3C2=C1 PFWJFKBTIBAASX-UHFFFAOYSA-N 0.000 title claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 title claims 2
- 238000002360 preparation method Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 64
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- -1 alkyl radical Chemical class 0.000 claims description 18
- 150000003254 radicals Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 14
- 238000010992 reflux Methods 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 7
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- DRTQHJPVMGBUCF-UCVXFZOQSA-N 1-[(2s,3s,4s,5s)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione Chemical compound O[C@H]1[C@H](O)[C@H](CO)O[C@@H]1N1C(=O)NC(=O)C=C1 DRTQHJPVMGBUCF-UCVXFZOQSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 4
- UINFICGYFFOSMB-UHFFFAOYSA-N propanoate;pyridin-1-ium Chemical compound CCC(O)=O.C1=CC=NC=C1 UINFICGYFFOSMB-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- VMLHFTTZQXQOFL-UHFFFAOYSA-N propanamide pyridine Chemical compound CCC(N)=O.C1=CC=NC=C1 VMLHFTTZQXQOFL-UHFFFAOYSA-N 0.000 claims description 3
- VQMCLNZVXCKCCJ-UHFFFAOYSA-N propanenitrile pyridine Chemical compound N1=CC=CC=C1.C(CC)#N VQMCLNZVXCKCCJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 6
- 235000019260 propionic acid Nutrition 0.000 claims 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims 3
- WSMRJBYOIBBOQN-UHFFFAOYSA-N 6-pyridin-2-ylhexanoic acid Chemical compound OC(=O)CCCCCC1=CC=CC=N1 WSMRJBYOIBBOQN-UHFFFAOYSA-N 0.000 claims 1
- GKZVQQXVPMIVLH-UHFFFAOYSA-N C(C)OC(CC)=O.N1=CC=CC=C1 Chemical compound C(C)OC(CC)=O.N1=CC=CC=C1 GKZVQQXVPMIVLH-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- FHFJFSSWKDKHHG-UHFFFAOYSA-N butanoic acid;pyridine Chemical compound CCCC([O-])=O.C1=CC=[NH+]C=C1 FHFJFSSWKDKHHG-UHFFFAOYSA-N 0.000 claims 1
- 239000003085 diluting agent Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 150000004702 methyl esters Chemical class 0.000 claims 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000001704 evaporation Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- 150000001649 bromium compounds Chemical class 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 150000004694 iodide salts Chemical class 0.000 description 4
- NNMQULFLJMDOJK-UHFFFAOYSA-N propanoic acid;pyridine;hydrochloride Chemical compound Cl.CCC(O)=O.C1=CC=NC=C1 NNMQULFLJMDOJK-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- OJVSEHLMRCLAFY-UHFFFAOYSA-N methyl propanoate;hydrochloride Chemical compound Cl.CCC(=O)OC OJVSEHLMRCLAFY-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XGCCZESMWPVFJK-UHFFFAOYSA-N COC(CC)=O.N1=CC=CC=C1 Chemical compound COC(CC)=O.N1=CC=CC=C1 XGCCZESMWPVFJK-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- XIJIZGFUXFENSV-UHFFFAOYSA-N Cl.C(CC)#N.N1=CC=CC=C1 Chemical compound Cl.C(CC)#N.N1=CC=CC=C1 XIJIZGFUXFENSV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000002891 anorexigenic effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- KYLVAMSNNZMHSX-UHFFFAOYSA-N methyl 6-bromohexanoate Chemical compound COC(=O)CCCCCBr KYLVAMSNNZMHSX-UHFFFAOYSA-N 0.000 description 1
- KDQJLOVCWZQRIO-UHFFFAOYSA-N methyl propanoate pyridine hydrochloride Chemical compound Cl.COC(CC)=O.N1=CC=CC=C1 KDQJLOVCWZQRIO-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- YYFIGOPUHPDIBO-UHFFFAOYSA-N propanoic acid;hydrochloride Chemical compound Cl.CCC(O)=O YYFIGOPUHPDIBO-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000000472 traumatic effect Effects 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 230000002408 ulcerprotective effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/16—Ring systems of three rings containing carbocyclic rings other than six-membered
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH696769A CH516558A (de) | 1969-05-07 | 1969-05-07 | Verfahren zur Herstellung neuer Indenopyridinderivate |
| CH1842469 | 1969-12-11 | ||
| CH165170 | 1970-02-05 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL34468A0 IL34468A0 (en) | 1970-07-19 |
| IL34468A true IL34468A (en) | 1973-06-29 |
Family
ID=27173145
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL34468A IL34468A (en) | 1969-05-07 | 1970-05-05 | Acidic salt salts of the history of indonopyridine, their preparation and pharmaceutical preparations containing them |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3678058A (show.php) |
| CA (1) | CA951734A (show.php) |
| CY (1) | CY819A (show.php) |
| DE (1) | DE2021747A1 (show.php) |
| ES (3) | ES379299A1 (show.php) |
| FI (1) | FI51478C (show.php) |
| FR (1) | FR2051503B1 (show.php) |
| GB (1) | GB1306404A (show.php) |
| IE (1) | IE35052B1 (show.php) |
| IL (1) | IL34468A (show.php) |
| MY (1) | MY7500239A (show.php) |
| NL (1) | NL7006274A (show.php) |
| NO (1) | NO132478C (show.php) |
| SE (1) | SE375310B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3991066A (en) * | 1971-01-26 | 1976-11-09 | Sandoz Ltd. | 1,3,4,9B-Tetrahydro-5-methyl-2H-indeno[1,2-c]pyridines |
| US5319084A (en) * | 1993-08-16 | 1994-06-07 | Research Triangle Institute | Hexahydroindenopyridine compounds having antispermatogenic activity |
| US7544696B2 (en) * | 2003-01-24 | 2009-06-09 | Research Triangle Institute | Spermicidal and/or antifungal composition and methods of using the same |
| US7795436B2 (en) * | 2005-08-24 | 2010-09-14 | Bristol-Myers Squibb Company | Substituted tricyclic heterocycles as serotonin receptor agonists and antagonists |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3462443A (en) * | 1967-04-19 | 1969-08-19 | Mcneilab Inc | Indeno(1,2-c)pyridine derivatives |
-
1970
- 1970-04-10 CY CY819A patent/CY819A/xx unknown
- 1970-04-10 GB GB1708070A patent/GB1306404A/en not_active Expired
- 1970-04-29 NL NL7006274A patent/NL7006274A/xx unknown
- 1970-04-30 US US33498A patent/US3678058A/en not_active Expired - Lifetime
- 1970-05-04 DE DE19702021747 patent/DE2021747A1/de active Pending
- 1970-05-04 FR FR7016162A patent/FR2051503B1/fr not_active Expired
- 1970-05-05 IE IE586/70A patent/IE35052B1/xx unknown
- 1970-05-05 SE SE7006162A patent/SE375310B/xx unknown
- 1970-05-05 NO NO1707/70A patent/NO132478C/no unknown
- 1970-05-05 FI FI701261A patent/FI51478C/fi active
- 1970-05-05 IL IL34468A patent/IL34468A/en unknown
- 1970-05-05 ES ES379299A patent/ES379299A1/es not_active Expired
- 1970-05-06 CA CA081,987,A patent/CA951734A/en not_active Expired
-
1972
- 1972-12-01 ES ES409196A patent/ES409196A1/es not_active Expired
- 1972-12-01 ES ES409197A patent/ES409197A1/es not_active Expired
-
1975
- 1975-12-30 MY MY239/75A patent/MY7500239A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2051503A1 (show.php) | 1971-04-09 |
| IL34468A0 (en) | 1970-07-19 |
| IE35052L (en) | 1970-11-07 |
| ES409196A1 (es) | 1976-03-16 |
| NO132478B (show.php) | 1975-08-11 |
| CY819A (en) | 1976-12-01 |
| GB1306404A (en) | 1973-02-14 |
| NO132478C (show.php) | 1975-11-19 |
| FI51478B (show.php) | 1976-09-30 |
| US3678058A (en) | 1972-07-18 |
| MY7500239A (en) | 1975-12-31 |
| ES379299A1 (es) | 1973-04-16 |
| FI51478C (fi) | 1977-01-10 |
| NL7006274A (show.php) | 1970-11-10 |
| FR2051503B1 (show.php) | 1974-08-30 |
| DE2021747A1 (de) | 1970-11-19 |
| CA951734A (en) | 1974-07-23 |
| SE375310B (show.php) | 1975-04-14 |
| IE35052B1 (en) | 1975-10-29 |
| ES409197A1 (es) | 1976-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS582936B2 (ja) | 5↓−アロイルピロ−ル酢酸およびその塩類の製法 | |
| JPS6310784A (ja) | 抗アレルギー剤 | |
| JP3122792B2 (ja) | 新規な活性化合物 | |
| US3445473A (en) | 3-anilino-thiophene-4-carboxylic acids,esters,and amides | |
| US3658829A (en) | Phenoxy carboxylic acid derivatives | |
| KR900004587B1 (ko) | 페닐나프티리딘의 제조방법 | |
| US3780061A (en) | Tricyclic ketonic compounds | |
| US3408353A (en) | 1, 3, 4, 9b-tetrahydro-2h-indeno(1, 2-c)pyridine derivatives | |
| FI66857C (fi) | Foerfarande foer framstaellning av nya farmaceutiskt anvaendbara 3-substituerade dibensofuranderivat | |
| IL34468A (en) | Acidic salt salts of the history of indonopyridine, their preparation and pharmaceutical preparations containing them | |
| HU179391B (en) | Process for producing thiasolo-square bracket-2,3-b-square bracket closed-quinasoline derivatives | |
| SU900808A3 (ru) | Способ получени аминопропанолпроизводных 6-окси-2,3,4,5-тетрагидро-1н-1-бензазепин-2-она или их солей | |
| US3086972A (en) | Aza-thiaxanthene derivatives | |
| US4127667A (en) | Substituted thiopyrano(4,3-b)pyrans | |
| US3997589A (en) | 4-(2'-Fluoro-4-biphenylylr-4-oxo-butyric acid and esters and salts thereof | |
| US3929833A (en) | Organic compounds | |
| US3882119A (en) | Tetracyclic substituted phthalazine compounds | |
| EP0155524A1 (en) | -Omega-aryl-alkylthienyl compounds, process for their preparation and pharmaceutical products containing these compounds | |
| US3466277A (en) | N-allylic cyclohexyl lower alkyl normorphines | |
| JPS61158980A (ja) | 8α‐アシルアミノエルゴリン類、その製法および医薬組成物 | |
| JPS62149672A (ja) | 4H−ベンゾ〔4,5〕シクロヘプタ〔1,2−b〕チオフエン誘導体 | |
| JPS5810387B2 (ja) | 4,5,6,7テトラヒドロイミダゾ〔4,5−c〕ピリジン誘導体及びその製法 | |
| JPS59186962A (ja) | イミダゾリン誘導体およびそれを含有する医薬 | |
| HU180589B (en) | Process for producing dihydronicotinic acid derivatives | |
| US4218473A (en) | Derivatives of 4-cyclohexyl-1-naphthalene-acetic acid and their use as drugs |