IL32739A - 2,6-bis-(di-(hydroxyalkyl)-amino)-pyrimido(5,4-d)pyrimidines,their preparation and pharmaceutical compositions containing them - Google Patents
2,6-bis-(di-(hydroxyalkyl)-amino)-pyrimido(5,4-d)pyrimidines,their preparation and pharmaceutical compositions containing themInfo
- Publication number
- IL32739A IL32739A IL32739A IL3273969A IL32739A IL 32739 A IL32739 A IL 32739A IL 32739 A IL32739 A IL 32739A IL 3273969 A IL3273969 A IL 3273969A IL 32739 A IL32739 A IL 32739A
- Authority
- IL
- Israel
- Prior art keywords
- compounds
- bis
- pyrimidine
- compound
- formula
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 17
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 5
- 150000003230 pyrimidines Chemical class 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 53
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 38
- 239000000243 solution Substances 0.000 claims description 38
- 230000008569 process Effects 0.000 claims description 37
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 21
- -1 hexamethyleneimino Chemical group 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 230000009467 reduction Effects 0.000 claims description 10
- 239000004480 active ingredient Substances 0.000 claims description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 8
- 239000011630 iodine Substances 0.000 claims description 8
- 230000003647 oxidation Effects 0.000 claims description 8
- 238000007254 oxidation reaction Methods 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 239000000829 suppository Substances 0.000 claims description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 4
- 235000019253 formic acid Nutrition 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- SXDBWCPKPHAZSM-UHFFFAOYSA-M bromate Inorganic materials [O-]Br(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-M 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000006196 drop Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 239000000839 emulsion Substances 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims description 2
- 239000012286 potassium permanganate Substances 0.000 claims description 2
- 239000006188 syrup Substances 0.000 claims description 2
- 235000020357 syrup Nutrition 0.000 claims description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 239000004153 Potassium bromate Substances 0.000 claims 1
- 239000007924 injection Substances 0.000 claims 1
- 238000002347 injection Methods 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 229940094037 potassium bromate Drugs 0.000 claims 1
- 235000019396 potassium bromate Nutrition 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000003826 tablet Substances 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 230000001766 physiological effect Effects 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000007940 sugar coated tablet Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000002776 aggregation Effects 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229920001592 potato starch Polymers 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 235000013871 bee wax Nutrition 0.000 description 2
- 239000012166 beeswax Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 210000001772 blood platelet Anatomy 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229940057847 polyethylene glycol 600 Drugs 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 125000001302 tertiary amino group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LPZOCVVDSHQFST-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-ethylpyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CC LPZOCVVDSHQFST-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- JVKRKMWZYMKVTQ-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C=NN(C=1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JVKRKMWZYMKVTQ-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 101100490437 Mus musculus Acvrl1 gene Proteins 0.000 description 1
- 241001547870 Sida <angiosperm> Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000005792 cardiovascular activity Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical group CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- LQYCIOQCKLIHES-UHFFFAOYSA-N pyrimido[5,4-d]pyrimidin-2-amine Chemical compound N1=CN=CC2=NC(N)=NC=C21 LQYCIOQCKLIHES-UHFFFAOYSA-N 0.000 description 1
- JOZPEVMCAKXSEY-UHFFFAOYSA-N pyrimido[5,4-d]pyrimidine Chemical compound N1=CN=CC2=NC=NC=C21 JOZPEVMCAKXSEY-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795030 DE1795030A1 (de) | 1968-07-31 | 1968-07-31 | Neue 2,6-Bis-(diaethanolamino)-pyrimido-[5,4-d]-pyrimidine |
| DE19691933428 DE1933428A1 (de) | 1969-07-01 | 1969-07-01 | Neue 2,6-Bis-(diaethanolamino)-pyrimido[5,4-d]pyrimidine |
| DE19691933427 DE1933427A1 (de) | 1969-07-01 | 1969-07-01 | Neue 2,6-Bis-alkonolamino-pyrimido[5,4-6]pyrimidine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL32739A0 IL32739A0 (en) | 1969-09-25 |
| IL32739A true IL32739A (en) | 1973-07-30 |
Family
ID=27181475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL32739A IL32739A (en) | 1968-07-31 | 1969-07-30 | 2,6-bis-(di-(hydroxyalkyl)-amino)-pyrimido(5,4-d)pyrimidines,their preparation and pharmaceutical compositions containing them |
Country Status (12)
| Country | Link |
|---|---|
| AT (2) | AT297717B (OSRAM) |
| BE (1) | BE736917A (OSRAM) |
| CA (1) | CA932331A (OSRAM) |
| CH (2) | CH529143A (OSRAM) |
| ES (2) | ES370067A1 (OSRAM) |
| FR (1) | FR2014089B1 (OSRAM) |
| GB (1) | GB1237788A (OSRAM) |
| IL (1) | IL32739A (OSRAM) |
| NL (1) | NL6911721A (OSRAM) |
| PL (1) | PL80164B1 (OSRAM) |
| RO (1) | RO56153A (OSRAM) |
| SE (1) | SE351849B (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2004201A1 (de) * | 1970-01-30 | 1971-08-05 | Thomae Gmbh Dr K | Neue 2,6-Bis(dialkanolamino)-pyrimido-[5,4-d]pyrimidine und Verfahren zu ihrer Herstellung |
| US4963541A (en) * | 1989-02-22 | 1990-10-16 | Abbott Laboratories | Pyrimido-pyrimidine lipoxygenase inhibiting compounds |
-
1969
- 1969-07-28 SE SE10590/69A patent/SE351849B/xx unknown
- 1969-07-30 PL PL1969135130A patent/PL80164B1/pl unknown
- 1969-07-30 AT AT388571A patent/AT297717B/de not_active IP Right Cessation
- 1969-07-30 ES ES370067A patent/ES370067A1/es not_active Expired
- 1969-07-30 RO RO62642A patent/RO56153A/ro unknown
- 1969-07-30 AT AT735369A patent/AT296992B/de not_active IP Right Cessation
- 1969-07-30 ES ES370068A patent/ES370068A1/es not_active Expired
- 1969-07-30 IL IL32739A patent/IL32739A/en unknown
- 1969-07-31 GB GB38447/69A patent/GB1237788A/en not_active Expired
- 1969-07-31 CH CH1187971A patent/CH529143A/de not_active IP Right Cessation
- 1969-07-31 NL NL6911721A patent/NL6911721A/xx unknown
- 1969-07-31 CH CH1169669D patent/CH513881A/de not_active IP Right Cessation
- 1969-07-31 FR FR6926306A patent/FR2014089B1/fr not_active Expired
- 1969-07-31 CA CA058376A patent/CA932331A/en not_active Expired
- 1969-07-31 BE BE736917D patent/BE736917A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH529143A (de) | 1972-10-15 |
| PL80164B1 (OSRAM) | 1975-08-30 |
| FR2014089B1 (OSRAM) | 1974-08-09 |
| ES370068A1 (es) | 1971-04-01 |
| AT296992B (de) | 1972-03-10 |
| NL6911721A (OSRAM) | 1970-02-03 |
| AT297717B (de) | 1972-04-10 |
| FR2014089A1 (OSRAM) | 1970-04-10 |
| IL32739A0 (en) | 1969-09-25 |
| RO56153A (OSRAM) | 1974-03-01 |
| SU429582A3 (ru) | 1974-05-25 |
| CA932331A (en) | 1973-08-21 |
| BE736917A (OSRAM) | 1970-02-02 |
| ES370067A1 (es) | 1971-04-01 |
| GB1237788A (en) | 1971-06-30 |
| SE351849B (OSRAM) | 1972-12-11 |
| CH513881A (de) | 1971-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5260291A (en) | Tetrazine derivatives | |
| US4438128A (en) | Cardioactive aryloxypropanolamines | |
| TWI335918B (en) | Novel thioxanthine derivatives and medical use thereof | |
| EA008778B1 (ru) | Дигидроптеридиноны, способ их получения и их применение в качестве лекарственных средств | |
| KR20100119776A (ko) | 2-알킬아미노-3-아릴설포닐-사이클로알카노[e 또는 d]피라졸로[1,5-A]피리미딘/세로토닌 5-HT6 수용체의 길항제, 이의 제조방법 및 이의 용도 | |
| HUP0401293A2 (hu) | Új dihidropteridinonok, eljárás előállításukra és alkalmazásuk gyógyszerként | |
| KR101698283B1 (ko) | 티에노피리미딘 화합물의 제조 방법 | |
| HUE032403T2 (en) | Bicycloaniline derivative | |
| HK1042483A1 (en) | Method for the production of thiazolidin | |
| EP0133234B1 (en) | Imidazoquinazolin-2-one compounds process for their production and pharmaceutical compositions containing said compounds | |
| NZ201668A (en) | (3h)-imidazo(5,1-d)-1,2,3,5-tetrazin-4-one derivatives and pharmaceutical compositions | |
| KR101651933B1 (ko) | 세로토닌 5-ht6 수용체의 2-아미노-3-설포닐-테트라하이드로-피라졸로[1,5-a]피리도-피리미딘 길항제, 이의 제조방법 및 이의 용도 | |
| US3459753A (en) | Theophylline and theobromine,their salts and processes for the production thereof | |
| IL102456A (en) | Medicinal preparations containing a history of xanthine for the treatment of secondary damage to nerve cells and functional disorders of closed skull-brain injury, some such new compounds | |
| IL32739A (en) | 2,6-bis-(di-(hydroxyalkyl)-amino)-pyrimido(5,4-d)pyrimidines,their preparation and pharmaceutical compositions containing them | |
| GB2105587A (en) | Pharmaceutical compositions containing blood flow-promoting agents | |
| US3284452A (en) | 1:4-diazine preparation and certain pteridenes produced thereby | |
| KR101526930B1 (ko) | 3-설포닐-피라졸로[1,5-a] 피리미딘 / 세로토닌 5-ht6 수용체의 길항제, 이의 제조방법 및 이의 용도 | |
| EP2657225A2 (en) | Substituted methyl amines, serotonin 5-ht6 receptor antagonists, methods for the production and use thereof | |
| EP0134928A1 (en) | Imidazo[1,5-a]pyrimidine derivatives and process for their preparation | |
| DE2117657A1 (en) | Amino-subst pyrido(3,2-d)pyrimidines - useful for inhibiting thrombocyte aggregation and adhesion | |
| NZ194228A (en) | 2-(1,4-diazacycloalk-1-yl)-4-(morpholino or thiomorpholino)-8-substituted pyrimido(4,5-b)pyrimidines | |
| EP2351756A1 (en) | Substituted 3-arylsulfonyl-pyrazolo[1,5-a]pyrimidines, serotonin 5-ht6 receptor antagonists and methods for the production and use thereof | |
| PL144481B1 (en) | Process for preparing derivatives of pyrimidinotrione | |
| US3274188A (en) | 5-aminobenzocarbazoles |