IL28962A - 3,1-benzoxazine derivatives and process for their manufacture - Google Patents
3,1-benzoxazine derivatives and process for their manufactureInfo
- Publication number
- IL28962A IL28962A IL28962A IL2896267A IL28962A IL 28962 A IL28962 A IL 28962A IL 28962 A IL28962 A IL 28962A IL 2896267 A IL2896267 A IL 2896267A IL 28962 A IL28962 A IL 28962A
- Authority
- IL
- Israel
- Prior art keywords
- benzoxazine
- chloro
- methyl
- compound
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 13
- GTYZDORKFFSTLS-UHFFFAOYSA-N 2h-3,1-benzoxazine Chemical class C1=CC=CC2=NCOC=C21 GTYZDORKFFSTLS-UHFFFAOYSA-N 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- -1 oyoloalkenyl Chemical group 0.000 claims description 51
- 150000001875 compounds Chemical class 0.000 claims description 49
- 239000002253 acid Substances 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 13
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 8
- 150000007513 acids Chemical class 0.000 claims description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 7
- 150000002513 isocyanates Chemical class 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 150000003585 thioureas Chemical class 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 150000003672 ureas Chemical class 0.000 claims description 6
- 150000005840 aryl radicals Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000005864 Sulphur Chemical group 0.000 claims description 4
- 238000010306 acid treatment Methods 0.000 claims description 4
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 150000007514 bases Chemical class 0.000 claims description 4
- 235000013877 carbamide Nutrition 0.000 claims description 4
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 4
- 230000009467 reduction Effects 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 229910052987 metal hydride Inorganic materials 0.000 claims description 3
- 150000004681 metal hydrides Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- PSFXVKGWHCTLKA-UHFFFAOYSA-N 6-chloro-N,4-diethyl-4-phenyl-1H-3,1-benzoxazin-2-imine Chemical compound C(C)NC1=NC2=C(C(O1)(C1=CC=CC=C1)CC)C=C(C=C2)Cl PSFXVKGWHCTLKA-UHFFFAOYSA-N 0.000 claims description 2
- KRZZKXYTSCQNNE-UHFFFAOYSA-N 6-chloro-n,4-dimethyl-4-phenyl-3,1-benzoxazin-2-amine Chemical compound O1C(NC)=NC2=CC=C(Cl)C=C2C1(C)C1=CC=CC=C1 KRZZKXYTSCQNNE-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000005265 dialkylamine group Chemical group 0.000 claims description 2
- 230000000506 psychotropic effect Effects 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 239000003937 drug carrier Substances 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- SEGVYZVDFPUJCK-UHFFFAOYSA-N 6-chloro-N-ethyl-4-phenyl-4-propyl-1H-3,1-benzoxazin-2-imine Chemical compound C(C)NC1=NC2=C(C(O1)(C1=CC=CC=C1)CCC)C=C(C=C2)Cl SEGVYZVDFPUJCK-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 201000010099 disease Diseases 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 230000003236 psychic effect Effects 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 91
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 58
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 45
- 239000013078 crystal Substances 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000003208 petroleum Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 229910000474 mercury oxide Inorganic materials 0.000 description 14
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 14
- 150000001298 alcohols Chemical class 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 12
- 229960004217 benzyl alcohol Drugs 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000008164 mustard oil Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 229960004592 isopropanol Drugs 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 229940073584 methylene chloride Drugs 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical class NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- OPFTUNCRGUEPRZ-QLFBSQMISA-N Cyclohexane Natural products CC(=C)[C@@H]1CC[C@@](C)(C=C)[C@H](C(C)=C)C1 OPFTUNCRGUEPRZ-QLFBSQMISA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 150000003938 benzyl alcohols Chemical class 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 230000002048 spasmolytic effect Effects 0.000 description 3
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical group COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 208000010513 Stupor Diseases 0.000 description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 230000003001 depressive effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VXWPONVCMVLXBW-UHFFFAOYSA-M magnesium;carbanide;iodide Chemical compound [CH3-].[Mg+2].[I-] VXWPONVCMVLXBW-UHFFFAOYSA-M 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 2
- 230000002035 prolonged effect Effects 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 1
- PPKPKFIWDXDAGC-IHWYPQMZSA-N (z)-1,2-dichloroprop-1-ene Chemical compound C\C(Cl)=C\Cl PPKPKFIWDXDAGC-IHWYPQMZSA-N 0.000 description 1
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- HJTAZXHBEBIQQX-UHFFFAOYSA-N 1,5-bis(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1CCl HJTAZXHBEBIQQX-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- TULOMSGHBGPACW-UHFFFAOYSA-N 1-benzyl-4-(3-isothiocyanatopropyl)piperazine Chemical compound C(C1=CC=CC=C1)N1CCN(CC1)CCCN=C=S TULOMSGHBGPACW-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- GOEXOFDHFDONEZ-UHFFFAOYSA-N 2-[chloro(diphenyl)methyl]aniline Chemical compound NC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 GOEXOFDHFDONEZ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- MLMTVTFCBQQURX-UHFFFAOYSA-N 3,4-dihydro-1h-2,1-benzoxazine Chemical class C1=CC=C2NOCCC2=C1 MLMTVTFCBQQURX-UHFFFAOYSA-N 0.000 description 1
- XAZNOOMRYLFDQO-UHFFFAOYSA-N 4h-3,1-benzoxazine Chemical compound C1=CC=C2COC=NC2=C1 XAZNOOMRYLFDQO-UHFFFAOYSA-N 0.000 description 1
- PGSDPKVMKMOURZ-UHFFFAOYSA-N 6-chloro-4-methyl-4-phenyl-3,1-benzoxazin-2-amine Chemical compound O1C(N)=NC2=CC=C(Cl)C=C2C1(C)C1=CC=CC=C1 PGSDPKVMKMOURZ-UHFFFAOYSA-N 0.000 description 1
- IQHBAMBWRCPWLR-UHFFFAOYSA-N 6-chloro-4-methyl-4-phenyl-N-propan-2-yl-1H-3,1-benzoxazin-2-imine Chemical compound C(C)(C)NC1=NC2=C(C(O1)(C1=CC=CC=C1)C)C=C(C=C2)Cl IQHBAMBWRCPWLR-UHFFFAOYSA-N 0.000 description 1
- DFNLGTFZWHOTTK-UHFFFAOYSA-N 6-chloro-4-methyl-N,4-diphenyl-3,1-benzoxazin-2-amine Chemical compound C1(=CC=CC=C1)NC1=NC2=C(C(O1)(C1=CC=CC=C1)C)C=C(C=C2)Cl DFNLGTFZWHOTTK-UHFFFAOYSA-N 0.000 description 1
- MDTPDVFYVSGPHJ-UHFFFAOYSA-N 6-chloro-N-ethyl-4,4-dimethyl-1H-3,1-benzoxazin-2-imine Chemical compound C(C)NC1=NC2=C(C(O1)(C)C)C=C(C=C2)Cl MDTPDVFYVSGPHJ-UHFFFAOYSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- QBTKYJBHZFZZEP-UHFFFAOYSA-N C(C)(=O)NC1=NC2=C(C(O1)(C1=CC=CC=C1)C)C=CC=C2 Chemical compound C(C)(=O)NC1=NC2=C(C(O1)(C1=CC=CC=C1)C)C=CC=C2 QBTKYJBHZFZZEP-UHFFFAOYSA-N 0.000 description 1
- BLOMXVGWRDMJQH-UHFFFAOYSA-N C(C)C1=NC2=C(C(O1)(C1=CC=CC=C1)C)C(=C(C=C2)Cl)N Chemical compound C(C)C1=NC2=C(C(O1)(C1=CC=CC=C1)C)C(=C(C=C2)Cl)N BLOMXVGWRDMJQH-UHFFFAOYSA-N 0.000 description 1
- BMQPRJHDRTZPLT-UHFFFAOYSA-N C(C)NC1=NC2=C(C(O1)(CC)CC)C=CC=C2 Chemical compound C(C)NC1=NC2=C(C(O1)(CC)CC)C=CC=C2 BMQPRJHDRTZPLT-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- UEWBCTYKGQYRDI-UHFFFAOYSA-N N-ethyl-4,4-dimethyl-1H-3,1-benzoxazin-2-imine Chemical compound C(C)NC1=NC2=C(C(O1)(C)C)C=CC=C2 UEWBCTYKGQYRDI-UHFFFAOYSA-N 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- 208000032140 Sleepiness Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 206010041349 Somnolence Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910021502 aluminium hydroxide Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- GOLCXWYRSKYTSP-UHFFFAOYSA-N arsenic trioxide Inorganic materials O1[As]2O[As]1O2 GOLCXWYRSKYTSP-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 1
- GSEZYWGNEACOIW-UHFFFAOYSA-N bis(2-aminophenyl)methanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1N GSEZYWGNEACOIW-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- VPKDCDLSJZCGKE-UHFFFAOYSA-N carbodiimide group Chemical group N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 150000001912 cyanamides Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 208000037765 diseases and disorders Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910003439 heavy metal oxide Inorganic materials 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 238000011005 laboratory method Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- UGVPKMAWLOMPRS-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].CC[CH2-] UGVPKMAWLOMPRS-UHFFFAOYSA-M 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- LASJRIHCUCYPGY-UHFFFAOYSA-N n,n-diethyl-2-isothiocyanatoethanamine Chemical compound CCN(CC)CCN=C=S LASJRIHCUCYPGY-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229960002715 nicotine Drugs 0.000 description 1
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 1
- VYFOAVADNIHPTR-UHFFFAOYSA-N o-aminobenzyl alcohol Natural products NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229940117953 phenylisothiocyanate Drugs 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/18—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Load-Bearing And Curtain Walls (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1670772A DE1670772C3 (de) | 1966-11-24 | 1966-11-24 | 4H-3,1-Benzoxazin-Derivate, deren Salze und pharmazeutische Präparate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28962A true IL28962A (en) | 1972-05-30 |
Family
ID=7104042
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28962A IL28962A (en) | 1966-11-24 | 1967-11-17 | 3,1-benzoxazine derivatives and process for their manufacture |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3725404A (cs) |
| AT (4) | AT278026B (cs) |
| BE (1) | BE707013A (cs) |
| CH (2) | CH534174A (cs) |
| CS (5) | CS154242B2 (cs) |
| DE (1) | DE1670772C3 (cs) |
| DK (1) | DK131905C (cs) |
| ES (2) | ES347430A1 (cs) |
| FI (1) | FI48595C (cs) |
| FR (2) | FR1571287A (cs) |
| GB (1) | GB1197479A (cs) |
| IL (1) | IL28962A (cs) |
| NL (1) | NL156402B (cs) |
| NO (1) | NO119743B (cs) |
| SE (1) | SE329620B (cs) |
| YU (1) | YU32857B (cs) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670772C3 (de) * | 1966-11-24 | 1978-04-20 | Hoechst Ag, 6000 Frankfurt | 4H-3,1-Benzoxazin-Derivate, deren Salze und pharmazeutische Präparate |
| US4596801A (en) * | 1983-03-24 | 1986-06-24 | Chugai Seiyaku Kabushiki Kaisha | 4H-3,1-benzoxazine derivatives, process for producing the same and agricultural or horticultural fungicide containing the same |
| FR2888749B1 (fr) | 2005-07-19 | 2007-10-12 | Biocodex | Composition pharmaceutique destinee a la prevention ou au traitement des oedemes cerebraux |
| FR2888748B1 (fr) | 2005-07-19 | 2007-10-12 | Biocodex | Composes neuroprotecteurs et compositions pharmaceutiques les comprenant |
| US20080039453A1 (en) * | 2006-03-20 | 2008-02-14 | David Putman | Enantiomerically pure R-etifoxine, pharmaceutical compositions thereof and methods of their use |
| US8110569B2 (en) * | 2006-03-20 | 2012-02-07 | The Regents Of The University Of California | Enantiomerically pure S-etifoxine, pharmaceutical compositions thereof and methods of their use |
| FR2930891B1 (fr) * | 2008-05-06 | 2010-09-24 | Biocodex | Composes anti-amnesiants et compositions pharmaceutiques les comprenant |
| FR2937552B1 (fr) | 2008-10-27 | 2011-05-06 | Biocodex | Composition pharmaceutique destinee a la prevention ou au traitement du syndrome de sevrage alcoolique |
| WO2010103064A1 (en) * | 2009-03-13 | 2010-09-16 | Neurosearch A/S | Novel benzoxazinone derivatives useful for the treatment of cns disorders |
| FR2972192A1 (fr) | 2011-03-04 | 2012-09-07 | Biocodex | Composition pharmaceutique destinee a la prevention ou au traitement des cancers |
| FR3016881B1 (fr) | 2014-01-29 | 2016-03-04 | Biocodex | Traitement des degenerescences et des lesions photo-induites de la retine |
| LT3347006T (lt) | 2015-03-20 | 2022-10-25 | Gaba Therapeutics Inc. | Deuterinti etifoksino analogai, jų dariniai ir panaudojimai |
| ES2885065T3 (es) * | 2016-03-31 | 2021-12-13 | Dow Global Technologies Llc | Biscarbodiimidas y policarbodiimidas y método para su preparación |
| FR3051114B1 (fr) | 2016-05-11 | 2019-09-27 | Biocodex | Composes pour le traitement de la maladie d'alzheimer |
| US10420773B2 (en) | 2017-09-26 | 2019-09-24 | Ovid Therapeutics Inc. | Methods of treating developmental disorders and/or seizure disorders with etifoxine |
| CN117586198B (zh) * | 2023-11-24 | 2024-10-25 | 南开大学 | 溴苯并恶嗪类化合物的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1545820A1 (de) * | 1965-06-03 | 1969-12-11 | Hoechst Ag | Verfahren zur Herstellung von 3,1-Benzothiazin-Derivaten |
| DE1670772C3 (de) * | 1966-11-24 | 1978-04-20 | Hoechst Ag, 6000 Frankfurt | 4H-3,1-Benzoxazin-Derivate, deren Salze und pharmazeutische Präparate |
-
1966
- 1966-11-24 DE DE1670772A patent/DE1670772C3/de not_active Expired
-
1967
- 1967-11-17 NL NL6715652.A patent/NL156402B/xx not_active IP Right Cessation
- 1967-11-17 IL IL28962A patent/IL28962A/en unknown
- 1967-11-20 CS CS793372*1A patent/CS154242B2/cs unknown
- 1967-11-20 CS CS821567A patent/CS154238B2/cs unknown
- 1967-11-20 GB GB52643/67A patent/GB1197479A/en not_active Expired
- 1967-11-20 CS CS556472*1A patent/CS154241B2/cs unknown
- 1967-11-20 CS CS556372*1A patent/CS154240B2/cs unknown
- 1967-11-20 CS CS556272*1A patent/CS154239B2/cs unknown
- 1967-11-21 ES ES347430A patent/ES347430A1/es not_active Expired
- 1967-11-21 YU YU2271/67A patent/YU32857B/xx unknown
- 1967-11-22 AT AT1136868A patent/AT278026B/de not_active IP Right Cessation
- 1967-11-22 CH CH1083571A patent/CH534174A/de not_active IP Right Cessation
- 1967-11-22 AT AT1136668A patent/AT278024B/de not_active IP Right Cessation
- 1967-11-22 CH CH1635167A patent/CH522671A/de not_active IP Right Cessation
- 1967-11-22 SE SE16017/67A patent/SE329620B/xx unknown
- 1967-11-22 AT AT1136768A patent/AT278025B/de not_active IP Right Cessation
- 1967-11-22 AT AT1055167A patent/AT276412B/de active
- 1967-11-23 DK DK587767A patent/DK131905C/da not_active IP Right Cessation
- 1967-11-23 NO NO170669A patent/NO119743B/no unknown
- 1967-11-24 FR FR1571287D patent/FR1571287A/fr not_active Expired
- 1967-11-24 BE BE707013D patent/BE707013A/xx not_active IP Right Cessation
- 1967-11-24 FI FI673169A patent/FI48595C/fi active
-
1968
- 1968-02-23 FR FR141043A patent/FR7358M/fr not_active Expired
-
1969
- 1969-05-05 ES ES366801A patent/ES366801A1/es not_active Expired
-
1971
- 1971-06-09 US US00151599A patent/US3725404A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| YU227167A (en) | 1974-10-31 |
| NL6715652A (cs) | 1968-05-27 |
| DE1670772A1 (de) | 1970-07-16 |
| NO119743B (cs) | 1970-06-29 |
| US3725404A (en) | 1973-04-03 |
| AT276412B (de) | 1969-11-25 |
| YU32857B (en) | 1975-10-31 |
| FR7358M (cs) | 1969-10-20 |
| DE1670772C3 (de) | 1978-04-20 |
| NL156402B (nl) | 1978-04-17 |
| CH534174A (de) | 1973-02-28 |
| FI48595B (cs) | 1974-07-31 |
| CS154238B2 (cs) | 1974-03-29 |
| CS154240B2 (cs) | 1974-03-29 |
| DK131905C (da) | 1976-02-23 |
| BE707013A (cs) | 1968-05-24 |
| CH522671A (de) | 1972-06-30 |
| SE329620B (cs) | 1970-10-19 |
| AT278026B (de) | 1970-01-26 |
| AT278024B (de) | 1970-01-26 |
| DK131905B (da) | 1975-09-22 |
| FI48595C (fi) | 1974-11-11 |
| DE1670772B2 (de) | 1977-08-25 |
| CS154241B2 (cs) | 1974-03-29 |
| GB1197479A (en) | 1970-07-08 |
| AT278025B (de) | 1970-01-26 |
| CS154239B2 (cs) | 1974-03-29 |
| ES347430A1 (es) | 1969-11-01 |
| FR1571287A (cs) | 1969-06-20 |
| CS154242B2 (cs) | 1974-03-29 |
| ES366801A1 (es) | 1971-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL28962A (en) | 3,1-benzoxazine derivatives and process for their manufacture | |
| AU721247B2 (en) | Nitrosated and nitrosylated alpha-adrenergic receptor antagonist compounds, compositions and their uses | |
| EP1852422A2 (en) | Nitrosated and nitorsylated alpha-andrenergic receptor antagonist compounds, compositions and their uses | |
| EP0980362B1 (de) | Substituierte heterocyclen und deren verwendung in arzneimitteln | |
| NO163816B (no) | Analogifremgangsmaate for fremstilling av nye, terapeutiskaktive piperazinderivater. | |
| KR20130046436A (ko) | 안드로겐 수용체 길항제, 항암제로서 사이클릭 n,n''-다이아릴티오우레아 및 n,n''-다이아릴우레아, 이의 제조방법 및 이의 용도 | |
| US2852510A (en) | Heterocyclic compounds and process for producing same | |
| AU640300B2 (en) | Pharmacologically active substituted oxybenzamides | |
| NO156087B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive alkylurinstoff-derivater. | |
| US3933802A (en) | New sulphamoylbenzoic acid amides | |
| JPS63135381A (ja) | 多剤耐性癌細胞に対する感受性増強剤及びその製造方法 | |
| US3417085A (en) | 3,1-benzothiazines and 3,1-benzoxazines | |
| US3060177A (en) | O-(aminoalkyl)oxime derivatives of heterocyclic aldehydes and ketones | |
| US2935514A (en) | Benzimidazoles | |
| US2619484A (en) | Y-dihydro - sh-dibenz | |
| US3247199A (en) | Diphenyl-methanes | |
| US3539626A (en) | Substituted urea derivatives | |
| US2569415A (en) | Imidazolines | |
| US4055642A (en) | Imidazolyl-2-quinazoline derivatives | |
| US3334115A (en) | Basically substituted ureas and salts thereof | |
| US2942001A (en) | Piperazo-pyridazines | |
| CH636876A5 (de) | Imidazo- und pyrimido(2,1-b)chinazoline, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. | |
| DK158722B (da) | Analogifremgangsmaade til fremstilling af 5,6-dihydro-11h-dibenzo(b,e)azepin-6-oner | |
| US3812182A (en) | S-bis-(2-lower alkyl amino hydroxy-methylethoxy)-methanes | |
| US3663610A (en) | Amidine derivatives with spasmolytic,psychostimulant and anorexigenic properties |