IL28598A - Carbamoyloxy-phenylurea - Google Patents
Carbamoyloxy-phenylureaInfo
- Publication number
- IL28598A IL28598A IL28598A IL2859867A IL28598A IL 28598 A IL28598 A IL 28598A IL 28598 A IL28598 A IL 28598A IL 2859867 A IL2859867 A IL 2859867A IL 28598 A IL28598 A IL 28598A
- Authority
- IL
- Israel
- Prior art keywords
- group
- hydrogen atom
- atom
- lower alkyl
- oxygen
- Prior art date
Links
- XMSKVJRYDPFLMF-UHFFFAOYSA-N (n-carbamoylanilino) carbamate Chemical compound NC(=O)ON(C(N)=O)C1=CC=CC=C1 XMSKVJRYDPFLMF-UHFFFAOYSA-N 0.000 title 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 14
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 239000004202 carbamide Substances 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 claims description 9
- 235000021536 Sugar beet Nutrition 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 241000220261 Sinapis Species 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 5
- DOTMOQHOJINYBL-UHFFFAOYSA-N molecular nitrogen;molecular oxygen Chemical compound N#N.O=O DOTMOQHOJINYBL-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 6
- 239000005864 Sulphur Substances 0.000 claims 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- -1 carbamoyloxy Chemical group 0.000 claims 2
- 238000009833 condensation Methods 0.000 claims 2
- 230000005494 condensation Effects 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 150000002367 halogens Chemical class 0.000 claims 2
- 229920006395 saturated elastomer Polymers 0.000 claims 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims 2
- 241000282320 Panthera leo Species 0.000 claims 1
- OLBVUFHMDRJKTK-UHFFFAOYSA-N [N].[O] Chemical group [N].[O] OLBVUFHMDRJKTK-UHFFFAOYSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001447 alkali salts Chemical class 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 230000002363 herbicidal effect Effects 0.000 claims 1
- 239000013543 active substance Substances 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 14
- 241000335053 Beta vulgaris Species 0.000 description 9
- 235000016068 Berberis vulgaris Nutrition 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 235000010582 Pisum sativum Nutrition 0.000 description 4
- 241001049108 Scabiosa columbaria Species 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- 241000748465 Galinsoga Species 0.000 description 3
- 241000409199 Packera Species 0.000 description 3
- 240000004713 Pisum sativum Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 230000006735 deficit Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 241000780602 Senecio Species 0.000 description 2
- 240000006694 Stellaria media Species 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000907681 Morpho Species 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 241000219843 Pisum Species 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical group C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical compound ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ZJHHPAUQMCHPRB-UHFFFAOYSA-N urea urea Chemical compound NC(N)=O.NC(N)=O ZJHHPAUQMCHPRB-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DESC039491 | 1966-09-05 | ||
| DESC040838 | 1967-06-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL28598A true IL28598A (en) | 1972-10-29 |
Family
ID=25993407
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL28598A IL28598A (en) | 1966-09-05 | 1967-09-04 | Carbamoyloxy-phenylurea |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3879441A (OSRAM) |
| JP (1) | JPS5133965B1 (OSRAM) |
| BE (1) | BE703477A (OSRAM) |
| BG (1) | BG16313A3 (OSRAM) |
| CH (1) | CH491598A (OSRAM) |
| CS (2) | CS168498B2 (OSRAM) |
| DE (1) | DE1593520C3 (OSRAM) |
| DK (1) | DK118074B (OSRAM) |
| ES (1) | ES344462A1 (OSRAM) |
| FI (1) | FI45102C (OSRAM) |
| GB (1) | GB1205029A (OSRAM) |
| IL (1) | IL28598A (OSRAM) |
| LU (1) | LU54163A1 (OSRAM) |
| NL (1) | NL157299B (OSRAM) |
| NO (1) | NO120813B (OSRAM) |
| SE (1) | SE328863B (OSRAM) |
| YU (1) | YU32367B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3979202A (en) * | 1970-05-26 | 1976-09-07 | Monsanto Company | Meta-bifunctional benzenes and herbicidal compositions |
| US4076518A (en) * | 1970-08-20 | 1978-02-28 | Schering Aktiengesellschaft | Substituted phenyl thiocarbamates with herbicidal action and method for their production |
| US4013450A (en) * | 1970-10-02 | 1977-03-22 | Monsanto Company | Herbicidal ureido containing carbanilates |
| DE2730325A1 (de) * | 1977-07-01 | 1979-01-11 | Schering Ag | Carbanilsaeure-(3-ureido-phenyl)- ester, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| US5194661A (en) * | 1990-08-20 | 1993-03-16 | Ici Americas Inc. | Substituted benzyl carbamates and their use as herbicides |
| FR2767823B1 (fr) * | 1997-08-27 | 1999-10-15 | Oreal | Composes derives d'aminophenol et leur utilisation en cosmetique |
| WO2004111025A1 (en) * | 2003-06-12 | 2004-12-23 | Novo Nordisk A/S | Para-substituted phenyl carbamates as inhibitors of hormone sensitive lipase |
| CN113651722A (zh) * | 2021-08-13 | 2021-11-16 | 浙江海昇药业股份有限公司 | 一种1-(3-羟基苯基)-1,3,3-三甲基脲的合成方法、中间体及其用途 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3434822A (en) * | 1964-03-23 | 1969-03-25 | Fmc Corp | M-ureidophenyl carbamates as herbicides |
| US3404975A (en) * | 1964-12-18 | 1968-10-08 | Fmc Corp | m-(carbamoyloxy)-carbanilates as herbicides |
-
1966
- 1966-09-05 DE DE1593520A patent/DE1593520C3/de not_active Expired
-
1967
- 1967-07-24 LU LU54163D patent/LU54163A1/xx unknown
- 1967-07-28 BG BG009009A patent/BG16313A3/bg unknown
- 1967-08-02 FI FI672102A patent/FI45102C/fi active
- 1967-08-23 DK DK427067AA patent/DK118074B/da unknown
- 1967-08-25 ES ES344462A patent/ES344462A1/es not_active Expired
- 1967-08-26 YU YU1683/67A patent/YU32367B/xx unknown
- 1967-08-30 SE SE12043/67A patent/SE328863B/xx unknown
- 1967-09-04 NL NL6712096.A patent/NL157299B/xx unknown
- 1967-09-04 CH CH1235467A patent/CH491598A/de not_active IP Right Cessation
- 1967-09-04 CS CS2504*[A patent/CS168498B2/cs unknown
- 1967-09-04 NO NO169594A patent/NO120813B/no unknown
- 1967-09-04 GB GB40291/67A patent/GB1205029A/en not_active Expired
- 1967-09-04 IL IL28598A patent/IL28598A/en unknown
- 1967-09-04 CS CS6299A patent/CS168497B2/cs unknown
- 1967-09-05 BE BE703477D patent/BE703477A/xx unknown
- 1967-09-05 JP JP42056954A patent/JPS5133965B1/ja active Pending
-
1970
- 1970-07-10 US US053988A patent/US3879441A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CS168498B2 (OSRAM) | 1976-06-29 |
| US3879441A (en) | 1975-04-22 |
| YU168367A (en) | 1974-04-30 |
| CH491598A (de) | 1970-06-15 |
| ES344462A1 (es) | 1968-10-01 |
| BG16313A3 (bg) | 1972-08-20 |
| FI45102C (fi) | 1972-03-10 |
| NO120813B (OSRAM) | 1970-12-07 |
| FI45102B (OSRAM) | 1971-11-30 |
| SE328863B (OSRAM) | 1970-09-28 |
| DK118074B (da) | 1970-07-06 |
| GB1205029A (en) | 1970-09-09 |
| BE703477A (OSRAM) | 1968-03-05 |
| NL6712096A (OSRAM) | 1968-03-06 |
| JPS5133965B1 (OSRAM) | 1976-09-22 |
| DE1593520C3 (de) | 1974-07-11 |
| DE1643026A1 (de) | 1971-04-15 |
| NL157299B (nl) | 1978-07-17 |
| DE1593520A1 (de) | 1970-08-13 |
| DE1643026B2 (de) | 1976-01-22 |
| DE1593520B2 (de) | 1973-12-13 |
| LU54163A1 (OSRAM) | 1967-09-25 |
| CS168497B2 (OSRAM) | 1976-06-29 |
| YU32367B (en) | 1974-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2913327A (en) | Certain thiolcarbamates and use as herbicides | |
| IL28598A (en) | Carbamoyloxy-phenylurea | |
| US3249619A (en) | Carbamate esters of trichloro and tetrachloro pyridine | |
| US3535101A (en) | Herbicide and algicide means | |
| US2901498A (en) | N-alkyl, n-allyl thiolcarbamate compositions | |
| DE1297111B (de) | Thiabicyclo-2-nonenverbindungen | |
| US3862976A (en) | Isocyanophenyl carbamates | |
| US3910783A (en) | Dinitro-1,3-p | |
| US3009909A (en) | Azobenzene esters | |
| US2910463A (en) | Phenylazo formamides and production thereof | |
| US6555120B1 (en) | Isolation, structural determination, synthesis, biological activity and application as control agent of the host marking pheromone (and derivatives thereof) of the fruit flies of the type anastrepha (diptera: tephritidae) | |
| US3246976A (en) | Method for controlling crab grass and water grass | |
| US3813436A (en) | Phenylurea derivatives and process for their manufacture | |
| US2804381A (en) | Herbicides | |
| US2774658A (en) | Herbicidal alkyl-amino-phosphonium halides | |
| US3705914A (en) | Pesticidal carbamate derivatives of naphthaquinones | |
| US4164414A (en) | N-methylcarbanilic-[3-(ethoxycarbonylamino)-phenyl]-ester as a cotton herbicide | |
| US3432495A (en) | Aryl hydroxyalkyl arsinic acids and salts thereof | |
| US3117855A (en) | Herbicidal nu-substituted alpha, alpha-diphenylacetamides | |
| US2997498A (en) | Schiff base carbamates | |
| US3210178A (en) | Compositions for the selective combating of monocotyledonous seeds in cultures of useful plants | |
| US3217013A (en) | N-aralkyl derivatives of 3, 6-epoxy-hexahydrophthalimide | |
| SU704426A3 (ru) | Фунгицидное средство | |
| US3617248A (en) | Selective weed control with herbicidal diphenyl-n-(chlorophenoxy-acetyl)-thiazone imines | |
| US2637644A (en) | Plant growth regulation |