IL26477A - Benzene-sulfonyl ureas and process for their preparation - Google Patents
Benzene-sulfonyl ureas and process for their preparationInfo
- Publication number
- IL26477A IL26477A IL26477A IL2647766A IL26477A IL 26477 A IL26477 A IL 26477A IL 26477 A IL26477 A IL 26477A IL 2647766 A IL2647766 A IL 2647766A IL 26477 A IL26477 A IL 26477A
- Authority
- IL
- Israel
- Prior art keywords
- formula
- urea
- benzenesulfonyl
- substituted
- ureas
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000004202 carbamide Substances 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000008280 blood Substances 0.000 claims description 7
- 210000004369 blood Anatomy 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- -1 urea isourea ethers Chemical class 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 4
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 claims description 4
- 206010012601 diabetes mellitus Diseases 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- 150000008331 benzenesulfonamides Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 150000002430 hydrocarbons Chemical group 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- ACBYHGWPQKQMHV-UHFFFAOYSA-N carbamic acid;carbamothioic s-acid Chemical compound NC(O)=O.NC(S)=O ACBYHGWPQKQMHV-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 238000000034 method Methods 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 7
- 235000013877 carbamide Nutrition 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 230000002218 hypoglycaemic effect Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000003672 ureas Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- AFSPXVGMYPRROH-UHFFFAOYSA-N 1-(4-aminophenyl)sulfonyl-1-butylurea Chemical compound CCCCN(C(N)=O)S(=O)(=O)C1=CC=C(N)C=C1 AFSPXVGMYPRROH-UHFFFAOYSA-N 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 3
- ALZKZGUTVJXYEF-UHFFFAOYSA-N benzenesulfonylcarbamic acid Chemical class OC(=O)NS(=O)(=O)C1=CC=CC=C1 ALZKZGUTVJXYEF-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- GHDLZGOOOLEJKI-UHFFFAOYSA-N benzenesulfonylurea Chemical class NC(=O)NS(=O)(=O)C1=CC=CC=C1 GHDLZGOOOLEJKI-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical class C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JOMVGRRCEIJQFK-UHFFFAOYSA-N benzenesulfonylcarbamothioic s-acid Chemical class OC(=S)NS(=O)(=O)C1=CC=CC=C1 JOMVGRRCEIJQFK-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001714 carbamic acid halides Chemical class 0.000 description 1
- 150000001716 carbazoles Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CVJNUXOQCZAWPD-UHFFFAOYSA-N ethyl N-[4-(benzamidomethyl)phenyl]sulfonylcarbamate Chemical compound C(C1=CC=CC=C1)(=O)NCC1=CC=C(C=C1)S(=O)(=O)NC(=O)OCC CVJNUXOQCZAWPD-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/64—Sulfonylureas, e.g. glibenclamide, tolbutamide, chlorpropamide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/32—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1965F0047142 DE1244174C2 (de) | 1965-09-10 | 1965-09-10 | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL26477A true IL26477A (en) | 1971-04-28 |
Family
ID=7101444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL26477A IL26477A (en) | 1965-09-10 | 1966-09-07 | Benzene-sulfonyl ureas and process for their preparation |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3504026A (de) |
| JP (1) | JPS5017470B1 (de) |
| AT (4) | AT273992B (de) |
| BE (1) | BE686784A (de) |
| BR (1) | BR6682693D0 (de) |
| CH (4) | CH512450A (de) |
| DE (1) | DE1244174C2 (de) |
| DK (1) | DK123595B (de) |
| ES (1) | ES330971A1 (de) |
| FI (1) | FI45960C (de) |
| FR (2) | FR1501005A (de) |
| GB (1) | GB1163171A (de) |
| IL (1) | IL26477A (de) |
| NL (1) | NL150781B (de) |
| NO (1) | NO122920B (de) |
| SE (1) | SE344587B (de) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH499501A (de) * | 1968-06-20 | 1970-11-30 | Ciba Geigy Ag | Verfahren zur Herstellung von neuen Derivaten des p-Aminoalkyl-benzolsulfonamids |
| US3832397A (en) * | 1970-03-19 | 1974-08-27 | Hoffmann La Roche | Process for substituted sulfonylureas |
| US3927220A (en) * | 1971-12-29 | 1975-12-16 | Stauffer Chemical Co | Method of controlling pests with thioureido sulfonanilide compounds |
| US4288454A (en) * | 1978-07-24 | 1981-09-08 | Hoffman-La Roche Inc. | Antiviral 1-adamantyl-3-(phenylsulfonyl)thioureas |
| JPS57154964U (de) * | 1981-03-20 | 1982-09-29 | ||
| JPS63124360U (de) * | 1987-02-06 | 1988-08-12 | ||
| HRP20090186A2 (hr) | 2009-03-31 | 2010-10-31 | Institut Ruđer Bošković | Adamantanski bisureidni derivati, metoda priprave i primjena u detekciji aniona |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3096372A (en) * | 1961-08-15 | 1963-07-02 | Lilly Co Eli | Novel nu-(substituted)-phenylsulfonyl-n'-1-adamantylureas |
| DE1185180B (de) * | 1963-10-19 | 1965-01-14 | Hoechst Ag | Verfahren zur Herstellung von Benzolsulfonylharnstoffen |
| FR1440351A (fr) * | 1964-06-30 | 1966-05-27 | Hoechst Ag | Nouvelles benzènesulfonyl-urées et leur préparation |
-
1965
- 1965-09-10 DE DE1965F0047142 patent/DE1244174C2/de not_active Expired
-
1966
- 1966-08-31 FI FI662285A patent/FI45960C/fi active
- 1966-09-07 ES ES0330971A patent/ES330971A1/es not_active Expired
- 1966-09-07 CH CH1078869A patent/CH512450A/de not_active IP Right Cessation
- 1966-09-07 CH CH1079069A patent/CH512451A/de not_active IP Right Cessation
- 1966-09-07 CH CH1293866A patent/CH529116A/de not_active IP Right Cessation
- 1966-09-07 IL IL26477A patent/IL26477A/en unknown
- 1966-09-07 CH CH1078969A patent/CH520661A/de not_active IP Right Cessation
- 1966-09-07 US US577619A patent/US3504026A/en not_active Expired - Lifetime
- 1966-09-08 AT AT1042867A patent/AT273992B/de active
- 1966-09-08 AT AT1042767A patent/AT273991B/de active
- 1966-09-08 NO NO164628A patent/NO122920B/no unknown
- 1966-09-08 AT AT848266A patent/AT273988B/de active
- 1966-09-08 BR BR182693/66A patent/BR6682693D0/pt unknown
- 1966-09-08 AT AT1042967A patent/AT273993B/de active
- 1966-09-09 NL NL666612734A patent/NL150781B/xx unknown
- 1966-09-09 GB GB40409/66A patent/GB1163171A/en not_active Expired
- 1966-09-09 SE SE12142/66A patent/SE344587B/xx unknown
- 1966-09-09 DK DK467266AA patent/DK123595B/da unknown
- 1966-09-10 JP JP41059800A patent/JPS5017470B1/ja active Pending
- 1966-09-10 FR FR75948A patent/FR1501005A/fr not_active Expired
- 1966-09-12 BE BE686784D patent/BE686784A/xx unknown
- 1966-12-09 FR FR86809A patent/FR6870M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE686784A (de) | 1967-03-13 |
| FR1501005A (fr) | 1967-11-10 |
| JPS5017470B1 (de) | 1975-06-20 |
| NO122920B (de) | 1971-09-06 |
| BR6682693D0 (pt) | 1973-12-26 |
| CH512450A (de) | 1971-09-15 |
| AT273991B (de) | 1969-09-10 |
| US3504026A (en) | 1970-03-31 |
| CH529116A (de) | 1972-10-15 |
| DE1244174C2 (de) | 1968-01-18 |
| FI45960B (de) | 1972-07-31 |
| GB1163171A (en) | 1969-09-04 |
| SE344587B (de) | 1972-04-24 |
| AT273992B (de) | 1969-09-10 |
| NL150781B (nl) | 1976-09-15 |
| ES330971A1 (es) | 1967-09-16 |
| CH520661A (de) | 1972-03-31 |
| CH512451A (de) | 1971-09-15 |
| DK123595B (da) | 1972-07-10 |
| NL6612734A (de) | 1967-03-13 |
| AT273988B (de) | 1969-09-10 |
| DE1244174B (de) | 1967-07-13 |
| FR6870M (de) | 1969-04-14 |
| FI45960C (fi) | 1972-11-10 |
| AT273993B (de) | 1969-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0031058B1 (de) | Sulfonylharnstoffe, Verfahren zu ihrer Herstellung und pharmazeutische Präparate enthaltend diese Verbindungen | |
| US3962244A (en) | Benzene sulfonyl ureas | |
| IL26477A (en) | Benzene-sulfonyl ureas and process for their preparation | |
| US3036128A (en) | N-alkenyl-trialkoxybenzamides | |
| US4132795A (en) | Benzenesulfonyl ureas and their use for the treatment of diabetes mellitus | |
| US3546234A (en) | Benzene-sulfonyl-semicarbazides | |
| US3843661A (en) | Benzene-sulfonyl semicarbazides | |
| DE1543564A1 (de) | Benzolsulfonylharnstoffe und Verfahren zu ihrer Herstellung | |
| US3449346A (en) | Benzenesulfonyl ureas | |
| US3448149A (en) | Benzenesulfonyl ureas | |
| KR880002706B1 (ko) | 설포닐 우레아의 제조방법 | |
| US3655756A (en) | Benzenesulfonyl ureas having hypoglycemic activity | |
| US3754030A (en) | N - (4-(beta-<2-methoxy-5-chloro-benzamido>-ethyl) - benzenesulfonyl)-n'-cyclopentyl-urea and process for its manufacture | |
| US3336322A (en) | Benzenesulfonyl ureas and process for their manufacture | |
| US3483297A (en) | Treatment of diabetes with benzenesulfonylcyclohexyl ureas | |
| US3214467A (en) | Sulfonyl urea compounds and a process of making same | |
| US3435116A (en) | The treatment of diabetes mellitus with benzenesulfonyl ureas | |
| US3475450A (en) | Arylsulfonylureas and arylsulfonylthioureas | |
| US3420882A (en) | Benzenesulfonyl ureas | |
| US3927088A (en) | Sulfonyl ureas and process for preparing them | |
| IL28873A (en) | Benzenesulfonyl ureas and process for their manufacture | |
| US3621057A (en) | Benzenesulfonyl-ureas and process for their manufacture | |
| US3932658A (en) | Composition and method for lower blood sugar containing N-[4-(β-<2-methoxy-5-chloro-benzamido>-ethyl)-benzenesulfonyl]-N'-cyclopentyl-urea | |
| US3489798A (en) | Benzenesulfonyl-ureas and process for preparing them | |
| NL8202227A (nl) | 4-amino.benzylaminederivaten en werkwijzen voor hun bereiding en hun toepassing als farmaceutica. |