IL25304A - Method and machine for electrophoretic photography - Google Patents
Method and machine for electrophoretic photographyInfo
- Publication number
- IL25304A IL25304A IL25304A IL2530466A IL25304A IL 25304 A IL25304 A IL 25304A IL 25304 A IL25304 A IL 25304A IL 2530466 A IL2530466 A IL 2530466A IL 25304 A IL25304 A IL 25304A
- Authority
- IL
- Israel
- Prior art keywords
- electrode
- suspension
- imaging
- contact
- image
- Prior art date
Links
- 238000003384 imaging method Methods 0.000 title claims description 41
- 239000000725 suspension Substances 0.000 claims description 56
- 239000002245 particle Substances 0.000 claims description 28
- 230000000903 blocking effect Effects 0.000 claims description 23
- 239000000463 material Substances 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 239000007788 liquid Substances 0.000 claims description 13
- 230000005684 electric field Effects 0.000 claims description 8
- 230000005670 electromagnetic radiation Effects 0.000 claims description 4
- 238000000151 deposition Methods 0.000 claims description 2
- 239000003086 colorant Substances 0.000 claims 1
- BALXUFOVQVENIU-KXNXZCPBSA-N pseudoephedrine hydrochloride Chemical compound [H+].[Cl-].CN[C@@H](C)[C@@H](O)C1=CC=CC=C1 BALXUFOVQVENIU-KXNXZCPBSA-N 0.000 claims 1
- 239000011521 glass Substances 0.000 description 7
- CMSGUKVDXXTJDQ-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethylamino)-4-oxobutanoic acid Chemical compound C1=CC=C2C(CCNC(=O)CCC(=O)O)=CC=CC2=C1 CMSGUKVDXXTJDQ-UHFFFAOYSA-N 0.000 description 6
- 238000005096 rolling process Methods 0.000 description 6
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 5
- 229910001864 baryta Inorganic materials 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 3
- 239000007772 electrode material Substances 0.000 description 3
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 3
- 239000010959 steel Substances 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001084 poly(chloroprene) Polymers 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 229910001887 tin oxide Inorganic materials 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 101100489581 Caenorhabditis elegans par-5 gene Proteins 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- OIQPTROHQCGFEF-UHFFFAOYSA-L chembl1371409 Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 OIQPTROHQCGFEF-UHFFFAOYSA-L 0.000 description 1
- JBTHDAVBDKKSRW-UHFFFAOYSA-N chembl1552233 Chemical compound CC1=CC(C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 JBTHDAVBDKKSRW-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- UJMBCXLDXJUMFB-UHFFFAOYSA-K trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4h-pyrazole-3-carboxylate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-UHFFFAOYSA-K 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/34—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 3 only
- C07D311/38—2,3-Dihydro derivatives, e.g. isoflavanones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/06—Benzothiopyrans; Hydrogenated benzothiopyrans
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G17/00—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process
- G03G17/04—Electrographic processes using patterns other than charge patterns, e.g. an electric conductivity pattern; Processes involving a migration, e.g. photoelectrophoresis, photoelectrosolography; Processes involving a selective transfer, e.g. electrophoto-adhesive processes; Apparatus essentially involving a single such process using photoelectrophoresis
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/12—Recording members for multicolour processes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Physics & Mathematics (AREA)
- Physics & Mathematics (AREA)
- Molecular Biology (AREA)
- Electrochemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Optical Filters (AREA)
- Vertical, Hearth, Or Arc Furnaces (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US44110665A | 1965-03-19 | 1965-03-19 | |
| US41110665A | 1965-03-19 | 1965-03-19 | |
| US45265165A | 1965-05-03 | 1965-05-03 | |
| US45496265A | 1965-05-11 | 1965-05-11 | |
| US504122A US3419560A (en) | 1965-03-19 | 1965-10-23 | 1-aminoalkyl 2-aryl indanes and tetrahydronaphthalenes |
| US59066666A | 1966-10-31 | 1966-10-31 | |
| US79882868A | 1968-11-01 | 1968-11-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IL25304A true IL25304A (en) | 1969-11-30 |
Family
ID=27569758
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL25304A IL25304A (en) | 1965-03-19 | 1966-03-04 | Method and machine for electrophoretic photography |
Country Status (11)
| Country | Link |
|---|---|
| US (5) | US3553093A (enExample) |
| AT (3) | AT285326B (enExample) |
| BE (1) | BE680863A (enExample) |
| CH (3) | CH479100A (enExample) |
| DE (1) | DE1522742A1 (enExample) |
| FR (2) | FR1568731A (enExample) |
| GB (4) | GB1157671A (enExample) |
| IL (1) | IL25304A (enExample) |
| NL (1) | NL6606339A (enExample) |
| NO (2) | NO123368B (enExample) |
| SE (2) | SE341330B (enExample) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE371190B (enExample) * | 1972-03-24 | 1974-11-11 | Kabi Ab | |
| US3804508A (en) * | 1965-05-28 | 1974-04-16 | V Mihajlov | Photoelectrophoretic apparatus for heat fixing an image |
| US3504031A (en) * | 1966-05-24 | 1970-03-31 | Mead Johnson & Co | 1-aminoalkyl-1-phenylindene process and intermediate therefor |
| US3477934A (en) * | 1966-06-29 | 1969-11-11 | Xerox Corp | Imaging process |
| US3680955A (en) * | 1968-07-16 | 1972-08-01 | Minolta Camera Kk | Apparatus for forming an electrostatic image in a camera |
| US3743404A (en) * | 1968-10-03 | 1973-07-03 | Xerox Corp | Photoelectrophoretic imaging apparatus including means to simultaneously apply a compressive stress and shear stress to the imaging suspension |
| US3657091A (en) * | 1968-10-03 | 1972-04-18 | Xerox Corp | Electrophoretic imaging method employing a periodic electric field |
| US3620950A (en) * | 1968-10-03 | 1971-11-16 | Xerox Corp | Electrophoretic imaging employing periodic electromagnetic radiation |
| US3811764A (en) * | 1968-10-03 | 1974-05-21 | Xerox Corp | Apparatus for photoelectrophoretic imaging using a periodic electric field |
| US3784302A (en) * | 1968-10-03 | 1974-01-08 | Xerox Corp | Electrophoretic imaging apparatus including application of dynamic stress on the particle suspension |
| US3853556A (en) * | 1969-05-02 | 1974-12-10 | Xerox Corp | Method for eliminating electrical arcing during photoelectrophoretic imaging |
| BE756481A (fr) * | 1969-09-23 | 1971-03-22 | Xerox Corp | Procede de formation d'image photoelectrophoretique par reflexion |
| USRE28360E (en) * | 1969-10-03 | 1975-03-04 | Electrophoretic color display device | |
| US3761174A (en) * | 1969-10-31 | 1973-09-25 | Xerox Corp | Manifold web handling |
| US3690754A (en) * | 1969-11-14 | 1972-09-12 | Xerox Corp | Control system for an optical imaging system |
| JPS527348B1 (enExample) * | 1970-01-09 | 1977-03-01 | ||
| US3909262A (en) * | 1970-12-14 | 1975-09-30 | Xerox Corp | Imaging migration member employing a gelatin overcoating |
| US3719484A (en) * | 1971-01-06 | 1973-03-06 | Xerox Corp | Photoelectrophoretic imaging method |
| US3751420A (en) * | 1971-04-01 | 1973-08-07 | Squibb & Sons Inc | Monoolmonoene amines |
| US3859438A (en) * | 1971-07-08 | 1975-01-07 | Boehringer Sohn Ingelheim | Pharmaceutical compositions containing an n-(1-bicyclic aryl-propyl-2)-n-bicyclic aryl-piperazine and method of use |
| US3984464A (en) * | 1972-10-06 | 1976-10-05 | A. Christiaens Societe Anonyme | Derivatives of 2-amino-(1,2,3,4-tetrahydronaphthalene), the preparation and use thereof |
| US3859576A (en) * | 1973-02-15 | 1975-01-07 | Xerox Corp | High performance blocking electrode for electrophotophoresis |
| US3905812A (en) * | 1973-04-23 | 1975-09-16 | Xerox Corp | Imaging process |
| US3917880A (en) * | 1973-06-27 | 1975-11-04 | Xerox Corp | Electrophoretic imaging system |
| US3945724A (en) * | 1974-06-04 | 1976-03-23 | Xerox Corporation | Velocity compensation for bead bypass |
| US4078928A (en) * | 1975-03-03 | 1978-03-14 | Xerox Corporation | Photoelectrophoretic imaging method |
| US4084896A (en) * | 1975-04-24 | 1978-04-18 | Xerox Corporation | Photoelectrophoretic web imaging apparatus |
| CH619701A5 (enExample) * | 1975-08-07 | 1980-10-15 | Bayer Ag | |
| US4013673A (en) * | 1976-04-13 | 1977-03-22 | Warner-Lambert Company | 2,3-dihydro-3-(2-pyridinyl)-4h-1-benzopyran-4-one n-oxides |
| US4130359A (en) * | 1976-07-23 | 1978-12-19 | Eastman Kodak Company | Electrophoretic migration imaging apparatus and method utilizing enlarged migration environment |
| DE2814983A1 (de) * | 1978-04-07 | 1979-10-18 | Bayer Ag | Neue chromanon-derivate |
| CH641147A5 (de) * | 1979-01-17 | 1984-02-15 | Sandoz Ag | 3-amino-2-hydroxypropoxyaryl-derivat, seine herstellung und dieses enthaltende heilmittel. |
| NL8003141A (nl) * | 1980-05-30 | 1982-01-04 | Akzo Nv | Biologisch aktieve tricyclische aminen. |
| CH648030A5 (de) * | 1980-12-15 | 1985-02-28 | Sandoz Ag | Benzopyran-allylaminderivate, verfahren zu ihrer herstellung und ihre verwendung. |
| US4321270A (en) * | 1981-01-29 | 1982-03-23 | E. R. Squibb & Sons, Inc. | Substituted chromans |
| US4452801A (en) * | 1981-09-24 | 1984-06-05 | E. R. Squibb & Sons, Inc. | Chromans including heterocyclic substituent |
| US4505932A (en) * | 1983-05-13 | 1985-03-19 | Abbott Laboratories | Method of producing α2 -adrenergic receptor agonist activity |
| GB8704572D0 (en) * | 1987-02-26 | 1987-04-01 | Lundbeck & Co As H | Organic compounds |
| WO1989006645A1 (en) * | 1988-01-15 | 1989-07-27 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5086074A (en) * | 1988-01-15 | 1992-02-04 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5128362A (en) * | 1988-01-15 | 1992-07-07 | Abbott Laboratories | 1-aminomethyl-1,2,3,4-tetrahydronaphthalenes |
| US5298512A (en) * | 1989-04-07 | 1994-03-29 | Pfizer Inc. | Substituted chromans and their use in the treatment of asthma, arthritis and related diseases |
| US5500444A (en) * | 1989-11-14 | 1996-03-19 | Hoechst Marion Roussel, Inc. | Cardioprotective tocopherol analogs |
| US5063397A (en) * | 1990-05-25 | 1991-11-05 | Xerox Corporation | Variable-thickness imaging members |
| EP0550292A1 (en) * | 1992-01-02 | 1993-07-07 | Merrell Dow Pharmaceuticals Inc. | Tissue protective tocopherol analogs |
| US5721233A (en) * | 1992-04-06 | 1998-02-24 | Merrell Pharmaceuticals Inc. | Derivatives of 2,3-dihydro benzofuranols |
| US5510373A (en) * | 1992-04-06 | 1996-04-23 | Merrell Pharmaceuticals Inc. | Cardioprotective agents |
| US5545660A (en) * | 1992-04-07 | 1996-08-13 | Merrell Pharmaceuticals Inc. | Hydrazide derivatives of 3,4-dihydro-2H-1-benzopyrans |
| IL143780A (en) * | 2001-06-14 | 2007-06-03 | Cerel Ceramic Technologies Ltd | Process for manufacturing electrode |
| US7339715B2 (en) * | 2003-03-25 | 2008-03-04 | E Ink Corporation | Processes for the production of electrophoretic displays |
| DE102005010000A1 (de) * | 2005-03-04 | 2006-09-07 | Merck Patent Gmbh | Indane |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2758939A (en) * | 1953-12-30 | 1956-08-14 | Rca Corp | Electrostatic printing |
| US2987660A (en) * | 1955-06-06 | 1961-06-06 | Haloid Xerox Inc | Xerographic charging |
| US2902974A (en) * | 1956-06-14 | 1959-09-08 | Ibm | Latent electrostatic image developing apparatus |
| US2884434A (en) * | 1957-03-07 | 1959-04-28 | Dow Corning | Haloorgano silcarbane siloxanes |
| US2940847A (en) * | 1957-07-03 | 1960-06-14 | None i red | |
| US3068479A (en) * | 1958-05-09 | 1962-12-11 | Burroughs Corp | Electrographic recording apparatus |
| US3251685A (en) * | 1959-10-19 | 1966-05-17 | Xerox Corp | Method of controlling contrast in a xerographic reproduction process |
| US3142682A (en) * | 1961-11-21 | 1964-07-28 | Ciba Geigy Corp | Tertiary amino derivatives of chromans and homo-chromans |
| US3271145A (en) * | 1963-12-23 | 1966-09-06 | Eastman Kodak Co | Process for producing an electrostatic charge image |
| US3301866A (en) * | 1965-08-12 | 1967-01-31 | Rexall Drug Chemical | Substituted indenopyridines |
-
1965
- 1965-03-19 US US441106A patent/US3553093A/en not_active Expired - Lifetime
- 1965-05-03 US US452651A patent/US3474019A/en not_active Expired - Lifetime
- 1965-10-23 US US504122A patent/US3419560A/en not_active Expired - Lifetime
-
1966
- 1966-03-04 IL IL25304A patent/IL25304A/en unknown
- 1966-03-17 GB GB11857/66A patent/GB1157671A/en not_active Expired
- 1966-03-17 DE DE19661522742 patent/DE1522742A1/de active Pending
- 1966-03-17 GB GB34793/68A patent/GB1149666A/en not_active Expired
- 1966-03-17 GB GB11856/66A patent/GB1149665A/en not_active Expired
- 1966-03-18 CH CH393866A patent/CH479100A/fr not_active IP Right Cessation
- 1966-03-18 AT AT262066A patent/AT285326B/de not_active IP Right Cessation
- 1966-03-18 CH CH393766A patent/CH479099A/fr not_active IP Right Cessation
- 1966-03-18 SE SE03639/66A patent/SE341330B/xx unknown
- 1966-03-18 SE SE03640/66A patent/SE334540B/xx unknown
- 1966-03-18 NO NO162166A patent/NO123368B/no unknown
- 1966-03-18 AT AT261966A patent/AT286783B/de active
- 1966-04-19 GB GB17156/66A patent/GB1149615A/en not_active Expired
- 1966-04-21 NO NO162689A patent/NO120030B/no unknown
- 1966-05-10 NL NL6606339A patent/NL6606339A/xx unknown
- 1966-05-11 FR FR1568731D patent/FR1568731A/fr not_active Expired
- 1966-05-11 CH CH682366A patent/CH466305A/fr unknown
- 1966-05-11 BE BE680863D patent/BE680863A/xx unknown
- 1966-05-11 AT AT447466A patent/AT279598B/de not_active IP Right Cessation
- 1966-08-10 FR FR72633A patent/FR5864M/fr not_active Expired
- 1966-10-31 US US590666A patent/US3448025A/en not_active Expired - Lifetime
-
1968
- 1968-11-01 US US798828*A patent/US3551320A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH466305A (fr) | 1968-12-15 |
| US3419560A (en) | 1968-12-31 |
| BE680863A (enExample) | 1966-11-14 |
| FR1568731A (enExample) | 1969-05-30 |
| DE1522743B2 (de) | 1972-07-27 |
| AT286783B (de) | 1970-12-28 |
| DE1522743A1 (de) | 1969-10-30 |
| DE1522742A1 (de) | 1969-10-30 |
| NO123368B (enExample) | 1971-11-01 |
| CH479100A (fr) | 1969-09-30 |
| FR5864M (enExample) | 1968-03-11 |
| AT285326B (de) | 1970-10-27 |
| NL6606339A (enExample) | 1966-11-14 |
| US3448025A (en) | 1969-06-03 |
| GB1157671A (en) | 1969-07-09 |
| GB1149615A (en) | 1969-04-23 |
| US3551320A (en) | 1970-12-29 |
| GB1149666A (en) | 1969-04-23 |
| US3553093A (en) | 1971-01-05 |
| NO120030B (enExample) | 1970-08-17 |
| SE334540B (enExample) | 1971-04-26 |
| SE341330B (enExample) | 1971-12-20 |
| US3474019A (en) | 1969-10-21 |
| AT279598B (de) | 1970-03-10 |
| CH479099A (fr) | 1969-09-30 |
| GB1149665A (en) | 1969-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL25304A (en) | Method and machine for electrophoretic photography | |
| US3582205A (en) | Imaging apparatus | |
| US3551313A (en) | Image contrast control in photoelectrophoretic imaging | |
| US4049343A (en) | Combination imaging and grounding roller | |
| US3697409A (en) | Belt electrode imaging system | |
| US3477934A (en) | Imaging process | |
| US3703459A (en) | Liquid applicator | |
| US3952700A (en) | Liquid applicator | |
| US3586615A (en) | Photoelectrophoretic imaging process including the use of an electrically charged suspension coating means | |
| US3658519A (en) | Image transfer process from conductive substrates | |
| US3657103A (en) | Electrode imaging system | |
| US4130359A (en) | Electrophoretic migration imaging apparatus and method utilizing enlarged migration environment | |
| US3666472A (en) | Magnetic photo-electrophoretic imaging composition | |
| US3782932A (en) | Electrophoretic imaging process using transparent particles | |
| US3723288A (en) | Electrophoretic imaging apparatus including means to project an imageat a liquid nip | |
| US3945724A (en) | Velocity compensation for bead bypass | |
| US3784294A (en) | Image density control | |
| US3645874A (en) | Image density control in photoelectrophoretic imaging | |
| US3655370A (en) | Photoelectrophoretic image transfer | |
| US3719484A (en) | Photoelectrophoretic imaging method | |
| US3696020A (en) | Electrophoretic imaging apparatus including means to coat and electrify the imaging electrode | |
| US3616395A (en) | Photoelectrophoretic imaging with corona field application | |
| US3620948A (en) | Photoelectrophoretic imaging system employing preliminary electrophoretic disposition of the imaging suspension | |
| US3957510A (en) | Overflow prevention for liquid between flexible layers on a solid surface | |
| US3769009A (en) | Inking system for liquid particle migration on automatic machines |