IE53323B1 - Process for the preparation of isosorbide-2-nitrate - Google Patents
Process for the preparation of isosorbide-2-nitrateInfo
- Publication number
- IE53323B1 IE53323B1 IE1460/82A IE146082A IE53323B1 IE 53323 B1 IE53323 B1 IE 53323B1 IE 1460/82 A IE1460/82 A IE 1460/82A IE 146082 A IE146082 A IE 146082A IE 53323 B1 IE53323 B1 IE 53323B1
- Authority
- IE
- Ireland
- Prior art keywords
- isosorbide
- nitrate
- acylate
- acid anhydride
- process according
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 44
- 238000002360 preparation method Methods 0.000 title claims abstract description 16
- YWXYYJSYQOXTPL-JGWLITMVSA-N [(3r,3ar,6s,6as)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O)CO[C@@H]21 YWXYYJSYQOXTPL-JGWLITMVSA-N 0.000 title claims abstract description 15
- 229960002479 isosorbide Drugs 0.000 claims abstract description 86
- KLDXJTOLSGUMSJ-JGWLITMVSA-N Isosorbide Chemical compound O[C@@H]1CO[C@@H]2[C@@H](O)CO[C@@H]21 KLDXJTOLSGUMSJ-JGWLITMVSA-N 0.000 claims abstract description 71
- 229910002651 NO3 Inorganic materials 0.000 claims abstract description 17
- 150000003839 salts Chemical class 0.000 claims abstract description 14
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910017604 nitric acid Inorganic materials 0.000 claims abstract description 9
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims abstract description 8
- 229910052751 metal Inorganic materials 0.000 claims abstract description 7
- 239000002184 metal Substances 0.000 claims abstract description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- -1 alkali metal alkoxide Chemical class 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000005917 acylation reaction Methods 0.000 claims description 13
- 150000008064 anhydrides Chemical class 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 4
- 238000000605 extraction Methods 0.000 claims description 4
- 238000001953 recrystallisation Methods 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 3
- 150000004703 alkoxides Chemical class 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052753 mercury Inorganic materials 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 239000005711 Benzoic acid Substances 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 229910052787 antimony Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 235000010233 benzoic acid Nutrition 0.000 claims description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 238000004821 distillation Methods 0.000 claims description 2
- 229910052738 indium Inorganic materials 0.000 claims description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052747 lanthanoid Inorganic materials 0.000 claims description 2
- 150000002602 lanthanoids Chemical class 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052716 thallium Inorganic materials 0.000 claims description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- CHIHQLCVLOXUJW-UHFFFAOYSA-N benzoic anhydride Chemical group C=1C=CC=CC=1C(=O)OC(=O)C1=CC=CC=C1 CHIHQLCVLOXUJW-UHFFFAOYSA-N 0.000 claims 2
- JRQMCPMJDNVZDZ-UHFFFAOYSA-N (2,3,4-trimethylbenzoyl) 2,3,4-trimethylbenzoate Chemical compound CC1=C(C)C(C)=CC=C1C(=O)OC(=O)C1=CC=C(C)C(C)=C1C JRQMCPMJDNVZDZ-UHFFFAOYSA-N 0.000 claims 1
- AXHLTKQEAUZHIO-UHFFFAOYSA-N (2,3-dimethylbenzoyl) 2,3-dimethylbenzoate Chemical compound CC1=CC=CC(C(=O)OC(=O)C=2C(=C(C)C=CC=2)C)=C1C AXHLTKQEAUZHIO-UHFFFAOYSA-N 0.000 claims 1
- SOFDTMPXXZJJMJ-UHFFFAOYSA-N (2-nitrobenzoyl) 2-nitrobenzoate Chemical compound [O-][N+](=O)C1=CC=CC=C1C(=O)OC(=O)C1=CC=CC=C1[N+]([O-])=O SOFDTMPXXZJJMJ-UHFFFAOYSA-N 0.000 claims 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 125000005587 carbonate group Chemical group 0.000 claims 1
- 150000007942 carboxylates Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 150000002815 nickel Chemical class 0.000 claims 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N ortho-methoxybenzoic acid Natural products COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 claims 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims 1
- 239000010452 phosphate Substances 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 125000005233 alkylalcohol group Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 230000010933 acylation Effects 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 229960000201 isosorbide dinitrate Drugs 0.000 description 8
- MOYKHGMNXAOIAT-JGWLITMVSA-N isosorbide dinitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 MOYKHGMNXAOIAT-JGWLITMVSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 238000005809 transesterification reaction Methods 0.000 description 8
- 238000002955 isolation Methods 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000006396 nitration reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 150000002823 nitrates Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- KLDXJTOLSGUMSJ-BXKVDMCESA-N (3s,3as,6s,6as)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol Chemical compound O[C@H]1CO[C@H]2[C@@H](O)CO[C@H]21 KLDXJTOLSGUMSJ-BXKVDMCESA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001559 benzoic acids Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 229940046892 lead acetate Drugs 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 description 1
- VJMAITQRABEEKP-UHFFFAOYSA-N [6-(phenylmethoxymethyl)-1,4-dioxan-2-yl]methyl acetate Chemical compound O1C(COC(=O)C)COCC1COCC1=CC=CC=C1 VJMAITQRABEEKP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000036983 biotransformation Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- UHEAMRPXLXUPRI-UHFFFAOYSA-N cyclohexanecarboxylic acid;cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1.OC(=O)C1CCCCC1 UHEAMRPXLXUPRI-UHFFFAOYSA-N 0.000 description 1
- NKLCHDQGUHMCGL-UHFFFAOYSA-N cyclohexylidenemethanone Chemical group O=C=C1CCCCC1 NKLCHDQGUHMCGL-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Substances OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229960003711 glyceryl trinitrate Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 125000004401 m-toluyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])[H])C(*)=O 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229940082615 organic nitrates used in cardiac disease Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D493/00—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system
- C07D493/02—Heterocyclic compounds containing oxygen atoms as the only ring hetero atoms in the condensed system in which the condensed system contains two hetero rings
- C07D493/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813124410 DE3124410A1 (de) | 1981-06-22 | 1981-06-22 | Verfahren zur herstellung von isosorbid-2-nitrat |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE821460L IE821460L (en) | 1982-12-22 |
| IE53323B1 true IE53323B1 (en) | 1988-10-12 |
Family
ID=6135078
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1460/82A IE53323B1 (en) | 1981-06-22 | 1982-06-21 | Process for the preparation of isosorbide-2-nitrate |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4417065A (env) |
| EP (1) | EP0067964B1 (env) |
| JP (1) | JPS584785A (env) |
| AT (1) | ATE12500T1 (env) |
| CS (1) | CS224648B2 (env) |
| DD (1) | DD202719A5 (env) |
| DE (2) | DE3124410A1 (env) |
| DK (1) | DK149155C (env) |
| GR (1) | GR75951B (env) |
| IE (1) | IE53323B1 (env) |
| PL (1) | PL130910B1 (env) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3479800D1 (en) * | 1983-11-25 | 1989-10-26 | Toshin Chemical Co | A method for the preparation of isosorbide-5-nitrate and sodium isosorbide-5-nitrate hydrate as a precursor thereof |
| JPS60149521A (ja) * | 1984-01-18 | 1985-08-07 | Eisai Co Ltd | 高眼圧・緑内障治療・予防用点眼剤 |
| DE3683500D1 (de) * | 1986-11-05 | 1992-02-27 | Consiglio Nazionale Ricerche | Verfahren zur selektiven herstellung von isosorbid-2-nitrat, ausgehend vom isosorbid-2,5-dinitrat. |
| IT1204571B (it) * | 1987-05-08 | 1989-03-10 | Chiesi Farma Spa | Esteri di 1,4:3,6-dianidrosorbitolo-2-mononitrato e 5-mononitrato,loro procedimento di preparazione e loro composizioni farmaceutiche |
| DE4129093A1 (de) * | 1991-09-02 | 1993-03-04 | Schneider Manfred Prof Dr | Verfahren zur enzymatischen herstellung isomerenreiner isosorbid-2- und -5-monoester sowie deren ueberfuehrung in isosorbid-2- und -5-nitrat |
| US5538891A (en) * | 1991-09-02 | 1996-07-23 | Boehringer Mannheim Gmbh | Process for enzymatic production of isomerically pure isosorbide-2 and 5-monoesters and their conversion to isosorbide-2 and -5 nitrate |
| DE4410997A1 (de) * | 1994-03-30 | 1995-10-26 | Isis Pharma Gmbh | Pharmazeutische Zubereitungen und Arzneistoffe zur Prävention und Behandlung endothelialer Dysfunktionen |
| IT1303671B1 (it) * | 1998-07-28 | 2001-02-23 | Nicox Sa | Sali dell'acido nitrico con farmaci attivi nel trattamento dipatologie del sistema respiratorio |
| DE102008050597A1 (de) | 2008-10-09 | 2010-04-15 | Actavis Deutschland Gmbh & Co. Kg | Pharmazeutische Zubereitungen zur Anwendung in einem Verfahren zur therapeutischen Behandlung von Hörsturz |
| CN114514231B (zh) | 2019-09-23 | 2024-08-30 | 巴斯夫欧洲公司 | 包括选择性酯化双脱水己糖醇异构体混合物的制备和/或分离异艾杜糖醇的方法 |
| CN112390808B (zh) * | 2020-11-26 | 2021-11-16 | 连云港鹏辰特种新材料有限公司 | 一种捕集纯化均苯四甲酸二酐的方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4065488A (en) * | 1977-02-24 | 1977-12-27 | American Home Products Corporation | Process for preparing 1,4:3,6-dianhydro-D-glucitol 2-nitrate |
| DE2903983A1 (de) * | 1979-02-02 | 1980-09-04 | Sanol Arznei Schwarz Gmbh | Verfahren zur selektiven herstellung von isosorbid-2-nitrat |
| DE3028873C2 (de) * | 1980-07-30 | 1983-10-27 | Boehringer Mannheim Gmbh, 6800 Mannheim | Verfahren zur Herstellung von 1,4 zu 3,6-Dianhydro-D-glucit-5-nitrat (Isosorbid-5-nitrat) |
| DE3102947A1 (de) * | 1981-01-29 | 1982-09-02 | Heinrich Mack Nachf., 7918 Illertissen | Verfahren zur herstellung von isosorbid-5-nitrat |
| FR2500835A1 (fr) * | 1981-02-27 | 1982-09-03 | Poudres & Explosifs Ste Nale | Procede de synthese des mononitrates d'isosorbide |
| JPH1026755A (ja) * | 1992-07-07 | 1998-01-27 | Seiko Instr Inc | 液晶電気光学デバイス |
-
1981
- 1981-06-22 DE DE19813124410 patent/DE3124410A1/de not_active Withdrawn
-
1982
- 1982-05-18 EP EP82104366A patent/EP0067964B1/de not_active Expired
- 1982-05-18 DE DE8282104366T patent/DE3262856D1/de not_active Expired
- 1982-05-18 AT AT82104366T patent/ATE12500T1/de not_active IP Right Cessation
- 1982-05-24 US US06/381,124 patent/US4417065A/en not_active Expired - Fee Related
- 1982-05-31 CS CS824025A patent/CS224648B2/cs unknown
- 1982-06-01 PL PL1982236706A patent/PL130910B1/pl unknown
- 1982-06-18 DD DD82240885A patent/DD202719A5/de not_active IP Right Cessation
- 1982-06-21 JP JP57106634A patent/JPS584785A/ja active Granted
- 1982-06-21 IE IE1460/82A patent/IE53323B1/en not_active IP Right Cessation
- 1982-06-21 DK DK278082A patent/DK149155C/da not_active IP Right Cessation
- 1982-06-22 GR GR68514A patent/GR75951B/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4417065A (en) | 1983-11-22 |
| DK278082A (da) | 1982-12-23 |
| DK149155B (da) | 1986-02-17 |
| IE821460L (en) | 1982-12-22 |
| PL130910B1 (en) | 1984-09-29 |
| EP0067964A2 (de) | 1982-12-29 |
| DD202719A5 (de) | 1983-09-28 |
| EP0067964A3 (en) | 1983-01-19 |
| DK149155C (da) | 1986-07-28 |
| CS224648B2 (en) | 1984-01-16 |
| JPS584785A (ja) | 1983-01-11 |
| ATE12500T1 (de) | 1985-04-15 |
| EP0067964B1 (de) | 1985-04-03 |
| PL236706A1 (en) | 1983-01-03 |
| DE3124410A1 (de) | 1983-01-05 |
| JPH0129191B2 (env) | 1989-06-08 |
| DE3262856D1 (en) | 1985-05-09 |
| GR75951B (env) | 1984-08-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI85493B (fi) | Foerfarande foer framstaellning av sackarosestrar. | |
| FR1449628A (fr) | Procédé de préparation d'indoles polynucléaires désacylés, notamment d'esters de la série de la désacétyl-vincaleucoblastine et de la désacétyl-vincristine | |
| US4417065A (en) | Process for the preparation of isosorbide 2-nitrate | |
| IE45705B1 (en) | Process for preparing 1,4:3,6-dianhydro-d-glucitol 2-nitrate | |
| US3687982A (en) | Separation of mixed diastereoisomers of zearalanol | |
| US4371703A (en) | Process for the production of isosorbide-5-nitrate | |
| RU2208616C2 (ru) | Способ получения фуроата мометазона | |
| Weissmann | Preparation of 2-Acetamido-2-deoxy-α-glycopyra nosides1 | |
| US4431830A (en) | Process for the preparation of isosorbide-5-nitrate | |
| US5777136A (en) | Process for the glycosidation of colchicine derivatives and the products obtained thereby | |
| US4158012A (en) | Steroid synthesis process using mixed anhydride | |
| Mádi-Puskás et al. | Carbocyclic ring closure of an aminodeoxy hex-5-enopyranoside | |
| CZ191398A3 (cs) | Způsob přípravy 9,11ß-epoxisteroidů | |
| US4914195A (en) | Process for preparing N-acetylneuraminic acid derivatives | |
| JPS6317077B2 (env) | ||
| US4464534A (en) | Process for the preparation of vincaminic acid esters | |
| EP0240338B1 (en) | Butenoic acid derivatives | |
| US3405147A (en) | 17-phenylaliphatylestra-1, 3, 5(10)-trien-3-ols, 16-dehydro derivatives correspondingand esters thereof | |
| US5710293A (en) | Method of preparation of ester derivatives of steroids | |
| EP0503388B1 (en) | Pregna-21-oic acid esters | |
| US4166849A (en) | Peruvoside derivatives and processes for their preparation | |
| ZA200205697B (en) | Method for preparing and isolating 9-deoxo-9(z)-hydroxyiminoerythromycin A. | |
| IL27745A (en) | Ethers of 17beta-hydroxy-gona-4,9,11-trienes | |
| JPS6117836B2 (env) | ||
| JPH10130293A (ja) | α結合を有するシアル酸グリコシドの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |