IE46787B1 - Esters and thiolesters of amino acids,processes for their production, and compositions including them - Google Patents
Esters and thiolesters of amino acids,processes for their production, and compositions including themInfo
- Publication number
- IE46787B1 IE46787B1 IE552/78A IE55278A IE46787B1 IE 46787 B1 IE46787 B1 IE 46787B1 IE 552/78 A IE552/78 A IE 552/78A IE 55278 A IE55278 A IE 55278A IE 46787 B1 IE46787 B1 IE 46787B1
- Authority
- IE
- Ireland
- Prior art keywords
- valine
- ester
- hydrogen
- phenoxybenzyl
- fluoro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 107
- 239000000203 mixture Substances 0.000 title claims description 58
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 150000002148 esters Chemical class 0.000 title abstract description 67
- 150000001413 amino acids Chemical class 0.000 title abstract description 8
- 150000007970 thio esters Chemical class 0.000 title abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 64
- -1 methylenedioxy group Chemical group 0.000 claims description 282
- 239000001257 hydrogen Substances 0.000 claims description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 37
- 125000004432 carbon atom Chemical group C* 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 28
- 239000002253 acid Substances 0.000 claims description 26
- DLULJAUWRRKBML-JTQLQIEISA-N (2s)-2-[2-fluoro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(F)(F)F)C=C1F DLULJAUWRRKBML-JTQLQIEISA-N 0.000 claims description 25
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 125000001153 fluoro group Chemical group F* 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 14
- 241000238631 Hexapoda Species 0.000 claims description 13
- 241000607479 Yersinia pestis Species 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 11
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 10
- YKSHSSFDOHACTC-JTQLQIEISA-N (2s)-2-[2-chloro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(F)(F)F)C=C1Cl YKSHSSFDOHACTC-JTQLQIEISA-N 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 125000000304 alkynyl group Chemical group 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000001188 haloalkyl group Chemical group 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 7
- 125000001246 bromo group Chemical group Br* 0.000 claims description 7
- 241000238876 Acari Species 0.000 claims description 6
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 241000255925 Diptera Species 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 4
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 4
- 125000005110 aryl thio group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 claims description 3
- 125000005291 haloalkenyloxy group Chemical group 0.000 claims description 3
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 3
- 125000000232 haloalkynyl group Chemical group 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 claims description 2
- 241000254173 Coleoptera Species 0.000 claims description 2
- 241000258937 Hemiptera Species 0.000 claims description 2
- 241001466007 Heteroptera Species 0.000 claims description 2
- 241000257303 Hymenoptera Species 0.000 claims description 2
- 241000255777 Lepidoptera Species 0.000 claims description 2
- 241000238814 Orthoptera Species 0.000 claims description 2
- 241000916145 Tarsonemidae Species 0.000 claims description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims 6
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 2
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 claims 2
- 241001454295 Tetranychidae Species 0.000 claims 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims 1
- 230000000895 acaricidal effect Effects 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 238
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Natural products CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 101
- 239000004474 valine Substances 0.000 description 101
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 94
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 87
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 76
- 238000006243 chemical reaction Methods 0.000 description 71
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 58
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- FBCHRMFAWNWJCU-JTQLQIEISA-N (2s)-2-(4-chloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1 FBCHRMFAWNWJCU-JTQLQIEISA-N 0.000 description 47
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 45
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 description 42
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 42
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 41
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 40
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- 239000012267 brine Substances 0.000 description 39
- 239000000243 solution Substances 0.000 description 37
- 235000019441 ethanol Nutrition 0.000 description 34
- 239000011541 reaction mixture Substances 0.000 description 33
- UEBARDWJXBGYEJ-UHFFFAOYSA-N 2-bromo-3-methylbutanoic acid Chemical compound CC(C)C(Br)C(O)=O UEBARDWJXBGYEJ-UHFFFAOYSA-N 0.000 description 32
- 229910000027 potassium carbonate Inorganic materials 0.000 description 29
- AJWAECPVBMQFSX-NSHDSACASA-N (2s)-3-methyl-2-(4-methylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C)C=C1 AJWAECPVBMQFSX-NSHDSACASA-N 0.000 description 27
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 24
- 239000002904 solvent Substances 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 20
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 17
- 238000004809 thin layer chromatography Methods 0.000 description 17
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 16
- 239000010410 layer Substances 0.000 description 16
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 15
- 239000012259 ether extract Substances 0.000 description 15
- 159000000000 sodium salts Chemical class 0.000 description 15
- 229910052938 sodium sulfate Inorganic materials 0.000 description 15
- 235000011152 sodium sulphate Nutrition 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 14
- 239000005457 ice water Substances 0.000 description 13
- KZPLXTSZVZBJPO-JTQLQIEISA-N (2s)-2-(4-chloro-2-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1F KZPLXTSZVZBJPO-JTQLQIEISA-N 0.000 description 12
- NZPWGWAEKDSVFN-JTQLQIEISA-N (2s)-3-methyl-2-[4-(trifluoromethyl)anilino]butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(F)(F)F)C=C1 NZPWGWAEKDSVFN-JTQLQIEISA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 239000008346 aqueous phase Substances 0.000 description 12
- 239000012071 phase Substances 0.000 description 11
- HNBHHMUCXASXEW-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-bromo-3-methylbutanoate Chemical compound CC(C)C(Br)C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 HNBHHMUCXASXEW-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 9
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 9
- 238000012746 preparative thin layer chromatography Methods 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- CAXWIGJTXJTLLU-JTQLQIEISA-N (2s)-2-(4-bromo-2-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Br)C=C1F CAXWIGJTXJTLLU-JTQLQIEISA-N 0.000 description 8
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 8
- 230000007935 neutral effect Effects 0.000 description 8
- 239000012074 organic phase Substances 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 101150041968 CDC13 gene Proteins 0.000 description 7
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 7
- 229940024606 amino acid Drugs 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 238000005192 partition Methods 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- XCAMLAFYNOLVPM-NSHDSACASA-N (2s)-2-(2,6-dimethylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(C)C=CC=C1C XCAMLAFYNOLVPM-NSHDSACASA-N 0.000 description 6
- LYJVJCQYQYSJHU-NSHDSACASA-N (2s)-2-(2-fluoro-4-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C)C=C1F LYJVJCQYQYSJHU-NSHDSACASA-N 0.000 description 6
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- XZUCJVTXERYPQH-NSHDSACASA-N (2s)-2-(4-methoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 XZUCJVTXERYPQH-NSHDSACASA-N 0.000 description 5
- MBRPCSKHPRLQQQ-JTQLQIEISA-N (2s)-2-anilino-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1 MBRPCSKHPRLQQQ-JTQLQIEISA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- CSFDTBRRIBJILD-UHFFFAOYSA-N 4-chloro-2-fluoroaniline Chemical compound NC1=CC=C(Cl)C=C1F CSFDTBRRIBJILD-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- CQVOILYSLSWABZ-NSHDSACASA-N (2s)-2-(2-fluoro-4-methoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N[C@@H](C(C)C)C(O)=O)C(F)=C1 CQVOILYSLSWABZ-NSHDSACASA-N 0.000 description 4
- XWTQCMHYIJEQPD-JTQLQIEISA-N (2s)-2-(4-chloro-3-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C(F)=C1 XWTQCMHYIJEQPD-JTQLQIEISA-N 0.000 description 4
- IUKZSVHIWMVLEQ-NSHDSACASA-N (2s)-3-methyl-2-(2-methylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1C IUKZSVHIWMVLEQ-NSHDSACASA-N 0.000 description 4
- ZQEXBVHABAJPHJ-UHFFFAOYSA-N 2-fluoro-4-methylaniline Chemical compound CC1=CC=C(N)C(F)=C1 ZQEXBVHABAJPHJ-UHFFFAOYSA-N 0.000 description 4
- RMXZAXNAIMJGCX-UHFFFAOYSA-N 3-[2-fluoro-4-(trifluoromethyl)phenyl]-4-propan-2-yl-1,3-oxazolidine-2,5-dione Chemical compound O=C1OC(=O)C(C(C)C)N1C1=CC=C(C(F)(F)F)C=C1F RMXZAXNAIMJGCX-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 235000019445 benzyl alcohol Nutrition 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 4
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- VEMHDYZLZMGTPY-NSHDSACASA-N (2s)-2-(2-chloro-4-cyanoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C#N)C=C1Cl VEMHDYZLZMGTPY-NSHDSACASA-N 0.000 description 3
- VROZCADDFUUKKS-NSHDSACASA-N (2s)-2-(2-chloro-4-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C)C=C1Cl VROZCADDFUUKKS-NSHDSACASA-N 0.000 description 3
- QMUHBXHJSJMIMS-NSHDSACASA-N (2s)-2-(3-cyanoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC(C#N)=C1 QMUHBXHJSJMIMS-NSHDSACASA-N 0.000 description 3
- MEFVUVHUSRMQFS-NSHDSACASA-N (2s)-2-(3-fluoro-4-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C)C(F)=C1 MEFVUVHUSRMQFS-NSHDSACASA-N 0.000 description 3
- WROFLMBQEAWZQE-JTQLQIEISA-N (2s)-3-methyl-2-[4-(trifluoromethylsulfanyl)anilino]butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(SC(F)(F)F)C=C1 WROFLMBQEAWZQE-JTQLQIEISA-N 0.000 description 3
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 3
- RKOXEZQTSCBPJU-UHFFFAOYSA-N 1-(1-bromoprop-2-ynyl)-3-phenoxybenzene Chemical compound C#CC(Br)C1=CC=CC(OC=2C=CC=CC=2)=C1 RKOXEZQTSCBPJU-UHFFFAOYSA-N 0.000 description 3
- WGSBBUARHFQRMJ-UHFFFAOYSA-N 2-anilino-3-hydroxybutanoic acid Chemical compound CC(O)C(C(O)=O)NC1=CC=CC=C1 WGSBBUARHFQRMJ-UHFFFAOYSA-N 0.000 description 3
- DRPSAOSWRROJGM-UHFFFAOYSA-N 3-(4-chlorophenyl)-4-propan-2-yl-1,3-oxazolidine-2,5-dione Chemical compound O=C1OC(=O)C(C(C)C)N1C1=CC=C(Cl)C=C1 DRPSAOSWRROJGM-UHFFFAOYSA-N 0.000 description 3
- OHHHTUXVBNGOGI-UHFFFAOYSA-N 4-(trifluoromethylsulfanyl)aniline Chemical compound NC1=CC=C(SC(F)(F)F)C=C1 OHHHTUXVBNGOGI-UHFFFAOYSA-N 0.000 description 3
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 3
- 241001124076 Aphididae Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- LPUVHKRZLUSGEQ-UHFFFAOYSA-N ethyl 3,3-dimethyl-2-oxobutanoate Chemical compound CCOC(=O)C(=O)C(C)(C)C LPUVHKRZLUSGEQ-UHFFFAOYSA-N 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 125000001475 halogen functional group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- MCVAFONMAQMVCV-JTQLQIEISA-N (2s)-2-(2,3-dichloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC(Cl)=C1Cl MCVAFONMAQMVCV-JTQLQIEISA-N 0.000 description 2
- GGRCRIDGJPZWSP-JTQLQIEISA-N (2s)-2-(2,4-dichloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1Cl GGRCRIDGJPZWSP-JTQLQIEISA-N 0.000 description 2
- AAOZSVIAUPQWBF-JTQLQIEISA-N (2s)-2-(2,4-difluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C=C1F AAOZSVIAUPQWBF-JTQLQIEISA-N 0.000 description 2
- HJJZMHYQUZXNLK-LBPRGKRZSA-N (2s)-2-(2,4-dimethoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N[C@@H](C(C)C)C(O)=O)C(OC)=C1 HJJZMHYQUZXNLK-LBPRGKRZSA-N 0.000 description 2
- VWECIPUUTBEHCX-VIFPVBQESA-N (2s)-2-(2,6-dichloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(Cl)C=CC=C1Cl VWECIPUUTBEHCX-VIFPVBQESA-N 0.000 description 2
- ZDJAAANFBXVIRN-JTQLQIEISA-N (2s)-2-(2-chloro-4-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C=C1Cl ZDJAAANFBXVIRN-JTQLQIEISA-N 0.000 description 2
- VQOVNRSMVVGTFF-JTQLQIEISA-N (2s)-2-(2-chloro-6-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(C)C=CC=C1Cl VQOVNRSMVVGTFF-JTQLQIEISA-N 0.000 description 2
- IIRPTJLXIHEPBZ-JTQLQIEISA-N (2s)-2-(2-chloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1Cl IIRPTJLXIHEPBZ-JTQLQIEISA-N 0.000 description 2
- VXTZBGCLXOSNCZ-NSHDSACASA-N (2s)-2-(2-fluoro-5-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC(C)=CC=C1F VXTZBGCLXOSNCZ-NSHDSACASA-N 0.000 description 2
- NUQSUTBBONGPBG-JTQLQIEISA-N (2s)-2-(2-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1F NUQSUTBBONGPBG-JTQLQIEISA-N 0.000 description 2
- SRISUIIVZVMEGC-LBPRGKRZSA-N (2s)-2-(3,4-dimethylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C)C(C)=C1 SRISUIIVZVMEGC-LBPRGKRZSA-N 0.000 description 2
- SWRZKPXCIZQCFP-JTQLQIEISA-N (2s)-2-(3-chloro-4-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C(Cl)=C1 SWRZKPXCIZQCFP-JTQLQIEISA-N 0.000 description 2
- YINPNAZYBCSMMW-JTQLQIEISA-N (2s)-2-(3-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC(F)=C1 YINPNAZYBCSMMW-JTQLQIEISA-N 0.000 description 2
- AOIJBVAVSLTNDB-LBPRGKRZSA-N (2s)-2-(4-acetylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(C)=O)C=C1 AOIJBVAVSLTNDB-LBPRGKRZSA-N 0.000 description 2
- CKTUEUJBIQRPDS-VIFPVBQESA-N (2s)-2-(4-chloro-2,6-difluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(F)C=C(Cl)C=C1F CKTUEUJBIQRPDS-VIFPVBQESA-N 0.000 description 2
- YPLCPXLWQFHYTL-NSHDSACASA-N (2s)-2-(4-chloro-2-cyanoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1C#N YPLCPXLWQFHYTL-NSHDSACASA-N 0.000 description 2
- OGVJCKDWSVGTTR-NSHDSACASA-N (2s)-2-(4-chloro-2-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1C OGVJCKDWSVGTTR-NSHDSACASA-N 0.000 description 2
- LSLNKAVJKMXGPW-NSHDSACASA-N (2s)-2-(4-chloro-n-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)N(C)C1=CC=C(Cl)C=C1 LSLNKAVJKMXGPW-NSHDSACASA-N 0.000 description 2
- WWZZZTQHHFPSOD-NSHDSACASA-N (2s)-2-(4-cyano-2-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C#N)C=C1F WWZZZTQHHFPSOD-NSHDSACASA-N 0.000 description 2
- OLXMDPAVYCQLHY-NSHDSACASA-N (2s)-2-(4-cyanoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C#N)C=C1 OLXMDPAVYCQLHY-NSHDSACASA-N 0.000 description 2
- RRKHNNURUGQBCS-LBPRGKRZSA-N (2s)-2-(4-ethoxycarbonylanilino)-3-methylbutanoic acid Chemical compound CCOC(=O)C1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 RRKHNNURUGQBCS-LBPRGKRZSA-N 0.000 description 2
- HFDJUPVCKVYKKL-NSHDSACASA-N (2s)-2-(4-fluoro-3-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C(C)=C1 HFDJUPVCKVYKKL-NSHDSACASA-N 0.000 description 2
- GPMPXWHKXRHNEO-JTQLQIEISA-N (2s)-2-(4-fluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C=C1 GPMPXWHKXRHNEO-JTQLQIEISA-N 0.000 description 2
- MFOQAAROVBJMNI-ZDUSSCGKSA-N (2s)-2-(4-tert-butylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(C)(C)C)C=C1 MFOQAAROVBJMNI-ZDUSSCGKSA-N 0.000 description 2
- SDQTZJXVQFENSC-JTQLQIEISA-N (2s)-2-[2-chloro-5-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC(C(F)(F)F)=CC=C1Cl SDQTZJXVQFENSC-JTQLQIEISA-N 0.000 description 2
- ZUJATFFGSYJOTD-JTQLQIEISA-N (2s)-2-[3-fluoro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(F)(F)F)C(F)=C1 ZUJATFFGSYJOTD-JTQLQIEISA-N 0.000 description 2
- QBYYLBWFBPAOKU-YFKPBYRVSA-N (2s)-2-formamido-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC=O QBYYLBWFBPAOKU-YFKPBYRVSA-N 0.000 description 2
- SYFGFFHQDZCALA-VIFPVBQESA-N (2s)-3-methyl-2-(2,3,4,5,6-pentafluoroanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(F)C(F)=C(F)C(F)=C1F SYFGFFHQDZCALA-VIFPVBQESA-N 0.000 description 2
- URVPVJKHECQZKV-LBPRGKRZSA-N (2s)-3-methyl-2-(2,4,6-trimethylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(C)C=C(C)C=C1C URVPVJKHECQZKV-LBPRGKRZSA-N 0.000 description 2
- WAUCVFJWBIXCMP-JTQLQIEISA-N (2s)-3-methyl-2-(2-nitroanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1[N+]([O-])=O WAUCVFJWBIXCMP-JTQLQIEISA-N 0.000 description 2
- JIPTTYUXNHQPEN-JTQLQIEISA-N (2s)-3-methyl-2-(3-nitroanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC([N+]([O-])=O)=C1 JIPTTYUXNHQPEN-JTQLQIEISA-N 0.000 description 2
- AKBMHFXFDNXIEX-NSHDSACASA-N (2s)-3-methyl-2-(4-methylsulfanylanilino)butanoic acid Chemical compound CSC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 AKBMHFXFDNXIEX-NSHDSACASA-N 0.000 description 2
- SNVLRKMZCYYEHD-JTQLQIEISA-N (2s)-3-methyl-2-(4-nitroanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1 SNVLRKMZCYYEHD-JTQLQIEISA-N 0.000 description 2
- XNXRJUZWOJIVSN-ZDUSSCGKSA-N (2s)-3-methyl-2-(4-propan-2-yloxycarbonylanilino)butanoic acid Chemical compound CC(C)OC(=O)C1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 XNXRJUZWOJIVSN-ZDUSSCGKSA-N 0.000 description 2
- LAZKWQOFMWWSLT-NSHDSACASA-N (2s)-3-methyl-2-(n-methylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)N(C)C1=CC=CC=C1 LAZKWQOFMWWSLT-NSHDSACASA-N 0.000 description 2
- JFEHKMRTKKTGJA-JTQLQIEISA-N (2s)-3-methyl-2-[4-(trifluoromethoxy)anilino]butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(OC(F)(F)F)C=C1 JFEHKMRTKKTGJA-JTQLQIEISA-N 0.000 description 2
- KSUVNILNCQGJCF-KWQFWETISA-N (2s,3s)-2-(4-chloroanilino)-3-methylpentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC1=CC=C(Cl)C=C1 KSUVNILNCQGJCF-KWQFWETISA-N 0.000 description 2
- SWJRKXGYNNAADM-JQWIXIFHSA-N (2s,3s)-3-methyl-2-(4-methylanilino)pentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC1=CC=C(C)C=C1 SWJRKXGYNNAADM-JQWIXIFHSA-N 0.000 description 2
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 2
- WNXOJUBUEPIETE-UHFFFAOYSA-N 1-(bromomethyl)-3-(4-chlorophenoxy)benzene Chemical compound C1=CC(Cl)=CC=C1OC1=CC=CC(CBr)=C1 WNXOJUBUEPIETE-UHFFFAOYSA-N 0.000 description 2
- JGFSTQUUDSBQCO-UHFFFAOYSA-N 1-(bromomethyl)-3-(4-fluorophenoxy)benzene Chemical compound C1=CC(F)=CC=C1OC1=CC=CC(CBr)=C1 JGFSTQUUDSBQCO-UHFFFAOYSA-N 0.000 description 2
- AWOGNRQRFYZDFB-UHFFFAOYSA-N 1-(bromomethyl)-3-(4-methoxyphenoxy)benzene Chemical compound C1=CC(OC)=CC=C1OC1=CC=CC(CBr)=C1 AWOGNRQRFYZDFB-UHFFFAOYSA-N 0.000 description 2
- NSPHLAYWAKKWTA-UHFFFAOYSA-N 1-(bromomethyl)-3-(4-methylphenoxy)benzene Chemical compound C1=CC(C)=CC=C1OC1=CC=CC(CBr)=C1 NSPHLAYWAKKWTA-UHFFFAOYSA-N 0.000 description 2
- ZTGBZEIZZSETSZ-UHFFFAOYSA-N 1-(bromomethyl)-3-[3-(trifluoromethyl)phenoxy]benzene Chemical compound FC(F)(F)C1=CC=CC(OC=2C=C(CBr)C=CC=2)=C1 ZTGBZEIZZSETSZ-UHFFFAOYSA-N 0.000 description 2
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 2
- NEZGPRYOJVPJKL-UHFFFAOYSA-N 1-methylsulfanyl-4-nitrobenzene Chemical compound CSC1=CC=C([N+]([O-])=O)C=C1 NEZGPRYOJVPJKL-UHFFFAOYSA-N 0.000 description 2
- ILLBHPYCTYQBQI-UHFFFAOYSA-N 1-nitro-4-(trifluoromethylsulfanyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(SC(F)(F)F)C=C1 ILLBHPYCTYQBQI-UHFFFAOYSA-N 0.000 description 2
- XYHKNCXZYYTLRG-UHFFFAOYSA-N 1h-imidazole-2-carbaldehyde Chemical compound O=CC1=NC=CN1 XYHKNCXZYYTLRG-UHFFFAOYSA-N 0.000 description 2
- AYLCDVYHZOZQKM-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-3-methylbutanoic acid Chemical compound CC(C)C(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O AYLCDVYHZOZQKM-UHFFFAOYSA-N 0.000 description 2
- CUGRONDTFFPKOA-UHFFFAOYSA-N 2-benzyl-4-(bromomethyl)furan Chemical compound BrCC1=COC(CC=2C=CC=CC=2)=C1 CUGRONDTFFPKOA-UHFFFAOYSA-N 0.000 description 2
- WIQISTBTOQNVCE-UHFFFAOYSA-N 2-fluoro-1-methyl-4-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1F WIQISTBTOQNVCE-UHFFFAOYSA-N 0.000 description 2
- ARHDUOQIXLGANT-UHFFFAOYSA-N 2-fluoro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1F ARHDUOQIXLGANT-UHFFFAOYSA-N 0.000 description 2
- WZMOWQCNPFDWPA-UHFFFAOYSA-N 2-fluoro-4-methyl-1-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C(F)=C1 WZMOWQCNPFDWPA-UHFFFAOYSA-N 0.000 description 2
- XYKVQPNHGFUXBS-UHFFFAOYSA-N 2-fluoro-4-nitro-1-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(C(F)(F)F)C(F)=C1 XYKVQPNHGFUXBS-UHFFFAOYSA-N 0.000 description 2
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 2
- DOLQYFPDPKPQSS-UHFFFAOYSA-N 3,4-dimethylaniline Chemical compound CC1=CC=C(N)C=C1C DOLQYFPDPKPQSS-UHFFFAOYSA-N 0.000 description 2
- FQEVHRCPXFKJHF-UHFFFAOYSA-N 3-(trifluoromethoxy)benzaldehyde Chemical compound FC(F)(F)OC1=CC=CC(C=O)=C1 FQEVHRCPXFKJHF-UHFFFAOYSA-N 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-M 3-Methylbutanoic acid Natural products CC(C)CC([O-])=O GWYFCOCPABKNJV-UHFFFAOYSA-M 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- GZRMNMGWNKSANY-UHFFFAOYSA-N 4-bromo-2-fluoroaniline Chemical compound NC1=CC=C(Br)C=C1F GZRMNMGWNKSANY-UHFFFAOYSA-N 0.000 description 2
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 2
- ZLPXBWMVZANJJQ-UHFFFAOYSA-N 4-chloro-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1F ZLPXBWMVZANJJQ-UHFFFAOYSA-N 0.000 description 2
- HRXZRAXKKNUKRF-UHFFFAOYSA-N 4-ethylaniline Chemical compound CCC1=CC=C(N)C=C1 HRXZRAXKKNUKRF-UHFFFAOYSA-N 0.000 description 2
- 241001425390 Aphis fabae Species 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 241000256244 Heliothis virescens Species 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 2
- 241000819999 Nymphes Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- GWYFCOCPABKNJV-UHFFFAOYSA-N beta-methyl-butyric acid Natural products CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- OXNJTHYNYAMYOZ-UHFFFAOYSA-N ethyl 2-bromo-3-hydroxybutanoate Chemical compound CCOC(=O)C(Br)C(C)O OXNJTHYNYAMYOZ-UHFFFAOYSA-N 0.000 description 2
- 229940093499 ethyl acetate Drugs 0.000 description 2
- 235000019439 ethyl acetate Nutrition 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 125000000962 organic group Chemical group 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000002728 pyrethroid Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 150000004992 toluidines Chemical class 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- LTYHRSPNORCERP-KRWDZBQOSA-N (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound C1(C2=C(C(N1COC([C@@H](NC1=CC=C(C=C1)Cl)C(C)C)=O)=O)CCCC2)=O LTYHRSPNORCERP-KRWDZBQOSA-N 0.000 description 1
- VMFYVJMFTYUQAU-KRWDZBQOSA-N (1,3-dioxoisoindol-2-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound C1(C=2C(C(N1COC([C@@H](NC1=CC=C(C=C1)Cl)C(C)C)=O)=O)=CC=CC2)=O VMFYVJMFTYUQAU-KRWDZBQOSA-N 0.000 description 1
- XJRIDJAGAYGJCK-UHFFFAOYSA-N (1-acetyl-5-bromoindol-3-yl) acetate Chemical compound C1=C(Br)C=C2C(OC(=O)C)=CN(C(C)=O)C2=C1 XJRIDJAGAYGJCK-UHFFFAOYSA-N 0.000 description 1
- LODDFDHPSIYCTK-UHFFFAOYSA-N (2,4,6-trimethylphenyl)methanol Chemical compound CC1=CC(C)=C(CO)C(C)=C1 LODDFDHPSIYCTK-UHFFFAOYSA-N 0.000 description 1
- MXORHTNDIXNORF-QFIPXVFZSA-N (2,6-dimethyl-4-prop-2-ynylphenyl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound CC1=C(COC([C@@H](NC2=CC=C(C=C2)Cl)C(C)C)=O)C(=CC(=C1)CC#C)C MXORHTNDIXNORF-QFIPXVFZSA-N 0.000 description 1
- VSXDVGNZJJVCLO-QHCPKHFHSA-N (2,6-dimethyl-4-prop-2-ynylphenyl)methyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound CC1=C(COC([C@@H](NC2=CC=C(C=C2)C)C(C)C)=O)C(=CC(=C1)CC#C)C VSXDVGNZJJVCLO-QHCPKHFHSA-N 0.000 description 1
- WSGRWFYAFLAPNV-IBGZPJMESA-N (2-methyl-5-prop-2-ynylfuran-3-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound CC=1OC(=CC1COC([C@@H](NC1=CC=C(C=C1)Cl)C(C)C)=O)CC#C WSGRWFYAFLAPNV-IBGZPJMESA-N 0.000 description 1
- PUVZZPHOIXKASP-FQEVSTJZSA-N (2-methyl-5-prop-2-ynylfuran-3-yl)methyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound CC=1OC(=CC1COC([C@@H](NC1=CC=C(C=C1)C)C(C)C)=O)CC#C PUVZZPHOIXKASP-FQEVSTJZSA-N 0.000 description 1
- OSEOJQNBMWJSFC-NSHDSACASA-N (2s)-2-(1,3-benzodioxol-5-ylamino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C2OCOC2=C1 OSEOJQNBMWJSFC-NSHDSACASA-N 0.000 description 1
- BFYKUPZKXWFICG-VIFPVBQESA-N (2s)-2-(2,6-difluoroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(F)C=CC=C1F BFYKUPZKXWFICG-VIFPVBQESA-N 0.000 description 1
- SOSVQNJHYNMQTE-NSHDSACASA-N (2s)-2-(2-chloro-4-methoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N[C@@H](C(C)C)C(O)=O)C(Cl)=C1 SOSVQNJHYNMQTE-NSHDSACASA-N 0.000 description 1
- HKVKKRZSKOJMKM-NSHDSACASA-N (2s)-2-(2-methoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=CC=C1N[C@@H](C(C)C)C(O)=O HKVKKRZSKOJMKM-NSHDSACASA-N 0.000 description 1
- TZSAWBCPTQVXKX-JTQLQIEISA-N (2s)-2-(3,4-dibromoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Br)C(Br)=C1 TZSAWBCPTQVXKX-JTQLQIEISA-N 0.000 description 1
- ZXQBLNFEDMEUKS-JTQLQIEISA-N (2s)-2-(3,4-dichloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C(Cl)=C1 ZXQBLNFEDMEUKS-JTQLQIEISA-N 0.000 description 1
- PRXCZIFJNHGQSW-LBPRGKRZSA-N (2s)-2-(3,4-dimethoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1OC PRXCZIFJNHGQSW-LBPRGKRZSA-N 0.000 description 1
- PFZGRHSCYIAMDG-LBPRGKRZSA-N (2s)-2-(3,5-dimethoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC(N[C@@H](C(C)C)C(O)=O)=CC(OC)=C1 PFZGRHSCYIAMDG-LBPRGKRZSA-N 0.000 description 1
- ZIGUKZUDOGGLLP-LBPRGKRZSA-N (2s)-2-(3,5-dimethylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC(C)=CC(C)=C1 ZIGUKZUDOGGLLP-LBPRGKRZSA-N 0.000 description 1
- JRZVTVXUWUQKCP-JTQLQIEISA-N (2s)-2-(3-bromo-4-chloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C(Br)=C1 JRZVTVXUWUQKCP-JTQLQIEISA-N 0.000 description 1
- YVOBULRETZQHNX-JTQLQIEISA-N (2s)-2-(3-chloroanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC(Cl)=C1 YVOBULRETZQHNX-JTQLQIEISA-N 0.000 description 1
- JVCAAMOTNLBZIO-NSHDSACASA-N (2s)-2-(3-methoxyanilino)-3-methylbutanoic acid Chemical compound COC1=CC=CC(N[C@@H](C(C)C)C(O)=O)=C1 JVCAAMOTNLBZIO-NSHDSACASA-N 0.000 description 1
- DQRJKQORDXAFOY-JTQLQIEISA-N (2s)-2-(4-bromoanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Br)C=C1 DQRJKQORDXAFOY-JTQLQIEISA-N 0.000 description 1
- BWNRMCJXJKPIJA-AWEZNQCLSA-N (2s)-2-(4-butylanilino)-3-methylbutanoic acid Chemical compound CCCCC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 BWNRMCJXJKPIJA-AWEZNQCLSA-N 0.000 description 1
- UKARFDJEQAUHAT-NSHDSACASA-N (2s)-2-(4-chloro-2,6-dimethylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(C)C=C(Cl)C=C1C UKARFDJEQAUHAT-NSHDSACASA-N 0.000 description 1
- XZSGNCSZTJPAIR-NSHDSACASA-N (2s)-2-(4-chloro-n-formylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)N(C=O)C1=CC=C(Cl)C=C1 XZSGNCSZTJPAIR-NSHDSACASA-N 0.000 description 1
- REUQOKJZXGJLMX-ZDUSSCGKSA-N (2s)-2-(4-cyclopropylanilino)-3-methylbutanoic acid Chemical compound C1=CC(N[C@@H](C(C)C)C(O)=O)=CC=C1C1CC1 REUQOKJZXGJLMX-ZDUSSCGKSA-N 0.000 description 1
- ZTBKQGVCHHSERL-LBPRGKRZSA-N (2s)-2-(4-ethoxyanilino)-3-methylbutanoic acid Chemical compound CCOC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 ZTBKQGVCHHSERL-LBPRGKRZSA-N 0.000 description 1
- QYPGTAQNXKYOBM-LBPRGKRZSA-N (2s)-2-(4-ethylanilino)-3-methylbutanoic acid Chemical compound CCC1=CC=C(N[C@@H](C(C)C)C(O)=O)C=C1 QYPGTAQNXKYOBM-LBPRGKRZSA-N 0.000 description 1
- ZOZOVGMHHVYJCG-NSHDSACASA-N (2s)-2-(4-fluoro-2-methylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(F)C=C1C ZOZOVGMHHVYJCG-NSHDSACASA-N 0.000 description 1
- FFJGMXBCTALVPR-NSHDSACASA-N (2s)-2-(4-methoxy-n-(2,2,2-trifluoroacetyl)anilino)-3-methylbutanoic acid Chemical compound COC1=CC=C(N([C@@H](C(C)C)C(O)=O)C(=O)C(F)(F)F)C=C1 FFJGMXBCTALVPR-NSHDSACASA-N 0.000 description 1
- BNBBXEWJFIPADN-JTQLQIEISA-N (2s)-2-(cyclohexylamino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1CCCCC1 BNBBXEWJFIPADN-JTQLQIEISA-N 0.000 description 1
- OICFGQOQBWELGC-LBPRGKRZSA-N (2s)-2-(n,4-dimethylanilino)-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)N(C)C1=CC=C(C)C=C1 OICFGQOQBWELGC-LBPRGKRZSA-N 0.000 description 1
- MZVJBIZIMJVNEH-JTQLQIEISA-N (2s)-2-[4-chloro-3-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(Cl)C(C(F)(F)F)=C1 MZVJBIZIMJVNEH-JTQLQIEISA-N 0.000 description 1
- AJCOVGIJFQGEJZ-PPHPATTJSA-N (2s)-2-anilino-3-methylbutanoic acid;hydrochloride Chemical compound Cl.CC(C)[C@@H](C(O)=O)NC1=CC=CC=C1 AJCOVGIJFQGEJZ-PPHPATTJSA-N 0.000 description 1
- RJQNOAWZSDWHFS-VIFPVBQESA-N (2s)-3-methyl-2-(2,4,6-trichloroanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=C(Cl)C=C(Cl)C=C1Cl RJQNOAWZSDWHFS-VIFPVBQESA-N 0.000 description 1
- OOAIWPFNZZQMCK-LBPRGKRZSA-N (2s)-3-methyl-2-(3,4,5-trimethoxyanilino)butanoic acid Chemical compound COC1=CC(N[C@@H](C(C)C)C(O)=O)=CC(OC)=C1OC OOAIWPFNZZQMCK-LBPRGKRZSA-N 0.000 description 1
- WEDDSGROIZUSSD-NSHDSACASA-N (2s)-3-methyl-2-(3-methylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=CC(C)=C1 WEDDSGROIZUSSD-NSHDSACASA-N 0.000 description 1
- SISWFYVUPFWBJU-ZDUSSCGKSA-N (2s)-3-methyl-2-(4-propan-2-ylanilino)butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C(C(C)C)C=C1 SISWFYVUPFWBJU-ZDUSSCGKSA-N 0.000 description 1
- AQIOBAJYUUYYFU-JTQLQIEISA-N (2s)-3-methyl-2-[4-nitro-3-(trifluoromethyl)anilino]butanoic acid Chemical compound CC(C)[C@@H](C(O)=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 AQIOBAJYUUYYFU-JTQLQIEISA-N 0.000 description 1
- RMJDTEZNCGEAST-DEOSSOPVSA-N (3-benzylphenyl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound C(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)Cl)C(C)C)=O)C=CC1 RMJDTEZNCGEAST-DEOSSOPVSA-N 0.000 description 1
- OJXWDPAQMKNXFG-VWLOTQADSA-N (3-benzylphenyl)methyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound C(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)C)C(C)C)=O)C=CC1 OJXWDPAQMKNXFG-VWLOTQADSA-N 0.000 description 1
- ULVQEJNAOGLCRP-FQEVSTJZSA-N (3-chloro-4-phenylbut-2-enyl) (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound C1(=CC=CC=C1)CC(=CCOC([C@@H](NC1=CC=C(C=C1)Cl)C(C)C)=O)Cl ULVQEJNAOGLCRP-FQEVSTJZSA-N 0.000 description 1
- ZGTYDZTYQLGMDL-DEOSSOPVSA-N (3-phenoxyphenyl)methyl (2S)-2-(4-chloroanilino)-4-methylpentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)Cl)CC(C)C)=O)C=CC1 ZGTYDZTYQLGMDL-DEOSSOPVSA-N 0.000 description 1
- JGNWDFDJWZGPPZ-VWLOTQADSA-N (3-phenoxyphenyl)methyl (2S)-4-methyl-2-(4-methylanilino)pentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)C)CC(C)C)=O)C=CC1 JGNWDFDJWZGPPZ-VWLOTQADSA-N 0.000 description 1
- FGIVXFBYDLKCFG-UUOWRZLLSA-N (3-phenoxyphenyl)methyl (2S,3S)-2-(4-chloroanilino)-3-methylpentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)Cl)[C@@H](C)CC)=O)C=CC1 FGIVXFBYDLKCFG-UUOWRZLLSA-N 0.000 description 1
- SMCACIYWDMSCPV-CPJSRVTESA-N (3-phenoxyphenyl)methyl (2S,3S)-3-methyl-2-(4-methylanilino)pentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC([C@@H](NC2=CC=C(C=C2)C)[C@@H](C)CC)=O)C=CC1 SMCACIYWDMSCPV-CPJSRVTESA-N 0.000 description 1
- XLKUADBKLHYIDC-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2,3-dibromo-3-methylbutanoate Chemical compound CC(C)(Br)C(Br)C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 XLKUADBKLHYIDC-UHFFFAOYSA-N 0.000 description 1
- YDCAFUYKYYWGOL-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-(4-chloroanilino)butanoate Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1COC(=O)C(CC)NC1=CC=C(Cl)C=C1 YDCAFUYKYYWGOL-UHFFFAOYSA-N 0.000 description 1
- CPCOIOURHLEQEY-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-(4-methylanilino)butanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CC)NC2=CC=C(C=C2)C)=O)C=CC1 CPCOIOURHLEQEY-UHFFFAOYSA-N 0.000 description 1
- SHQUZIXDXUATRG-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-(4-methylanilino)hexanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CCCC)NC2=CC=C(C=C2)C)=O)C=CC1 SHQUZIXDXUATRG-UHFFFAOYSA-N 0.000 description 1
- SSEKVINRKIPLKI-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-anilino-3,3-dimethylpent-4-enoate Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1COC(=O)C(C(C)(C=C)C)NC1=CC=CC=C1 SSEKVINRKIPLKI-UHFFFAOYSA-N 0.000 description 1
- VCDBPOMBXJRFCS-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-bromo-3-methylbut-3-enoate Chemical compound CC(=C)C(Br)C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 VCDBPOMBXJRFCS-UHFFFAOYSA-N 0.000 description 1
- OUFVWOPASHJKNG-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-bromobutanoate Chemical compound CCC(Br)C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 OUFVWOPASHJKNG-UHFFFAOYSA-N 0.000 description 1
- IMBHSBCCUFQBPV-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 3-chloro-2-(4-chloroanilino)propanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CCl)NC2=CC=C(C=C2)Cl)=O)C=CC1 IMBHSBCCUFQBPV-UHFFFAOYSA-N 0.000 description 1
- CDSQQVBUUSKWKL-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 3-chloro-2-(4-methylanilino)propanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CCl)NC2=CC=C(C=C2)C)=O)C=CC1 CDSQQVBUUSKWKL-UHFFFAOYSA-N 0.000 description 1
- NWOVHHPDNYJCPR-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 3-methylbut-2-enoate Chemical compound CC(C)=CC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 NWOVHHPDNYJCPR-UHFFFAOYSA-N 0.000 description 1
- GRZUGMJHIYCFNL-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 5-chloro-2-(4-chloroanilino)pentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CCCCl)NC2=CC=C(C=C2)Cl)=O)C=CC1 GRZUGMJHIYCFNL-UHFFFAOYSA-N 0.000 description 1
- HSTJXVXDULRJBF-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 5-chloro-2-(4-methylanilino)pentanoate Chemical compound O(C1=CC=CC=C1)C=1C=C(COC(C(CCCCl)NC2=CC=C(C=C2)C)=O)C=CC1 HSTJXVXDULRJBF-UHFFFAOYSA-N 0.000 description 1
- KRESRJASQNOINS-UHFFFAOYSA-N (3-phenoxyphenyl)methyl butanoate Chemical compound CCCC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KRESRJASQNOINS-UHFFFAOYSA-N 0.000 description 1
- FEOMFFKZOZMBKD-UHFFFAOYSA-N (4-phenoxyphenyl)methanol Chemical compound C1=CC(CO)=CC=C1OC1=CC=CC=C1 FEOMFFKZOZMBKD-UHFFFAOYSA-N 0.000 description 1
- JHLWOUDFNFHIFU-FQEVSTJZSA-N (4-prop-2-ynylphenyl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate Chemical compound C(C#C)C1=CC=C(COC([C@@H](NC2=CC=C(C=C2)Cl)C(C)C)=O)C=C1 JHLWOUDFNFHIFU-FQEVSTJZSA-N 0.000 description 1
- AKXVTLNHYSFVAV-NRFANRHFSA-N (4-prop-2-ynylphenyl)methyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound C(C#C)C1=CC=C(COC([C@@H](NC2=CC=C(C=C2)C)C(C)C)=O)C=C1 AKXVTLNHYSFVAV-NRFANRHFSA-N 0.000 description 1
- FZRBKIRIBLNOAM-UHFFFAOYSA-N (E,E)-2-propynyl 3,7,11-trimethyl-2,4-dodecadienoate Chemical compound CC(C)CCCC(C)CC=CC(C)=CC(=O)OCC#C FZRBKIRIBLNOAM-UHFFFAOYSA-N 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- QBIPGYZYGMGLHK-UHFFFAOYSA-N 1-(2,4-dichlorobut-2-enyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CC(Cl)=CCCl QBIPGYZYGMGLHK-UHFFFAOYSA-N 0.000 description 1
- VPOUFNIUULMWGZ-UHFFFAOYSA-N 1-(2,4-dichlorobut-2-enyl)-4-fluorobenzene Chemical compound FC1=CC=C(CC(Cl)=CCCl)C=C1 VPOUFNIUULMWGZ-UHFFFAOYSA-N 0.000 description 1
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 description 1
- BKVGXKMHROLTHN-UHFFFAOYSA-N 1-(bromomethyl)-3-(2,2-dichloroethenoxy)benzene Chemical compound ClC(Cl)=COC1=CC=CC(CBr)=C1 BKVGXKMHROLTHN-UHFFFAOYSA-N 0.000 description 1
- FWAHWPGVFDHNCH-UHFFFAOYSA-N 1-(bromomethyl)-3-(2-fluorophenoxy)benzene Chemical compound FC1=CC=CC=C1OC1=CC=CC(CBr)=C1 FWAHWPGVFDHNCH-UHFFFAOYSA-N 0.000 description 1
- VEULEVHEAUGWQG-UHFFFAOYSA-N 1-(bromomethyl)-3-(4-tert-butylphenoxy)benzene Chemical compound C1=CC(C(C)(C)C)=CC=C1OC1=CC=CC(CBr)=C1 VEULEVHEAUGWQG-UHFFFAOYSA-N 0.000 description 1
- QSIVWRRHVXSDNE-UHFFFAOYSA-N 1-(bromomethyl)-3-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=CC(CBr)=C1 QSIVWRRHVXSDNE-UHFFFAOYSA-N 0.000 description 1
- GLFQFHVSQMOXNH-UHFFFAOYSA-N 1-(bromomethyl)-3-prop-2-ynoxybenzene Chemical compound BrCC1=CC=CC(OCC#C)=C1 GLFQFHVSQMOXNH-UHFFFAOYSA-N 0.000 description 1
- CXUUCZSAIZWXNR-UHFFFAOYSA-N 1-(bromomethyl)-4-prop-2-ynylbenzene Chemical compound BrCC1=CC=C(CC#C)C=C1 CXUUCZSAIZWXNR-UHFFFAOYSA-N 0.000 description 1
- SMRQEXDKLSROFE-UHFFFAOYSA-N 1-benzyl-3-(bromomethyl)benzene Chemical compound BrCC1=CC=CC(CC=2C=CC=CC=2)=C1 SMRQEXDKLSROFE-UHFFFAOYSA-N 0.000 description 1
- AVMHMVJVHYGDOO-UHFFFAOYSA-N 1-bromobut-2-ene Chemical compound CC=CCBr AVMHMVJVHYGDOO-UHFFFAOYSA-N 0.000 description 1
- JKXQKGNGJVZKFA-UHFFFAOYSA-N 1-chloro-3-methylbut-2-ene Chemical compound CC(C)=CCCl JKXQKGNGJVZKFA-UHFFFAOYSA-N 0.000 description 1
- FEWDXGMBVQULLN-UHFFFAOYSA-N 1-hydroxy-2-phenyl-1,5,6,7-tetrahydro-4H-benzimidazol-4-one Chemical compound ON1C=2CCCC(=O)C=2N=C1C1=CC=CC=C1 FEWDXGMBVQULLN-UHFFFAOYSA-N 0.000 description 1
- NFGXHKASABOEEW-UHFFFAOYSA-N 1-methylethyl 11-methoxy-3,7,11-trimethyl-2,4-dodecadienoate Chemical compound COC(C)(C)CCCC(C)CC=CC(C)=CC(=O)OC(C)C NFGXHKASABOEEW-UHFFFAOYSA-N 0.000 description 1
- PBCJPHDFBOPCHJ-UHFFFAOYSA-N 1-nitro-4-(trichloromethylsulfanyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(SC(Cl)(Cl)Cl)C=C1 PBCJPHDFBOPCHJ-UHFFFAOYSA-N 0.000 description 1
- MBGYUAFTBUSTNL-UHFFFAOYSA-N 1-phenoxy-3-[(3-phenoxyphenyl)methylsulfanylmethyl]benzene Chemical compound C=1C=CC(OC=2C=CC=CC=2)=CC=1CSCC(C=1)=CC=CC=1OC1=CC=CC=C1 MBGYUAFTBUSTNL-UHFFFAOYSA-N 0.000 description 1
- LYUPJHVGLFETDG-UHFFFAOYSA-N 1-phenylbutan-2-ol Chemical compound CCC(O)CC1=CC=CC=C1 LYUPJHVGLFETDG-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- BRPSAOUFIJSKOT-UHFFFAOYSA-N 2,3-dichloroaniline Chemical compound NC1=CC=CC(Cl)=C1Cl BRPSAOUFIJSKOT-UHFFFAOYSA-N 0.000 description 1
- NJQJGRGGIUNVAB-UHFFFAOYSA-N 2,4,4,6-tetrabromocyclohexa-2,5-dien-1-one Chemical compound BrC1=CC(Br)(Br)C=C(Br)C1=O NJQJGRGGIUNVAB-UHFFFAOYSA-N 0.000 description 1
- KWVPRPSXBZNOHS-UHFFFAOYSA-N 2,4,6-Trimethylaniline Chemical compound CC1=CC(C)=C(N)C(C)=C1 KWVPRPSXBZNOHS-UHFFFAOYSA-N 0.000 description 1
- NATVSFWWYVJTAZ-UHFFFAOYSA-N 2,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Cl NATVSFWWYVJTAZ-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- BDTXPYBHFYIYGP-UHFFFAOYSA-N 2-(4-chloroanilino)-3,3-dimethylbutanoic acid Chemical compound CC(C)(C)C(C(O)=O)NC1=CC=C(Cl)C=C1 BDTXPYBHFYIYGP-UHFFFAOYSA-N 0.000 description 1
- HCBZDTVVEJKWON-UHFFFAOYSA-N 2-(4-chloroanilino)hexanoic acid Chemical compound CCCCC(C(O)=O)NC1=CC=C(Cl)C=C1 HCBZDTVVEJKWON-UHFFFAOYSA-N 0.000 description 1
- AQDHXMBUTDLAMD-UHFFFAOYSA-N 2-(4-methylphenyl)sulfonylacetic acid Chemical compound CC1=CC=C(S(=O)(=O)CC(O)=O)C=C1 AQDHXMBUTDLAMD-UHFFFAOYSA-N 0.000 description 1
- MLMQRCFJRRUCQO-UHFFFAOYSA-N 2-(bromomethyl)-1,3-dimethyl-5-prop-2-ynylbenzene Chemical compound CC1=CC(CC#C)=CC(C)=C1CBr MLMQRCFJRRUCQO-UHFFFAOYSA-N 0.000 description 1
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 1
- DLULJAUWRRKBML-UHFFFAOYSA-N 2-[2-fluoro-4-(trifluoromethyl)anilino]-3-methylbutanoic acid Chemical compound CC(C)C(C(O)=O)NC1=CC=C(C(F)(F)F)C=C1F DLULJAUWRRKBML-UHFFFAOYSA-N 0.000 description 1
- UDWRJARVHYCCEN-UHFFFAOYSA-N 2-anilino-3,3-dimethylpent-4-enoic acid Chemical compound C=CC(C)(C)C(C(O)=O)NC1=CC=CC=C1 UDWRJARVHYCCEN-UHFFFAOYSA-N 0.000 description 1
- RQUVEWXCLQFLFF-UHFFFAOYSA-N 2-anilino-3-chlorobutanoic acid Chemical compound CC(Cl)C(C(O)=O)NC1=CC=CC=C1 RQUVEWXCLQFLFF-UHFFFAOYSA-N 0.000 description 1
- DSQFSFBBPSALMS-UHFFFAOYSA-N 2-bromo-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(Br)C1=CC=CC(OC=2C=CC=CC=2)=C1 DSQFSFBBPSALMS-UHFFFAOYSA-N 0.000 description 1
- MVYUMPZRKNBHOP-UHFFFAOYSA-N 2-bromo-3-methylbutanoyl chloride Chemical compound CC(C)C(Br)C(Cl)=O MVYUMPZRKNBHOP-UHFFFAOYSA-N 0.000 description 1
- KZOBODYIXDMSCF-UHFFFAOYSA-N 2-bromohexanoyl chloride Chemical compound CCCCC(Br)C(Cl)=O KZOBODYIXDMSCF-UHFFFAOYSA-N 0.000 description 1
- NKGAPYOBDADCJM-UHFFFAOYSA-N 2-chlorobut-2-enylbenzene Chemical compound CC=C(Cl)CC1=CC=CC=C1 NKGAPYOBDADCJM-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CHUWZNKJFGLDLP-UHFFFAOYSA-N 3,3,3-trichloro-2-(4-chloroanilino)propanoic acid Chemical compound OC(=O)C(C(Cl)(Cl)Cl)NC1=CC=C(Cl)C=C1 CHUWZNKJFGLDLP-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- XEFRNCLPPFDWAC-UHFFFAOYSA-N 3,4,5-trimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1OC XEFRNCLPPFDWAC-UHFFFAOYSA-N 0.000 description 1
- WNRGWPVJGDABME-UHFFFAOYSA-N 3,5-Dimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1 WNRGWPVJGDABME-UHFFFAOYSA-N 0.000 description 1
- MKARNSWMMBGSHX-UHFFFAOYSA-N 3,5-dimethylaniline Chemical compound CC1=CC(C)=CC(N)=C1 MKARNSWMMBGSHX-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- RBBOPKWXELESAN-UHFFFAOYSA-N 3-benzoylbenzaldehyde Chemical compound O=CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 RBBOPKWXELESAN-UHFFFAOYSA-N 0.000 description 1
- IEVAKUCVZWTRHQ-UHFFFAOYSA-N 3-bromo-3-methylbutanoic acid Chemical compound CC(C)(Br)CC(O)=O IEVAKUCVZWTRHQ-UHFFFAOYSA-N 0.000 description 1
- OVENUGPMQDFGLE-UHFFFAOYSA-N 3-chloro-5-(trifluoromethyl)aniline Chemical compound NC1=CC(Cl)=CC(C(F)(F)F)=C1 OVENUGPMQDFGLE-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- CRRVZRDISHOQQL-UHFFFAOYSA-N 3-fluoro-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C(F)=C1 CRRVZRDISHOQQL-UHFFFAOYSA-N 0.000 description 1
- MGRHBBRSAFPBIN-UHFFFAOYSA-N 3-fluoro-4-methylaniline Chemical compound CC1=CC=C(N)C=C1F MGRHBBRSAFPBIN-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- CSZIZZIBXJQWFW-UHFFFAOYSA-N 3-methyl-2-(4-methylanilino)but-3-enoic acid Chemical compound CC(=C)C(C(O)=O)NC1=CC=C(C)C=C1 CSZIZZIBXJQWFW-UHFFFAOYSA-N 0.000 description 1
- YYPNJNDODFVZLE-UHFFFAOYSA-N 3-methylbut-2-enoic acid Chemical compound CC(C)=CC(O)=O YYPNJNDODFVZLE-UHFFFAOYSA-N 0.000 description 1
- OSJIANKQQRLVNI-UHFFFAOYSA-N 3-naphthalen-1-yloxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C3=CC=CC=C3C=CC=2)=C1 OSJIANKQQRLVNI-UHFFFAOYSA-N 0.000 description 1
- MRLGCTNJRREZHZ-UHFFFAOYSA-N 3-phenoxybenzaldehyde Chemical compound O=CC1=CC=CC(OC=2C=CC=CC=2)=C1 MRLGCTNJRREZHZ-UHFFFAOYSA-N 0.000 description 1
- RMLBOIHFTKPMRI-UHFFFAOYSA-N 4,4,4-trichloro-2-(4-chloroanilino)butanoic acid Chemical compound ClC(Cl)(Cl)CC(C(=O)O)NC1=CC=C(Cl)C=C1 RMLBOIHFTKPMRI-UHFFFAOYSA-N 0.000 description 1
- WQBVGAREDZYPRI-UHFFFAOYSA-N 4,4,4-trichloro-2-(4-methylanilino)butanoic acid Chemical compound CC1=CC=C(NC(CC(Cl)(Cl)Cl)C(O)=O)C=C1 WQBVGAREDZYPRI-UHFFFAOYSA-N 0.000 description 1
- YDCAUAOBSSITGX-QFIPXVFZSA-N 4-(4-methylphenoxy)but-2-ynyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound CC1=CC=C(OCC#CCOC([C@@H](NC2=CC=C(C=C2)C)C(C)C)=O)C=C1 YDCAUAOBSSITGX-QFIPXVFZSA-N 0.000 description 1
- JGGTXXCKYKKRCA-QFIPXVFZSA-N 4-(4-methylphenyl)but-2-enyl (2S)-3-methyl-2-(4-methylanilino)butanoate Chemical compound CC1=CC=C(C=C1)CC=CCOC([C@@H](NC1=CC=C(C=C1)C)C(C)C)=O JGGTXXCKYKKRCA-QFIPXVFZSA-N 0.000 description 1
- SWXFMMWYVSYQGF-UHFFFAOYSA-N 4-(ethylamino)benzoic acid Chemical compound CCNC1=CC=C(C(O)=O)C=C1 SWXFMMWYVSYQGF-UHFFFAOYSA-N 0.000 description 1
- CGBJERXCFISBBL-UHFFFAOYSA-N 4-[3-(bromomethyl)phenoxy]-1,2-dichlorobenzene Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=CC=CC(CBr)=C1 CGBJERXCFISBBL-UHFFFAOYSA-N 0.000 description 1
- OREVCMGFYSUYPX-UHFFFAOYSA-N 4-amino-3-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1Cl OREVCMGFYSUYPX-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- AKDPHEYBBWDWCM-UHFFFAOYSA-N 4-chloro-2,6-difluoroaniline Chemical compound NC1=C(F)C=C(Cl)C=C1F AKDPHEYBBWDWCM-UHFFFAOYSA-N 0.000 description 1
- MKFCYQTVSDCXAQ-UHFFFAOYSA-N 4-chloro-2-fluoro-1-methylbenzene Chemical compound CC1=CC=C(Cl)C=C1F MKFCYQTVSDCXAQ-UHFFFAOYSA-N 0.000 description 1
- ACMJJQYSPUPMPN-UHFFFAOYSA-N 4-chloro-3-fluoroaniline Chemical compound NC1=CC=C(Cl)C(F)=C1 ACMJJQYSPUPMPN-UHFFFAOYSA-N 0.000 description 1
- FOHHWGVAOVDVLP-UHFFFAOYSA-N 4-chloro-3-nitroaniline Chemical compound NC1=CC=C(Cl)C([N+]([O-])=O)=C1 FOHHWGVAOVDVLP-UHFFFAOYSA-N 0.000 description 1
- UBXDNWVNEZBDBN-UHFFFAOYSA-N 4-cyclopropylaniline Chemical compound C1=CC(N)=CC=C1C1CC1 UBXDNWVNEZBDBN-UHFFFAOYSA-N 0.000 description 1
- IMPPGHMHELILKG-UHFFFAOYSA-N 4-ethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1 IMPPGHMHELILKG-UHFFFAOYSA-N 0.000 description 1
- KMHLGVTVACLEJE-UHFFFAOYSA-N 4-fluoro-2-methylaniline Chemical compound CC1=CC(F)=CC=C1N KMHLGVTVACLEJE-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- ISFGTDAAYLSOFY-UHFFFAOYSA-N 4-hydroxy-3-methyl-2-prop-2-ynylcyclopent-2-en-1-one Chemical compound CC1=C(CC#C)C(=O)CC1O ISFGTDAAYLSOFY-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- UTKUVRNVYFTEHF-UHFFFAOYSA-N 4-nitro-3-(trifluoromethyl)aniline Chemical compound NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 UTKUVRNVYFTEHF-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- MLGPTVZSEHBYTG-UHFFFAOYSA-N 4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]-1,3-oxazolidine-2,5-dione Chemical compound O=C1OC(=O)C(C(C)C)N1C1=CC=C(C(F)(F)F)C=C1 MLGPTVZSEHBYTG-UHFFFAOYSA-N 0.000 description 1
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- MPFZPXJNSPNQRL-UHFFFAOYSA-N BrC(C(=O)Cl)CC.BrC(C(=O)Cl)CC(C)C.BrC(C(=O)Cl)C(CC)C Chemical compound BrC(C(=O)Cl)CC.BrC(C(=O)Cl)CC(C)C.BrC(C(=O)Cl)C(CC)C MPFZPXJNSPNQRL-UHFFFAOYSA-N 0.000 description 1
- TVVPZWUOAQNRHV-LBPRGKRZSA-N CC(C)[C@@H](C(O)=O)N(CC)C1=CC=C(Cl)C=C1 Chemical compound CC(C)[C@@H](C(O)=O)N(CC)C1=CC=C(Cl)C=C1 TVVPZWUOAQNRHV-LBPRGKRZSA-N 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZUWHMEUFWMASDI-UHFFFAOYSA-N ClC(C(=O)OCC1=CC(=CC=C1)OC1=CC=CC=C1)CC(Cl)(Cl)Cl.ClC(C(=O)OCC1=CC(=CC=C1)OC1=CC=CC=C1)CCCCl Chemical compound ClC(C(=O)OCC1=CC(=CC=C1)OC1=CC=CC=C1)CC(Cl)(Cl)Cl.ClC(C(=O)OCC1=CC(=CC=C1)OC1=CC=CC=C1)CCCCl ZUWHMEUFWMASDI-UHFFFAOYSA-N 0.000 description 1
- 241000254171 Curculionidae Species 0.000 description 1
- ZFDIRQKJPRINOQ-HWKANZROSA-N Ethyl crotonate Chemical compound CCOC(=O)\C=C\C ZFDIRQKJPRINOQ-HWKANZROSA-N 0.000 description 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- SOQDSYGZFNQNQT-UHFFFAOYSA-N FC=1C=C(N)C=CC1C(F)(F)F.NC1=CC(=C(C=C1)C(F)(F)F)F Chemical compound FC=1C=C(N)C=CC1C(F)(F)F.NC1=CC(=C(C=C1)C(F)(F)F)F SOQDSYGZFNQNQT-UHFFFAOYSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 238000010468 Hell-Volhard-Zelinsky reaction Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- IGRURXZWJCSNKU-UHFFFAOYSA-N Isopropenylacetic acid Chemical compound CC(=C)CC(O)=O IGRURXZWJCSNKU-UHFFFAOYSA-N 0.000 description 1
- AGPKZVBTJJNPAG-WHFBIAKZSA-N L-isoleucine Chemical compound CC[C@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-WHFBIAKZSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- MNSGOOCAMMSKGI-UHFFFAOYSA-N N-(hydroxymethyl)phthalimide Chemical compound C1=CC=C2C(=O)N(CO)C(=O)C2=C1 MNSGOOCAMMSKGI-UHFFFAOYSA-N 0.000 description 1
- 241000238887 Ornithodoros Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 1
- SZJQXQICJDHRJE-UHFFFAOYSA-N [3-(bromomethyl)phenyl]-phenylmethanone Chemical compound BrCC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 SZJQXQICJDHRJE-UHFFFAOYSA-N 0.000 description 1
- RYULULVJWLRDQH-UHFFFAOYSA-N [4-(bromomethyl)phenyl]-phenylmethanone Chemical compound C1=CC(CBr)=CC=C1C(=O)C1=CC=CC=C1 RYULULVJWLRDQH-UHFFFAOYSA-N 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 210000001142 back Anatomy 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 229960005286 carbaryl Drugs 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 210000000038 chest Anatomy 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 1
- 230000006196 deacetylation Effects 0.000 description 1
- 238000003381 deacetylation reaction Methods 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- 229950001327 dichlorvos Drugs 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- CHDFNIZLAAFFPX-UHFFFAOYSA-N ethoxyethane;oxolane Chemical compound CCOCC.C1CCOC1 CHDFNIZLAAFFPX-UHFFFAOYSA-N 0.000 description 1
- QFIFUKSTZGHSFY-UHFFFAOYSA-N ethyl 2-(4-chloroanilino)-3,3-dimethylbutanoate Chemical compound CCOC(=O)C(C(C)(C)C)NC1=CC=C(Cl)C=C1 QFIFUKSTZGHSFY-UHFFFAOYSA-N 0.000 description 1
- IODMJRFLLIWQIX-UHFFFAOYSA-N ethyl 2-anilino-3-hydroxybutanoate Chemical compound CCOC(=O)C(C(C)O)NC1=CC=CC=C1 IODMJRFLLIWQIX-UHFFFAOYSA-N 0.000 description 1
- AKEFSKQAKBVCGG-UHFFFAOYSA-N ethyl 3,3,3-trichloro-2-oxopropanoate Chemical compound CCOC(=O)C(=O)C(Cl)(Cl)Cl AKEFSKQAKBVCGG-UHFFFAOYSA-N 0.000 description 1
- KJHQVUNUOIEYSV-UHFFFAOYSA-N ethyl 3,3,3-trifluoro-2-oxopropanoate Chemical compound CCOC(=O)C(=O)C(F)(F)F KJHQVUNUOIEYSV-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- FYQGBXGJFWXIPP-UHFFFAOYSA-N hydroprene Chemical compound CCOC(=O)C=C(C)C=CCC(C)CCCC(C)C FYQGBXGJFWXIPP-UHFFFAOYSA-N 0.000 description 1
- 229930000073 hydroprene Natural products 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 239000002949 juvenile hormone Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229930001540 kinoprene Natural products 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- UPRXAOPZPSAYHF-UHFFFAOYSA-N lithium;cyclohexyl(propan-2-yl)azanide Chemical compound CC(C)N([Li])C1CCCCC1 UPRXAOPZPSAYHF-UHFFFAOYSA-N 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229930002897 methoprene Natural products 0.000 description 1
- 229950003442 methoprene Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- LRTFPLFDLJYEKT-UHFFFAOYSA-N para-isopropylaniline Chemical compound CC(C)C1=CC=C(N)C=C1 LRTFPLFDLJYEKT-UHFFFAOYSA-N 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 1
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical class CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 1
- 229940070846 pyrethrins Drugs 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 239000012066 reaction slurry Substances 0.000 description 1
- VEMKTZHHVJILDY-FIWHBWSRSA-N resmethrin Chemical compound CC1(C)[C@H](C=C(C)C)C1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-FIWHBWSRSA-N 0.000 description 1
- 229940108410 resmethrin Drugs 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000526 short-path distillation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical class [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Chemical group 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- ZFDIRQKJPRINOQ-UHFFFAOYSA-N transbutenic acid ethyl ester Natural products CCOC(=O)C=CC ZFDIRQKJPRINOQ-UHFFFAOYSA-N 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- 125000006493 trifluoromethyl benzyl group Chemical group 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 150000003679 valine derivatives Chemical class 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/34—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D263/44—Two oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/44—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a nitrogen atom attached to the same carbon skeleton by a single or double bond, this nitrogen atom not being a member of a derivative or of a thio analogue of a carboxylic group, e.g. amino-carboxylic acids
- A01N37/46—N-acyl derivatives
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having no bond to a nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US77988677A | 1977-03-21 | 1977-03-21 | |
US82494777A | 1977-08-15 | 1977-08-15 | |
US05/878,091 US4243819A (en) | 1978-02-16 | 1978-02-16 | Substituted amino acids |
Publications (2)
Publication Number | Publication Date |
---|---|
IE780552L IE780552L (en) | 1978-09-21 |
IE46787B1 true IE46787B1 (en) | 1983-09-21 |
Family
ID=27419755
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
IE552/78A IE46787B1 (en) | 1977-03-21 | 1978-03-20 | Esters and thiolesters of amino acids,processes for their production, and compositions including them |
Country Status (14)
Country | Link |
---|---|
JP (1) | JPS53121731A (nl) |
AR (1) | AR221332A1 (nl) |
BG (1) | BG60495B2 (nl) |
CA (1) | CA1147745A (nl) |
CH (1) | CH632232A5 (nl) |
DE (1) | DE2812169A1 (nl) |
DK (1) | DK154642C (nl) |
FR (2) | FR2405922A1 (nl) |
GB (1) | GB1588111A (nl) |
IE (1) | IE46787B1 (nl) |
IL (1) | IL54293A (nl) |
KE (1) | KE3413A (nl) |
NL (1) | NL193021C (nl) |
NZ (1) | NZ186688A (nl) |
Families Citing this family (12)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3005201A1 (de) * | 1979-03-02 | 1980-09-11 | Zoecon Corp | Neue ester und thiolester von n-phenylsubstituierten valinderivaten |
DE2915026A1 (de) * | 1979-04-12 | 1980-10-30 | Bayer Ag | N,n-disubstituierte ethylglycin (thiol)ester, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
US4224330A (en) * | 1979-09-13 | 1980-09-23 | Zoecon Corporation | Esters and thiolesters of benzothienyl acids |
US4260633A (en) | 1980-04-21 | 1981-04-07 | Zoecon Corporation | Pesticidal esters of amino acids |
US4259348A (en) | 1980-05-02 | 1981-03-31 | Zoecon Corporation | Pesticidal esters of amino acids |
US4260782A (en) * | 1980-06-09 | 1981-04-07 | Ciba-Geigy Corporation | Process for the preparation of N-(1'-alkoxycarbonylethyl)-2,6-dialkylanilines |
US4267356A (en) * | 1980-06-09 | 1981-05-12 | Ciba-Geigy Corporation | Process for the preparation of N-(1'-alkoxycarbonylethyl)-2,6-dialkylanilines |
AU559413B2 (en) * | 1981-01-26 | 1987-03-12 | Novartis Ag | Emulsion concentrates of synthetic pyrethroids |
ATE50244T1 (de) * | 1984-11-05 | 1990-02-15 | Sandoz Ag | Aminosaeureester. |
JPS62111903A (ja) * | 1985-11-11 | 1987-05-22 | Nippon Kayaku Co Ltd | 殺虫組成物 |
DE3737986A1 (de) * | 1987-11-09 | 1989-05-18 | Bayer Ag | Fluor und/oder chlor enthaltende trifluormethylaminobenzole und deren herstellung |
WO2023203038A1 (en) | 2022-04-19 | 2023-10-26 | Syngenta Crop Protection Ag | Insect, acarina and nematode pest control |
Family Cites Families (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
IT1065062B (it) * | 1975-08-08 | 1985-02-25 | Hoffmann La Roche | Esteri di acidi alfa arilossicar bossilici sostituiti |
DE2647368A1 (de) * | 1975-10-23 | 1977-05-05 | Ciba Geigy Ag | Alpha-(1-pyrrolyl)-carbonsaeure-3- phenoxy-benzylester, verfahren zu ihrer herstellung und ihre verwendung |
JPS5852987B2 (ja) * | 1976-02-17 | 1983-11-26 | 大日本除虫菊株式会社 | アニリノアセテ−ト誘導体 |
DE2753605A1 (de) * | 1976-12-01 | 1978-06-08 | Dainippon Jochugiku Kk | Isovaleriansaeureesterderivate sowie optische und geometrische isomere davon |
JP3108953B2 (ja) * | 1992-04-01 | 2000-11-13 | セイコーエプソン株式会社 | 光磁気信号検出器及び記録再生装置 |
JPH05291833A (ja) * | 1992-04-08 | 1993-11-05 | Yokogawa Electric Corp | ピーク値測定回路 |
-
1978
- 1978-03-07 GB GB9026/78A patent/GB1588111A/en not_active Expired
- 1978-03-08 CA CA000298515A patent/CA1147745A/en not_active Expired
- 1978-03-14 NZ NZ186688A patent/NZ186688A/xx unknown
- 1978-03-15 IL IL54293A patent/IL54293A/xx unknown
- 1978-03-16 AR AR271452A patent/AR221332A1/es active
- 1978-03-20 JP JP3226378A patent/JPS53121731A/ja active Granted
- 1978-03-20 CH CH302178A patent/CH632232A5/fr not_active IP Right Cessation
- 1978-03-20 IE IE552/78A patent/IE46787B1/en not_active IP Right Cessation
- 1978-03-20 DE DE19782812169 patent/DE2812169A1/de active Granted
- 1978-03-20 FR FR7808047A patent/FR2405922A1/fr active Granted
- 1978-03-21 NL NL7803030A patent/NL193021C/nl not_active IP Right Cessation
- 1978-03-21 DK DK127278A patent/DK154642C/da active Protection Beyond IP Right Term
- 1978-08-24 FR FR7824616A patent/FR2392959A1/fr not_active Withdrawn
-
1984
- 1984-06-12 KE KE3413A patent/KE3413A/xx unknown
-
1994
- 1994-02-14 BG BG098476A patent/BG60495B2/bg unknown
Also Published As
Publication number | Publication date |
---|---|
DK127278A (da) | 1978-09-22 |
IL54293A0 (en) | 1978-06-15 |
DE2812169C2 (nl) | 1991-10-17 |
FR2405922A1 (fr) | 1979-05-11 |
BG60495B2 (bg) | 1995-05-31 |
NL193021C (nl) | 1998-08-04 |
NL7803030A (nl) | 1978-09-25 |
IE780552L (en) | 1978-09-21 |
JPS53121731A (en) | 1978-10-24 |
JPS623146B2 (nl) | 1987-01-23 |
DE2812169A1 (de) | 1978-10-05 |
NZ186688A (en) | 1980-11-14 |
CH632232A5 (en) | 1982-09-30 |
FR2392959A1 (fr) | 1978-12-29 |
KE3413A (en) | 1984-07-13 |
GB1588111A (en) | 1981-04-15 |
IL54293A (en) | 1982-08-31 |
DK154642B (da) | 1988-12-05 |
CA1147745A (en) | 1983-06-07 |
FR2405922B1 (nl) | 1984-03-30 |
AR221332A1 (es) | 1981-01-30 |
DK154642C (da) | 1989-06-19 |
NL193021B (nl) | 1998-04-01 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4411912A (en) | Insecticidal isovaleric acid esters | |
SU1075974A3 (ru) | Способ получени гетероциклических соединений | |
US4199595A (en) | M-phenoxybenzyl and α-cyano-M-phenoxybenzyl esters of 2-haloalkyl (oxy-, thio-, sulfinyl-, or sulfonyl)phenylalkanoic acids | |
IE46787B1 (en) | Esters and thiolesters of amino acids,processes for their production, and compositions including them | |
JPH0759556B2 (ja) | ピラゾール系化合物 | |
HU206074B (en) | Insecticidal and acaricidal compositions comprising cyclopropyl-substituted diaryl compounds as active ingredient and process for producing the active ingredients | |
JPS6411627B2 (nl) | ||
JPS62175451A (ja) | 殺虫活性のあるヒドラジン類 | |
US4110345A (en) | 2,2-Difluoro-1,3-benzodioxole-5-(α-alkyl)-acetic acids, and their use for the preparation of insecticides and acaricides | |
BE865114A (fr) | Esters et thiolesters d'acides amines, procede d'obtention et application a titre pesticides. | |
JPS5943458B2 (ja) | アニリン誘導体及びその製法並びに該化合物を有効成分とする微生物防除剤 | |
HU182016B (en) | Insecticide composition containing phenyl-alcancarboxylic acid derivative and process for preparing the active substance | |
US5064847A (en) | 5-substituted 3-arylisoxazole derivatives, their preparation and their use as pesticides | |
KR860002107B1 (ko) | α, α-디메틸페닐초산 아닐리드 유도체의 제조방법 | |
IE44423B1 (en) | Phenoxyphenoxy-alkane carboxylic acid derivatives, process for their preparation and compositions containing them | |
JPH04290865A (ja) | 殺虫性、殺ダニ性ジアリールピロールカーボニトリルとジアリールニトロピロール化合物 | |
JPH04211065A (ja) | 3−置換フェニルピラゾール誘導体又はその塩類及びその用途 | |
JPS6030301B2 (ja) | シクロプロパンカルボン酸3−(2,2−ジクロロビニルオキシ)ベンジルエステル、その製造方法及び該化合物を含有する殺虫、殺ダニ剤 | |
CA1126735A (en) | 3'-(substituted phenyl)-spiro[isobenzofuran-1(3h), 5'(4'h)-isoxazol]-3-ones and their use as herbicides and plant growth regulants | |
HU201648B (en) | Compositions for destroying molluscs, comprising acidamide derivatives as active ingredient | |
SU999970A3 (ru) | Способ получени гетероциклических соединений | |
US4267359A (en) | Novel carboxylic acid esters | |
JPS5940830B2 (ja) | アニリン誘導体、その製造方法および該化合物を含有する殺微生物剤並びにそれによる防除方法 | |
JP2599964B2 (ja) | カルバメート誘導体及びこれを有効成分として含有する除草剤 | |
CA2058401A1 (en) | Process for the manufacture of insecticidal 2-aryl-1-(alkoxymethyl)-4-halo-5-(trifluoromethyl) pyrroles |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
MK9A | Patent expired |