IE46001B1 - Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivatives - Google Patents
Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivativesInfo
- Publication number
- IE46001B1 IE46001B1 IE245377A IE245377A IE46001B1 IE 46001 B1 IE46001 B1 IE 46001B1 IE 245377 A IE245377 A IE 245377A IE 245377 A IE245377 A IE 245377A IE 46001 B1 IE46001 B1 IE 46001B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- formula
- carbon atoms
- represent
- atoms
- Prior art date
Links
- ZYEWRBNSDKQNSJ-UHFFFAOYSA-N 5-methyl-n-phenyl-1,2-oxazole-4-carboxamide Chemical class O1N=CC(C(=O)NC=2C=CC=CC=2)=C1C ZYEWRBNSDKQNSJ-UHFFFAOYSA-N 0.000 title claims abstract description 12
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 9
- 238000006243 chemical reaction Methods 0.000 claims abstract description 7
- 239000002253 acid Substances 0.000 claims description 16
- -1 methylenedioxy group Chemical group 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 239000011230 binding agent Substances 0.000 claims description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- VPKDCDLSJZCGKE-UHFFFAOYSA-N carbodiimide group Chemical group N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 2
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical group [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 claims 1
- VQBXUKGMJCPBMF-UHFFFAOYSA-N 5-methyl-1,2-oxazole-4-carboxylic acid Chemical class CC=1ON=CC=1C(O)=O VQBXUKGMJCPBMF-UHFFFAOYSA-N 0.000 abstract description 4
- 238000002360 preparation method Methods 0.000 abstract description 2
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 abstract 1
- 230000001760 anti-analgesic effect Effects 0.000 abstract 1
- 230000003110 anti-inflammatory effect Effects 0.000 abstract 1
- 230000003389 potentiating effect Effects 0.000 abstract 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical class CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLIAQPCKUPLGJA-UHFFFAOYSA-N (4-bromophenyl) 5-methyl-1,2-oxazole-4-carboxylate Chemical compound O1N=CC(C(=O)OC=2C=CC(Br)=CC=2)=C1C YLIAQPCKUPLGJA-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- YMSOVEUZDOFJFC-UHFFFAOYSA-N O1N=CC(C(=O)N(C=2C=CC=CC=2)C(F)(F)F)=C1C Chemical compound O1N=CC(C(=O)N(C=2C=CC=CC=2)C(F)(F)F)=C1C YMSOVEUZDOFJFC-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000002843 carboxylic acid group Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- LGVXPSMGABFXST-UHFFFAOYSA-N phenyl 5-methyl-1,2-oxazole-4-carboxylate Chemical class C1(=CC=CC=C1)OC(=O)C=1C=NOC=1C LGVXPSMGABFXST-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/18—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762654797 DE2654797A1 (de) | 1976-12-03 | 1976-12-03 | Verfahren zur herstellung von isoxazolderivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE46001L IE46001L (en) | 1978-06-03 |
| IE46001B1 true IE46001B1 (en) | 1983-01-26 |
Family
ID=5994582
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE245377A IE46001B1 (en) | 1976-12-03 | 1977-12-02 | Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivatives |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5371068A (cg-RX-API-DMAC7.html) |
| AT (1) | AT361917B (cg-RX-API-DMAC7.html) |
| BE (1) | BE861500R (cg-RX-API-DMAC7.html) |
| CA (1) | CA1095056A (cg-RX-API-DMAC7.html) |
| CH (1) | CH609341A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2654797A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK538777A (cg-RX-API-DMAC7.html) |
| ES (1) | ES464533A2 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2381756A2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1572309A (cg-RX-API-DMAC7.html) |
| IE (1) | IE46001B1 (cg-RX-API-DMAC7.html) |
| IT (1) | IT1089430B (cg-RX-API-DMAC7.html) |
| LU (1) | LU78614A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7713083A (cg-RX-API-DMAC7.html) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0035285A3 (en) * | 1979-08-17 | 1981-10-14 | American Cyanamid Company | Novel isoxazole carboxylic acid phenyl esters, pharmaceutical compositions containing certain of said esters, and process for preparing said esters |
| JPS55500866A (cg-RX-API-DMAC7.html) * | 1978-11-03 | 1980-10-30 | ||
| DE2854439A1 (de) * | 1978-12-16 | 1980-07-03 | Hoechst Ag | Ein isoxazolderivat, verfahren zu seiner herstellung, diese verbindung enthaltende mittel und verwendung |
| DE2854438A1 (de) * | 1978-12-16 | 1980-07-03 | Hoechst Ag | Isoxazolderivate, verfahren zu ihrer herstellung, diese verbindungen enthaltende mittel und ihre verwendung |
| IL60269A (en) * | 1979-06-11 | 1983-12-30 | Ciba Geigy | Alpha-carbamoyl-pyrrolpropionitriles,their preparation and pharmaceutical compositions containing them |
| DE3247454A1 (de) * | 1982-12-22 | 1984-06-28 | Laboratorios Bago S.A., Buenos Aires | Substituierte 3-phenyl-5-methyl-isoxazol-4-carboxy-anilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| GB8619432D0 (en) * | 1986-08-08 | 1986-09-17 | Lilly Industries Ltd | Pharmaceutical compounds |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL178596C (nl) * | 1975-06-05 | 1986-04-16 | Hoechst Ag | Werkwijze voor het bereiden van een geneesmiddel met antiflogistische en/of analgetische werking, alsmede werkwijze voor het bereiden van daarin als geneeskrachtige verbindingen te gebruiken 5-methylisoxazool-4-carbonzuuraniliden. |
| DE2525023A1 (de) * | 1975-06-05 | 1976-12-16 | Hoechst Ag | Neue isoxazolderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende fungizide |
-
1976
- 1976-12-03 DE DE19762654797 patent/DE2654797A1/de not_active Withdrawn
-
1977
- 1977-11-15 CH CH1393277A patent/CH609341A5/xx not_active IP Right Cessation
- 1977-11-28 NL NL7713083A patent/NL7713083A/xx not_active Application Discontinuation
- 1977-11-28 ES ES464533A patent/ES464533A2/es not_active Expired
- 1977-12-01 LU LU78614A patent/LU78614A1/xx unknown
- 1977-12-01 IT IT3028677A patent/IT1089430B/it active
- 1977-12-02 CA CA292,253A patent/CA1095056A/en not_active Expired
- 1977-12-02 FR FR7736424A patent/FR2381756A2/fr active Granted
- 1977-12-02 DK DK538777A patent/DK538777A/da not_active Application Discontinuation
- 1977-12-02 IE IE245377A patent/IE46001B1/en unknown
- 1977-12-02 AT AT866177A patent/AT361917B/de not_active IP Right Cessation
- 1977-12-02 GB GB5034277A patent/GB1572309A/en not_active Expired
- 1977-12-03 JP JP14561977A patent/JPS5371068A/ja active Pending
- 1977-12-05 BE BE183167A patent/BE861500R/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2381756B2 (cg-RX-API-DMAC7.html) | 1982-10-29 |
| CH609341A5 (en) | 1979-02-28 |
| DK538777A (da) | 1978-06-04 |
| FR2381756A2 (fr) | 1978-09-22 |
| IE46001L (en) | 1978-06-03 |
| DE2654797A1 (de) | 1978-06-08 |
| ATA866177A (de) | 1980-09-15 |
| NL7713083A (nl) | 1978-06-06 |
| LU78614A1 (cg-RX-API-DMAC7.html) | 1978-07-14 |
| JPS5371068A (en) | 1978-06-24 |
| IT1089430B (it) | 1985-06-18 |
| AT361917B (de) | 1981-04-10 |
| ES464533A2 (es) | 1979-10-16 |
| BE861500R (fr) | 1978-06-05 |
| GB1572309A (en) | 1980-07-30 |
| CA1095056A (en) | 1981-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1082202A (en) | Cyano acetic acid anilide derivatives, process for their manufacture and compositions containing these compounds | |
| US4327222A (en) | 3,4-Diarylisoxazol-5-acetic acids and process for making same | |
| GB2087870A (en) | Urea derivatives | |
| PL164432B1 (pl) | Sposób wytwarzania nowych pochodnych aminofenolu PL | |
| ITMI20010042A1 (it) | Composti di eteri e di ammidi e loro preparazione come antidiabetici | |
| JPH0733729A (ja) | N−シアノ−n′−置換−アリールカルボキシイミダミド化合物の製造法 | |
| IE46001B1 (en) | Process for the manufacture of 5-methyl isoxazole-4-carboxylic acid anilide derivatives | |
| US5371099A (en) | Phenyl carboxamide isoxazoles | |
| US4165428A (en) | Indoleacetic acid ester derivatives | |
| IE46102B1 (en) | 5-methylisoxazole-4-carboxylic acid anilides having pharmaceutical activity | |
| US4236012A (en) | 5-Phenethyl-2-oxazolidone derivatives and a process for producing the same | |
| US4226802A (en) | 2-(4-Trifluoromethylphenylamino)-3-methylbutanoic acid esters and intermediates therefor | |
| JPH0841030A (ja) | 1−(ヘテロ)アリール−3−ヒドロキシピラゾールの製造方法 | |
| US3985765A (en) | Phenyl- and (substituted)-phenyl-1,2,3-triazole-alkanoic and -alkenoic acids | |
| US4018817A (en) | 6-Halo-5-cyclohexylindan-1-carbohydroxamic acid | |
| KR800001145B1 (ko) | 이속사졸 유도체의 제조 방법 | |
| EP0012435A2 (de) | Isoxazolderivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Arzneimittel und bei dem Verfahren benötigte Zwischenprodukte | |
| US4350815A (en) | Process for the production of 4,6-diamino-5-cyano-3-aryl-isoxazolo [5,4-b]p | |
| US3948932A (en) | Phenyl- and (substituted)-phenyl-1,2,3-triazole-alkanoic and -alkenoic acids | |
| JP2010090124A (ja) | ヘテロ環置換チオフェノール化合物の製造中間体および製造法 | |
| US4482561A (en) | Therapeutically effective piperidyl N-(4-quinolyl)-anthraniloyloxyalkanoates | |
| US3703513A (en) | Novel 3,5-dioxopyrazolidine derivatives | |
| JPS5927343B2 (ja) | 3−アミノイソオキサゾ−ル類の合成法 | |
| US5476940A (en) | 3-substituted quinoline-5-carboxylic acids | |
| US3948930A (en) | Phenyl-and (substituted)-phenyl-1,2,3-triazole-alkanoic and- alkenoic acids |