IE44869B1 - Isoxazole derivatives - Google Patents
Isoxazole derivativesInfo
- Publication number
- IE44869B1 IE44869B1 IE643/77A IE64377A IE44869B1 IE 44869 B1 IE44869 B1 IE 44869B1 IE 643/77 A IE643/77 A IE 643/77A IE 64377 A IE64377 A IE 64377A IE 44869 B1 IE44869 B1 IE 44869B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- formula
- composition
- alkyl
- amino
- Prior art date
Links
- 150000002545 isoxazoles Chemical class 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 claims abstract description 41
- 238000000034 method Methods 0.000 claims abstract description 37
- -1 substituted-phenyl group Chemical group 0.000 claims abstract description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 13
- 230000002411 adverse Effects 0.000 claims abstract description 9
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 9
- 230000000694 effects Effects 0.000 claims abstract description 8
- 230000002538 fungal effect Effects 0.000 claims abstract description 6
- 150000001875 compounds Chemical class 0.000 claims description 112
- 241000196324 Embryophyta Species 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 11
- 125000001246 bromo group Chemical group Br* 0.000 claims description 10
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- WBXCXSNKEGVCFO-UHFFFAOYSA-N [[bromo(chloro)amino]-chlorohydrazinylidene]-sulfanylidenemethane Chemical compound BrN(N(Cl)N=C=S)Cl WBXCXSNKEGVCFO-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- TWDAWKIAUQCSLF-UHFFFAOYSA-N [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methanamine Chemical compound O1C(CN)=CC(C=2C=CC(Cl)=CC=2)=N1 TWDAWKIAUQCSLF-UHFFFAOYSA-N 0.000 claims description 4
- 239000000428 dust Substances 0.000 claims description 4
- 230000002401 inhibitory effect Effects 0.000 claims description 4
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 4
- YGCXXYLQISERCR-UHFFFAOYSA-N 5-(bromomethyl)-3-(4-chlorophenyl)-1,2-oxazole Chemical compound C1=CC(Cl)=CC=C1C1=NOC(CBr)=C1 YGCXXYLQISERCR-UHFFFAOYSA-N 0.000 claims description 3
- ANRMBFFXQKJEIS-UHFFFAOYSA-N 5-(bromomethyl)-3-phenyl-1,2-oxazole Chemical compound O1C(CBr)=CC(C=2C=CC=CC=2)=N1 ANRMBFFXQKJEIS-UHFFFAOYSA-N 0.000 claims description 3
- BTNNNJHRJAQJIU-UHFFFAOYSA-N 5-(isothiocyanatomethyl)-3-phenyl-1,2-oxazole Chemical compound O1C(CN=C=S)=CC(C=2C=CC=CC=2)=N1 BTNNNJHRJAQJIU-UHFFFAOYSA-N 0.000 claims description 3
- FQHPYWLMGXNZPT-UHFFFAOYSA-N C1N(C2)CN3CN2C[N+]1(Cl)C3 Chemical compound C1N(C2)CN3CN2C[N+]1(Cl)C3 FQHPYWLMGXNZPT-UHFFFAOYSA-N 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 2
- 241001281803 Plasmopara viticola Species 0.000 claims description 2
- 241000219094 Vitaceae Species 0.000 claims description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims description 2
- 235000021021 grapes Nutrition 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000004563 wettable powder Substances 0.000 claims description 2
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 239000012141 concentrate Substances 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 239000000047 product Substances 0.000 description 31
- 238000012360 testing method Methods 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- 239000006185 dispersion Substances 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 201000010099 disease Diseases 0.000 description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 12
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 240000006365 Vitis vinifera Species 0.000 description 6
- 235000021028 berry Nutrition 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 6
- 239000004312 hexamethylene tetramine Substances 0.000 description 6
- 235000009754 Vitis X bourquina Nutrition 0.000 description 5
- 235000012333 Vitis X labruscana Nutrition 0.000 description 5
- 235000014787 Vitis vinifera Nutrition 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 241001465180 Botrytis Species 0.000 description 4
- 240000007594 Oryza sativa Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 241000233679 Peronosporaceae Species 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000007810 chemical reaction solvent Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000004495 emulsifiable concentrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000002054 inoculum Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 2
- 241000209443 Ceratophyllum demersum Species 0.000 description 2
- 241001157813 Cercospora Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- 244000052355 Hydrilla verticillata Species 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- 244000207740 Lemna minor Species 0.000 description 2
- 235000006439 Lemna minor Nutrition 0.000 description 2
- 244000070406 Malus silvestris Species 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- 241000606856 Pasteurella multocida Species 0.000 description 2
- 241000233622 Phytophthora infestans Species 0.000 description 2
- 241000233626 Plasmopara Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000021536 Sugar beet Nutrition 0.000 description 2
- IPUFALKBRMMZII-UHFFFAOYSA-N [amino(chloro)hydrazinylidene]-sulfanylidenemethane Chemical compound N(=C=S)N(Cl)N IPUFALKBRMMZII-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 235000021186 dishes Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 125000001810 isothiocyanato group Chemical group *N=C=S 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 229940051027 pasteurella multocida Drugs 0.000 description 2
- 239000001965 potato dextrose agar Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- AQZLTCXQTOKUAA-UHFFFAOYSA-N (3-phenyl-1,2-oxazol-5-yl)methanamine Chemical compound O1C(CN)=CC(C=2C=CC=CC=2)=N1 AQZLTCXQTOKUAA-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- JXMPZLAZFWCPMI-UHFFFAOYSA-N 3-(furan-2-yl)-4-nitro-4,5-dihydro-1,2-oxazole Chemical class [O-][N+](=O)C1CON=C1C1=CC=CO1 JXMPZLAZFWCPMI-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- XDVYMOJPTKBZDW-UHFFFAOYSA-N 4-amino-1,2-oxazole-3-carboxylic acid Chemical class NC1=CON=C1C(O)=O XDVYMOJPTKBZDW-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- 241000607528 Aeromonas hydrophila Species 0.000 description 1
- 241000228197 Aspergillus flavus Species 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- 241000222178 Candida tropicalis Species 0.000 description 1
- 241000588919 Citrobacter freundii Species 0.000 description 1
- 241000222235 Colletotrichum orbiculare Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000375722 Cyperus eriocauloides Species 0.000 description 1
- 241000194032 Enterococcus faecalis Species 0.000 description 1
- 241000588694 Erwinia amylovora Species 0.000 description 1
- 241000896222 Erysiphe polygoni Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000588915 Klebsiella aerogenes Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241000204022 Mycoplasma gallisepticum Species 0.000 description 1
- 241000204045 Mycoplasma hyopneumoniae Species 0.000 description 1
- 241000202938 Mycoplasma hyorhinis Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 241000221671 Ophiostoma ulmi Species 0.000 description 1
- 235000010617 Phaseolus lunatus Nutrition 0.000 description 1
- 235000001855 Portulaca oleracea Nutrition 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000589774 Pseudomonas sp. Species 0.000 description 1
- 241000589771 Ralstonia solanacearum Species 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000392514 Salmonella enterica subsp. enterica serovar Dublin Species 0.000 description 1
- 241000293869 Salmonella enterica subsp. enterica serovar Typhimurium Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000223238 Trichophyton Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- MHQHMMLKXGSJCH-UHFFFAOYSA-N [3-(4-bromophenyl)-1,2-oxazol-5-yl]methanamine Chemical compound O1C(CN)=CC(C=2C=CC(Br)=CC=2)=N1 MHQHMMLKXGSJCH-UHFFFAOYSA-N 0.000 description 1
- PSMOKIROUDLQEV-UHFFFAOYSA-N [3-(4-chlorophenyl)-1,2-oxazol-5-yl]methylcarbamic acid Chemical compound O1C(CNC(=O)O)=CC(C=2C=CC(Cl)=CC=2)=N1 PSMOKIROUDLQEV-UHFFFAOYSA-N 0.000 description 1
- MOFLNZGDBYVUPF-UHFFFAOYSA-N [3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-5-yl]methanamine Chemical compound O1C(CN)=CC(C=2C=CC(=CC=2)C(F)(F)F)=N1 MOFLNZGDBYVUPF-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- DOZZESQBLWOEBQ-UHFFFAOYSA-N chlorohydrazine Chemical compound NNCl DOZZESQBLWOEBQ-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229940092559 enterobacter aerogenes Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- MDXBVNYOXKYAOA-UHFFFAOYSA-N ethyl n-[(3-phenyl-1,2-oxazol-5-yl)methyl]carbamate Chemical compound O1C(CNC(=O)OCC)=CC(C=2C=CC=CC=2)=N1 MDXBVNYOXKYAOA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003854 isothiazoles Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000004452 microanalysis Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- OVPLZYJGTGDFNB-UHFFFAOYSA-N propan-2-yl carbamate Chemical compound CC(C)OC(N)=O OVPLZYJGTGDFNB-UHFFFAOYSA-N 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052903 pyrophyllite Inorganic materials 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/695,669 US4109002A (en) | 1976-06-14 | 1976-06-14 | Fungicidal 3-phenyl-5-(substituted methyl) isoxaxoles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE44869L IE44869L (en) | 1977-12-14 |
| IE44869B1 true IE44869B1 (en) | 1982-04-21 |
Family
ID=24793998
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE643/77A IE44869B1 (en) | 1976-06-14 | 1977-03-28 | Isoxazole derivatives |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4109002A (enExample) |
| JP (1) | JPS52154525A (enExample) |
| BE (1) | BE855603A (enExample) |
| CA (1) | CA1081120A (enExample) |
| CH (1) | CH626229A5 (enExample) |
| DE (1) | DE2723688A1 (enExample) |
| FR (1) | FR2354708A1 (enExample) |
| GB (1) | GB1580462A (enExample) |
| IE (1) | IE44869B1 (enExample) |
| IL (1) | IL51779A (enExample) |
| IT (1) | IT1075840B (enExample) |
| NL (1) | NL7706559A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4247322A (en) * | 1979-10-01 | 1981-01-27 | Monsanto Company | 3-(m-Trifluoromethylphenyl)-5-halomethyl isoxazoles as safening agents |
| WO1992018908A1 (en) * | 1991-04-11 | 1992-10-29 | Agfa-Gevaert N.V. | Electrophotographic developer composition |
| US6576633B1 (en) | 1996-02-22 | 2003-06-10 | The Dow Chemical Company | Stable liquid antimicrobial suspension compositions containing quarternaries prepared from hexamethylenetetramine and certain halohydrocarbons |
| WO2003074501A1 (en) * | 2002-03-07 | 2003-09-12 | Sds Biotech K.K. | Substituted isoxazole alkylamine derivative and agri- and horticultural fungicide |
| CN117510429A (zh) * | 2023-10-23 | 2024-02-06 | 中国农业大学 | 一种含甲基异恶唑结构的化合物及其制备方法和应用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2946720A (en) * | 1957-05-13 | 1960-07-26 | Monsanto Chemicals | Method of treating nematodes by treating with a heterocyclic methyl isothiocyanate |
| GB1164510A (en) | 1967-06-15 | 1969-09-17 | Ici Ltd | Novel Isoxazole Derivatives, the preparation thereof, and Compositions containing the same |
| NL137326C (enExample) * | 1967-08-26 | |||
| GB1245238A (en) * | 1967-12-04 | 1971-09-08 | Imp Chemicals Ltd | New isoxazolyl derivatives and compositions containing them |
| US3781438A (en) * | 1972-03-27 | 1973-12-25 | Fmc Corp | Arylisoxazoles as nematicides |
| FR2215219A1 (en) | 1973-01-26 | 1974-08-23 | Roussel Uclaf | Thiocarbamoylthioamides - with bactericidal and fungicidal activity for use in medicine and in agriculture |
| US3869466A (en) * | 1973-07-30 | 1975-03-04 | Dow Chemical Co | 4-cyano-3,5-isothiazolediylbis(thiomethylene)dithiocyanate |
-
1976
- 1976-06-14 US US05/695,669 patent/US4109002A/en not_active Expired - Lifetime
-
1977
- 1977-03-28 IE IE643/77A patent/IE44869B1/en unknown
- 1977-03-29 IL IL51779A patent/IL51779A/xx unknown
- 1977-03-30 CA CA275,149A patent/CA1081120A/en not_active Expired
- 1977-04-27 IT IT22889/77A patent/IT1075840B/it active
- 1977-05-25 DE DE19772723688 patent/DE2723688A1/de not_active Withdrawn
- 1977-06-01 CH CH673677A patent/CH626229A5/de not_active IP Right Cessation
- 1977-06-09 GB GB24260/77A patent/GB1580462A/en not_active Expired
- 1977-06-10 BE BE1008186A patent/BE855603A/xx unknown
- 1977-06-13 FR FR7718051A patent/FR2354708A1/fr active Granted
- 1977-06-13 JP JP7043377A patent/JPS52154525A/ja active Pending
- 1977-06-14 NL NL7706559A patent/NL7706559A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52154525A (en) | 1977-12-22 |
| FR2354708A1 (fr) | 1978-01-13 |
| FR2354708B1 (enExample) | 1979-10-12 |
| IE44869L (en) | 1977-12-14 |
| CH626229A5 (enExample) | 1981-11-13 |
| IT1075840B (it) | 1985-04-22 |
| IL51779A0 (en) | 1977-05-31 |
| CA1081120A (en) | 1980-07-08 |
| GB1580462A (en) | 1980-12-03 |
| DE2723688A1 (de) | 1977-12-22 |
| IL51779A (en) | 1980-06-30 |
| US4109002A (en) | 1978-08-22 |
| NL7706559A (nl) | 1977-12-16 |
| BE855603A (fr) | 1977-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP4936623B2 (ja) | 殺菌剤 | |
| EP1178039B1 (fr) | Dérivés de phényl(thio)urées et phényl(thio)carbamates fongicides | |
| HU185231B (en) | Pesticide composition and process for preparing new pyridyl-aniline derivatives applicable as the active substances of the composition | |
| US4135910A (en) | Oxadiazol-3-yl-benzoates as plant growth regulants | |
| JPH04230670A (ja) | 有害生物防除剤 | |
| SK282027B6 (sk) | Oxímétery, spôsob a medziprodukt ich prípravy, mikrobicídne prostriedky, ktoré ich obsahujú | |
| US4283403A (en) | Substituted isoxazolines for control of plant phytopathogens | |
| IE44869B1 (en) | Isoxazole derivatives | |
| JPH06172348A (ja) | 有害生物防除剤 | |
| US4203994A (en) | Fungicidal 3-phenyl-5-(substituted methyl)isoxazoles | |
| US4569690A (en) | 3-Aryl-5,6-dihydro-1,4,2-oxathiazines and their oxides | |
| HU176020B (en) | Herbicide composition containing n-/4-benzyl-oxy-phenyl/-n'-methyl-n'-methoxy-carbamide and process for preparing the active substance | |
| JPS6147835B2 (enExample) | ||
| CZ423897A3 (cs) | Bis-oximderiváty triazolinu a isoxazolinu, způsob jejich přípravy a meziprodukty v tomto způsobu, pesticidní prostředky, které je obsahují, a jejich použití | |
| SK54197A3 (en) | Benzisoxazole derivatives, preparation method thereof, pesticidal compositions containing them and their use for the control of pests | |
| JPH08507053A (ja) | ピリミジン誘導体および有害生物防除剤としてのそれらの使用方法 | |
| CA1082185A (en) | Substituted isoxazolines for control of plant phytopathogens | |
| US4001227A (en) | Tetrazolo- and triazolobenzothiazines | |
| KR960009116B1 (ko) | 시아노아세트아미드 유도체, 그의 제조방법 및 그것을 유효 성분으로 함유하는 식물병 예방제 | |
| CN113402426B (zh) | N-取代-3,3-二甲基-2-氧代丁磺酰胺化合物及其制备方法和应用 | |
| US4331669A (en) | Fungicidal pyridyl arylureas, compositions containing them and method of controlling fungi and bacteria | |
| KR100427262B1 (ko) | 살균활성을 가지는 유황함유 메톡시 아크릴레이트 유도체 | |
| EP0104940A1 (en) | 3-Aryl-5,6-dihydro-1,4,2-oxathiazines and their oxides | |
| US3721679A (en) | 1,3-disubstituted-2-trichloromethyl-5-imino-4-imidazolidinones | |
| RU2794339C1 (ru) | 2-Алкилтио-5-(1,2,4-триазол-1-илметил)-1,3,4-оксадиазолы, способ их получения и фунгицидные композиции на их основе |