IE44607B1 - Cephalosporin compounds - Google Patents
Cephalosporin compoundsInfo
- Publication number
- IE44607B1 IE44607B1 IE557/76A IE55776A IE44607B1 IE 44607 B1 IE44607 B1 IE 44607B1 IE 557/76 A IE557/76 A IE 557/76A IE 55776 A IE55776 A IE 55776A IE 44607 B1 IE44607 B1 IE 44607B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- carboxylic acid
- cephem
- compound according
- tetrazol
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims abstract description 14
- 229940124587 cephalosporin Drugs 0.000 title claims abstract description 14
- -1 Cephalosporin compounds Chemical class 0.000 title claims description 48
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical class SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 claims abstract description 32
- 150000001780 cephalosporins Chemical class 0.000 claims abstract description 8
- 230000010933 acylation Effects 0.000 claims abstract description 5
- 238000005917 acylation reaction Methods 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims description 72
- 239000002253 acid Substances 0.000 claims description 55
- 238000000034 method Methods 0.000 claims description 33
- 229910052739 hydrogen Inorganic materials 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 8
- 231100000252 nontoxic Toxicity 0.000 claims description 8
- 230000003000 nontoxic effect Effects 0.000 claims description 8
- 239000008194 pharmaceutical composition Substances 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000006239 protecting group Chemical group 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 claims description 3
- 208000035143 Bacterial infection Diseases 0.000 claims description 3
- 208000022362 bacterial infectious disease Diseases 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 208000015181 infectious disease Diseases 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 claims 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims 1
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 abstract description 11
- 238000006467 substitution reaction Methods 0.000 abstract description 5
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 239000003242 anti bacterial agent Substances 0.000 abstract 1
- 229940088710 antibiotic agent Drugs 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- 229910001868 water Inorganic materials 0.000 description 38
- 239000000203 mixture Substances 0.000 description 37
- 239000000243 solution Substances 0.000 description 35
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 229910052799 carbon Inorganic materials 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 18
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 17
- 235000017557 sodium bicarbonate Nutrition 0.000 description 17
- 239000011541 reaction mixture Substances 0.000 description 16
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- 238000001914 filtration Methods 0.000 description 11
- 229920001429 chelating resin Polymers 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 159000000000 sodium salts Chemical class 0.000 description 10
- 239000008346 aqueous phase Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- HCPVYBCAYPMANM-UHFFFAOYSA-N 2-(1,3-dioxoisoindol-2-yl)ethanesulfonyl chloride Chemical compound C1=CC=C2C(=O)N(CCS(=O)(=O)Cl)C(=O)C2=C1 HCPVYBCAYPMANM-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 229960003080 taurine Drugs 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- OBESRABRARNZJB-UHFFFAOYSA-N aminomethanesulfonic acid Chemical compound NCS(O)(=O)=O OBESRABRARNZJB-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- DPZNOMCNRMUKPS-UHFFFAOYSA-N 1,3-Dimethoxybenzene Chemical compound COC1=CC=CC(OC)=C1 DPZNOMCNRMUKPS-UHFFFAOYSA-N 0.000 description 2
- JAXFQRFUWURHNT-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)ethanesulfonic acid Chemical compound OS(=O)(=O)CCN1N=NN=C1S JAXFQRFUWURHNT-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NJVWBSNUDITJDJ-UHFFFAOYSA-N 5-aminopentane-1-sulfonic acid Chemical compound NCCCCCS(O)(=O)=O NJVWBSNUDITJDJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001782 cephems Chemical class 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- IDCIUQDJMOCJKU-UHFFFAOYSA-N methyl n-[2-(tert-butylsulfamoyl)ethyl]carbamodithioate Chemical compound CSC(=S)NCCS(=O)(=O)NC(C)(C)C IDCIUQDJMOCJKU-UHFFFAOYSA-N 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- BKLJNEFEKPGWSY-UHFFFAOYSA-M potassium;3-(methylsulfanylcarbothioylamino)propane-1-sulfonate Chemical compound [K+].CSC(=S)NCCCS([O-])(=O)=O BKLJNEFEKPGWSY-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 150000003536 tetrazoles Chemical group 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- MBEMFMVWDXXCHH-SBXXRYSUSA-N (6r)-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C=1C=CSC=1CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NN=NN1CS(O)(=O)=O MBEMFMVWDXXCHH-SBXXRYSUSA-N 0.000 description 1
- SIJIOIRVLVCJRS-UHFFFAOYSA-N (methylsulfanylcarbothioylamino)methanesulfonic acid Chemical compound CSC(=S)NCS(O)(=O)=O SIJIOIRVLVCJRS-UHFFFAOYSA-N 0.000 description 1
- LFUHYWFRVFTWEE-UHFFFAOYSA-N 10-(5-sulfanylidene-2h-tetrazol-1-yl)decane-1-sulfonamide Chemical compound NS(=O)(=O)CCCCCCCCCCN1NN=NC1=S LFUHYWFRVFTWEE-UHFFFAOYSA-N 0.000 description 1
- OWWCDGHHHQANOM-UHFFFAOYSA-N 10-aminodecane-1-sulfonic acid Chemical compound NCCCCCCCCCCS(O)(=O)=O OWWCDGHHHQANOM-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- QSIPESHACLDKKR-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-tetrazol-1-yl)ethanesulfonamide Chemical compound NS(=O)(=O)CCN1N=NN=C1S QSIPESHACLDKKR-UHFFFAOYSA-N 0.000 description 1
- IQPXOOMMSTUJTR-UHFFFAOYSA-N 2-(methylsulfanylcarbothioylamino)ethanesulfonic acid Chemical compound CSC(=S)NCCS(O)(=O)=O IQPXOOMMSTUJTR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XDZZQMNDCFNREN-UHFFFAOYSA-N 2-azaniumylpropane-1-sulfonate Chemical compound CC(N)CS(O)(=O)=O XDZZQMNDCFNREN-UHFFFAOYSA-N 0.000 description 1
- AJYXPNIENRLELY-UHFFFAOYSA-N 2-thiophen-2-ylacetyl chloride Chemical compound ClC(=O)CC1=CC=CS1 AJYXPNIENRLELY-UHFFFAOYSA-N 0.000 description 1
- RDXUBBUYWZAROQ-UHFFFAOYSA-N 3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonyl chloride Chemical compound C1=CC=C2C(=O)N(CCCS(=O)(=O)Cl)C(=O)C2=C1 RDXUBBUYWZAROQ-UHFFFAOYSA-N 0.000 description 1
- GLOPCRRWMPCIKF-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propane-1-sulfonamide Chemical compound NS(=O)(=O)CCCN1N=NN=C1S GLOPCRRWMPCIKF-UHFFFAOYSA-N 0.000 description 1
- YAJISZZJOACFSY-UHFFFAOYSA-N 3-(5-sulfanylidene-2h-tetrazol-1-yl)propane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCN1N=NN=C1S YAJISZZJOACFSY-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- IWKLLXDRVSRRCR-UHFFFAOYSA-N 5-(5-sulfanylidene-2h-tetrazol-1-yl)pentane-1-sulfonic acid Chemical compound OS(=O)(=O)CCCCCN1N=NN=C1S IWKLLXDRVSRRCR-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 101100277337 Arabidopsis thaliana DDM1 gene Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- NBUPKZPQBKHTFQ-UHFFFAOYSA-N C(C)(C)(C)NS(=O)=O.NCCC Chemical compound C(C)(C)(C)NS(=O)=O.NCCC NBUPKZPQBKHTFQ-UHFFFAOYSA-N 0.000 description 1
- WRIODUOHHZGPIX-UHFFFAOYSA-M CC(CS([O-])(=O)=O)NC(SC)=S.[K+] Chemical compound CC(CS([O-])(=O)=O)NC(SC)=S.[K+] WRIODUOHHZGPIX-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CJORJJVJEUJVJD-UHFFFAOYSA-N Cl.C(C)(C)(C)NS(=O)=O.NCC Chemical compound Cl.C(C)(C)(C)NS(=O)=O.NCC CJORJJVJEUJVJD-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- IPLPOQJHYPQMEH-UHFFFAOYSA-N N-tert-butyl-3-(1,3-dioxoisoindol-2-yl)propane-1-sulfonamide Chemical compound C(C)(C)(C)NS(=O)(=O)CCCN1C(C=2C(C1=O)=CC=CC2)=O IPLPOQJHYPQMEH-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- DULREPCWOQXZMY-GILAUPEISA-M [Na+].FC(F)(F)CC(=S)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CCS(N)(=O)=O)C(=O)[O-])C1=O Chemical compound [Na+].FC(F)(F)CC(=S)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CCS(N)(=O)=O)C(=O)[O-])C1=O DULREPCWOQXZMY-GILAUPEISA-M 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- VUFGUVLLDPOSBC-XRZFDKQNSA-M cephalothin sodium Chemical compound [Na+].N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C([O-])=O)C(=O)CC1=CC=CS1 VUFGUVLLDPOSBC-XRZFDKQNSA-M 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 101150113676 chr1 gene Proteins 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- LZTRERIOLQLJJS-POEUQKCMSA-L disodium (6R)-8-oxo-3-[[1-(sulfonatomethyl)tetrazol-5-yl]sulfanylmethyl]-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].[Na+].S1C(=CC=C1)CC(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=NN2CS(=O)(=O)[O-])C(=O)[O-])C1=O LZTRERIOLQLJJS-POEUQKCMSA-L 0.000 description 1
- PXCXMTKJRYTWQE-UHFFFAOYSA-L disodium;(5-sulfanylidene-2h-tetrazol-1-yl)methanesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)CN1NN=NC1=S.[O-]S(=O)(=O)CN1NN=NC1=S PXCXMTKJRYTWQE-UHFFFAOYSA-L 0.000 description 1
- NAXFZVGOZUWLEP-WEUCUGKOSA-L disodium;(6r)-7-[[(2r)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-[[1-(sulfonatomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [Na+].[Na+].S([C@@H]1C(C(N1C=1C([O-])=O)=O)NC(=O)[C@H](O)C=2C=CC=CC=2)CC=1CSC1=NN=NN1CS([O-])(=O)=O NAXFZVGOZUWLEP-WEUCUGKOSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- AJXOQEQKQPBLKG-UHFFFAOYSA-M potassium (methylsulfanylcarbothioylamino)methanesulfonate Chemical compound [K+].S(=O)(=O)([O-])CNC(SC)=S AJXOQEQKQPBLKG-UHFFFAOYSA-M 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- MVJHKSNLHSUNRA-UHFFFAOYSA-M potassium;5-(methylsulfanylcarbothioylamino)pentane-1-sulfonate Chemical compound [K+].CSC(=S)NCCCCCS([O-])(=O)=O MVJHKSNLHSUNRA-UHFFFAOYSA-M 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- ICDOJLHGNRCMRX-UHFFFAOYSA-M sodium;(5-sulfanylidene-2h-tetrazol-1-yl)methanesulfonate Chemical compound [Na]OS(=O)(=O)CN1N=NN=C1S ICDOJLHGNRCMRX-UHFFFAOYSA-M 0.000 description 1
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IE1253/80A IE44609B1 (en) | 1975-03-18 | 1976-03-16 | Tetrazole-5-thiols |
| IE1252/80A IE44608B1 (en) | 1975-03-18 | 1976-03-16 | 7-aminocephalosporin derivatives |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55960975A | 1975-03-18 | 1975-03-18 | |
| US64739476A | 1976-01-08 | 1976-01-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE44607L IE44607L (en) | 1976-09-18 |
| IE44607B1 true IE44607B1 (en) | 1982-01-27 |
Family
ID=27072108
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE557/76A IE44607B1 (en) | 1975-03-18 | 1976-03-16 | Cephalosporin compounds |
Country Status (13)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4066762A (en) * | 1976-07-12 | 1978-01-03 | Smithkline Corporation | Derivatives of 7-(2-substituted-2-hydroxyiminoacetamido)-3-(1-substituted tetrazol-5-ylthiomethyl-3-cephem-4-carboxylic acid |
| US4112086A (en) * | 1976-11-02 | 1978-09-05 | Smithkline Corporation | 7β-Acylamino-3-(phosphonoalkyl and esterified phosphonoalkyl substituted tetrazolylthiomethyl)cephalosporins |
| FR2377848A1 (fr) * | 1977-01-25 | 1978-08-18 | Ceramospray Establishment | Machine pour projeter des fibres minerales et ceramiques |
| DE2724092A1 (de) * | 1977-05-27 | 1978-12-07 | Smithkline Corp | Cephalosporine, verfahren zu deren herstellung und diese verbindungen enthaltende arzneimittel |
| IT1265341B1 (it) * | 1993-07-16 | 1996-11-22 | Farmabios Srl | Procedimento per la preparazione di cefalosporine |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3641021A (en) * | 1969-04-18 | 1972-02-08 | Lilly Co Eli | 3 7-(ring-substituted) cephalosporin compounds |
| JPS5442994B1 (enrdf_load_stackoverflow) * | 1971-07-29 | 1979-12-17 | ||
| GB1478055A (en) * | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
-
1976
- 1976-03-16 JP JP51029040A patent/JPS51115493A/ja active Granted
- 1976-03-16 IE IE557/76A patent/IE44607B1/en unknown
- 1976-03-17 GB GB42761/77A patent/GB1547475A/en not_active Expired
- 1976-03-17 DE DE2660579A patent/DE2660579C2/de not_active Expired
- 1976-03-17 GB GB10728/76A patent/GB1547473A/en not_active Expired
- 1976-03-17 GB GB42760/77A patent/GB1547474A/en not_active Expired
- 1976-03-17 LU LU74586A patent/LU74586A1/xx unknown
- 1976-03-17 CH CH332976A patent/CH630633A5/de not_active IP Right Cessation
- 1976-03-17 CY CY1142A patent/CY1142A/xx unknown
- 1976-03-17 DE DE2611270A patent/DE2611270C2/de not_active Expired
- 1976-03-17 AU AU12097/76A patent/AU497053B2/en not_active Expired
- 1976-03-17 DE DE2660578A patent/DE2660578C2/de not_active Expired
- 1976-03-18 NL NLAANVRAGE7602854,A patent/NL178321C/xx not_active IP Right Cessation
- 1976-03-18 FR FR7607842A patent/FR2304343A1/fr active Granted
- 1976-11-18 FR FR7634794A patent/FR2347370A1/fr active Granted
- 1976-11-18 FR FR7634788A patent/FR2347355A1/fr active Granted
-
1978
- 1978-10-12 JP JP53126030A patent/JPS596308B2/ja not_active Expired
-
1982
- 1982-03-17 KE KE3195A patent/KE3195A/xx unknown
- 1982-03-18 HK HK123/82A patent/HK12382A/xx unknown
- 1982-12-30 MY MY264/82A patent/MY8200264A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7602854A (nl) | 1976-09-21 |
| FR2347370B1 (enrdf_load_stackoverflow) | 1979-08-17 |
| NL178321B (nl) | 1985-10-01 |
| JPS51115493A (en) | 1976-10-12 |
| KE3195A (en) | 1982-04-02 |
| GB1547474A (en) | 1979-06-20 |
| IE44607L (en) | 1976-09-18 |
| FR2304343B1 (enrdf_load_stackoverflow) | 1979-09-07 |
| CY1142A (en) | 1982-09-10 |
| GB1547475A (en) | 1979-06-20 |
| FR2347370A1 (fr) | 1977-11-04 |
| NL178321C (nl) | 1986-03-03 |
| FR2347355A1 (fr) | 1977-11-04 |
| DE2611270C2 (de) | 1982-12-30 |
| AU497053B2 (en) | 1978-11-23 |
| JPS5459278A (en) | 1979-05-12 |
| MY8200264A (en) | 1982-12-31 |
| DE2611270A1 (de) | 1976-09-30 |
| FR2347355B1 (enrdf_load_stackoverflow) | 1980-05-23 |
| HK12382A (en) | 1982-03-26 |
| DE2660579C2 (de) | 1985-07-04 |
| CH630633A5 (en) | 1982-06-30 |
| GB1547473A (en) | 1979-06-20 |
| FR2304343A1 (fr) | 1976-10-15 |
| JPS55397B2 (enrdf_load_stackoverflow) | 1980-01-08 |
| DE2660578C2 (de) | 1984-09-13 |
| AU1209776A (en) | 1977-09-22 |
| LU74586A1 (enrdf_load_stackoverflow) | 1976-09-01 |
| JPS596308B2 (ja) | 1984-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3989694A (en) | 7-Acyl-3-(substituted triazolyl thiomethyl)cephalosporins | |
| US4048311A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins | |
| US4068073A (en) | 7-Amino intermediates for preparing 7-acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins | |
| US4286089A (en) | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins | |
| IE44607B1 (en) | Cephalosporin compounds | |
| US4220644A (en) | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins | |
| US4245107A (en) | Cephalosporin derivatives and process for preparing the same | |
| US4139701A (en) | 7-Amino-3-(sulfonic acid and sulfamoyl substituted tetrazolythiomethyl)cephalosporin intermediates | |
| US4101656A (en) | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| EP0584797A2 (en) | Novel cephalosporin compounds and processes for the preparation thereof | |
| US4112088A (en) | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins | |
| IE41899B1 (en) | 7 -methoxycephalosporins | |
| US4159373A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins | |
| US4131734A (en) | 7β-Acyloxy-3-heterocyclicthiomethyl cephalosporins | |
| US4126682A (en) | 7-acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins and antibacterial compositions and methods employing them | |
| EP0000100B1 (en) | 7-acylamino-3-(1-(2-sulfamoylaminoethyl)-tetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids, a process for their preparation and compositions containing them | |
| US4111981A (en) | Intermediates for preparing substituted phenylglycylcephalosporins | |
| IE41525B1 (en) | Meyhods and compositions for improving subsituded phenylglycephalosporins | |
| EP0006011B1 (en) | Cephalosporins and pharmaceutical compositions containing them | |
| CA1072078A (en) | Cephalosporin compounds | |
| US4171362A (en) | 7-Acylamino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4118491A (en) | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4171368A (en) | 7-Acylamino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US4178288A (en) | Sulfaminoalkyl substituted tetrazole thiol intermediates for preparing cephalosporins | |
| US4171433A (en) | 7-Amino-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporin intermediates for preparing 7-acylamino cephalosporins |