IE44483B1 - Improvements in or relating to carbamyltriazole insecticides - Google Patents
Improvements in or relating to carbamyltriazole insecticidesInfo
- Publication number
- IE44483B1 IE44483B1 IE448/77A IE44877A IE44483B1 IE 44483 B1 IE44483 B1 IE 44483B1 IE 448/77 A IE448/77 A IE 448/77A IE 44877 A IE44877 A IE 44877A IE 44483 B1 IE44483 B1 IE 44483B1
- Authority
- IE
- Ireland
- Prior art keywords
- dimethylcarbamyl
- butyl
- tert
- 4triazole
- triazole
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title abstract description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 21
- 238000000034 method Methods 0.000 claims abstract description 8
- -1 t - butyl Chemical group 0.000 claims abstract description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims abstract description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims abstract description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims abstract description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims abstract 2
- 125000005394 methallyl group Chemical group 0.000 claims abstract 2
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 claims description 10
- 241000238631 Hexapoda Species 0.000 claims description 10
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 230000000749 insecticidal effect Effects 0.000 claims description 4
- 241000254173 Coleoptera Species 0.000 claims description 3
- 241000255777 Lepidoptera Species 0.000 claims description 3
- 241000238814 Orthoptera Species 0.000 claims description 3
- 241000255925 Diptera Species 0.000 claims description 2
- 229960005286 carbaryl Drugs 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 150000003852 triazoles Chemical class 0.000 claims description 2
- 231100001184 nonphytotoxic Toxicity 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 241000489976 Diabrotica undecimpunctata howardi Species 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 241001425390 Aphis fabae Species 0.000 description 3
- 241000462639 Epilachna varivestis Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241001454293 Tetranychus urticae Species 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 241000208236 Tropaeolaceae Species 0.000 description 2
- 235000004424 Tropaeolum majus Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 244000045232 Canavalia ensiformis Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- CVXBEEMKQHEXEN-UHFFFAOYSA-N carbaryl Chemical compound C1=CC=C2C(OC(=O)NC)=CC=CC2=C1 CVXBEEMKQHEXEN-UHFFFAOYSA-N 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical group CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000177 propargylthio group Chemical group [H]C#CC([H])([H])S* 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/662,496 US4160839A (en) | 1976-03-01 | 1976-03-01 | Carbamyltriazole insecticides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE44483L IE44483L (en) | 1977-09-01 |
| IE44483B1 true IE44483B1 (en) | 1981-12-16 |
Family
ID=24657962
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE448/77A IE44483B1 (en) | 1976-03-01 | 1977-03-01 | Improvements in or relating to carbamyltriazole insecticides |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4160839A (enExample) |
| JP (1) | JPS52122625A (enExample) |
| AT (1) | AT350845B (enExample) |
| AU (1) | AU501697B2 (enExample) |
| BE (1) | BE851959A (enExample) |
| BR (1) | BR7701160A (enExample) |
| CA (1) | CA1076122A (enExample) |
| DD (1) | DD128928A5 (enExample) |
| DE (1) | DE2707782A1 (enExample) |
| EG (1) | EG13757A (enExample) |
| FR (1) | FR2342660A1 (enExample) |
| GB (1) | GB1508757A (enExample) |
| GR (1) | GR62560B (enExample) |
| IE (1) | IE44483B1 (enExample) |
| IN (1) | IN146275B (enExample) |
| IT (1) | IT1079488B (enExample) |
| LU (1) | LU76865A1 (enExample) |
| NL (1) | NL7701894A (enExample) |
| PH (1) | PH14427A (enExample) |
| PT (1) | PT66216B (enExample) |
| TR (1) | TR19924A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4291043A (en) * | 1978-09-06 | 1981-09-22 | Ciba-Geigy Corporation | 1-N,N-dimethylcarbamoyl-3(5)-alkyl-5(3)-alkylthioalkylthio-1,2,4-triazoles, a process for their manufacture, compositions which contain them and their use in pest control |
| EP0029407A3 (de) * | 1979-08-21 | 1981-08-26 | Ciba-Geigy Ag | 1-N,N-Dimethylcarbamoyl-3(5)-alkyl-5(3)-alkoxyalkylthio-1,2,4-triazole, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Mittel und ihre Verwendung zur Bekämpfung von Schädlingen sowie ihre Ausgangsprodukte und deren Herstellung |
| US4255435A (en) * | 1980-01-04 | 1981-03-10 | The Boots Company Limited | Triazole compounds |
| DE3439450A1 (de) * | 1984-10-27 | 1986-05-07 | Boehringer Ingelheim KG, 6507 Ingelheim | 1,2,4-triazolo-carbamate und ihre saeureadditionssalze, verfahren zu ihrer herstellung und arzneimittel |
| CA1293505C (en) | 1985-07-25 | 1991-12-24 | Richard Martin Jacobson | 1-dimethylcarbamoyl-3-substituted-5-substituted-1h-1, 2,4-triazoles |
| US4742072A (en) * | 1985-07-25 | 1988-05-03 | Rohm And Haas Company | 1-dimethylcarbamoyl-3-t-butyl-5-substituted-1H-1,2,4-triazoles |
| US5015652A (en) * | 1988-04-04 | 1991-05-14 | Rohm And Haas Company | 1-dimethylcarbamoyl-3-substituted-5-substituted-1H-1,2,4-triazoles |
| US4970224A (en) * | 1988-04-15 | 1990-11-13 | Rohm And Haas Company | 1-dimethylcarbamoyl-3-substituted-5-substituted-1H-1,2,4-triazzoles |
| EP0399553A1 (en) * | 1989-05-26 | 1990-11-28 | SDS Biotech K.K. | Triazole compound and insecticide composition containing the same |
| FR2883875A1 (fr) * | 2005-04-01 | 2006-10-06 | Galderma Res & Dev | Nouveaux inhibiteurs de la tyrosinase, leur procede de preparation et leur utilisation en medecine humaine ainsi qu'en cosmetique |
| WO2006103119A2 (en) * | 2005-04-01 | 2006-10-05 | Galderma Research & Development | Tyrosinase inhibitors, process for the preparation thereof and use thereof in human medicine and also in cosmetics |
| WO2011111077A1 (en) * | 2010-03-12 | 2011-09-15 | Council Of Scientific & Industrial Research | 1, 2, 4-triazole derivatives and their anti mycobacterial activity |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3308131A (en) * | 1962-12-06 | 1967-03-07 | Du Pont | Tertiary carbamyl triazoles |
| US3952001A (en) * | 1970-07-01 | 1976-04-20 | The Boots Company Limited | 1-Carbamoyl-1,2,4-triazoles |
| GB1510636A (en) * | 1974-07-08 | 1978-05-10 | Boots Co Ltd | Substituted 1,2,4-triazoles and insecticidal compositions and uses of them |
-
1976
- 1976-03-01 US US05/662,496 patent/US4160839A/en not_active Expired - Lifetime
-
1977
- 1977-02-17 AU AU22385/77A patent/AU501697B2/en not_active Expired
- 1977-02-21 PT PT66216A patent/PT66216B/pt unknown
- 1977-02-22 NL NL7701894A patent/NL7701894A/xx not_active Application Discontinuation
- 1977-02-22 PH PH19481A patent/PH14427A/en unknown
- 1977-02-23 DE DE19772707782 patent/DE2707782A1/de not_active Withdrawn
- 1977-02-24 CA CA272,548A patent/CA1076122A/en not_active Expired
- 1977-02-25 BR BR7701160A patent/BR7701160A/pt unknown
- 1977-02-25 FR FR7705527A patent/FR2342660A1/fr active Granted
- 1977-02-26 EG EG120/77A patent/EG13757A/xx active
- 1977-02-28 IT IT48242/77A patent/IT1079488B/it active
- 1977-02-28 DD DD7700197600A patent/DD128928A5/xx unknown
- 1977-02-28 TR TR19924A patent/TR19924A/xx unknown
- 1977-02-28 GR GR52867A patent/GR62560B/el unknown
- 1977-02-28 AT AT132977A patent/AT350845B/de not_active IP Right Cessation
- 1977-03-01 JP JP2091477A patent/JPS52122625A/ja active Pending
- 1977-03-01 LU LU76865A patent/LU76865A1/xx unknown
- 1977-03-01 BE BE175370A patent/BE851959A/xx unknown
- 1977-03-01 IE IE448/77A patent/IE44483B1/en unknown
- 1977-03-01 GB GB8477/77A patent/GB1508757A/en not_active Expired
- 1977-04-07 IN IN532/CAL/77A patent/IN146275B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD128928A5 (de) | 1977-12-21 |
| PT66216B (en) | 1978-07-14 |
| IT1079488B (it) | 1985-05-13 |
| TR19924A (tr) | 1980-04-30 |
| JPS52122625A (en) | 1977-10-15 |
| NL7701894A (nl) | 1977-09-05 |
| LU76865A1 (enExample) | 1977-07-12 |
| DE2707782A1 (de) | 1977-09-08 |
| AU501697B2 (en) | 1979-06-28 |
| US4160839A (en) | 1979-07-10 |
| GR62560B (en) | 1979-05-10 |
| IE44483L (en) | 1977-09-01 |
| ATA132977A (de) | 1978-11-15 |
| CA1076122A (en) | 1980-04-22 |
| FR2342660A1 (fr) | 1977-09-30 |
| PH14427A (en) | 1981-07-16 |
| GB1508757A (en) | 1978-04-26 |
| EG13757A (en) | 1982-03-31 |
| FR2342660B1 (enExample) | 1981-03-20 |
| PT66216A (en) | 1977-03-01 |
| BE851959A (fr) | 1977-09-01 |
| BR7701160A (pt) | 1977-11-01 |
| AU2238577A (en) | 1978-08-24 |
| IN146275B (enExample) | 1979-04-07 |
| AT350845B (de) | 1979-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU215695B (hu) | Eljárás N-[(amino-alkil)-karbonil-oxi-metil]-pirrol-származékok előállítására, ezeket hatóanyagként tartalmazó inszekticid, akaricid és molluszkicid készítmények, és eljárás a készítmények alkalmazására | |
| HU186379B (en) | Compoisitons for kiling tree-louse, containing new sulphonyl derivatives as active substances and process for preparing the active substance | |
| DE3013162A1 (de) | N-substituierte tetrahydrophthalimide und herbizide mittel mit einem gehalt derselben | |
| IE44483B1 (en) | Improvements in or relating to carbamyltriazole insecticides | |
| EP0042732A1 (en) | 1-benzoyl-3-substituted ureas and thioureas, their preparation, insecticidal formulations containing them and their use as insecticides | |
| US3686200A (en) | Phosphoric acid esters | |
| DE68917617T2 (de) | Triazolverbindungen, Verfahren zu ihrer Herstellung und diese enthaltende herbizide Zusammensetzungen. | |
| US4863947A (en) | N-aryl-3-aryl-4,5-dihydro-1H-pyrazole-1-carboxamides and methods of their production | |
| DE68908789T2 (de) | Insectizide N'-substituierte-N-alkylcarbonyl-N'-acylhydrazine und N'-substituierte-N-acyl-N'-alkylcarbonyl hydrazine. | |
| EP0213718B1 (en) | 1-dimethylcarbamoyl-3-substituted-5-substituted-1h-1,2,4-triazoles | |
| US4255435A (en) | Triazole compounds | |
| DE2225516C2 (de) | Cyclische 2-Alkylglycerinacetale, Verfahren zu deren Herstellung und ihre Verwendung als Herbicide | |
| US4066774A (en) | Method of killing insects employing a certain triazole | |
| US4220790A (en) | 1-N,N-Dimethylcarbamyl-3-tert.butyl-5-methylthio-1,2,4-triazole | |
| EP0140590B1 (en) | Benzoylureas, and their production and use | |
| IE51860B1 (en) | Insecticidally active acyl-ureas and their manufacture and use | |
| US4205177A (en) | Carbamyltriazole insecticides | |
| US3795680A (en) | 2-trifluoromethylbenzimidazoles | |
| US4038403A (en) | Benzotriazole ovicides and larvicides | |
| EP0396215A1 (de) | 5-Substituierte 3-Arylisoxazol-Derivate, deren Herstellung und Verwendung als Schädlingsbekämpfungsmittel. | |
| EP0018943A1 (de) | 1-Triazolo-N-(phenyl)-azomethin-Derivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Mittel und ihre Verwendung in der Schädlingsbekämpfung | |
| US4226873A (en) | 5-Substituted-3-fluorosulfonyl-4H-1,2,4-triazoles and use as insecticides and miticides | |
| US3355352A (en) | Fungicidal composition | |
| US3925551A (en) | 2-substituted phenylhydrazonoimidazolenine fungicidal and bactericidal agents | |
| US3781446A (en) | Carbamyloxybenzylidenemalononitrile insecticides |