IE42642B1 - Process for the preparation of an ethylene polymer - Google Patents
Process for the preparation of an ethylene polymerInfo
- Publication number
- IE42642B1 IE42642B1 IE353/76A IE35376A IE42642B1 IE 42642 B1 IE42642 B1 IE 42642B1 IE 353/76 A IE353/76 A IE 353/76A IE 35376 A IE35376 A IE 35376A IE 42642 B1 IE42642 B1 IE 42642B1
- Authority
- IE
- Ireland
- Prior art keywords
- salt
- catalyst
- process according
- ethylene
- reactor
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 21
- 230000008569 process Effects 0.000 title claims description 20
- 229920000573 polyethylene Polymers 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims abstract description 44
- 150000003839 salts Chemical class 0.000 claims abstract description 28
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 18
- 239000005977 Ethylene Substances 0.000 claims abstract description 18
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims abstract description 13
- 239000000178 monomer Substances 0.000 claims abstract description 9
- 150000001342 alkaline earth metals Chemical class 0.000 claims abstract description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 5
- 230000009849 deactivation Effects 0.000 claims abstract description 5
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 5
- 239000003513 alkali Substances 0.000 claims abstract description 4
- 239000000725 suspension Substances 0.000 claims abstract description 4
- 238000010924 continuous production Methods 0.000 claims abstract 2
- 229920000642 polymer Polymers 0.000 claims description 17
- 239000010936 titanium Substances 0.000 claims description 16
- 229910052751 metal Inorganic materials 0.000 claims description 12
- 239000002184 metal Substances 0.000 claims description 12
- 239000000470 constituent Substances 0.000 claims description 11
- 229910052719 titanium Inorganic materials 0.000 claims description 11
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical group [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 10
- 229910052782 aluminium Inorganic materials 0.000 claims description 10
- -1 alkaline earth metal salt Chemical class 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 8
- 239000004411 aluminium Substances 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 150000003623 transition metal compounds Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 150000002902 organometallic compounds Chemical class 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 229920001038 ethylene copolymer Polymers 0.000 claims 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims 1
- 235000014113 dietary fatty acids Nutrition 0.000 claims 1
- 229930195729 fatty acid Natural products 0.000 claims 1
- 239000000194 fatty acid Substances 0.000 claims 1
- 150000004665 fatty acids Chemical class 0.000 claims 1
- 238000006116 polymerization reaction Methods 0.000 abstract description 6
- 238000002347 injection Methods 0.000 abstract description 5
- 239000007924 injection Substances 0.000 abstract description 5
- 239000000243 solution Substances 0.000 abstract description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 abstract description 2
- 235000013539 calcium stearate Nutrition 0.000 abstract description 2
- 239000008116 calcium stearate Substances 0.000 abstract description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract description 2
- WEGDVNIPLOLRJC-UHFFFAOYSA-M sodium;naphthalene-1-carboxylate Chemical compound [Na+].C1=CC=C2C(C(=O)[O-])=CC=CC2=C1 WEGDVNIPLOLRJC-UHFFFAOYSA-M 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 description 13
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000004698 Polyethylene Substances 0.000 description 5
- 239000000654 additive Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000009434 installation Methods 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000005234 alkyl aluminium group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- 238000010517 secondary reaction Methods 0.000 description 2
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 2
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910003074 TiCl4 Inorganic materials 0.000 description 1
- 229910052768 actinide Inorganic materials 0.000 description 1
- 150000001255 actinides Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229940078456 calcium stearate Drugs 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- ZTXLZPNGKWQASW-UHFFFAOYSA-L dicalcium octadecanoate Chemical compound C(CCCCCCCCCCCCCCCCC)(=O)[O-].[Ca+2].C(CCCCCCCCCCCCCCCCC)(=O)[O-].[Ca+2] ZTXLZPNGKWQASW-UHFFFAOYSA-L 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N ferric oxide Chemical compound O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000002899 organoaluminium compounds Chemical class 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229940103091 potassium benzoate Drugs 0.000 description 1
- 235000010235 potassium benzoate Nutrition 0.000 description 1
- 239000004300 potassium benzoate Substances 0.000 description 1
- 229940114930 potassium stearate Drugs 0.000 description 1
- ZVUVJTQITHFYHV-UHFFFAOYSA-M potassium;naphthalene-1-carboxylate Chemical compound [K+].C1=CC=C2C(C(=O)[O-])=CC=CC2=C1 ZVUVJTQITHFYHV-UHFFFAOYSA-M 0.000 description 1
- ANBFRLKBEIFNQU-UHFFFAOYSA-M potassium;octadecanoate Chemical compound [K+].CCCCCCCCCCCCCCCCCC([O-])=O ANBFRLKBEIFNQU-UHFFFAOYSA-M 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 235000003441 saturated fatty acids Nutrition 0.000 description 1
- 150000004671 saturated fatty acids Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 229960003885 sodium benzoate Drugs 0.000 description 1
- KQSJSRIUULBTSE-UHFFFAOYSA-M sodium;3-(3-ethylcyclopentyl)propanoate Chemical compound [Na+].CCC1CCC(CCC([O-])=O)C1 KQSJSRIUULBTSE-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229940114926 stearate Drugs 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003608 titanium Chemical class 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F6/00—Post-polymerisation treatments
- C08F6/02—Neutralisation of the polymerisation mass, e.g. killing the catalyst also removal of catalyst residues
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F10/02—Ethene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7506436A FR2302305A1 (fr) | 1975-02-28 | 1975-02-28 | Procede perfectionne de polymerisation et de copolyme |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42642L IE42642L (en) | 1976-08-28 |
| IE42642B1 true IE42642B1 (en) | 1980-09-24 |
Family
ID=9151949
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE353/76A IE42642B1 (en) | 1975-02-28 | 1976-02-23 | Process for the preparation of an ethylene polymer |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4105609A (OSRAM) |
| JP (1) | JPS5936641B2 (OSRAM) |
| BE (1) | BE838992A (OSRAM) |
| BR (1) | BR7601217A (OSRAM) |
| CA (1) | CA1070898A (OSRAM) |
| DE (1) | DE2607601C2 (OSRAM) |
| DK (1) | DK144948C (OSRAM) |
| FR (1) | FR2302305A1 (OSRAM) |
| GB (1) | GB1535568A (OSRAM) |
| IE (1) | IE42642B1 (OSRAM) |
| IT (1) | IT1057639B (OSRAM) |
| LU (1) | LU74422A1 (OSRAM) |
| NL (1) | NL7602132A (OSRAM) |
Families Citing this family (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2460306A1 (fr) * | 1979-07-05 | 1981-01-23 | Charbonnages Ste Chimique | Procede de production de polymeres de l'ethylene et appareil pour sa mise en oeuvre |
| JPS56133347A (en) * | 1980-03-22 | 1981-10-19 | Mitsubishi Petrochem Co Ltd | Polyolefinic resin composition |
| DE3170328D1 (en) * | 1980-12-11 | 1985-06-05 | Du Pont Canada | Deactivation of catalyst in solution process for polymerization of alpha-olefins |
| AU548257B2 (en) * | 1981-06-09 | 1985-12-05 | Du Pont Canada Inc. | Deactivation of alpha olefin catalyst |
| DE3211457A1 (de) * | 1982-03-27 | 1983-09-29 | Ruhrchemie Ag, 4200 Oberhausen | Kontinuierliches verfahren zur polymerisation und copolymerisation von ethylen |
| US4425464A (en) | 1982-05-20 | 1984-01-10 | The Dow Chemical Company | Neutralizing polyethylene catalyst residues |
| JPS58225106A (ja) * | 1982-06-24 | 1983-12-27 | Mitsubishi Petrochem Co Ltd | ポリエチレンの製造法 |
| JPS5922910A (ja) * | 1982-07-29 | 1984-02-06 | Sumitomo Chem Co Ltd | エチレン重合体またはエチレン共重合体の製造方法 |
| EP0112054B1 (en) * | 1982-11-29 | 1986-10-08 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing polyethylene or an ethylene-alpha-olefin copolymer in which the coordination catalyst is deactivated by a deactivator copolymer |
| FR2538397A1 (fr) * | 1982-12-24 | 1984-06-29 | Charbonnages Ste Chimique | Procede continu de fabrication d'homopolymeres ou de copolymeres de l'ethylene |
| FR2538398B1 (fr) * | 1982-12-24 | 1986-01-24 | Charbonnages Ste Chimique | Procede continu ameliore de fabrication d'homopolymeres ou de copolymeres de l'ethylene |
| FR2538399B1 (fr) * | 1982-12-24 | 1986-06-06 | Charbonnages Ste Chimique | Procede continu perfectionne de fabrication d'homopolymeres ou de copolymeres de l'ethylene |
| DE3305782A1 (de) * | 1983-02-19 | 1984-08-30 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur polymerisation und copolymerisation von ethylen |
| US4900792A (en) * | 1983-06-13 | 1990-02-13 | Allied-Signal Inc. | Crosslinkable polyethylene composition |
| US5030695A (en) * | 1983-06-15 | 1991-07-09 | Exxon Research & Engineering Company | End-capped polymer chains, star and graft copolymers, and process of making same |
| JPS604509A (ja) * | 1983-06-21 | 1985-01-11 | Ube Ind Ltd | エチレンの重合法 |
| DE3335824A1 (de) * | 1983-10-01 | 1985-04-18 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur polymerisation und copolymerisation von ethylen |
| US4558105A (en) * | 1983-12-07 | 1985-12-10 | Chemplex Company | Copolymerization of ethylene |
| EP0148302A1 (en) * | 1984-01-10 | 1985-07-17 | The Dow Chemical Company | Neutralizing polyethylene catalyst residues |
| DE3415527A1 (de) * | 1984-04-26 | 1985-10-31 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur polymerisation und copolymerisation von ethylen |
| US4634744A (en) * | 1985-01-09 | 1987-01-06 | Chemplex Company | Method of catalyst deactivation |
| WO1987003603A1 (en) * | 1985-12-16 | 1987-06-18 | Exxon Research And Engineering Company | End-capped polymer chains, graft and star copolymers, and process of making same |
| US4786717A (en) * | 1986-11-10 | 1988-11-22 | Aristech Chemical Corporation | Deactivation of aluminum alkyls |
| US4818799A (en) * | 1987-11-13 | 1989-04-04 | Shell Oil Company | Process for the in-reactor stabilization of polyolefins |
| US5414034A (en) * | 1993-03-29 | 1995-05-09 | General Electric Company | Processing stabilizer formulations |
| CA2227674C (en) * | 1998-01-21 | 2007-04-24 | Stephen John Brown | Catalyst deactivation |
| US8431096B2 (en) * | 2007-08-27 | 2013-04-30 | Nova Chemicals (International) S.A | Process for high temperature solution polymerization |
| CA2598960C (en) * | 2007-08-27 | 2015-04-07 | Nova Chemicals Corporation | High temperature process for solution polymerization |
| CA2598957C (en) * | 2007-08-27 | 2014-07-15 | Nova Chemicals Corporation | Process for high temperature solution polymerization |
| JP6073818B2 (ja) * | 2011-03-08 | 2017-02-01 | ダウ グローバル テクノロジーズ エルエルシー | エチレン系重合反応中に使用される溶媒を再循環するための方法およびそのためのシステム |
| CA2809718C (en) | 2013-03-15 | 2020-03-24 | Nova Chemicals Corporation | Improved energy utilization in a solution polymerization plant |
| CA2827839C (en) | 2013-09-19 | 2019-12-24 | Nova Chemicals Corporation | A solution polymerization process with improved energy utilization |
| EP3209722B1 (en) | 2014-10-21 | 2025-07-16 | Nova Chemicals (International) S.A. | Ethylene interpolymer product with dilution index |
| EP3209721B1 (en) | 2014-10-21 | 2021-09-22 | Nova Chemicals (International) S.A. | Continuous solution polymerization process |
| CA2868640C (en) | 2014-10-21 | 2021-10-26 | Nova Chemicals Corporation | Solution polymerization process |
| CA2897552C (en) | 2015-07-17 | 2022-08-16 | Nova Chemicals Corporation | Shrink films |
| CA2957706C (en) | 2017-02-13 | 2020-12-15 | Nova Chemicals Corporation | Caps and closures |
| US10442921B2 (en) | 2017-04-19 | 2019-10-15 | Nova Chemicals (International) S.A. | Means for increasing the molecular weight and decreasing the density employing mixed homogeneous catalyst formulations |
| US10442920B2 (en) | 2017-04-19 | 2019-10-15 | Nova Chemicals (International) S.A. | Means for increasing the molecular weight and decreasing the density of ethylene interpolymers employing homogeneous and heterogeneous catalyst formulations |
| US10538654B2 (en) | 2017-04-19 | 2020-01-21 | Nova Chemicals (International) S.A. | Multi reactor solution polymerization, polyethylene and polyethylene film |
| US9963529B1 (en) | 2017-04-19 | 2018-05-08 | Nova Chemicals (International) S.A. | Multi reactor solution polymerization |
| WO2019086987A1 (en) | 2017-11-06 | 2019-05-09 | Nova Chemicals (International) S.A. | Polyolefin preparation process |
| US10995166B2 (en) | 2017-11-07 | 2021-05-04 | Nova Chemicals (International) S.A. | Ethylene interpolymer products and films |
| US20190135960A1 (en) | 2017-11-07 | 2019-05-09 | Nova Chemicals (International) S.A. | Process to manufacture ethylene interpolymer products |
| US10683376B2 (en) | 2017-11-07 | 2020-06-16 | Nova Chemicals (International) S.A. | Manufacturing ethylene interpolymer products at higher production rate |
| WO2019099138A1 (en) | 2017-11-17 | 2019-05-23 | Exxonmobil Chemical Patents Inc. | Method of online cleaning of heater exchangers |
| CA2989212C (en) | 2017-12-18 | 2024-05-14 | Nova Chemicals Corporation | Multistage process for the solution polymerization of ethylene |
| EP3774938B1 (en) * | 2018-03-28 | 2025-03-19 | Dow Global Technologies LLC | Ziegler-natta catalyst deactivation and neutralization |
| US10882987B2 (en) | 2019-01-09 | 2021-01-05 | Nova Chemicals (International) S.A. | Ethylene interpolymer products having intermediate branching |
| MX2022004862A (es) | 2019-11-01 | 2022-05-19 | Nova Chem Int Sa | Polietileno de alta densidad lineal con alta tenacidad y alta resistencia al agrietamiento por tension ambiental (escr). |
| KR102504117B1 (ko) * | 2020-03-24 | 2023-02-24 | 바젤 폴리올레핀 게엠베하 | 현탁 매질의 워크 업을 포함하는 에틸렌 중합체의 제조를 위한 현탁 프로세스 |
| US20240228681A1 (en) | 2020-03-26 | 2024-07-11 | Nova Chemicals (International) S.A. | Nonlinear rheology of ethylene interpolymer compositions |
| KR102872208B1 (ko) | 2020-05-08 | 2025-10-15 | 노바 케미컬즈 (인터내셔널) 소시에테 아노님 | 독특한 용융 흐름 고유 점도 지수(mfivi) 및 낮은 불포화도를 갖는 에틸렌 혼성중합체 생성물 |
| EP4146711A1 (en) | 2020-05-08 | 2023-03-15 | Nova Chemicals (International) S.A. | Ethylene interpolymer products having unique melt flow-intrinsic viscosity (mfivi) and high unsaturation |
| US20230279166A1 (en) | 2020-08-26 | 2023-09-07 | Nova Chemicals (International) S.A. | Ethylene interpolymer products having a melt flow-intrinsic viscosity index (mfivi) |
| EP4431583A1 (fr) | 2023-03-14 | 2024-09-18 | SNF Group | Methode d'injection d'une solution aqueuse de polymere dans une formation souterraine |
| WO2024235431A1 (en) | 2023-05-12 | 2024-11-21 | Nova Chemicals (International) S.A. | Solution-phase polymerization process |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA644406A (en) * | 1955-09-02 | 1962-07-10 | S. Kenyon Allen | Polymer stabilization |
| US2882264A (en) | 1955-10-10 | 1959-04-14 | Dow Chemical Co | Polymerization of ethylene |
| NL213858A (OSRAM) | 1956-01-20 | |||
| US3075959A (en) * | 1957-05-24 | 1963-01-29 | Hoechst Ag | Process of purifying polyolefins |
| FR1190714A (fr) * | 1957-12-13 | 1959-10-14 | Pechiney | Purification de polyoléfines |
| US3009907A (en) * | 1958-09-08 | 1961-11-21 | Hercules Powder Co Ltd | Recovery and purification of polyolefins |
| FR1252417A (fr) | 1959-03-25 | 1961-01-27 | Hoechst Ag | Traitement complémentaire de polyoléfines, améliorant en particulier leur stabilité de teinte |
| FR1310232A (OSRAM) * | 1961-01-09 | 1963-03-06 | ||
| US3164578A (en) * | 1962-07-26 | 1965-01-05 | Du Pont | Recovery process for polyolefins |
| GB1053904A (OSRAM) * | 1964-04-10 | |||
| GB1028957A (en) * | 1965-02-02 | 1966-05-11 | Shell Int Research | The purification of polymers and the resulting polymers |
| US3520866A (en) * | 1966-09-26 | 1970-07-21 | Chevron Res | Preparation of coordination catalyst type polypropylene without subsequent removal of catalyst residue |
| GB1456841A (en) * | 1973-03-29 | 1976-11-24 | Ici Ltd | Ethylene polymerisation |
-
1975
- 1975-02-28 FR FR7506436A patent/FR2302305A1/fr active Granted
-
1976
- 1976-02-23 IE IE353/76A patent/IE42642B1/en unknown
- 1976-02-24 LU LU74422A patent/LU74422A1/xx unknown
- 1976-02-25 DE DE2607601A patent/DE2607601C2/de not_active Expired
- 1976-02-25 US US05/661,414 patent/US4105609A/en not_active Expired - Lifetime
- 1976-02-26 CA CA246,612A patent/CA1070898A/en not_active Expired
- 1976-02-26 DK DK81776A patent/DK144948C/da not_active IP Right Cessation
- 1976-02-26 GB GB7682/76A patent/GB1535568A/en not_active Expired
- 1976-02-26 BR BR7601217A patent/BR7601217A/pt unknown
- 1976-02-27 IT IT67467/76A patent/IT1057639B/it active
- 1976-02-27 BE BE2054850A patent/BE838992A/xx not_active IP Right Cessation
- 1976-02-28 JP JP51021744A patent/JPS5936641B2/ja not_active Expired
- 1976-03-01 NL NL7602132A patent/NL7602132A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK144948C (da) | 1982-11-29 |
| CA1070898A (en) | 1980-01-29 |
| US4105609A (en) | 1978-08-08 |
| NL7602132A (nl) | 1976-08-31 |
| GB1535568A (en) | 1978-12-13 |
| JPS51111282A (en) | 1976-10-01 |
| JPS5936641B2 (ja) | 1984-09-05 |
| LU74422A1 (OSRAM) | 1976-08-13 |
| DK81776A (da) | 1976-08-29 |
| FR2302305A1 (fr) | 1976-09-24 |
| IT1057639B (it) | 1982-03-30 |
| BR7601217A (pt) | 1976-09-14 |
| IE42642L (en) | 1976-08-28 |
| DE2607601C2 (de) | 1984-09-13 |
| DK144948B (da) | 1982-07-12 |
| BE838992A (fr) | 1976-06-16 |
| DE2607601A1 (de) | 1976-09-09 |
| FR2302305B1 (OSRAM) | 1978-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4105609A (en) | Deactivation of catalysts of the ziegler type used for the preparation of polyethylene in high pressure, high temperature processes | |
| US2973344A (en) | Modified polymers | |
| US2882264A (en) | Polymerization of ethylene | |
| US4168361A (en) | Random copolymer of propylene and 1-butene and process for its production | |
| US3932307A (en) | Tetra(neophyl) zirconium and its use in process for the polymerization of olefins | |
| CA1085096A (en) | Method for the production of a low density polyethylene | |
| EP0191220B1 (en) | Method of deactivating ethylene polymerisation catalysts | |
| US4011383A (en) | Tetra(neophyl) zirconium and its use in process for the polymerization of olefins | |
| US3491073A (en) | Process for the polymerization of olefins | |
| US5276115A (en) | Mono-1-olefin polymerization in the presence of hydrogen and a cyclopentadienyl compound | |
| US3200173A (en) | Process for preparing blends of polypropylene with copolymers of ethylene and propylene | |
| US4017525A (en) | Tetra(neophyl) zirconium | |
| US3002961A (en) | Process for the preparation of propylene of high molecular weight | |
| US4351930A (en) | Propylene copolymerization process and product | |
| US3334079A (en) | Polymerization catalyst system consisting of aluminum triethyl, titanium trichloride and a metal cyclopentadienyl | |
| US4308357A (en) | Block copolymerization process and product | |
| US4234716A (en) | Process for the separation of polyolefins manufactured at low pressure | |
| JPS6015410A (ja) | アルフア−オレフイン類の重合体類製造のための溶液法 | |
| US3296237A (en) | Stereospecific polymerization of olefins | |
| US3445443A (en) | Process for the preparation of polyolefins with a transition metal halide-organo aluminum compound catalyst | |
| US3390141A (en) | Copolymerization process | |
| CA1120646A (en) | Catalyst and process for the polymerization of butene-1 | |
| US4342856A (en) | Propylene polymerization process and product | |
| SE449495B (sv) | Kontinuerligt forfarande for framstellning av eten-propen-segmentpolymerer i angfas | |
| US3944529A (en) | Process for the preparation of polybutene-1 |