IE42289B1 - Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino 1,2,4-triazin-5(4h)-one - Google Patents
Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino 1,2,4-triazin-5(4h)-oneInfo
- Publication number
- IE42289B1 IE42289B1 IE2768/75A IE276875A IE42289B1 IE 42289 B1 IE42289 B1 IE 42289B1 IE 2768/75 A IE2768/75 A IE 2768/75A IE 276875 A IE276875 A IE 276875A IE 42289 B1 IE42289 B1 IE 42289B1
- Authority
- IE
- Ireland
- Prior art keywords
- process according
- pinacolone
- moles
- formula
- tert
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 52
- OFKAVNQBCRJBJE-UHFFFAOYSA-N 4-amino-6-tert-butyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC(C)(C)C1=NNC(=S)N(N)C1=O OFKAVNQBCRJBJE-UHFFFAOYSA-N 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 7
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 claims abstract description 50
- 150000001412 amines Chemical class 0.000 claims abstract description 33
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims abstract description 28
- 239000003085 diluting agent Substances 0.000 claims abstract description 18
- 239000007864 aqueous solution Substances 0.000 claims abstract description 17
- IAWVHZJZHDSEOC-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanoic acid Chemical compound CC(C)(C)C(=O)C(O)=O IAWVHZJZHDSEOC-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000011541 reaction mixture Substances 0.000 claims abstract description 14
- -1 alkali metal salt Chemical class 0.000 claims abstract description 13
- LJTFFORYSFGNCT-UHFFFAOYSA-N Thiocarbohydrazide Chemical compound NNC(=S)NN LJTFFORYSFGNCT-UHFFFAOYSA-N 0.000 claims abstract description 12
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 12
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 10
- 239000002253 acid Substances 0.000 claims abstract description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- 239000005864 Sulphur Substances 0.000 claims abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 8
- 239000000460 chlorine Chemical group 0.000 claims abstract description 7
- 238000001914 filtration Methods 0.000 claims abstract description 6
- 230000020477 pH reduction Effects 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052801 chlorine Chemical group 0.000 claims abstract description 5
- 238000010438 heat treatment Methods 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 4
- 239000011707 mineral Substances 0.000 claims abstract description 4
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 238000002955 isolation Methods 0.000 claims abstract description 3
- 238000000746 purification Methods 0.000 claims abstract description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 52
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 4
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 claims description 4
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 claims description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 4
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 claims description 4
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 claims description 4
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 claims description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 claims description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 claims description 3
- 229950011008 tetrachloroethylene Drugs 0.000 claims description 3
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 claims description 2
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- LAWOZCWGWDVVSG-UHFFFAOYSA-N dioctylamine Chemical compound CCCCCCCCNCCCCCCCC LAWOZCWGWDVVSG-UHFFFAOYSA-N 0.000 claims description 2
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 claims description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 2
- SEGJNMCIMOLEDM-UHFFFAOYSA-N n-methyloctan-1-amine Chemical compound CCCCCCCCNC SEGJNMCIMOLEDM-UHFFFAOYSA-N 0.000 claims description 2
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 claims description 2
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 claims description 2
- 229940100684 pentylamine Drugs 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 239000001117 sulphuric acid Substances 0.000 claims description 2
- 235000011149 sulphuric acid Nutrition 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 abstract description 2
- 230000004048 modification Effects 0.000 abstract 1
- 238000012986 modification Methods 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 35
- 239000000243 solution Substances 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 238000001816 cooling Methods 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 5
- 239000012286 potassium permanganate Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- TZKRXCKERSCAQY-UHFFFAOYSA-N 4-amino-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical class NN1C(S)=NN=CC1=O TZKRXCKERSCAQY-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- UDWZXMQIEHAAQT-UHFFFAOYSA-N 1,1-dichloro-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)C(Cl)Cl UDWZXMQIEHAAQT-UHFFFAOYSA-N 0.000 description 1
- FWVNWTNCNWRCOU-UHFFFAOYSA-N 2-hydroxy-3,3-dimethylbutanoic acid Chemical compound CC(C)(C)C(O)C(O)=O FWVNWTNCNWRCOU-UHFFFAOYSA-N 0.000 description 1
- LTVWZBWCELTNGH-UHFFFAOYSA-N 4-amino-3-methylsulfanyl-1,2,4-triazin-5-one Chemical compound CSC1=NN=CC(=O)N1N LTVWZBWCELTNGH-UHFFFAOYSA-N 0.000 description 1
- BRTAAZXLXLRRFH-UHFFFAOYSA-N 4-amino-6-methyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC1=NNC(=S)N(N)C1=O BRTAAZXLXLRRFH-UHFFFAOYSA-N 0.000 description 1
- MYRZHMIBRIKWDO-UHFFFAOYSA-N 4h-triazin-5-one Chemical compound O=C1CN=NN=C1 MYRZHMIBRIKWDO-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000004716 alpha keto acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229920001577 copolymer Chemical compound 0.000 description 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2460889A DE2460889C2 (de) | 1974-12-21 | 1974-12-21 | Verfahren zur Herstellung von 6-tert.-Butyl-3-mercapto-4-amino- 1.2.4-triazin-5(4H)-on |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE42289L IE42289L (en) | 1976-06-21 |
| IE42289B1 true IE42289B1 (en) | 1980-07-16 |
Family
ID=5934283
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2768/75A IE42289B1 (en) | 1974-12-21 | 1975-12-19 | Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino 1,2,4-triazin-5(4h)-one |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4113767A (oth) |
| JP (1) | JPS5910353B2 (oth) |
| BE (1) | BE836860A (oth) |
| BR (1) | BR7508411A (oth) |
| CA (1) | CA1049519A (oth) |
| CH (1) | CH615168A5 (oth) |
| DE (1) | DE2460889C2 (oth) |
| DK (1) | DK143338C (oth) |
| FR (1) | FR2295032A1 (oth) |
| GB (1) | GB1464810A (oth) |
| IE (1) | IE42289B1 (oth) |
| IL (1) | IL48694A (oth) |
| IT (1) | IT1051849B (oth) |
| LU (1) | LU74077A1 (oth) |
| NL (1) | NL7514784A (oth) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4151355A (en) * | 1974-12-21 | 1979-04-24 | Bayer Aktiengesellschaft | Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino-1,2,4-triazin-5(4H)-one |
| US4564704A (en) * | 1976-01-20 | 1986-01-14 | Bayer Aktiengesellschaft | Production of 3,3-dimethyl-2-oxo-butyric acid salt |
| US4898974A (en) * | 1976-01-20 | 1990-02-06 | Bayer Aktiengesellschaft | Production of 3,3-dimethyl-2-oxo-butyric acid salt |
| DE2733180C3 (de) * | 1977-07-22 | 1983-04-14 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von 4-Amino-3-methylmercapto-1,2,4-triazin- 5-on-Derivaten |
| US4308384A (en) * | 1978-09-18 | 1981-12-29 | Glaxo Group Limited | Production of triazinones |
| US4614822A (en) * | 1978-11-13 | 1986-09-30 | Mobay Chemical Corporation | Catalytic oxidation of 3,3-dimethyl-2-hydroxybutyric acid to 2-oxo acid and preparation of 4-amino-6-tert.-butyl-3-thio-1,2,4-triazine-5(4-H)-one |
| US4252944A (en) | 1980-03-24 | 1981-02-24 | Wiley Richard H | 4-Amino-6-(2-carboxyphenyl)-3-mercapto-1,2,4-triazin-5(4H)-one |
-
1974
- 1974-12-21 DE DE2460889A patent/DE2460889C2/de not_active Expired
-
1975
- 1975-10-17 GB GB4263175A patent/GB1464810A/en not_active Expired
- 1975-12-15 US US05/640,830 patent/US4113767A/en not_active Expired - Lifetime
- 1975-12-17 CH CH1635875A patent/CH615168A5/de not_active IP Right Cessation
- 1975-12-18 BR BR7508411*A patent/BR7508411A/pt unknown
- 1975-12-18 NL NL7514784A patent/NL7514784A/xx not_active Application Discontinuation
- 1975-12-19 IT IT30577/75A patent/IT1051849B/it active
- 1975-12-19 IE IE2768/75A patent/IE42289B1/en unknown
- 1975-12-19 FR FR7539063A patent/FR2295032A1/fr active Granted
- 1975-12-19 DK DK581175A patent/DK143338C/da not_active IP Right Cessation
- 1975-12-19 IL IL48694A patent/IL48694A/xx unknown
- 1975-12-19 BE BE162927A patent/BE836860A/xx not_active IP Right Cessation
- 1975-12-19 CA CA242,160A patent/CA1049519A/en not_active Expired
- 1975-12-19 LU LU74077A patent/LU74077A1/xx unknown
- 1975-12-20 JP JP50151258A patent/JPS5910353B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK143338B (da) | 1981-08-10 |
| DE2460889C2 (de) | 1983-06-09 |
| BR7508411A (pt) | 1976-08-24 |
| CH615168A5 (oth) | 1980-01-15 |
| CA1049519A (en) | 1979-02-27 |
| FR2295032A1 (fr) | 1976-07-16 |
| DE2460889A1 (de) | 1976-06-24 |
| DK143338C (da) | 1981-12-21 |
| NL7514784A (nl) | 1976-06-23 |
| JPS5910353B2 (ja) | 1984-03-08 |
| US4113767A (en) | 1978-09-12 |
| FR2295032B1 (oth) | 1980-07-11 |
| BE836860A (fr) | 1976-06-21 |
| LU74077A1 (oth) | 1976-11-11 |
| IL48694A (en) | 1978-12-17 |
| IL48694A0 (en) | 1976-02-29 |
| JPS5188983A (en) | 1976-08-04 |
| GB1464810A (en) | 1977-02-16 |
| IE42289L (en) | 1976-06-21 |
| DK581175A (da) | 1976-06-22 |
| IT1051849B (it) | 1981-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU707177B2 (en) | Process for the preparation of a halosubstituted aromatic acid | |
| IE42289B1 (en) | Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino 1,2,4-triazin-5(4h)-one | |
| US4459424A (en) | Process for the preparation of thiuram disulfides | |
| CA1043354A (en) | Sulfonyl semicarbazides | |
| US4151355A (en) | Process for the preparation of 6-tert.-butyl-3-mercapto-4-amino-1,2,4-triazin-5(4H)-one | |
| US6156906A (en) | Process for the preparation of 5,5'-bi-1H-tetrazole salt | |
| JPH0456831B2 (oth) | ||
| EP0044203A1 (en) | Process for producing 2-mercaptoethylamine hydrohalides | |
| KR100499901B1 (ko) | 피리딜메틸이소티오시아네이트의제조방법 | |
| US5998670A (en) | Method of making high purity substituted diphenyldisulfides | |
| US4620003A (en) | Process for producing 2-quinoxalinols | |
| EP0353944B1 (en) | Aminocarbonyl-substituted pyridinesulfinic acid or salts thereof | |
| KR950008208B1 (ko) | 메르캅토벤조에이트의 제조방법 | |
| US6271415B1 (en) | S-(4-biphenyl)-thiosulphuric acids and their salts, method for producing the same and method for producing 4-mercaptobiphenyls | |
| JPH0625151A (ja) | オルソベンゼンジチオール類の製造方法 | |
| TW201908297A (zh) | 製備3,4-二氯-n-(2-氰苯基)-5-異噻唑羧醯胺之方法 | |
| KR970011007B1 (ko) | 하이드록시에틸술포닐니트로-및 하이드록시에틸술포닐아미노-벤조산 및 이들의 제조방법 | |
| EP0266552A1 (en) | Process for production of isothiocyanates | |
| KR100634076B1 (ko) | 티올카르바메이트 및 티오시아네이트 화합물의 제조방법 | |
| US4375562A (en) | Process for the preparation of bis-(amino-phenyl)-disulphides | |
| KR0129550B1 (ko) | 아미노카르보닐 치환 피리딘술핀산 또는 그의 염 | |
| US20020058820A1 (en) | Process for the preparation of highly pure 5,5' -bi-1H-tetrazolediammonium salts | |
| KR20080031044A (ko) | 3,4-디클로로이소티아졸카복실산의 제조방법 | |
| SK142295A3 (en) | Preparation of n-cyanodithioimino-carbonates and 3-mercapto-5- -amino-1h-1,2,4-triazole | |
| Naud et al. | Preparation of bis-(1 (2) H-tetrazol-5-yl)-amine monohydrate |