IE37423B1 - Substituted-benzofurans - Google Patents
Substituted-benzofuransInfo
- Publication number
- IE37423B1 IE37423B1 IE912/74A IE91272A IE37423B1 IE 37423 B1 IE37423 B1 IE 37423B1 IE 912/74 A IE912/74 A IE 912/74A IE 91272 A IE91272 A IE 91272A IE 37423 B1 IE37423 B1 IE 37423B1
- Authority
- IE
- Ireland
- Prior art keywords
- nitro
- aryl
- give
- benzofuran
- alkyl
- Prior art date
Links
- -1 Substituted-benzofurans Chemical class 0.000 title 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 abstract 4
- 150000001875 compounds Chemical class 0.000 abstract 4
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 abstract 2
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- RBMGLNKKNKTZMZ-UHFFFAOYSA-N 1-(3-nitro-1-benzofuran-2-yl)ethanone Chemical compound [N+](=O)([O-])C1=C(OC2=C1C=CC=C2)C(C)=O RBMGLNKKNKTZMZ-UHFFFAOYSA-N 0.000 abstract 1
- YPXYZKXBZJOITF-UHFFFAOYSA-N 2-(3-nitro-1-benzofuran-2-yl)-2-oxoacetaldehyde Chemical compound [N+](=O)([O-])C1=C(OC2=C1C=CC=C2)C(C=O)=O YPXYZKXBZJOITF-UHFFFAOYSA-N 0.000 abstract 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 abstract 1
- 101150065749 Churc1 gene Proteins 0.000 abstract 1
- 102100038239 Protein Churchill Human genes 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000005018 aryl alkenyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000005015 aryl alkynyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 102000012740 beta Adrenergic Receptors Human genes 0.000 abstract 1
- 108010079452 beta Adrenergic Receptors Proteins 0.000 abstract 1
- 230000000903 blocking effect Effects 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000001907 coumarones Chemical class 0.000 abstract 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 150000004985 diamines Chemical class 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 150000003944 halohydrins Chemical class 0.000 abstract 1
- 238000007327 hydrogenolysis reaction Methods 0.000 abstract 1
- 210000004072 lung Anatomy 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/81—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/80—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1004371 | 1971-04-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| IE37423B1 true IE37423B1 (en) | 1977-07-20 |
Family
ID=9960415
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE912/74A IE37423B1 (en) | 1971-04-20 | 1972-04-05 | Substituted-benzofurans |
| IE435/72A IE37422B1 (en) | 1971-04-20 | 1972-04-05 | Benzofuran derivatives and a process for the manufacture thereof |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE435/72A IE37422B1 (en) | 1971-04-20 | 1972-04-05 | Benzofuran derivatives and a process for the manufacture thereof |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3859279A (enExample) |
| AT (1) | AT313892B (enExample) |
| AU (1) | AU460419B2 (enExample) |
| BE (1) | BE782296A (enExample) |
| DE (1) | DE2217329A1 (enExample) |
| DK (1) | DK130344B (enExample) |
| ES (1) | ES401898A1 (enExample) |
| FR (1) | FR2133982B1 (enExample) |
| GB (1) | GB1346911A (enExample) |
| HU (1) | HU164259B (enExample) |
| IE (2) | IE37423B1 (enExample) |
| IL (1) | IL39126A (enExample) |
| NL (1) | NL7205339A (enExample) |
| TR (1) | TR16784A (enExample) |
| ZA (1) | ZA722073B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3931157A (en) * | 1974-12-18 | 1976-01-06 | American Cyanamid Company | Substituted 2-benzofuranyl propenones and method of preparation |
| US4006234A (en) * | 1974-12-18 | 1977-02-01 | American Cyanamid Company | Substituted 2-benzofuranyl propenones as anti-tubercular agents |
| DE3260490D1 (en) * | 1981-03-31 | 1984-09-06 | Beecham Group Plc | Secondary amines, their preparation, pharmaceutical compositions containing them and their use |
| US4500543A (en) * | 1982-06-01 | 1985-02-19 | Abbott Laboratories | Substituted 1-aminomethyl-phthalans |
| ATE525354T1 (de) | 2004-05-03 | 2011-10-15 | Janssen Pharmaceutica Nv | Benzofuranderivate als selektive androgenrezeptormodulatoren (sarms) |
| JP2009173594A (ja) * | 2008-01-25 | 2009-08-06 | Sumitomo Chemical Co Ltd | アミロイドβタンパク質の蓄積を抑制するための医薬組成物 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2955108A (en) * | 1957-01-07 | 1960-10-04 | Univ Ohio State Res Found | Process for 1,1,1-trisubstituted hydrazinium chlorides |
-
1971
- 1971-02-16 TR TR16784A patent/TR16784A/xx unknown
-
1972
- 1972-03-27 ZA ZA722073A patent/ZA722073B/xx unknown
- 1972-03-30 AU AU40645/72A patent/AU460419B2/en not_active Expired
- 1972-04-03 IL IL39126A patent/IL39126A/xx unknown
- 1972-04-05 IE IE912/74A patent/IE37423B1/xx unknown
- 1972-04-05 IE IE435/72A patent/IE37422B1/xx unknown
- 1972-04-10 US US242808A patent/US3859279A/en not_active Expired - Lifetime
- 1972-04-11 DE DE19722217329 patent/DE2217329A1/de active Pending
- 1972-04-19 ES ES401898A patent/ES401898A1/es not_active Expired
- 1972-04-19 BE BE782296A patent/BE782296A/xx unknown
- 1972-04-19 AT AT342972A patent/AT313892B/de not_active IP Right Cessation
- 1972-04-19 DK DK192672AA patent/DK130344B/da unknown
- 1972-04-20 HU HUHO1475A patent/HU164259B/hu unknown
- 1972-04-20 FR FR7214059A patent/FR2133982B1/fr not_active Expired
- 1972-04-20 GB GB1004371A patent/GB1346911A/en not_active Expired
- 1972-04-20 NL NL7205339A patent/NL7205339A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK130344B (da) | 1975-02-10 |
| IE37422B1 (en) | 1977-07-20 |
| BE782296A (fr) | 1972-10-19 |
| TR16784A (tr) | 1973-05-01 |
| GB1346911A (en) | 1974-02-13 |
| IE37422L (en) | 1972-10-20 |
| US3859279A (en) | 1975-01-07 |
| DK130344C (enExample) | 1975-07-07 |
| FR2133982B1 (enExample) | 1975-06-20 |
| NL7205339A (enExample) | 1972-10-24 |
| AU4064572A (en) | 1973-10-04 |
| FR2133982A1 (enExample) | 1972-12-01 |
| IL39126A0 (en) | 1972-06-28 |
| AT313892B (de) | 1974-03-11 |
| ES401898A1 (es) | 1975-03-01 |
| IL39126A (en) | 1975-05-22 |
| ZA722073B (en) | 1972-12-27 |
| HU164259B (enExample) | 1974-01-28 |
| AU460419B2 (en) | 1975-04-07 |
| DE2217329A1 (de) | 1972-11-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1383409A (en) | Derivatives of 2-amino- and 4-amino-quinazoline and pharmaceutical compositions containing them | |
| GB1260848A (en) | Propanolamine derivatives | |
| GB1380129A (en) | Benzofuran derivatives and preparation thereof | |
| GB1390014A (en) | Process for the preparation of carbocyclic fused pyrimidine derivatives | |
| GB1298313A (en) | Quinazoline derivatives | |
| GB1373212A (en) | Pyrazole compounds | |
| IE37422L (en) | Benzofuran derivatives. | |
| IE40052L (en) | Piperidinoalkylindoles | |
| GB1386150A (en) | 6-acylaminophenyl-4,5-dihydropyridazones | |
| GB1247711A (en) | Antibacterial agents and a process for the preparation thereof | |
| GB1394791A (en) | Diphenylalkyllactamimide derivatives | |
| GB1343833A (en) | Substituted hexahydroazepines | |
| GB1292787A (en) | Benzodioxane derivatives and pharmaceutical compositions containing them | |
| GB1308029A (en) | Indole derivatives | |
| GB1494299A (en) | Propionic acid derivative salts having hiperlipemic activity | |
| GB1161062A (en) | Active Sulphonamides | |
| GB1289658A (enExample) | ||
| GB1173809A (en) | N-Substituted Nor-Morphines | |
| GB1133080A (en) | Improvements in or relating to derivatives of nitrofuran | |
| KR890009919A (ko) | 4- 헤테로아릴-1,3- 벤조디아제핀 및 2-치환된-α-(헤테로아릴) 벤젠에탄아민, 이의 제조방법 및 약제로서의 이의 용도 | |
| GB1394756A (en) | Pharmaceutically active benzofuran derivatives | |
| GB1115590A (en) | Novel benzylamine derivatives and preparation thereof | |
| GB1495680A (en) | 1-(2-benzoylphenoxy)-2-hydroxy-3-aminopropanes | |
| GB1334471A (en) | Preparation of urea derivatives | |
| GB1471371A (en) | Cyclopenteno-b-pyridine derivative |