IE34087B1 - Stabilized nh4no3-caco3 fertilizer compositions - Google Patents
Stabilized nh4no3-caco3 fertilizer compositionsInfo
- Publication number
- IE34087B1 IE34087B1 IE1290/69A IE129069A IE34087B1 IE 34087 B1 IE34087 B1 IE 34087B1 IE 1290/69 A IE1290/69 A IE 1290/69A IE 129069 A IE129069 A IE 129069A IE 34087 B1 IE34087 B1 IE 34087B1
- Authority
- IE
- Ireland
- Prior art keywords
- percent
- fertilizer compositions
- nh4no3
- caco3
- stabilized
- Prior art date
Links
- 239000003337 fertilizer Substances 0.000 title abstract 2
- 239000000203 mixture Substances 0.000 title abstract 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 abstract 4
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 abstract 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 229910000019 calcium carbonate Inorganic materials 0.000 abstract 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- 239000005696 Diammonium phosphate Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- -1 alkali metal salt Chemical class 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 abstract 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 abstract 1
- 235000011130 ammonium sulphate Nutrition 0.000 abstract 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 abstract 1
- 239000004327 boric acid Substances 0.000 abstract 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 abstract 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 abstract 1
- 235000019838 diammonium phosphate Nutrition 0.000 abstract 1
- 230000007704 transition Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C1/00—Ammonium nitrate fertilisers
- C05C1/02—Granulation; Pelletisation; Stabilisation; Colouring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83521369A | 1969-06-20 | 1969-06-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34087L IE34087L (en) | 1970-12-20 |
| IE34087B1 true IE34087B1 (en) | 1975-02-05 |
Family
ID=25268939
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1290/69A IE34087B1 (en) | 1969-06-20 | 1970-05-07 | Stabilized nh4no3-caco3 fertilizer compositions |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3647412A (instruction) |
| AT (1) | AT299996B (instruction) |
| BE (2) | BE739881A (instruction) |
| BG (1) | BG20328A3 (instruction) |
| CH (1) | CH558765A (instruction) |
| CS (1) | CS163212B2 (instruction) |
| DE (1) | DE2029086C3 (instruction) |
| DK (1) | DK122719B (instruction) |
| ES (1) | ES372685A1 (instruction) |
| FI (1) | FI50706C (instruction) |
| FR (2) | FR2046928A1 (instruction) |
| GB (1) | GB1261279A (instruction) |
| IE (1) | IE34087B1 (instruction) |
| IL (1) | IL34438A (instruction) |
| NL (1) | NL6916860A (instruction) |
| NO (1) | NO121789B (instruction) |
| PL (1) | PL80501B1 (instruction) |
| RO (1) | RO58324A2 (instruction) |
| SE (1) | SE353525B (instruction) |
| ZM (1) | ZM6370A1 (instruction) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1252664B (it) * | 1991-12-23 | 1995-06-21 | Enichem Agricoltura Spa | Processo per la granulazione di un fertilizzante denominato nitrato ammonico |
| FR2804954B1 (fr) * | 2000-02-15 | 2002-09-06 | Cfpi Nufarm | Additif et procede pour la preparation des engrais du type can et can ainsi obtenu |
| RU2223934C1 (ru) * | 2002-09-03 | 2004-02-20 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П.Константинова" | Способ получения известково-аммиачной селитры |
| RU2252206C1 (ru) * | 2003-12-08 | 2005-05-20 | Закрытое акционерное общество "Куйбышевазот" | Технологическая линия по производству известково-аммиачной селитры |
| RU2259979C1 (ru) * | 2004-08-26 | 2005-09-10 | Открытое акционерное общество "Азот" | Способ получения аммиачно-кальциевой селитры |
| RU2265001C1 (ru) * | 2004-11-19 | 2005-11-27 | Закрытое акционерное общество "Минерально-химическая компания "ЕвроХим" (ЗАО "МХК "ЕвроХим") | Способ получения известково-аммиачного удобрения |
| RU2281274C1 (ru) * | 2005-03-31 | 2006-08-10 | Открытое акционерное общество "Научно-исследовательский институт по удобрениям и инсектофунгицидам им. Я.В. Самойлова" | Способ получения гранулированного известково-аммиачного удобрения |
| RU2309135C2 (ru) * | 2005-12-20 | 2007-10-27 | Открытое акционерное общество "КуйбышевАзот" | Технологическая линия для производства известково-аммиачной селитры |
| WO2015048729A1 (en) * | 2013-09-30 | 2015-04-02 | Sperber Donald S | Flame-retardant formulations and methods relating thereto |
| US12338190B2 (en) * | 2023-05-24 | 2025-06-24 | Defuse Technologies, LLC | Desensitized fertilizer compositions and methods of making same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2657977A (en) * | 1949-09-21 | 1953-11-03 | Commercial Solvents Corp | Process for preventing the physical disintegration of ammonium nitrate by temperature fluctuations |
| US2912318A (en) * | 1957-01-16 | 1959-11-10 | Commercial Solvents Corp | Process for making mixed fertilizers containing ammonium nitrate and calcium carbonate |
| FR1316412A (fr) * | 1962-03-01 | 1963-01-25 | Shell Int Research | Procédé de préparation d'engrais mixtes contenant du nitrate d'ammonium et du carbonate de calcium |
| US3421878A (en) * | 1966-04-06 | 1969-01-14 | Foster Wheeler Corp | Ammonium nitrate-calcium carbonate fertilizer mixture |
| US3317276A (en) * | 1966-10-24 | 1967-05-02 | Mississippi Chem Corp | Stabilized ammonium nitrate compositions and their production |
-
1969
- 1969-06-20 US US835213A patent/US3647412A/en not_active Expired - Lifetime
- 1969-08-05 SE SE10919/69A patent/SE353525B/xx unknown
- 1969-09-18 NO NO3733/69A patent/NO121789B/no unknown
- 1969-10-02 FI FI692838A patent/FI50706C/fi active
- 1969-10-03 DK DK528869AA patent/DK122719B/da not_active IP Right Cessation
- 1969-10-06 BE BE739881D patent/BE739881A/xx not_active IP Right Cessation
- 1969-10-09 FR FR6934518A patent/FR2046928A1/fr not_active Withdrawn
- 1969-10-09 GB GB49618/69A patent/GB1261279A/en not_active Expired
- 1969-10-18 ES ES372685A patent/ES372685A1/es not_active Expired
- 1969-11-03 RO RO61446A patent/RO58324A2/ro unknown
- 1969-11-07 NL NL6916860A patent/NL6916860A/xx unknown
-
1970
- 1970-02-10 AT AT120670A patent/AT299996B/de not_active IP Right Cessation
- 1970-02-12 CH CH202570A patent/CH558765A/xx not_active IP Right Cessation
- 1970-05-01 IL IL34438A patent/IL34438A/xx unknown
- 1970-05-07 IE IE1290/69A patent/IE34087B1/xx unknown
- 1970-05-27 BE BE750994D patent/BE750994R/xx active
- 1970-06-01 ZM ZM63/70A patent/ZM6370A1/xx unknown
- 1970-06-12 DE DE2029086A patent/DE2029086C3/de not_active Expired
- 1970-06-16 BG BG014953A patent/BG20328A3/xx unknown
- 1970-06-16 CS CS4215A patent/CS163212B2/cs unknown
- 1970-06-19 FR FR7022743A patent/FR2054583B2/fr not_active Expired
- 1970-06-19 PL PL1970141453A patent/PL80501B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES372685A1 (es) | 1972-02-01 |
| ZM6370A1 (en) | 1971-01-20 |
| FR2054583B2 (instruction) | 1974-05-03 |
| BG20328A3 (bg) | 1975-11-05 |
| IL34438A (en) | 1973-04-30 |
| DK122719B (da) | 1972-04-04 |
| CS163212B2 (instruction) | 1975-08-29 |
| FI50706C (fi) | 1976-06-10 |
| AT299996B (de) | 1972-07-10 |
| PL80501B1 (instruction) | 1975-08-30 |
| FR2054583A2 (instruction) | 1971-04-23 |
| IE34087L (en) | 1970-12-20 |
| FR2046928A1 (instruction) | 1971-03-12 |
| RO58324A2 (ro) | 1975-06-05 |
| SE353525B (instruction) | 1973-02-05 |
| DE2029086A1 (instruction) | 1970-12-23 |
| CH558765A (de) | 1975-02-14 |
| NO121789B (instruction) | 1971-04-13 |
| IL34438A0 (en) | 1970-07-19 |
| NL6916860A (instruction) | 1970-12-22 |
| DE2029086C3 (de) | 1975-12-18 |
| DE2029086B2 (de) | 1973-07-05 |
| BE739881A (instruction) | 1970-04-06 |
| GB1261279A (en) | 1972-01-26 |
| BE750994R (fr) | 1970-11-03 |
| US3647412A (en) | 1972-03-07 |
| FI50706B (instruction) | 1976-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE34087B1 (en) | Stabilized nh4no3-caco3 fertilizer compositions | |
| ES8402171A1 (es) | Un procedimiento para la produccion de granulos que contienen urea como componente principal. | |
| ATE1851T1 (de) | Nichtbackender koerniger mineralduenger. | |
| BG49613A3 (en) | Method for preparing of granulate carbamid | |
| GB1309612A (en) | Stabilized cammonium nitrate and preparation thereof | |
| GB1201879A (en) | Aqueous suspension fertilizers | |
| ES8503256A1 (es) | Un procedimiento para la produccion de granulos, que contienen urea, como componente mayoritario. | |
| IE34718L (en) | Liquid fertilizers | |
| GB1434697A (en) | Pesticide formulations | |
| GB1147545A (en) | Production of granular fertilizers | |
| GB1334871A (en) | Urea crystals pellets prills and the like | |
| GB1386918A (en) | Process for the preparation of an additive for maize silage on the basis of prilled urea | |
| GB886951A (en) | Phosphate fertilizer composition and the method of manufacture thereof | |
| GB780733A (en) | Fertilisers containing trace elements and a process of preparing them | |
| GB1008402A (en) | Production of fertilizers | |
| GB1212661A (en) | Process for the production of granular urea | |
| ES290607A1 (es) | Procedimiento para preparar una composiciën fertilizante granular | |
| GB951960A (en) | Fertilizer materials | |
| ATE71073T1 (de) | Komplexes npk-duengemittel mit verringerter neigung zum schwellen und zusammenbacken. | |
| GB1237897A (instruction) | ||
| GB1063419A (en) | The production of a fertilizer product from molten ammonium nitrate and powdered solid calcium carbonate | |
| GB769361A (en) | Improvements in or relating to reducing the caking of potassium or ammonium sulphates or mixtures essentially comprising the same | |
| GB382368A (en) | Improvements in the manufacture and production of mixed fertilisers containing ammonium nitrate which are stable when stored | |
| ES319727A1 (es) | Procedimiento de preparacion de un fertilizante. | |
| ES270204A1 (es) | Un procedimiento para la preparaciën de un fertilizante complejo |