IE33573B1 - Substituted phenylalkanoic acids and derivatives thereof - Google Patents
Substituted phenylalkanoic acids and derivatives thereofInfo
- Publication number
- IE33573B1 IE33573B1 IE1161/69A IE116169A IE33573B1 IE 33573 B1 IE33573 B1 IE 33573B1 IE 1161/69 A IE1161/69 A IE 1161/69A IE 116169 A IE116169 A IE 116169A IE 33573 B1 IE33573 B1 IE 33573B1
- Authority
- IE
- Ireland
- Prior art keywords
- alkyl
- methyl
- derivatives
- halo
- alkoxy
- Prior art date
Links
- 239000002253 acid Substances 0.000 title abstract 3
- 150000007513 acids Chemical class 0.000 title abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 8
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000005843 halogen group Chemical group 0.000 abstract 3
- -1 N,N-dimethyl-carbamyl Chemical group 0.000 abstract 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 abstract 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 abstract 2
- FZCDBGYCFVKRDV-UHFFFAOYSA-N 1-(3-phenoxyphenyl)ethanone Chemical compound CC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1 FZCDBGYCFVKRDV-UHFFFAOYSA-N 0.000 abstract 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 229940035676 analgesics Drugs 0.000 abstract 1
- 239000000730 antalgic agent Substances 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract 1
- 230000015572 biosynthetic process Effects 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract 1
- 150000001987 diarylethers Chemical class 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000000546 pharmaceutical excipient Substances 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 238000002360 preparation method Methods 0.000 abstract 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 238000003786 synthesis reaction Methods 0.000 abstract 1
- 125000003831 tetrazolyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/04—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms
- C07C275/20—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an unsaturated carbon skeleton
- C07C275/24—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/295—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75280168A | 1968-08-15 | 1968-08-15 | |
| US752800A US3649679A (en) | 1968-08-15 | 1968-08-15 | Substituted phenylalkanoic acid derivatives ii |
| US828756A US3600437A (en) | 1969-05-28 | 1969-05-28 | Substituted phenylalkanoic acids and derivatives thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE33573L IE33573L (en) | 1970-02-15 |
| IE33573B1 true IE33573B1 (en) | 1974-08-21 |
Family
ID=27419433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1161/69A IE33573B1 (en) | 1968-08-15 | 1969-08-15 | Substituted phenylalkanoic acids and derivatives thereof |
Country Status (16)
| Country | Link |
|---|---|
| JP (2) | JPS5144938B1 (enFirst) |
| AR (1) | AR197075A1 (enFirst) |
| BE (1) | BE737417A (enFirst) |
| CH (1) | CH527155A (enFirst) |
| CY (1) | CY743A (enFirst) |
| DE (1) | DE1941625C3 (enFirst) |
| DK (1) | DK145778C (enFirst) |
| ES (2) | ES370540A1 (enFirst) |
| FI (1) | FI54099C (enFirst) |
| GB (1) | GB1264340A (enFirst) |
| IE (1) | IE33573B1 (enFirst) |
| IL (1) | IL32825A (enFirst) |
| LU (1) | LU59302A1 (enFirst) |
| NL (2) | NL155820B (enFirst) |
| NO (2) | NO137824C (enFirst) |
| SE (2) | SE363818B (enFirst) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1307284A (en) * | 1970-03-16 | 1973-02-14 | Boots Co Ltd | 2-substituted phenyl propionic acids |
| JPS52168775U (enFirst) * | 1976-06-11 | 1977-12-21 | ||
| JPS5327662U (enFirst) * | 1976-08-14 | 1978-03-09 | ||
| DE2950608A1 (de) * | 1978-12-29 | 1980-07-10 | Chinoin Gyogyszer Es Vegyeszet | Verfahren zur herstellung von 2-(3-phenoxy-phenyl)-propionsaeure |
| US4367238A (en) * | 1980-01-28 | 1983-01-04 | Fujisawa Pharmaceutical Company, Ltd. | Phenyl-alkanoic acid derivative and preparation thereof |
| PH17096A (en) * | 1980-02-07 | 1984-05-29 | Richardson Merrell Inc | Anti-rhinovirus agents |
| US4792560A (en) * | 1985-04-03 | 1988-12-20 | Rorer Pharmaceutical Corporation | Quinoline hydroxamates and their use as modulators of arachidonic acid metabolic pathways |
| JPS6221294U (enFirst) * | 1985-07-23 | 1987-02-07 | ||
| DE3610892A1 (de) * | 1986-03-24 | 1987-10-08 | Hubert Kurz | Sektionalschiebewand |
| JPS6412403A (en) * | 1987-07-07 | 1989-01-17 | Kuroi Electric Ind Co | Light shielding panel |
| DE3816450A1 (de) * | 1988-05-13 | 1989-11-16 | Hubert Kurz | Sektionalschiebewand |
| DE3905518A1 (de) * | 1989-02-23 | 1990-10-11 | Bayer Ag | Substituierte phenoxyphenylpropionsaeure-derivate |
| JPH07502538A (ja) * | 1992-05-01 | 1995-03-16 | ファイザー インク. | 3(s)−メチルヘプタン酸の製造方法およびその中間体 |
| SE0103325D0 (sv) | 2001-10-04 | 2001-10-04 | Astrazeneca Ab | Novel compounds |
| CA2720096A1 (en) * | 2008-04-11 | 2009-10-15 | Institute Of Medicinal Molecular Design, Inc. | Pai-1 inhibitor |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL274139A (enFirst) * | ||||
| GB971700A (en) * | 1961-02-02 | 1964-09-30 | Boots Pure Drug Co Ltd | Anti-Inflammatory Agents |
-
1969
- 1969-08-12 SE SE11181/69A patent/SE363818B/xx unknown
- 1969-08-13 BE BE737417D patent/BE737417A/xx not_active IP Right Cessation
- 1969-08-14 IL IL32825A patent/IL32825A/xx unknown
- 1969-08-14 ES ES370540A patent/ES370540A1/es not_active Expired
- 1969-08-14 DK DK436169A patent/DK145778C/da active
- 1969-08-15 CH CH1241369A patent/CH527155A/de not_active IP Right Cessation
- 1969-08-15 NL NL6912504.A patent/NL155820B/xx not_active IP Right Cessation
- 1969-08-15 FI FI2392/69A patent/FI54099C/fi active
- 1969-08-15 JP JP44064690A patent/JPS5144938B1/ja active Pending
- 1969-08-15 IE IE1161/69A patent/IE33573B1/xx unknown
- 1969-08-15 GB GB4097169A patent/GB1264340A/en not_active Expired
- 1969-08-16 DE DE1941625A patent/DE1941625C3/de not_active Expired
- 1969-08-18 LU LU59302D patent/LU59302A1/xx unknown
-
1970
- 1970-09-01 AR AR230992A patent/AR197075A1/es active
-
1971
- 1971-04-30 ES ES390805A patent/ES390805A1/es not_active Expired
-
1972
- 1972-06-16 SE SE7207958A patent/SE398639B/xx unknown
-
1973
- 1973-04-19 JP JP48044630A patent/JPS5145586B1/ja active Pending
- 1973-09-25 NO NO3760/73A patent/NO137824C/no unknown
-
1974
- 1974-04-30 CY CY74374A patent/CY743A/xx unknown
-
1977
- 1977-10-12 NO NO773495A patent/NO139127C/no unknown
-
1979
- 1979-07-20 NL NL7905644AA patent/NL7905644A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DK145778B (da) | 1983-02-28 |
| SE363818B (enFirst) | 1974-02-04 |
| NO139127B (no) | 1978-10-02 |
| AR197075A1 (es) | 1974-03-15 |
| DE1941625B2 (de) | 1981-05-07 |
| ES370540A1 (es) | 1971-07-01 |
| NO139127C (no) | 1979-01-10 |
| LU59302A1 (enFirst) | 1970-05-18 |
| DE1941625C3 (de) | 1982-03-18 |
| NL155820B (nl) | 1978-02-15 |
| FI54099C (fi) | 1978-10-10 |
| NL7905644A (nl) | 1979-11-30 |
| NO137824C (no) | 1978-05-03 |
| JPS5144938B1 (enFirst) | 1976-12-01 |
| ES390805A1 (es) | 1974-03-16 |
| CH527155A (de) | 1972-08-31 |
| NL6912504A (enFirst) | 1970-02-17 |
| FI54099B (fi) | 1978-06-30 |
| NO773495L (no) | 1970-02-16 |
| DK145778C (da) | 1983-08-22 |
| NO137824B (no) | 1978-01-23 |
| BE737417A (enFirst) | 1970-02-13 |
| IE33573L (en) | 1970-02-15 |
| DE1941625A1 (de) | 1970-11-19 |
| IL32825A (en) | 1973-03-30 |
| JPS5145586B1 (enFirst) | 1976-12-04 |
| IL32825A0 (en) | 1969-11-12 |
| GB1264340A (enFirst) | 1972-02-23 |
| CY743A (en) | 1974-04-30 |
| SE398639B (sv) | 1978-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE33573B1 (en) | Substituted phenylalkanoic acids and derivatives thereof | |
| HUT56365A (en) | Process for producing antimuscarine quinuclidine derivatives having bronchodilator effect and pharmaceutical compositions comprising same as active ingredient | |
| ES8204739A1 (es) | Un procedimiento para preparar compuestos de cefem | |
| GB1298771A (en) | Carboxylic esters of hydroxyphenylalkanolamines | |
| AU2418692A (en) | New 3,5-di-tert.butyl-4-hydroxyphenyl derivatives, methods of preparing them and drugs containing them | |
| IL89785A0 (en) | Acyl derivatives,their manufacture and pharmaceutical compositions containing them | |
| GB1373212A (en) | Pyrazole compounds | |
| ES8801894A1 (es) | Precedimiento para la preparacion de derivados de fenetanolamina | |
| GB1063744A (en) | 4-substituted-4'-tertiary aminoalkoxy biphenyls | |
| GB1509819A (en) | Pharmaceutical composition for curing liver diseases | |
| GB1397731A (en) | Monothiachromone-2-carboxylic acids | |
| GB1291644A (en) | Substituted 1-indancarboxylic acids, their esters and salts | |
| IL58065A (en) | Furyl substituted polyene carboxylic acid derivatives,their preparation and pharmaceutical compositions containing them | |
| GB1164555A (en) | New Tropine Derivatives | |
| GB1474907A (en) | Pyrolidine derivatives | |
| US2721213A (en) | 2-methyl-4-ethoxy-5-tertiary butylacetanilide and preparation thereof | |
| EP0081971A3 (en) | Novel cephalosporin compound and process for preparing the same | |
| IE33065B1 (en) | A process for the preparation of sulfonyl urea derivatives | |
| JPS57192347A (en) | N-(4-(3-aminopropyl)aminobutyl)-2,2-dihydroxyethanamide and its synthesis | |
| JPS55164671A (en) | Azetidine derivative and its preparation | |
| GB1067694A (en) | A process for the preparation of 2-alkyl-4-alkylamino-6-alkoxy-s-triazines | |
| GB1449540A (en) | Nitrostyrene derivatives process for their preparation and compo sitions containing same | |
| GB1179900A (en) | Tropic acid derivatives | |
| GB1153071A (en) | Process for the preparation of New Therapeutically Active Basic Ethers | |
| GB1479572A (en) | Triazolocycloalkahydrothiadiazine derivatives |