IE33092B1 - Piperidine derivatives - Google Patents
Piperidine derivativesInfo
- Publication number
- IE33092B1 IE33092B1 IE671/69A IE67169A IE33092B1 IE 33092 B1 IE33092 B1 IE 33092B1 IE 671/69 A IE671/69 A IE 671/69A IE 67169 A IE67169 A IE 67169A IE 33092 B1 IE33092 B1 IE 33092B1
- Authority
- IE
- Ireland
- Prior art keywords
- prepared
- derivatives
- reaction
- pyridine derivative
- reduction
- Prior art date
Links
- 150000003053 piperidines Chemical class 0.000 title abstract 2
- 239000002253 acid Substances 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 150000003222 pyridines Chemical class 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 abstract 2
- DAXJNUBSBFUTRP-RTQNCGMRSA-N (8r,9s,10r,13s,14s)-6-(hydroxymethyl)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6h-cyclopenta[a]phenanthrene-3,17-dione Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(CO)C2=C1 DAXJNUBSBFUTRP-RTQNCGMRSA-N 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 150000005840 aryl radicals Chemical class 0.000 abstract 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 125000000468 ketone group Chemical group 0.000 abstract 1
- 239000007858 starting material Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/02—Preparation by ring-closure or hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/20—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms
- C07D211/22—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by singly bound oxygen or sulphur atoms by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/26—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Farming Of Fish And Shellfish (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27502/68A GB1203149A (en) | 1968-06-10 | 1968-06-10 | Piperidine derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE33092L IE33092L (en) | 1969-12-10 |
| IE33092B1 true IE33092B1 (en) | 1974-03-20 |
Family
ID=10260615
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE671/69A IE33092B1 (en) | 1968-06-10 | 1969-05-15 | Piperidine derivatives |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3634437A (Direct) |
| JP (1) | JPS4934990B1 (Direct) |
| AT (1) | AT289115B (Direct) |
| BE (1) | BE734296A (Direct) |
| BR (1) | BR6909577D0 (Direct) |
| CH (1) | CH513856A (Direct) |
| CS (1) | CS153519B2 (Direct) |
| DE (1) | DE1929260A1 (Direct) |
| DK (1) | DK120996B (Direct) |
| ES (1) | ES368169A1 (Direct) |
| FI (1) | FI49298C (Direct) |
| FR (1) | FR2010615A1 (Direct) |
| GB (1) | GB1203149A (Direct) |
| IE (1) | IE33092B1 (Direct) |
| IL (1) | IL32278A (Direct) |
| NL (1) | NL6908842A (Direct) |
| NO (1) | NO125928B (Direct) |
| PL (1) | PL79996B1 (Direct) |
| SE (1) | SE356978B (Direct) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4556664A (en) * | 1984-03-13 | 1985-12-03 | Gunnar A. K. Aberg | Method and composition for the treatment of cardiac arrhythmias |
| IE66332B1 (en) * | 1986-11-03 | 1995-12-27 | Novo Nordisk As | Piperidine compounds and their preparation and use |
| US4822778A (en) * | 1988-01-19 | 1989-04-18 | Gunnar Aberg | Membrane stabilizing phenoxy-piperidine compounds and pharmaceutical compositions employing such compounds |
| FR2667317B1 (fr) * | 1990-10-02 | 1992-12-04 | Synthelabo | Derives de 2-aminopyrimidine-4-carboxamide, leur preparation et leur application en therapeutique. |
| GB9226111D0 (en) * | 1992-12-15 | 1993-02-10 | Smithkline Beecham Plc | Madicaments |
| CA2232147A1 (en) * | 1997-04-03 | 1998-10-03 | F. Hoffmann-La Roche Ag | Phenoxymethyl piperidine derivatives |
| US6110937A (en) * | 1997-04-03 | 2000-08-29 | Syntex Usa, Inc. | Phenoxymethyl piperidine derivatives for the treatment of neuropathic pain |
| US6518284B2 (en) * | 1998-11-18 | 2003-02-11 | Faes, Fabrica Espanola De Productos Quimicos Y Farmaceuticos S.A. | 4-substituted piperidines |
| ES2157148B1 (es) * | 1998-11-18 | 2002-03-01 | Faes Fabrica Espanola De Produ | Nuevas piperidinas 4-sustituidas. |
| EP1854785A1 (en) * | 2006-05-12 | 2007-11-14 | Faes Farma, S.A. | 4-[(3-fluorophenoxy)phenylmethyl]piperidine methanesulfonate: uses, process of synthesis and pharmaceutical compositions |
| AU2007287338A1 (en) * | 2006-08-23 | 2008-02-28 | Pfizer Products Inc. | Piperidine derivatives |
| JP5405571B2 (ja) | 2008-07-24 | 2014-02-05 | セラヴァンス, インコーポレーテッド | 3−(フェノキシフェニルメチル)ピロリジン化合物 |
| EP2419405A1 (en) * | 2009-04-15 | 2012-02-22 | Theravance, Inc. | 3-(phenoxypyrrolidin-3-yl-methyl)heteroaryl, 3-(phenylpyrrolidin-3-ylmethoxy)heteroaryl, and 3-(heteroarylpyrrolidin-3-ylmethoxy)heteroaryl compounds |
| RU2535669C2 (ru) * | 2009-07-13 | 2014-12-20 | Тереванс, Инк. | 3-феноксиметилпирролидиновые соединения |
| US8273786B2 (en) * | 2009-07-21 | 2012-09-25 | Theravance, Inc. | 3-phenoxymethylpyrrolidine compounds |
| KR101114544B1 (ko) | 2009-10-15 | 2012-03-07 | 한국원자력의학원 | Nrf2 활성 억제제 및 그의 용도 |
| EP2627630B1 (en) | 2010-10-11 | 2014-12-31 | Theravance Biopharma R&D IP, LLC | Serotonin reuptake inhibitors |
| WO2012075239A1 (en) | 2010-12-03 | 2012-06-07 | Theravance, Inc. | Serotonin reuptake inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3381013A (en) * | 1964-01-15 | 1968-04-30 | Bristol Myers Co | Heterocyclicamino ethers of benzylphenols |
-
1968
- 1968-06-10 GB GB27502/68A patent/GB1203149A/en not_active Expired
-
1969
- 1969-05-15 IE IE671/69A patent/IE33092B1/xx unknown
- 1969-05-19 US US825934A patent/US3634437A/en not_active Expired - Lifetime
- 1969-05-19 PL PL1969133681A patent/PL79996B1/pl unknown
- 1969-05-22 IL IL32278A patent/IL32278A/en unknown
- 1969-05-28 DK DK289269AA patent/DK120996B/da unknown
- 1969-06-02 FI FI691646A patent/FI49298C/fi active
- 1969-06-06 SE SE08089/69A patent/SE356978B/xx unknown
- 1969-06-09 NO NO2370/69A patent/NO125928B/no unknown
- 1969-06-09 BR BR209577/69A patent/BR6909577D0/pt unknown
- 1969-06-09 ES ES368169A patent/ES368169A1/es not_active Expired
- 1969-06-09 CS CS406769A patent/CS153519B2/cs unknown
- 1969-06-09 BE BE734296D patent/BE734296A/xx unknown
- 1969-06-10 JP JP44045698A patent/JPS4934990B1/ja active Pending
- 1969-06-10 AT AT549669A patent/AT289115B/de not_active IP Right Cessation
- 1969-06-10 DE DE19691929260 patent/DE1929260A1/de active Pending
- 1969-06-10 FR FR6919217A patent/FR2010615A1/fr not_active Withdrawn
- 1969-06-10 CH CH878169A patent/CH513856A/de not_active IP Right Cessation
- 1969-06-10 NL NL6908842A patent/NL6908842A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL32278A (en) | 1972-10-29 |
| IE33092L (en) | 1969-12-10 |
| US3634437A (en) | 1972-01-11 |
| BR6909577D0 (pt) | 1973-05-24 |
| AT289115B (de) | 1971-04-13 |
| ES368169A1 (es) | 1971-05-01 |
| NO125928B (Direct) | 1972-11-27 |
| FI49298C (fi) | 1975-05-12 |
| DK120996B (da) | 1971-08-16 |
| IL32278A0 (en) | 1969-07-30 |
| JPS4934990B1 (Direct) | 1974-09-19 |
| CH513856A (de) | 1971-10-15 |
| PL79996B1 (Direct) | 1975-08-30 |
| CS153519B2 (Direct) | 1974-02-25 |
| NL6908842A (Direct) | 1969-12-12 |
| FI49298B (Direct) | 1975-01-31 |
| BE734296A (Direct) | 1969-12-09 |
| FR2010615A1 (Direct) | 1970-02-20 |
| GB1203149A (en) | 1970-08-26 |
| DE1929260A1 (de) | 1970-08-27 |
| SE356978B (Direct) | 1973-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE33092L (en) | Piperidine derivatives | |
| GB1132082A (en) | The manufacture of pyrimidine derivatives | |
| NL7505375A (nl) | Nieuwe penicilline en cefalosporinederivaten en werkwijze voor de bereiding daarvan. | |
| GB1530501A (en) | Azetidinones and cephalosporins obtained therefrom | |
| GB1396286A (en) | Herbicidal compounds | |
| EP0359112A3 (en) | Carbazate derivatives, their production and use | |
| GB1344735A (en) | Herbicidal s-aryl- arylamides | |
| GB1422216A (en) | Phenyl-formamidine derivatives | |
| GB1421280A (en) | 3-heterocyclicthiomethylcephalosporins | |
| GB1057697A (en) | Penicillins | |
| IE38275L (en) | Aminomethylenemalonitriles; fungicides | |
| IE40019L (en) | 6-trichloroacetamidopenicillanic acid derivatives | |
| IE32086B1 (en) | Oxazole derivatives | |
| IE35626B1 (en) | Phenylacetohydroxamic acids process for their manufacture and preparations containing them | |
| GB1440670A (en) | Lactam derivatives | |
| GB1527941A (en) | 1-(3-phenylpropyl)-4-(beta-alkoxyacryloyl)piperazine derivatives | |
| IE36558L (en) | Esterification of penicillins | |
| IE38215B1 (en) | Process for the preparation of oximinonitriles | |
| GB1346401A (en) | Cardioactive arylaminobutanols | |
| GB1251009A (Direct) | ||
| GB1435847A (en) | Esters of alpha-alkylidene-aminobenzyl penicillins | |
| IE33511B1 (en) | Derivatives of alpha-aminopenicillins | |
| GB1292662A (en) | Bicycloheptaneheptanoic acids and esters thereof | |
| GB1073933A (en) | 7-(nitrogen-containing heterocyclic carbonamido) cephalosporanic acid and derivatives thereof | |
| IE37258B1 (en) | A process for producing penicillin esters |