IE32791B1 - Benzodiazepine derivatives - Google Patents
Benzodiazepine derivativesInfo
- Publication number
- IE32791B1 IE32791B1 IE591/69A IE59169A IE32791B1 IE 32791 B1 IE32791 B1 IE 32791B1 IE 591/69 A IE591/69 A IE 591/69A IE 59169 A IE59169 A IE 59169A IE 32791 B1 IE32791 B1 IE 32791B1
- Authority
- IE
- Ireland
- Prior art keywords
- trifluoromethyl
- hydrogen
- methyl
- benzodiazepine derivatives
- us3624076a
- Prior art date
Links
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 title 1
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 title 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 239000000460 chlorine Chemical group 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 abstract 1
- 125000000068 chlorophenyl group Chemical group 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004188 dichlorophenyl group Chemical group 0.000 abstract 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- -1 methylamino, ethoxy, cyclohexyl Chemical group 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 229940035363 muscle relaxants Drugs 0.000 abstract 1
- 239000003158 myorelaxant agent Substances 0.000 abstract 1
- 125000006501 nitrophenyl group Chemical group 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000005504 styryl group Chemical group 0.000 abstract 1
- 125000001544 thienyl group Chemical group 0.000 abstract 1
- 125000003944 tolyl group Chemical group 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/12—1,5-Benzodiazepines; Hydrogenated 1,5-benzodiazepines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT416568A AT283372B (de) | 1968-04-29 | 1968-04-29 | Verfahren zur Herstellung neuer 1-Acyl-5-phenyl-1H-1,5-benzodiazepin-2,4-[3H,5H]-dione |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE32791L IE32791L (en) | 1969-10-29 |
| IE32791B1 true IE32791B1 (en) | 1973-11-28 |
Family
ID=3560503
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE591/69A IE32791B1 (en) | 1968-04-29 | 1969-04-28 | Benzodiazepine derivatives |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3624076A (enExample) |
| AT (1) | AT283372B (enExample) |
| BE (1) | BE732310A (enExample) |
| BR (1) | BR6908389D0 (enExample) |
| CH (1) | CH509329A (enExample) |
| DE (1) | DE1921828C3 (enExample) |
| DK (1) | DK128780B (enExample) |
| ES (1) | ES366502A1 (enExample) |
| FI (1) | FI50121C (enExample) |
| FR (1) | FR2007560A1 (enExample) |
| GB (1) | GB1214663A (enExample) |
| IE (1) | IE32791B1 (enExample) |
| IL (1) | IL32088A (enExample) |
| NL (1) | NL158794B (enExample) |
| PL (1) | PL72613B1 (enExample) |
| SE (1) | SE363827B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2052840C2 (de) * | 1970-10-28 | 1983-09-08 | Knoll Ag, 6700 Ludwigshafen | 8-Chlor-1-phenyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepin-2-on-Derivate |
| DE3405915A1 (de) * | 1984-02-18 | 1985-08-22 | Bayerische Motoren Werke AG, 8000 München | Schaltanordnung fuer einen ultraschall-entfernungsmesser |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670190A1 (de) * | 1967-02-07 | 1970-12-03 | Boehringer Sohn Ingelheim | Verfahren zur Herstellung von 1,5-Dihydro-5-phenyl-3H-1,5-benzodiazepin-2,4-dionen |
-
1968
- 1968-04-29 AT AT416568A patent/AT283372B/de not_active IP Right Cessation
-
1969
- 1969-04-26 ES ES366502A patent/ES366502A1/es not_active Expired
- 1969-04-28 BR BR208389/69A patent/BR6908389D0/pt unknown
- 1969-04-28 US US819940A patent/US3624076A/en not_active Expired - Lifetime
- 1969-04-28 CH CH645269A patent/CH509329A/de not_active IP Right Cessation
- 1969-04-28 DK DK233369AA patent/DK128780B/da unknown
- 1969-04-28 IE IE591/69A patent/IE32791B1/xx unknown
- 1969-04-28 PL PL1969133262A patent/PL72613B1/pl unknown
- 1969-04-28 IL IL32088A patent/IL32088A/en unknown
- 1969-04-28 NL NL6906537.A patent/NL158794B/xx unknown
- 1969-04-29 FI FI691254A patent/FI50121C/fi active
- 1969-04-29 FR FR6913669A patent/FR2007560A1/fr not_active Withdrawn
- 1969-04-29 BE BE732310D patent/BE732310A/xx unknown
- 1969-04-29 SE SE06126/69*A patent/SE363827B/xx unknown
- 1969-04-29 DE DE1921828A patent/DE1921828C3/de not_active Expired
- 1969-04-29 GB GB21880/69A patent/GB1214663A/en not_active Expired
-
1971
- 1971-03-25 US US128173A patent/US3683348A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IE32791L (en) | 1969-10-29 |
| US3624076A (en) | 1971-11-30 |
| ES366502A1 (es) | 1971-02-16 |
| FI50121C (fi) | 1975-12-10 |
| BR6908389D0 (pt) | 1973-05-03 |
| SE363827B (enExample) | 1974-02-04 |
| PL72613B1 (enExample) | 1974-08-30 |
| IL32088A (en) | 1972-05-30 |
| CH509329A (de) | 1971-06-30 |
| IL32088A0 (en) | 1969-06-25 |
| DK128780B (da) | 1974-07-01 |
| AT283372B (de) | 1970-08-10 |
| DE1921828A1 (de) | 1969-11-06 |
| GB1214663A (en) | 1970-12-02 |
| NL6906537A (enExample) | 1969-10-31 |
| DE1921828C3 (de) | 1974-02-14 |
| FR2007560A1 (enExample) | 1970-01-09 |
| DE1921828B2 (de) | 1973-06-07 |
| NL158794B (nl) | 1978-12-15 |
| FI50121B (enExample) | 1975-09-01 |
| US3683348A (en) | 1972-08-08 |
| BE732310A (enExample) | 1969-10-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES8305334A1 (es) | Derivados de carbostirilo y sus sales. | |
| NL930018I2 (nl) | (Piperidinylalkyl) chinazolinederivaten, werkwijzen voor hun bereiding en farmaceutische preparaten die ze bevatten. | |
| IE790099L (en) | Compositions containing azolyltriazine derivatives | |
| IE45051L (en) | Quinazolines | |
| IE802684L (en) | Quinoline derivatives | |
| JPS5283432A (en) | Preparation and applications of 3-(2-aryl-2-propyl) urea derivatives | |
| IE32791B1 (en) | Benzodiazepine derivatives | |
| JPS52108028A (en) | Remedies for dysacousis | |
| ES466192A1 (es) | Procedimiento para la obtencion de derivados de la isoqui- noleina. | |
| IE44830L (en) | Benzodiazepine derivatives. | |
| IE42122L (en) | Xanthones | |
| GB1152964A (en) | Substituted Imidazoline Derivatives | |
| EP0997463A4 (en) | NAPHTHYRIDINE DERIVATIVES | |
| AU6624281A (en) | 2,3-dihydro-imidazo(1,2-g)pyridazine derivatives | |
| GB1319840A (en) | Substituted 5-amino imidazoles | |
| GB1174626A (en) | New Benzoxazine Derivatives | |
| IE35541L (en) | Benzodiazepine derivatives. | |
| ES485992A1 (es) | Procedimiento para la obtencion de un fungicida a base de carboximidas y derivados sulfamidicos | |
| IE40805L (en) | Benzazepine sulphonylureas | |
| IE39639B1 (en) | N-substituted cycloserine compounds | |
| ES8302719A1 (es) | Un procedimiento para preparar compuestos de cefem | |
| JPS5321191A (en) | 7-arylmalonamidocephem derivatives | |
| GB1191443A (en) | Quinoline Derivatives | |
| IE45116L (en) | Preparation of 3-methylene-cephalosporins. | |
| IE37815B1 (en) | 1-aryl-3h-1,4-benzodiazepin-2,5-(1h,4h)-diones |