HUT57735A - Process for producing benzimidazolinone derivatives and pharmaceutical compositions comprising such compounds as active ingredient - Google Patents
Process for producing benzimidazolinone derivatives and pharmaceutical compositions comprising such compounds as active ingredient Download PDFInfo
- Publication number
- HUT57735A HUT57735A HU911226A HU122691A HUT57735A HU T57735 A HUT57735 A HU T57735A HU 911226 A HU911226 A HU 911226A HU 122691 A HU122691 A HU 122691A HU T57735 A HUT57735 A HU T57735A
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- benzimidazol
- dihydro
- group
- dimethylaminoethyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 98
- 238000000034 method Methods 0.000 title claims description 23
- 230000008569 process Effects 0.000 title claims description 14
- SILNNFMWIMZVEQ-UHFFFAOYSA-N 1,3-dihydrobenzimidazol-2-one Chemical class C1=CC=C2NC(O)=NC2=C1 SILNNFMWIMZVEQ-UHFFFAOYSA-N 0.000 title claims description 11
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 4
- 239000004480 active ingredient Substances 0.000 title description 2
- -1 cyano, carboxyl Chemical group 0.000 claims description 113
- 239000000203 mixture Substances 0.000 claims description 61
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 47
- 125000000217 alkyl group Chemical group 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 26
- 239000003580 lung surfactant Substances 0.000 claims description 26
- 229940066294 lung surfactant Drugs 0.000 claims description 25
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical class 0.000 claims description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 7
- 125000004104 aryloxy group Chemical group 0.000 claims description 7
- JSTZYOFLAQAJDC-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(CCN(C)C)C2=C1 JSTZYOFLAQAJDC-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 5
- MYONAGGJKCJOBT-UHFFFAOYSA-N benzimidazol-2-one Chemical group C1=CC=CC2=NC(=O)N=C21 MYONAGGJKCJOBT-UHFFFAOYSA-N 0.000 claims description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 4
- 230000002140 halogenating effect Effects 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- YOOLZGSGQBBZPM-UHFFFAOYSA-N 5,7-dibromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound BrC1=CC(Br)=C2NC(=O)N(CCN(C)C)C2=C1 YOOLZGSGQBBZPM-UHFFFAOYSA-N 0.000 claims description 3
- RIYGUVGJFNCUEE-UHFFFAOYSA-N 5-bromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound BrC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 RIYGUVGJFNCUEE-UHFFFAOYSA-N 0.000 claims description 3
- WBTWHZDYGDXTTE-UHFFFAOYSA-N 5-chloro-3-(2-pyrrolidin-1-ylethyl)-1h-benzimidazol-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCCC1 WBTWHZDYGDXTTE-UHFFFAOYSA-N 0.000 claims description 3
- DMGRCJYFGHMPRT-UHFFFAOYSA-N 5-chloro-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound ClC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 DMGRCJYFGHMPRT-UHFFFAOYSA-N 0.000 claims description 3
- 229910021529 ammonia Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 150000004986 phenylenediamines Chemical class 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical group NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 230000000580 secretagogue effect Effects 0.000 claims 1
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 117
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 93
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 90
- 238000006243 chemical reaction Methods 0.000 description 87
- 239000000243 solution Substances 0.000 description 85
- 238000005481 NMR spectroscopy Methods 0.000 description 80
- 238000001819 mass spectrum Methods 0.000 description 79
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 74
- 239000007858 starting material Substances 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 60
- 239000002904 solvent Substances 0.000 description 44
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 43
- 239000011541 reaction mixture Substances 0.000 description 43
- 239000000460 chlorine Substances 0.000 description 37
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 238000000921 elemental analysis Methods 0.000 description 27
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 26
- 229920006395 saturated elastomer Polymers 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 25
- 239000000741 silica gel Substances 0.000 description 25
- 229910002027 silica gel Inorganic materials 0.000 description 25
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- 238000004587 chromatography analysis Methods 0.000 description 24
- 239000011780 sodium chloride Substances 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000003480 eluent Substances 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- 239000013078 crystal Substances 0.000 description 11
- 239000012044 organic layer Substances 0.000 description 11
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 9
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 8
- 238000006722 reduction reaction Methods 0.000 description 8
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 230000028327 secretion Effects 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- 239000012298 atmosphere Substances 0.000 description 5
- KTLFENNEPHBKJD-UHFFFAOYSA-K benzyl(trimethyl)azanium;tribromide Chemical compound [Br-].[Br-].[Br-].C[N+](C)(C)CC1=CC=CC=C1.C[N+](C)(C)CC1=CC=CC=C1.C[N+](C)(C)CC1=CC=CC=C1 KTLFENNEPHBKJD-UHFFFAOYSA-K 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 230000029142 excretion Effects 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 201000002652 newborn respiratory distress syndrome Diseases 0.000 description 5
- 230000000144 pharmacologic effect Effects 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 4
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 4
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 208000032571 Infant acute respiratory distress syndrome Diseases 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 206010028974 Neonatal respiratory distress syndrome Diseases 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 description 4
- 206010038687 Respiratory distress Diseases 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 description 4
- 201000000028 adult respiratory distress syndrome Diseases 0.000 description 4
- PFYXSUNOLOJMDX-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)ON1C(=O)CCC1=O PFYXSUNOLOJMDX-UHFFFAOYSA-N 0.000 description 4
- 206010006451 bronchitis Diseases 0.000 description 4
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 4
- 210000004072 lung Anatomy 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 210000002345 respiratory system Anatomy 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- WEZVQBSWCGTSCU-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-methoxy-1h-benzimidazol-2-one Chemical compound COC1=CC=C2N(CCN(C)C)C(=O)NC2=C1 WEZVQBSWCGTSCU-UHFFFAOYSA-N 0.000 description 3
- ZCWXYZBQDNFULS-UHFFFAOYSA-N 5-chloro-2-nitroaniline Chemical compound NC1=CC(Cl)=CC=C1[N+]([O-])=O ZCWXYZBQDNFULS-UHFFFAOYSA-N 0.000 description 3
- CLHXKSVLPCOPHR-UHFFFAOYSA-N 5-nitrobenzimidazol-2-one Chemical compound C1=C([N+](=O)[O-])C=CC2=NC(=O)N=C21 CLHXKSVLPCOPHR-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000002828 nitro derivatives Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 235000010333 potassium nitrate Nutrition 0.000 description 3
- 239000004323 potassium nitrate Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000001603 reducing effect Effects 0.000 description 3
- 208000023504 respiratory system disease Diseases 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 2
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 2
- VBUPHKXHMSRRER-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carbonitrile Chemical compound C1=C(C#N)C=C2NC(=O)N(CCN(C)C)C2=C1 VBUPHKXHMSRRER-UHFFFAOYSA-N 0.000 description 2
- FBNPDAWPKKGSJX-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carboxamide Chemical compound C1=C(C(N)=O)C=C2NC(=O)N(CCN(C)C)C2=C1 FBNPDAWPKKGSJX-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 2
- DYTVCSKPYOHQAE-UHFFFAOYSA-N 2-nitro-5-phenoxyaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC(OC=2C=CC=CC=2)=C1 DYTVCSKPYOHQAE-UHFFFAOYSA-N 0.000 description 2
- LNZXTPOFEUGXLP-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5,6-dimethoxy-1h-benzimidazol-2-one Chemical compound C1=C(OC)C(OC)=CC2=C1N(CCN(C)C)C(=O)N2 LNZXTPOFEUGXLP-UHFFFAOYSA-N 0.000 description 2
- SGCNJCZARPGUPI-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-fluoro-1h-benzimidazol-2-one Chemical compound FC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 SGCNJCZARPGUPI-UHFFFAOYSA-N 0.000 description 2
- OTCXGVFKQBPMSR-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-imidazol-1-yl-1h-benzimidazol-2-one Chemical compound C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1N1C=CN=C1 OTCXGVFKQBPMSR-UHFFFAOYSA-N 0.000 description 2
- NHYJXYJFBCPTQZ-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-methoxy-1h-benzimidazol-2-one Chemical compound COC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 NHYJXYJFBCPTQZ-UHFFFAOYSA-N 0.000 description 2
- GEGGKRSSARKGFC-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-phenoxy-1h-benzimidazol-2-one Chemical compound C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1OC1=CC=CC=C1 GEGGKRSSARKGFC-UHFFFAOYSA-N 0.000 description 2
- QPZRLJQWKQPRGK-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-(hydroxymethyl)-1h-benzimidazol-2-one Chemical compound C1=C(CO)C=C2NC(=O)N(CCN(C)C)C2=C1 QPZRLJQWKQPRGK-UHFFFAOYSA-N 0.000 description 2
- VDHCCQXNKLPXOV-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-(trifluoromethyl)-1h-benzimidazol-2-one Chemical compound C1=C(C(F)(F)F)C=C2NC(=O)N(CCN(C)C)C2=C1 VDHCCQXNKLPXOV-UHFFFAOYSA-N 0.000 description 2
- DCRIKSBUXZFINQ-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-methyl-1h-benzimidazol-2-one Chemical compound C1=C(C)C=C2NC(=O)N(CCN(C)C)C2=C1 DCRIKSBUXZFINQ-UHFFFAOYSA-N 0.000 description 2
- DDPDYGKYIJFQRP-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-nitro-1h-benzimidazol-2-one Chemical compound C1=C([N+]([O-])=O)C=C2NC(=O)N(CCN(C)C)C2=C1 DDPDYGKYIJFQRP-UHFFFAOYSA-N 0.000 description 2
- LDAJFLKWQVYIFG-UHFFFAOYSA-N 4,5-dimethoxy-2-nitroaniline Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1OC LDAJFLKWQVYIFG-UHFFFAOYSA-N 0.000 description 2
- JAHADAZIDZMHOP-UHFFFAOYSA-N 4-amino-3-nitrobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1[N+]([O-])=O JAHADAZIDZMHOP-UHFFFAOYSA-N 0.000 description 2
- PTCPUGKKWNMITF-UHFFFAOYSA-N 4-chloro-2-fluoro-1-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1F PTCPUGKKWNMITF-UHFFFAOYSA-N 0.000 description 2
- NGPRHMOQBVKRAQ-UHFFFAOYSA-N 4-chloro-2-n-(2-piperidin-1-ylethyl)benzene-1,2-diamine Chemical compound NC1=CC=C(Cl)C=C1NCCN1CCCCC1 NGPRHMOQBVKRAQ-UHFFFAOYSA-N 0.000 description 2
- KJHONNYARAORHI-UHFFFAOYSA-N 4-chloro-2-n-(2-pyrrolidin-1-ylethyl)benzene-1,2-diamine Chemical compound NC1=CC=C(Cl)C=C1NCCN1CCCC1 KJHONNYARAORHI-UHFFFAOYSA-N 0.000 description 2
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 2
- WDGFBPUEBLQRCS-UHFFFAOYSA-N 5,6,7-tribromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound BrC1=C(Br)C(Br)=C2NC(=O)N(CCN(C)C)C2=C1 WDGFBPUEBLQRCS-UHFFFAOYSA-N 0.000 description 2
- CNRFJGORNIDATA-UHFFFAOYSA-N 5-benzoyl-3-[2-(dimethylamino)ethyl]-1-[(4-methoxyphenyl)methyl]benzimidazol-2-one Chemical compound C1=CC(OC)=CC=C1CN1C(=O)N(CCN(C)C)C2=CC(C(=O)C=3C=CC=CC=3)=CC=C21 CNRFJGORNIDATA-UHFFFAOYSA-N 0.000 description 2
- AOQFWHCNHFGECK-UHFFFAOYSA-N 5-benzoyl-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1C(=O)C1=CC=CC=C1 AOQFWHCNHFGECK-UHFFFAOYSA-N 0.000 description 2
- JMFUJOQZQHWSNO-UHFFFAOYSA-N 5-bromo-3-[2-(dimethylamino)ethyl]-6-methoxy-1h-benzimidazol-2-one Chemical compound C1=C(Br)C(OC)=CC2=C1N(CCN(C)C)C(=O)N2 JMFUJOQZQHWSNO-UHFFFAOYSA-N 0.000 description 2
- VLAJDBQYMIBENO-UHFFFAOYSA-N 5-chloro-2-nitro-n-(2-piperidin-1-ylethyl)aniline Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1NCCN1CCCCC1 VLAJDBQYMIBENO-UHFFFAOYSA-N 0.000 description 2
- JHIUVSKOIVHIRN-UHFFFAOYSA-N 5-chloro-2-nitro-n-(2-pyrrolidin-1-ylethyl)aniline Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1NCCN1CCCC1 JHIUVSKOIVHIRN-UHFFFAOYSA-N 0.000 description 2
- JXBOMSNEBXVJHB-UHFFFAOYSA-N 6-bromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound C1=C(Br)C=C2NC(=O)N(CCN(C)C)C2=C1 JXBOMSNEBXVJHB-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 206010006458 Bronchitis chronic Diseases 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 206010037423 Pulmonary oedema Diseases 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- 239000004147 Sorbitan trioleate Substances 0.000 description 2
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 2
- YTXIOTFBLCYYTN-UHFFFAOYSA-N [3-amino-4-[(4-methoxyphenyl)methylamino]phenyl]-phenylmethanone Chemical compound C1=CC(OC)=CC=C1CNC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1N YTXIOTFBLCYYTN-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- JBDGDEWWOUBZPM-XYPYZODXSA-N ambroxol Chemical compound NC1=C(Br)C=C(Br)C=C1CN[C@@H]1CC[C@@H](O)CC1 JBDGDEWWOUBZPM-XYPYZODXSA-N 0.000 description 2
- 229960005174 ambroxol Drugs 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 238000005915 ammonolysis reaction Methods 0.000 description 2
- LFYJSSARVMHQJB-QIXNEVBVSA-N bakuchiol Chemical compound CC(C)=CCC[C@@](C)(C=C)\C=C\C1=CC=C(O)C=C1 LFYJSSARVMHQJB-QIXNEVBVSA-N 0.000 description 2
- 229960000686 benzalkonium chloride Drugs 0.000 description 2
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 208000007451 chronic bronchitis Diseases 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 229940126208 compound 22 Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 229940099112 cornstarch Drugs 0.000 description 2
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 2
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 2
- UMNKXPULIDJLSU-UHFFFAOYSA-N dichlorofluoromethane Chemical compound FC(Cl)Cl UMNKXPULIDJLSU-UHFFFAOYSA-N 0.000 description 2
- 229940099364 dichlorofluoromethane Drugs 0.000 description 2
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- HFISSHLQKDEHAW-UHFFFAOYSA-N ethyl n-(2-amino-3,5-dibromophenyl)-n-[2-(dimethylamino)ethyl]carbamate Chemical compound CCOC(=O)N(CCN(C)C)C1=CC(Br)=CC(Br)=C1N HFISSHLQKDEHAW-UHFFFAOYSA-N 0.000 description 2
- DDNLJCJJBFIGRY-UHFFFAOYSA-N ethyl n-(2-aminophenyl)-n-[2-(dimethylamino)ethyl]carbamate Chemical compound CCOC(=O)N(CCN(C)C)C1=CC=CC=C1N DDNLJCJJBFIGRY-UHFFFAOYSA-N 0.000 description 2
- PRIXOKGAMNARTC-UHFFFAOYSA-N ethyl n-[2-(dimethylamino)ethyl]-n-[2-(ethoxycarbonylamino)-5-methoxyphenyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(OC)C=C1N(CCN(C)C)C(=O)OCC PRIXOKGAMNARTC-UHFFFAOYSA-N 0.000 description 2
- 230000002964 excitative effect Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XMEJSEBSUUTSMG-UHFFFAOYSA-N methyl 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carboxylate Chemical compound COC(=O)C1=CC=C2N(CCN(C)C)C(=O)NC2=C1 XMEJSEBSUUTSMG-UHFFFAOYSA-N 0.000 description 2
- SFUDPFSNTANJKS-UHFFFAOYSA-N methyl 4-[2-(dimethylamino)ethylamino]-3-nitrobenzoate Chemical compound COC(=O)C1=CC=C(NCCN(C)C)C([N+]([O-])=O)=C1 SFUDPFSNTANJKS-UHFFFAOYSA-N 0.000 description 2
- QKWTXJSLAZKYGV-UHFFFAOYSA-N methyl 4-acetamidobenzoate Chemical compound COC(=O)C1=CC=C(NC(C)=O)C=C1 QKWTXJSLAZKYGV-UHFFFAOYSA-N 0.000 description 2
- CWNMNVHDDCDSPU-UHFFFAOYSA-N methyl 4-amino-2-nitrobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1[N+]([O-])=O CWNMNVHDDCDSPU-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- JSNWIWQOIKRWAK-UHFFFAOYSA-N n',n'-dimethyl-n-(2-nitrophenyl)ethane-1,2-diamine Chemical compound CN(C)CCNC1=CC=CC=C1[N+]([O-])=O JSNWIWQOIKRWAK-UHFFFAOYSA-N 0.000 description 2
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 2
- UFKRTEWFEYWIHD-UHFFFAOYSA-N n-(4-cyanophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(C#N)C=C1 UFKRTEWFEYWIHD-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 2
- 150000008105 phosphatidylcholines Chemical class 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 239000003380 propellant Substances 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 208000005333 pulmonary edema Diseases 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 235000019337 sorbitan trioleate Nutrition 0.000 description 2
- 229960000391 sorbitan trioleate Drugs 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- FEHRHLWOOXHURY-UHFFFAOYSA-N (2-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=CC=C([N+]([O-])=O)C(N)=C1C(=O)C1=CC=CC=C1 FEHRHLWOOXHURY-UHFFFAOYSA-N 0.000 description 1
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- NGOOFAMQPUEDJM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(=O)C1=CC=CC=C1 NGOOFAMQPUEDJM-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- DTLTUUJDCNTTSN-UHFFFAOYSA-N 1,4-dioxane;molecular bromine Chemical compound BrBr.C1COCCO1 DTLTUUJDCNTTSN-UHFFFAOYSA-N 0.000 description 1
- SPJIQTMICFSJSF-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carbonitrile;hydrochloride Chemical compound Cl.C1=C(C#N)C=C2NC(=O)N(CCN(C)C)C2=C1 SPJIQTMICFSJSF-UHFFFAOYSA-N 0.000 description 1
- SSQPJXLGLSMHKS-UHFFFAOYSA-N 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carboxamide;hydrochloride Chemical compound Cl.C1=C(C(N)=O)C=C2NC(=O)N(CCN(C)C)C2=C1 SSQPJXLGLSMHKS-UHFFFAOYSA-N 0.000 description 1
- NWESJZZPAJGHRZ-UHFFFAOYSA-N 1-chloro-4-methyl-2-nitrobenzene Chemical compound CC1=CC=C(Cl)C([N+]([O-])=O)=C1 NWESJZZPAJGHRZ-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- UPTVKXNNYNIRDM-UHFFFAOYSA-N 2-(2,3-dihydrobenzimidazol-1-yl)-N,N-dimethylethanamine Chemical compound CN(CCN1CNC2=C1C=CC=C2)C UPTVKXNNYNIRDM-UHFFFAOYSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- OCWGRWAYARCRTQ-UHFFFAOYSA-N 2-chloro-n,n-dimethylpropan-1-amine;hydron;chloride Chemical compound Cl.CC(Cl)CN(C)C OCWGRWAYARCRTQ-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- WNLWBCIUNCAMPH-UHFFFAOYSA-N 2-n,2-n-dimethylpropane-1,2-diamine Chemical compound NCC(C)N(C)C WNLWBCIUNCAMPH-UHFFFAOYSA-N 0.000 description 1
- SMZIKDBMCTUBEO-UHFFFAOYSA-N 2-n-[2-(dimethylamino)ethyl]benzene-1,2-diamine;dihydrochloride Chemical compound Cl.Cl.CN(C)CCNC1=CC=CC=C1N SMZIKDBMCTUBEO-UHFFFAOYSA-N 0.000 description 1
- AUTLVHYEAAAKNM-UHFFFAOYSA-N 2-nitro-5-(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC=C1[N+]([O-])=O AUTLVHYEAAAKNM-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- CJNRGSHEMCMUOE-UHFFFAOYSA-N 2-piperidin-1-ylethanamine Chemical compound NCCN1CCCCC1 CJNRGSHEMCMUOE-UHFFFAOYSA-N 0.000 description 1
- LGDHZCLREKIGKJ-UHFFFAOYSA-N 3,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C=C1OC LGDHZCLREKIGKJ-UHFFFAOYSA-N 0.000 description 1
- RMEAFCJCLSMPTA-UHFFFAOYSA-N 3-(2-morpholin-4-ylethyl)-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1CCN1CCOCC1 RMEAFCJCLSMPTA-UHFFFAOYSA-N 0.000 description 1
- MNJNPCZUOPQJQA-UHFFFAOYSA-N 3-(2-morpholin-4-ylethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.O=C1NC2=CC=CC=C2N1CCN1CCOCC1 MNJNPCZUOPQJQA-UHFFFAOYSA-N 0.000 description 1
- WIKQURVUAAIWAA-UHFFFAOYSA-N 3-(2-pyrrolidin-1-ylethyl)-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1CCN1CCCC1 WIKQURVUAAIWAA-UHFFFAOYSA-N 0.000 description 1
- FHPMVKHCEXYHHS-UHFFFAOYSA-N 3-(2-pyrrolidin-1-ylethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.O=C1NC2=CC=CC=C2N1CCN1CCCC1 FHPMVKHCEXYHHS-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- XEYGEPAKFLAOBU-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5,6-dimethoxy-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C(OC)C(OC)=CC2=C1N(CCN(C)C)C(=O)N2 XEYGEPAKFLAOBU-UHFFFAOYSA-N 0.000 description 1
- XYYIBOOXGHFHFB-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-(trifluoromethyl)-1h-benzimidazol-2-one Chemical compound FC(F)(F)C1=CC=C2NC(=O)N(CCN(C)C)C2=C1 XYYIBOOXGHFHFB-UHFFFAOYSA-N 0.000 description 1
- FXIZGHSZFKFGID-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-fluoro-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.FC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 FXIZGHSZFKFGID-UHFFFAOYSA-N 0.000 description 1
- FCSCQBOIHPWVIJ-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-imidazol-1-yl-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1N1C=CN=C1 FCSCQBOIHPWVIJ-UHFFFAOYSA-N 0.000 description 1
- YPJNBQWKAFFNRN-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-methoxy-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.COC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 YPJNBQWKAFFNRN-UHFFFAOYSA-N 0.000 description 1
- FYBQYAQSVMCGDT-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-methyl-1h-benzimidazol-2-one Chemical compound CC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 FYBQYAQSVMCGDT-UHFFFAOYSA-N 0.000 description 1
- YNMFADIGOFTTHI-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-methyl-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.CC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 YNMFADIGOFTTHI-UHFFFAOYSA-N 0.000 description 1
- WYTRVDICYIULCF-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-5-phenoxy-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1OC1=CC=CC=C1 WYTRVDICYIULCF-UHFFFAOYSA-N 0.000 description 1
- UHIOOEQUULFYSC-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-(hydroxymethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C(CO)C=C2NC(=O)N(CCN(C)C)C2=C1 UHIOOEQUULFYSC-UHFFFAOYSA-N 0.000 description 1
- AUWZPOMPJQBDAQ-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-(trifluoromethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C(C(F)(F)F)C=C2NC(=O)N(CCN(C)C)C2=C1 AUWZPOMPJQBDAQ-UHFFFAOYSA-N 0.000 description 1
- KJFRBOITAZXDCT-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-methoxy-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.COC1=CC=C2N(CCN(C)C)C(=O)NC2=C1 KJFRBOITAZXDCT-UHFFFAOYSA-N 0.000 description 1
- VDIMDAWIVQUNMV-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-6-nitro-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C([N+]([O-])=O)C=C2NC(=O)N(CCN(C)C)C2=C1 VDIMDAWIVQUNMV-UHFFFAOYSA-N 0.000 description 1
- VRBFMNIXQYCLBL-UHFFFAOYSA-N 3-[3-(dimethylamino)propyl]-1h-benzimidazol-2-one Chemical compound C1=CC=C2NC(=O)N(CCCN(C)C)C2=C1 VRBFMNIXQYCLBL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QZVQQUVWFIZUBQ-UHFFFAOYSA-N 3-fluoroaniline Chemical compound NC1=CC=CC(F)=C1 QZVQQUVWFIZUBQ-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZQLYNWVYDSVRAF-UHFFFAOYSA-N 4-[2-(dimethylamino)ethylamino]-3-nitrobenzamide Chemical compound CN(C)CCNC1=CC=C(C(N)=O)C=C1[N+]([O-])=O ZQLYNWVYDSVRAF-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- KMIFZILWRRENBO-UHFFFAOYSA-N 4-nitrobenzimidazol-2-one Chemical compound [O-][N+](=O)C1=CC=CC2=NC(=O)N=C12 KMIFZILWRRENBO-UHFFFAOYSA-N 0.000 description 1
- PCYGCNOMJCQBNR-UHFFFAOYSA-N 5,6,7-tribromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.BrC1=C(Br)C(Br)=C2NC(=O)N(CCN(C)C)C2=C1 PCYGCNOMJCQBNR-UHFFFAOYSA-N 0.000 description 1
- KMJBAUWQMUSJPD-UHFFFAOYSA-N 5,6-dibromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one Chemical compound BrC1=C(Br)C=C2NC(=O)N(CCN(C)C)C2=C1 KMJBAUWQMUSJPD-UHFFFAOYSA-N 0.000 description 1
- NUJLABDQGXEFRC-UHFFFAOYSA-N 5,7-dibromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.BrC1=CC(Br)=C2NC(=O)N(CCN(C)C)C2=C1 NUJLABDQGXEFRC-UHFFFAOYSA-N 0.000 description 1
- MFALUEBWDQCLQA-UHFFFAOYSA-N 5-benzoyl-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C=1C=C2NC(=O)N(CCN(C)C)C2=CC=1C(=O)C1=CC=CC=C1 MFALUEBWDQCLQA-UHFFFAOYSA-N 0.000 description 1
- GMMFHFBDJLDRKF-UHFFFAOYSA-N 5-bromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.BrC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 GMMFHFBDJLDRKF-UHFFFAOYSA-N 0.000 description 1
- FDKCFOHHDFOACM-UHFFFAOYSA-N 5-bromo-3-[2-(dimethylamino)ethyl]-6-methoxy-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C(Br)C(OC)=CC2=C1N(CCN(C)C)C(=O)N2 FDKCFOHHDFOACM-UHFFFAOYSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- IOBVBYFOVNNVLK-UHFFFAOYSA-N 5-chloro-3-(2-morpholin-4-ylethyl)-1h-benzimidazol-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCOCC1 IOBVBYFOVNNVLK-UHFFFAOYSA-N 0.000 description 1
- ZNNLGNGZIWURFN-UHFFFAOYSA-N 5-chloro-3-(2-morpholin-4-ylethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCOCC1 ZNNLGNGZIWURFN-UHFFFAOYSA-N 0.000 description 1
- ICZLRVKCLOJXJP-UHFFFAOYSA-N 5-chloro-3-(2-piperidin-1-ylethyl)-1h-benzimidazol-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCCCC1 ICZLRVKCLOJXJP-UHFFFAOYSA-N 0.000 description 1
- NVYPRUCZQQXRCV-UHFFFAOYSA-N 5-chloro-3-(2-piperidin-1-ylethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCCCC1 NVYPRUCZQQXRCV-UHFFFAOYSA-N 0.000 description 1
- CLONITSMNHBGDB-UHFFFAOYSA-N 5-chloro-3-(2-pyrrolidin-1-ylethyl)-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C12=CC(Cl)=CC=C2NC(=O)N1CCN1CCCC1 CLONITSMNHBGDB-UHFFFAOYSA-N 0.000 description 1
- GRECUCYHROMAKR-UHFFFAOYSA-N 5-chloro-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.ClC1=CC=C2NC(=O)N(CCN(C)C)C2=C1 GRECUCYHROMAKR-UHFFFAOYSA-N 0.000 description 1
- SRMRVIWUZKFNDF-UHFFFAOYSA-N 5-chloro-3-[2-(dimethylamino)propyl]-1h-benzimidazol-2-one Chemical compound ClC1=CC=C2NC(=O)N(CC(C)N(C)C)C2=C1 SRMRVIWUZKFNDF-UHFFFAOYSA-N 0.000 description 1
- HXJZEZPOUQPZIV-UHFFFAOYSA-N 5-chloro-3-[2-(dimethylamino)propyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.ClC1=CC=C2NC(=O)N(CC(C)N(C)C)C2=C1 HXJZEZPOUQPZIV-UHFFFAOYSA-N 0.000 description 1
- PEDMFCHWOVJDNW-UHFFFAOYSA-N 5-fluoro-2-nitroaniline Chemical compound NC1=CC(F)=CC=C1[N+]([O-])=O PEDMFCHWOVJDNW-UHFFFAOYSA-N 0.000 description 1
- CVGWDTJIPMBOKL-UHFFFAOYSA-N 5-imidazol-1-yl-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC(N2C=NC=C2)=C1 CVGWDTJIPMBOKL-UHFFFAOYSA-N 0.000 description 1
- QEHVRGACCVLLNN-UHFFFAOYSA-N 5-methoxy-2-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C(N)=C1 QEHVRGACCVLLNN-UHFFFAOYSA-N 0.000 description 1
- IGDYNWKWXUCIJB-UHFFFAOYSA-N 5-methyl-2-nitroaniline Chemical compound CC1=CC=C([N+]([O-])=O)C(N)=C1 IGDYNWKWXUCIJB-UHFFFAOYSA-N 0.000 description 1
- CJZYDAJVUMGXIX-UHFFFAOYSA-N 6-benzoyl-3-[(4-methoxyphenyl)methyl]-1h-benzimidazol-2-one Chemical compound C1=CC(OC)=CC=C1CN1C(=O)NC2=CC(C(=O)C=3C=CC=CC=3)=CC=C21 CJZYDAJVUMGXIX-UHFFFAOYSA-N 0.000 description 1
- STIKBIIUAGYXDC-UHFFFAOYSA-N 6-bromo-3-[2-(dimethylamino)ethyl]-1h-benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=C(Br)C=C2NC(=O)N(CCN(C)C)C2=C1 STIKBIIUAGYXDC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OKONXONUQYQCPW-UHFFFAOYSA-N C(=O)=C(CNC)NC Chemical compound C(=O)=C(CNC)NC OKONXONUQYQCPW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- KJMDUHQFMOCPGR-UHFFFAOYSA-N ClC=1C=CC(=C(C1)C(C(C)N(C)C)N)[N+](=O)[O-] Chemical compound ClC=1C=CC(=C(C1)C(C(C)N(C)C)N)[N+](=O)[O-] KJMDUHQFMOCPGR-UHFFFAOYSA-N 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- WZELXJBMMZFDDU-UHFFFAOYSA-N Imidazol-2-one Chemical group O=C1N=CC=N1 WZELXJBMMZFDDU-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AZOJAHYHVMGJPY-UHFFFAOYSA-N N,N'-dimethyl-N'-(2-nitrophenyl)ethane-1,2-diamine Chemical compound CNCCN(C)C1=CC=CC=C1[N+]([O-])=O AZOJAHYHVMGJPY-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010036590 Premature baby Diseases 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- QQYQPAVOFRGJAU-UHFFFAOYSA-N [4-[(4-methoxyphenyl)methylamino]-3-nitrophenyl]-phenylmethanone Chemical compound C1=CC(OC)=CC=C1CNC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1[N+]([O-])=O QQYQPAVOFRGJAU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 206010001053 acute respiratory failure Diseases 0.000 description 1
- 208000037883 airway inflammation Diseases 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- QUNGXSCIAYPUKE-UHFFFAOYSA-N benzimidazol-2-one;hydrochloride Chemical compound Cl.C1=CC=CC2=NC(=O)N=C21 QUNGXSCIAYPUKE-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- HFCSXCKLARAMIQ-UHFFFAOYSA-L disodium;sulfate;hydrate Chemical compound O.[Na+].[Na+].[O-]S([O-])(=O)=O HFCSXCKLARAMIQ-UHFFFAOYSA-L 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VWQGEYSEMOYFQT-UHFFFAOYSA-N ethyl n-[2-(dimethylamino)ethyl]-n-[2-(ethoxycarbonylamino)-4,5-dimethoxyphenyl]carbamate Chemical compound CCOC(=O)NC1=CC(OC)=C(OC)C=C1N(CCN(C)C)C(=O)OCC VWQGEYSEMOYFQT-UHFFFAOYSA-N 0.000 description 1
- WQLYITGZCFAONW-UHFFFAOYSA-N ethyl n-[2-(dimethylamino)ethyl]-n-[2-(ethoxycarbonylamino)-4-methoxyphenyl]carbamate Chemical compound CCOC(=O)NC1=CC(OC)=CC=C1N(CCN(C)C)C(=O)OCC WQLYITGZCFAONW-UHFFFAOYSA-N 0.000 description 1
- BYNFVHLQTZHVKV-UHFFFAOYSA-N ethyl n-[2-(dimethylamino)ethyl]-n-[2-(ethoxycarbonylamino)-4-methylphenyl]carbamate Chemical compound CCOC(=O)NC1=CC(C)=CC=C1N(CCN(C)C)C(=O)OCC BYNFVHLQTZHVKV-UHFFFAOYSA-N 0.000 description 1
- SBOSKMAZSROIMP-UHFFFAOYSA-N ethyl n-[2-[2-(dimethylamino)ethylamino]phenyl]carbamate Chemical compound CCOC(=O)NC1=CC=CC=C1NCCN(C)C SBOSKMAZSROIMP-UHFFFAOYSA-N 0.000 description 1
- JCGHHUSQDJMQED-UHFFFAOYSA-N ethyl n-[2-amino-4-(trifluoromethyl)phenyl]-n-[2-(dimethylamino)ethyl]carbamate Chemical compound CCOC(=O)N(CCN(C)C)C1=CC=C(C(F)(F)F)C=C1N JCGHHUSQDJMQED-UHFFFAOYSA-N 0.000 description 1
- DHUVTPBMIWVMIG-UHFFFAOYSA-N ethyl n-[4-bromo-2-(ethoxycarbonylamino)phenyl]-n-[2-(dimethylamino)ethyl]carbamate Chemical compound CCOC(=O)NC1=CC(Br)=CC=C1N(CCN(C)C)C(=O)OCC DHUVTPBMIWVMIG-UHFFFAOYSA-N 0.000 description 1
- CLMRBUXYXURBEJ-UHFFFAOYSA-N ethyl n-[5-bromo-2-(ethoxycarbonylamino)phenyl]-n-[2-(dimethylamino)ethyl]carbamate Chemical compound CCOC(=O)NC1=CC=C(Br)C=C1N(CCN(C)C)C(=O)OCC CLMRBUXYXURBEJ-UHFFFAOYSA-N 0.000 description 1
- 230000005713 exacerbation Effects 0.000 description 1
- 239000003172 expectorant agent Substances 0.000 description 1
- 230000003419 expectorant effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 238000011597 hartley guinea pig Methods 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000005921 isopentoxy group Chemical group 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005932 isopentyloxycarbonyl group Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- XQHJLWPHVUTJBG-UHFFFAOYSA-N methyl 1-[2-(dimethylamino)ethyl]-2-oxo-3h-benzimidazole-5-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=C2N(CCN(C)C)C(=O)NC2=C1 XQHJLWPHVUTJBG-UHFFFAOYSA-N 0.000 description 1
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- AJCPOROPGFNHFT-UHFFFAOYSA-N n',n'-dimethyl-n-(2-nitro-5-phenoxyphenyl)ethane-1,2-diamine Chemical compound C1=C([N+]([O-])=O)C(NCCN(C)C)=CC(OC=2C=CC=CC=2)=C1 AJCPOROPGFNHFT-UHFFFAOYSA-N 0.000 description 1
- FGYJAOLVZHKNMY-UHFFFAOYSA-N n',n'-dimethyl-n-(5-methyl-2-nitrophenyl)ethane-1,2-diamine Chemical compound CN(C)CCNC1=CC(C)=CC=C1[N+]([O-])=O FGYJAOLVZHKNMY-UHFFFAOYSA-N 0.000 description 1
- XQHQLXXAPXAGSZ-UHFFFAOYSA-N n',n'-dimethyl-n-[2-nitro-5-(trifluoromethyl)phenyl]ethane-1,2-diamine Chemical compound CN(C)CCNC1=CC(C(F)(F)F)=CC=C1[N+]([O-])=O XQHQLXXAPXAGSZ-UHFFFAOYSA-N 0.000 description 1
- LZPFDZOOXVWPHR-UHFFFAOYSA-N n-(4-methoxy-2-nitrophenyl)-n',n'-dimethylethane-1,2-diamine Chemical compound COC1=CC=C(NCCN(C)C)C([N+]([O-])=O)=C1 LZPFDZOOXVWPHR-UHFFFAOYSA-N 0.000 description 1
- LDVDBIXYFBCDGC-UHFFFAOYSA-N n-(5-chloro-2-nitrophenyl)-n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCNC1=CC(Cl)=CC=C1[N+]([O-])=O LDVDBIXYFBCDGC-UHFFFAOYSA-N 0.000 description 1
- YNJHWNSWHUEMEJ-UHFFFAOYSA-N n-(5-fluoro-2-nitrophenyl)-n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCNC1=CC(F)=CC=C1[N+]([O-])=O YNJHWNSWHUEMEJ-UHFFFAOYSA-N 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005933 neopentyloxycarbonyl group Chemical group 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- DYIZHKNUQPHNJY-UHFFFAOYSA-N oxorhenium Chemical compound [Re]=O DYIZHKNUQPHNJY-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- WTJKGGKOPKCXLL-RRHRGVEJSA-N phosphatidylcholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC WTJKGGKOPKCXLL-RRHRGVEJSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 230000009979 protective mechanism Effects 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- BATMYWDOUUWCJE-UHFFFAOYSA-N pyrimidin-1-ium;bromide Chemical compound Br.C1=CN=CN=C1 BATMYWDOUUWCJE-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 201000004193 respiratory failure Diseases 0.000 description 1
- 230000004202 respiratory function Effects 0.000 description 1
- 229910003449 rhenium oxide Inorganic materials 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000000967 suction filtration Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- PRXNKYBFWAWBNZ-UHFFFAOYSA-N trimethylphenylammonium tribromide Chemical compound Br[Br-]Br.C[N+](C)(C)C1=CC=CC=C1 PRXNKYBFWAWBNZ-UHFFFAOYSA-N 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/26—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9845590 | 1990-04-13 | ||
| JP28549390 | 1990-10-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HU911226D0 HU911226D0 (en) | 1991-10-28 |
| HUT57735A true HUT57735A (en) | 1991-12-30 |
Family
ID=26439622
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU911226A HUT57735A (en) | 1990-04-13 | 1991-04-12 | Process for producing benzimidazolinone derivatives and pharmaceutical compositions comprising such compounds as active ingredient |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US5162318A (enExample) |
| EP (1) | EP0454330A1 (enExample) |
| KR (1) | KR910018360A (enExample) |
| CN (1) | CN1060837A (enExample) |
| AU (1) | AU7500891A (enExample) |
| CA (1) | CA2040235A1 (enExample) |
| FI (1) | FI911776A7 (enExample) |
| HU (1) | HUT57735A (enExample) |
| IE (1) | IE911251A1 (enExample) |
| TW (1) | TW203049B (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9418326D0 (en) * | 1994-09-12 | 1994-11-02 | Lilly Industries Ltd | Pharmaceutical compounds |
| GB2308362A (en) * | 1995-12-19 | 1997-06-25 | Lilly Industries Ltd | Pharmaceutical indole derivatives |
| FR2767827A1 (fr) * | 1997-09-03 | 1999-02-26 | Adir | Nouveaux derives de l'indole et de l'indazole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US6498154B1 (en) | 1999-05-04 | 2002-12-24 | Wyeth | Cyclic regimens using quinazolinone and benzoxazine derivatives |
| US6369056B1 (en) | 1999-05-04 | 2002-04-09 | American Home Products Corporation | Cyclic urea and cyclic amide derivatives |
| US6319912B1 (en) | 1999-05-04 | 2001-11-20 | American Home Products Corporation | Cyclic regimens using 2,1-benzisothiazoline 2,2-dioxides |
| US6380178B1 (en) | 1999-05-04 | 2002-04-30 | American Home Products Corporation | Cyclic regimens using cyclocarbamate and cyclic amide derivatives |
| US6391907B1 (en) | 1999-05-04 | 2002-05-21 | American Home Products Corporation | Indoline derivatives |
| US6509334B1 (en) | 1999-05-04 | 2003-01-21 | American Home Products Corporation | Cyclocarbamate derivatives as progesterone receptor modulators |
| US6444668B1 (en) | 1999-05-04 | 2002-09-03 | Wyeth | Combination regimens using progesterone receptor modulators |
| US6380235B1 (en) * | 1999-05-04 | 2002-04-30 | American Home Products Corporation | Benzimidazolones and analogues |
| US6399593B1 (en) | 1999-05-04 | 2002-06-04 | Wyeth | Cyclic regimens using cyclic urea and cyclic amide derivatives |
| US6462032B1 (en) | 1999-05-04 | 2002-10-08 | Wyeth | Cyclic regimens utilizing indoline derivatives |
| US6358948B1 (en) | 1999-05-04 | 2002-03-19 | American Home Products Corporation | Quinazolinone and benzoxazine derivatives as progesterone receptor modulators |
| US6355648B1 (en) | 1999-05-04 | 2002-03-12 | American Home Products Corporation | Thio-oxindole derivatives |
| US6358947B1 (en) | 1999-05-04 | 2002-03-19 | American Home Products Corporation | Tetracyclic progesterone receptor modulator compounds and methods |
| US6339098B1 (en) | 1999-05-04 | 2002-01-15 | American Home Products Corporation | 2,1-benzisothiazoline 2,2-dioxides |
| US6407101B1 (en) | 1999-05-04 | 2002-06-18 | American Home Products Corporation | Cyanopyrroles |
| US6329416B1 (en) | 1999-05-04 | 2001-12-11 | American Home Products Corporation | Combination regimens using 3,3-substituted indoline derivatives |
| US6417214B1 (en) | 1999-05-04 | 2002-07-09 | Wyeth | 3,3-substituted indoline derivatives |
| US6423699B1 (en) | 1999-05-04 | 2002-07-23 | American Home Products Corporation | Combination therapies using benzimidazolones |
| US6306851B1 (en) | 1999-05-04 | 2001-10-23 | American Home Products Corporation | Cyclocarbamate and cyclic amide derivatives |
| UA73119C2 (en) | 2000-04-19 | 2005-06-15 | American Home Products Corpoir | Derivatives of cyclic thiocarbamates, pharmaceutical composition including noted derivatives of cyclic thiocarbamates and active ingredients of medicines as modulators of progesterone receptors |
| EP1465882B1 (en) | 2001-12-21 | 2011-08-24 | X-Ceptor Therapeutics, Inc. | Hetrocyclic modulators of nuclear receptors |
| US7115644B2 (en) * | 2002-09-13 | 2006-10-03 | Boehringer Ingelheim Pharmaceuticals Inc. | Heterocyclic compounds |
| BRPI0613430A2 (pt) | 2005-07-13 | 2011-01-11 | Hoffmann La Roche | compostos derivados de benzimidazol, uso dos mesmos, método para a preparação destes e composição farmacêutica |
| PE20230680A1 (es) * | 2020-05-06 | 2023-04-21 | Merck Sharp And Dohme Llc | Inhibidores de il4i1 y metodos de uso |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2609645A1 (de) * | 1976-03-09 | 1977-09-15 | Boehringer Sohn Ingelheim | Aminoalkylheterocyclen |
| DE2644833A1 (de) * | 1976-10-05 | 1978-04-20 | Boehringer Sohn Ingelheim | Neue 1-aryloxy-2-hydroxy-3-alkylenaminopropane und verfahren zu ihrer herstellung |
| US4200641A (en) * | 1976-12-21 | 1980-04-29 | Janssen Pharmaceutica, N.V. | 1-[(Heterocyclyl)-alkyl]-4-diarylmethoxy piperidine derivatives |
| US4359468A (en) * | 1981-02-25 | 1982-11-16 | Boehringer Ingelheim Ltd. | Antiallergic N-[4-(indolyl)-piperidino-alkyl]-benzimidazolones |
| US4492708A (en) * | 1982-09-27 | 1985-01-08 | Eli Lilly And Company | Antiviral benzimidazoles |
| JPS62252721A (ja) * | 1986-04-24 | 1987-11-04 | Kissei Pharmaceut Co Ltd | 消化性潰瘍治療剤 |
| FR2643903A1 (fr) * | 1989-03-03 | 1990-09-07 | Union Pharma Scient Appl | Nouveaux derives de benzimidazole, leurs procedes de preparation, intermediaires de synthese, compositions pharmaceutiques les contenant, utiles notamment pour le traitement des maladies cardiovasculaires, et des ulceres duodenaux |
-
1991
- 1991-04-10 TW TW080102725A patent/TW203049B/zh active
- 1991-04-11 CA CA002040235A patent/CA2040235A1/en not_active Abandoned
- 1991-04-12 EP EP91303264A patent/EP0454330A1/en not_active Withdrawn
- 1991-04-12 IE IE125191A patent/IE911251A1/en unknown
- 1991-04-12 FI FI911776A patent/FI911776A7/fi not_active Application Discontinuation
- 1991-04-12 KR KR1019910005825A patent/KR910018360A/ko not_active Ceased
- 1991-04-12 HU HU911226A patent/HUT57735A/hu unknown
- 1991-04-13 CN CN91102631A patent/CN1060837A/zh active Pending
- 1991-04-15 AU AU75008/91A patent/AU7500891A/en not_active Abandoned
- 1991-04-15 US US07/684,866 patent/US5162318A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0454330A1 (en) | 1991-10-30 |
| CA2040235A1 (en) | 1991-10-14 |
| KR910018360A (ko) | 1991-11-30 |
| TW203049B (enExample) | 1993-04-01 |
| HU911226D0 (en) | 1991-10-28 |
| FI911776A0 (fi) | 1991-04-12 |
| IE911251A1 (en) | 1991-10-23 |
| FI911776A7 (fi) | 1991-10-14 |
| AU7500891A (en) | 1991-10-17 |
| US5162318A (en) | 1992-11-10 |
| CN1060837A (zh) | 1992-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HUT57735A (en) | Process for producing benzimidazolinone derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| US5902813A (en) | Benzimidazole compounds, pharmaceutical compositions containing the compounds and their use | |
| EP1758857B1 (en) | Indole derivatives as antiviral agents | |
| EP0640085B1 (en) | Fused imidazole and triazole derivatives as 5-ht1 receptor agonists | |
| CZ17094A3 (en) | BENZIMIDAZOLE DERIVATIVES AS 5-HT1a AND 5-HT2 ANTAGONISTS | |
| US4663453A (en) | Benzo[b]pyrrolo[3,2,1-jk][1,4]benzodiazepines having dopamine receptor activity | |
| JPH04506222A (ja) | N−置換複素環誘導体およびその製法 | |
| CZ288351B6 (en) | Nitrogenous heterocyclic compound, process of its preparation and use as well as a medicament containing thereof | |
| EP0000490A1 (en) | Substituted naphthyridinones, processes for their preparations and therapeutical applications | |
| FI71148C (fi) | Foerfarande foer framstaellning av nya antihypertensiva 4h-1,2,4-triazolo(4,3-a)kinoxalin-4-oner | |
| SK282851B6 (sk) | Deriváty chinoxalíndiónu, spôsob ich výroby a ich použitie v liečivách | |
| DE69911580T2 (de) | Benzamidderivate als vasopressin-antagonisten | |
| PT821682E (pt) | Compostos de benzimidazola e sua utilizacao enquanto moduladores do complexo de receptores gaba a? | |
| EP0677042B1 (fr) | Ligands selectifs des recepteurs 5ht1d-5ht1b derives d'indole-piperazine utiles comme medicaments | |
| US4761411A (en) | Dihydrobenzopyrrolobenzodiazepines useful for treating pyschoses | |
| HU200337B (en) | Process for producing substituted 6-phenyldihydro-3/2h/-pyridazinone derivatives and pharmaceutical compositions comprising such compounds | |
| RO113348B1 (ro) | Procedeu pentru prepararea unor derivati de indol ce contin un substituent 1,2,4-triazol-1-il | |
| US4977175A (en) | 4,5,6,7-tetrahydrobenzimidazole derivatives as 5HT3 -antagonists | |
| RS50289B (sr) | Novi razgranati supstituisani amino derivati od 3-amino-1- fenil-1h(1,2,4) triazola, postupak za njihovo dobijanje i farmaceutski preparati koji ih sadrže | |
| HU186975B (en) | Process for preparing new triazolo-quinazolone derivatives | |
| US4764616A (en) | Benzopyrrolobenzodiazepines and quinobenzodiazepines | |
| EP0637307B1 (en) | Imidazole, triazole and tetrazole derivatives | |
| AU682889B2 (en) | Imidazolone and oxazolone derivatives as dopamine antagonists | |
| US4608375A (en) | Quinazolinone derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| JPH02300184A (ja) | インドール誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| DFC9 | Refusal of application |